!(function (t) {
    function e(i) {
        if (n[i]) return n[i].exports;
        var o = (n[i] = { i: i, l: false, exports: {} });
        return t[i].call(o.exports, o, o.exports, e), (o.l = true), o.exports;
    }
    var n = {};
    return (
        (e.m = t),
        (e.c = n),
        (e.d = function (t, n, i) {
            if (!e.o(t, n))
                Object.defineProperty(t, n, {
                    configurable: false,
                    enumerable: true,
                    get: i,
                });
        }),
        (e.n = function (t) {
            var n =
                t && t.__esModule
                    ? function e() {
                        return t["default"];
                    }
                    : function e() {
                        return t;
                    };
            return e.d(n, "a", n), n;
        }),
        (e.o = function (t, e) {
            return Object.prototype.hasOwnProperty.call(t, e);
        }),
        (e.p = "/Content/BundledScripts/"),
        e((e.s = 9796))
    );
})({
    10: function (t, e) {
        t.exports = jQuery;
    },
    12: function (t, e, n) {
        "use strict";
        (function (e, i, o, a) {
            function s(t) {
                if (!(8 === t || 16 === t || 24 === t || 32 === t))
                    throw new Error("Only 8, 16, 24, or 32 bits supported: " + t);
            }
            function u(t) {
                if (((this.data = ""), (this.read = 0), "string" == typeof t))
                    this.data = t;
                else if (util.isArrayBuffer(t) || util.isArrayBufferView(t))
                    if (void 0 !== a && t instanceof a) this.data = t.toString("binary");
                    else {
                        var e = new Uint8Array(t);
                        try {
                            this.data = String.fromCharCode.apply(null, e);
                        } catch (t) {
                            for (var n = 0; n < e.length; ++n) this.putByte(e[n]);
                        }
                    }
                else if (
                    t instanceof u ||
                    ("object" == typeof t &&
                        "string" == typeof t.data &&
                        "number" == typeof t.read)
                )
                    (this.data = t.data), (this.read = t.read);
                this._constructedStringLength = 0;
            }
            function l(t, e) {
                (e = e || {}),
                    (this.read = e.readOffset || 0),
                    (this.growSize = e.growSize || 1024);
                var n = util.isArrayBuffer(t),
                    i = util.isArrayBufferView(t);
                if (n || i) {
                    if (n) this.data = new DataView(t);
                    else this.data = new DataView(t.buffer, t.byteOffset, t.byteLength);
                    return (
                        (this.write =
                            "writeOffset" in e ? e.writeOffset : this.data.byteLength),
                        void 0
                    );
                }
                if (
                    ((this.data = new DataView(new ArrayBuffer(0))),
                        (this.write = 0),
                        null != t)
                )
                    this.putBytes(t);
                if ("writeOffset" in e) this.write = e.writeOffset;
            }
            var f = n(8),
                c = n(382),
                util = (t.exports = f.util = f.util || {});
            !(function () {
                if (void 0 === e || !e.nextTick || e.browser) {
                    if ("function" == typeof i)
                        return (
                            (util.setImmediate = function () {
                                return i.apply(void 0, arguments);
                            }),
                            (util.nextTick = function (t) {
                                return i(t);
                            }),
                            void 0
                        );
                    if (
                        ((util.setImmediate = function (t) {
                            setTimeout(t, 0);
                        }),
                            "undefined" != typeof window &&
                            "function" == typeof window.postMessage)
                    ) {
                        var t = "forge.setImmediate",
                            n = [];
                        function e(e) {
                            if (e.source === window && e.data === t) {
                                e.stopPropagation();
                                var copy = n.slice();
                                (n.length = 0),
                                    copy.forEach(function (t) {
                                        t();
                                    });
                            }
                        }
                        (util.setImmediate = function (e) {
                            if ((n.push(e), 1 === n.length)) window.postMessage(t, "*");
                        }),
                            window.addEventListener("message", e, true);
                    }
                    if ("undefined" != typeof MutationObserver) {
                        var o = Date.now(),
                            a = true,
                            s = document.createElement("div"),
                            n = [];
                        new MutationObserver(function () {
                            var copy = n.slice();
                            (n.length = 0),
                                copy.forEach(function (t) {
                                    t();
                                });
                        }).observe(s, { attributes: true });
                        var u = util.setImmediate;
                        util.setImmediate = function (t) {
                            if (Date.now() - o > 15) (o = Date.now()), u(t);
                            else if ((n.push(t), 1 === n.length))
                                s.setAttribute("a", (a = !a));
                        };
                    }
                    util.nextTick = util.setImmediate;
                } else if (((util.nextTick = e.nextTick), "function" == typeof i))
                    util.setImmediate = i;
                else util.setImmediate = util.nextTick;
            })(),
                (util.isNodejs = void 0 !== e && e.versions && e.versions.node),
                (util.globalScope = (function () {
                    if (util.isNodejs) return o;
                    else return "undefined" == typeof self ? window : self;
                })()),
                (util.isArray =
                    Array.isArray ||
                    function (t) {
                        return "[object Array]" === Object.prototype.toString.call(t);
                    }),
                (util.isArrayBuffer = function (t) {
                    return "undefined" != typeof ArrayBuffer && t instanceof ArrayBuffer;
                }),
                (util.isArrayBufferView = function (t) {
                    return t && util.isArrayBuffer(t.buffer) && void 0 !== t.byteLength;
                }),
                (util.ByteBuffer = u),
                (util.ByteStringBuffer = u);
            var h = 4096;
            (util.ByteStringBuffer.prototype._optimizeConstructedString = function (
                t
            ) {
                if (
                    ((this._constructedStringLength += t),
                        this._constructedStringLength > h)
                )
                    this.data.substr(0, 1), (this._constructedStringLength = 0);
            }),
                (util.ByteStringBuffer.prototype.length = function () {
                    return this.data.length - this.read;
                }),
                (util.ByteStringBuffer.prototype.isEmpty = function () {
                    return this.length() <= 0;
                }),
                (util.ByteStringBuffer.prototype.putByte = function (t) {
                    return this.putBytes(String.fromCharCode(t));
                }),
                (util.ByteStringBuffer.prototype.fillWithByte = function (t, e) {
                    t = String.fromCharCode(t);
                    for (var d = this.data; e > 0;) {
                        if (1 & e) d += t;
                        if ((e >>>= 1) > 0) t += t;
                    }
                    return (this.data = d), this._optimizeConstructedString(e), this;
                }),
                (util.ByteStringBuffer.prototype.putBytes = function (t) {
                    return (
                        (this.data += t), this._optimizeConstructedString(t.length), this
                    );
                }),
                (util.ByteStringBuffer.prototype.putString = function (t) {
                    return this.putBytes(util.encodeUtf8(t));
                }),
                (util.ByteStringBuffer.prototype.putInt16 = function (t) {
                    return this.putBytes(
                        String.fromCharCode((t >> 8) & 255) + String.fromCharCode(255 & t)
                    );
                }),
                (util.ByteStringBuffer.prototype.putInt24 = function (t) {
                    return this.putBytes(
                        String.fromCharCode((t >> 16) & 255) +
                        String.fromCharCode((t >> 8) & 255) +
                        String.fromCharCode(255 & t)
                    );
                }),
                (util.ByteStringBuffer.prototype.putInt32 = function (t) {
                    return this.putBytes(
                        String.fromCharCode((t >> 24) & 255) +
                        String.fromCharCode((t >> 16) & 255) +
                        String.fromCharCode((t >> 8) & 255) +
                        String.fromCharCode(255 & t)
                    );
                }),
                (util.ByteStringBuffer.prototype.putInt16Le = function (t) {
                    return this.putBytes(
                        String.fromCharCode(255 & t) + String.fromCharCode((t >> 8) & 255)
                    );
                }),
                (util.ByteStringBuffer.prototype.putInt24Le = function (t) {
                    return this.putBytes(
                        String.fromCharCode(255 & t) +
                        String.fromCharCode((t >> 8) & 255) +
                        String.fromCharCode((t >> 16) & 255)
                    );
                }),
                (util.ByteStringBuffer.prototype.putInt32Le = function (t) {
                    return this.putBytes(
                        String.fromCharCode(255 & t) +
                        String.fromCharCode((t >> 8) & 255) +
                        String.fromCharCode((t >> 16) & 255) +
                        String.fromCharCode((t >> 24) & 255)
                    );
                }),
                (util.ByteStringBuffer.prototype.putInt = function (t, e) {
                    s(e);
                    var n = "";
                    do {
                        (e -= 8), (n += String.fromCharCode((t >> e) & 255));
                    } while (e > 0);
                    return this.putBytes(n);
                }),
                (util.ByteStringBuffer.prototype.putSignedInt = function (t, e) {
                    if (t < 0) t += 2 << (e - 1);
                    return this.putInt(t, e);
                }),
                (util.ByteStringBuffer.prototype.putBuffer = function (t) {
                    return this.putBytes(t.getBytes());
                }),
                (util.ByteStringBuffer.prototype.getByte = function () {
                    return this.data.charCodeAt(this.read++);
                }),
                (util.ByteStringBuffer.prototype.getInt16 = function () {
                    var t =
                        (this.data.charCodeAt(this.read) << 8) ^
                        this.data.charCodeAt(this.read + 1);
                    return (this.read += 2), t;
                }),
                (util.ByteStringBuffer.prototype.getInt24 = function () {
                    var t =
                        (this.data.charCodeAt(this.read) << 16) ^
                        (this.data.charCodeAt(this.read + 1) << 8) ^
                        this.data.charCodeAt(this.read + 2);
                    return (this.read += 3), t;
                }),
                (util.ByteStringBuffer.prototype.getInt32 = function () {
                    var t =
                        (this.data.charCodeAt(this.read) << 24) ^
                        (this.data.charCodeAt(this.read + 1) << 16) ^
                        (this.data.charCodeAt(this.read + 2) << 8) ^
                        this.data.charCodeAt(this.read + 3);
                    return (this.read += 4), t;
                }),
                (util.ByteStringBuffer.prototype.getInt16Le = function () {
                    var t =
                        this.data.charCodeAt(this.read) ^
                        (this.data.charCodeAt(this.read + 1) << 8);
                    return (this.read += 2), t;
                }),
                (util.ByteStringBuffer.prototype.getInt24Le = function () {
                    var t =
                        this.data.charCodeAt(this.read) ^
                        (this.data.charCodeAt(this.read + 1) << 8) ^
                        (this.data.charCodeAt(this.read + 2) << 16);
                    return (this.read += 3), t;
                }),
                (util.ByteStringBuffer.prototype.getInt32Le = function () {
                    var t =
                        this.data.charCodeAt(this.read) ^
                        (this.data.charCodeAt(this.read + 1) << 8) ^
                        (this.data.charCodeAt(this.read + 2) << 16) ^
                        (this.data.charCodeAt(this.read + 3) << 24);
                    return (this.read += 4), t;
                }),
                (util.ByteStringBuffer.prototype.getInt = function (t) {
                    s(t);
                    var e = 0;
                    do {
                        (e = (e << 8) + this.data.charCodeAt(this.read++)), (t -= 8);
                    } while (t > 0);
                    return e;
                }),
                (util.ByteStringBuffer.prototype.getSignedInt = function (t) {
                    var e = this.getInt(t),
                        n = 2 << (t - 2);
                    if (e >= n) e -= n << 1;
                    return e;
                }),
                (util.ByteStringBuffer.prototype.getBytes = function (t) {
                    var e;
                    if (t)
                        (t = Math.min(this.length(), t)),
                            (e = this.data.slice(this.read, this.read + t)),
                            (this.read += t);
                    else if (0 === t) e = "";
                    else
                        (e = 0 === this.read ? this.data : this.data.slice(this.read)),
                            this.clear();
                    return e;
                }),
                (util.ByteStringBuffer.prototype.bytes = function (t) {
                    return void 0 === t
                        ? this.data.slice(this.read)
                        : this.data.slice(this.read, this.read + t);
                }),
                (util.ByteStringBuffer.prototype.at = function (t) {
                    return this.data.charCodeAt(this.read + t);
                }),
                (util.ByteStringBuffer.prototype.setAt = function (t, e) {
                    return (
                        (this.data =
                            this.data.substr(0, this.read + t) +
                            String.fromCharCode(e) +
                            this.data.substr(this.read + t + 1)),
                        this
                    );
                }),
                (util.ByteStringBuffer.prototype.last = function () {
                    return this.data.charCodeAt(this.data.length - 1);
                }),
                (util.ByteStringBuffer.prototype.copy = function () {
                    var t = util.createBuffer(this.data);
                    return (t.read = this.read), t;
                }),
                (util.ByteStringBuffer.prototype.compact = function () {
                    if (this.read > 0)
                        (this.data = this.data.slice(this.read)), (this.read = 0);
                    return this;
                }),
                (util.ByteStringBuffer.prototype.clear = function () {
                    return (this.data = ""), (this.read = 0), this;
                }),
                (util.ByteStringBuffer.prototype.truncate = function (t) {
                    var e = Math.max(0, this.length() - t);
                    return (
                        (this.data = this.data.substr(this.read, e)), (this.read = 0), this
                    );
                }),
                (util.ByteStringBuffer.prototype.toHex = function () {
                    for (var t = "", e = this.read; e < this.data.length; ++e) {
                        var n = this.data.charCodeAt(e);
                        if (n < 16) t += "0";
                        t += n.toString(16);
                    }
                    return t;
                }),
                (util.ByteStringBuffer.prototype.toString = function () {
                    return util.decodeUtf8(this.bytes());
                }),
                (util.DataBuffer = l),
                (util.DataBuffer.prototype.length = function () {
                    return this.write - this.read;
                }),
                (util.DataBuffer.prototype.isEmpty = function () {
                    return this.length() <= 0;
                }),
                (util.DataBuffer.prototype.accommodate = function (t, e) {
                    if (this.length() >= t) return this;
                    e = Math.max(e || this.growSize, t);
                    var n = new Uint8Array(
                        this.data.buffer,
                        this.data.byteOffset,
                        this.data.byteLength
                    ),
                        i = new Uint8Array(this.length() + e);
                    return i.set(n), (this.data = new DataView(i.buffer)), this;
                }),
                (util.DataBuffer.prototype.putByte = function (t) {
                    return this.accommodate(1), this.data.setUint8(this.write++, t), this;
                }),
                (util.DataBuffer.prototype.fillWithByte = function (t, e) {
                    this.accommodate(e);
                    for (var n = 0; n < e; ++n) this.data.setUint8(t);
                    return this;
                }),
                (util.DataBuffer.prototype.putBytes = function (t, e) {
                    if (util.isArrayBufferView(t)) {
                        var n,
                            i =
                                (n = new Uint8Array(t.buffer, t.byteOffset, t.byteLength))
                                    .byteLength - n.byteOffset,
                            o;
                        return (
                            this.accommodate(i),
                            (o = new Uint8Array(this.data.buffer, this.write)).set(n),
                            (this.write += i),
                            this
                        );
                    }
                    if (util.isArrayBuffer(t)) {
                        var n = new Uint8Array(t),
                            o;
                        return (
                            this.accommodate(n.byteLength),
                            (o = new Uint8Array(this.data.buffer)).set(n, this.write),
                            (this.write += n.byteLength),
                            this
                        );
                    }
                    if (
                        t instanceof util.DataBuffer ||
                        ("object" == typeof t &&
                            "number" == typeof t.read &&
                            "number" == typeof t.write &&
                            util.isArrayBufferView(t.data))
                    ) {
                        var n = new Uint8Array(t.data.byteLength, t.read, t.length()),
                            o;
                        return (
                            this.accommodate(n.byteLength),
                            (o = new Uint8Array(t.data.byteLength, this.write)).set(n),
                            (this.write += n.byteLength),
                            this
                        );
                    }
                    if (t instanceof util.ByteStringBuffer) (t = t.data), (e = "binary");
                    if (((e = e || "binary"), "string" == typeof t)) {
                        var view;
                        if ("hex" === e)
                            return (
                                this.accommodate(Math.ceil(t.length / 2)),
                                (view = new Uint8Array(this.data.buffer, this.write)),
                                (this.write += util.binary.hex.decode(t, view, this.write)),
                                this
                            );
                        if ("base64" === e)
                            return (
                                this.accommodate(3 * Math.ceil(t.length / 4)),
                                (view = new Uint8Array(this.data.buffer, this.write)),
                                (this.write += util.binary.base64.decode(t, view, this.write)),
                                this
                            );
                        if ("utf8" === e) (t = util.encodeUtf8(t)), (e = "binary");
                        if ("binary" === e || "raw" === e)
                            return (
                                this.accommodate(t.length),
                                (view = new Uint8Array(this.data.buffer, this.write)),
                                (this.write += util.binary.raw.decode(view)),
                                this
                            );
                        if ("utf16" === e)
                            return (
                                this.accommodate(2 * t.length),
                                (view = new Uint16Array(this.data.buffer, this.write)),
                                (this.write += util.text.utf16.encode(view)),
                                this
                            );
                        throw new Error("Invalid encoding: " + e);
                    }
                    throw Error("Invalid parameter: " + t);
                }),
                (util.DataBuffer.prototype.putBuffer = function (t) {
                    return this.putBytes(t), t.clear(), this;
                }),
                (util.DataBuffer.prototype.putString = function (t) {
                    return this.putBytes(t, "utf16");
                }),
                (util.DataBuffer.prototype.putInt16 = function (t) {
                    return (
                        this.accommodate(2),
                        this.data.setInt16(this.write, t),
                        (this.write += 2),
                        this
                    );
                }),
                (util.DataBuffer.prototype.putInt24 = function (t) {
                    return (
                        this.accommodate(3),
                        this.data.setInt16(this.write, (t >> 8) & 65535),
                        this.data.setInt8(this.write, (t >> 16) & 255),
                        (this.write += 3),
                        this
                    );
                }),
                (util.DataBuffer.prototype.putInt32 = function (t) {
                    return (
                        this.accommodate(4),
                        this.data.setInt32(this.write, t),
                        (this.write += 4),
                        this
                    );
                }),
                (util.DataBuffer.prototype.putInt16Le = function (t) {
                    return (
                        this.accommodate(2),
                        this.data.setInt16(this.write, t, true),
                        (this.write += 2),
                        this
                    );
                }),
                (util.DataBuffer.prototype.putInt24Le = function (t) {
                    return (
                        this.accommodate(3),
                        this.data.setInt8(this.write, (t >> 16) & 255),
                        this.data.setInt16(this.write, (t >> 8) & 65535, true),
                        (this.write += 3),
                        this
                    );
                }),
                (util.DataBuffer.prototype.putInt32Le = function (t) {
                    return (
                        this.accommodate(4),
                        this.data.setInt32(this.write, t, true),
                        (this.write += 4),
                        this
                    );
                }),
                (util.DataBuffer.prototype.putInt = function (t, e) {
                    s(e), this.accommodate(e / 8);
                    do {
                        (e -= 8), this.data.setInt8(this.write++, (t >> e) & 255);
                    } while (e > 0);
                    return this;
                }),
                (util.DataBuffer.prototype.putSignedInt = function (t, e) {
                    if ((s(e), this.accommodate(e / 8), t < 0)) t += 2 << (e - 1);
                    return this.putInt(t, e);
                }),
                (util.DataBuffer.prototype.getByte = function () {
                    return this.data.getInt8(this.read++);
                }),
                (util.DataBuffer.prototype.getInt16 = function () {
                    var t = this.data.getInt16(this.read);
                    return (this.read += 2), t;
                }),
                (util.DataBuffer.prototype.getInt24 = function () {
                    var t =
                        (this.data.getInt16(this.read) << 8) ^
                        this.data.getInt8(this.read + 2);
                    return (this.read += 3), t;
                }),
                (util.DataBuffer.prototype.getInt32 = function () {
                    var t = this.data.getInt32(this.read);
                    return (this.read += 4), t;
                }),
                (util.DataBuffer.prototype.getInt16Le = function () {
                    var t = this.data.getInt16(this.read, true);
                    return (this.read += 2), t;
                }),
                (util.DataBuffer.prototype.getInt24Le = function () {
                    var t =
                        this.data.getInt8(this.read) ^
                        (this.data.getInt16(this.read + 1, true) << 8);
                    return (this.read += 3), t;
                }),
                (util.DataBuffer.prototype.getInt32Le = function () {
                    var t = this.data.getInt32(this.read, true);
                    return (this.read += 4), t;
                }),
                (util.DataBuffer.prototype.getInt = function (t) {
                    s(t);
                    var e = 0;
                    do {
                        (e = (e << 8) + this.data.getInt8(this.read++)), (t -= 8);
                    } while (t > 0);
                    return e;
                }),
                (util.DataBuffer.prototype.getSignedInt = function (t) {
                    var e = this.getInt(t),
                        n = 2 << (t - 2);
                    if (e >= n) e -= n << 1;
                    return e;
                }),
                (util.DataBuffer.prototype.getBytes = function (t) {
                    var e;
                    if (t)
                        (t = Math.min(this.length(), t)),
                            (e = this.data.slice(this.read, this.read + t)),
                            (this.read += t);
                    else if (0 === t) e = "";
                    else
                        (e = 0 === this.read ? this.data : this.data.slice(this.read)),
                            this.clear();
                    return e;
                }),
                (util.DataBuffer.prototype.bytes = function (t) {
                    return void 0 === t
                        ? this.data.slice(this.read)
                        : this.data.slice(this.read, this.read + t);
                }),
                (util.DataBuffer.prototype.at = function (t) {
                    return this.data.getUint8(this.read + t);
                }),
                (util.DataBuffer.prototype.setAt = function (t, e) {
                    return this.data.setUint8(t, e), this;
                }),
                (util.DataBuffer.prototype.last = function () {
                    return this.data.getUint8(this.write - 1);
                }),
                (util.DataBuffer.prototype.copy = function () {
                    return new util.DataBuffer(this);
                }),
                (util.DataBuffer.prototype.compact = function () {
                    if (this.read > 0) {
                        var t = new Uint8Array(this.data.buffer, this.read),
                            e = new Uint8Array(t.byteLength);
                        e.set(t),
                            (this.data = new DataView(e)),
                            (this.write -= this.read),
                            (this.read = 0);
                    }
                    return this;
                }),
                (util.DataBuffer.prototype.clear = function () {
                    return (
                        (this.data = new DataView(new ArrayBuffer(0))),
                        (this.read = this.write = 0),
                        this
                    );
                }),
                (util.DataBuffer.prototype.truncate = function (t) {
                    return (
                        (this.write = Math.max(0, this.length() - t)),
                        (this.read = Math.min(this.read, this.write)),
                        this
                    );
                }),
                (util.DataBuffer.prototype.toHex = function () {
                    for (var t = "", e = this.read; e < this.data.byteLength; ++e) {
                        var n = this.data.getUint8(e);
                        if (n < 16) t += "0";
                        t += n.toString(16);
                    }
                    return t;
                }),
                (util.DataBuffer.prototype.toString = function (t) {
                    var view = new Uint8Array(this.data, this.read, this.length());
                    if ("binary" === (t = t || "utf8") || "raw" === t)
                        return util.binary.raw.encode(view);
                    if ("hex" === t) return util.binary.hex.encode(view);
                    if ("base64" === t) return util.binary.base64.encode(view);
                    if ("utf8" === t) return util.text.utf8.decode(view);
                    if ("utf16" === t) return util.text.utf16.decode(view);
                    throw new Error("Invalid encoding: " + t);
                }),
                (util.createBuffer = function (input, t) {
                    if (((t = t || "raw"), void 0 !== input && "utf8" === t))
                        input = util.encodeUtf8(input);
                    return new util.ByteBuffer(input);
                }),
                (util.fillString = function (t, e) {
                    for (var n = ""; e > 0;) {
                        if (1 & e) n += t;
                        if ((e >>>= 1) > 0) t += t;
                    }
                    return n;
                }),
                (util.xorBytes = function (t, e, n) {
                    for (var i = "", o = "", a = "", s = 0, u = 0; n > 0; --n, ++s) {
                        if (((o = t.charCodeAt(s) ^ e.charCodeAt(s)), u >= 10))
                            (i += a), (a = ""), (u = 0);
                        (a += String.fromCharCode(o)), ++u;
                    }
                    return (i += a);
                }),
                (util.hexToBytes = function (t) {
                    var e = "",
                        n = 0;
                    if (t.length & (1 == 1))
                        (n = 1), (e += String.fromCharCode(parseInt(t[0], 16)));
                    for (; n < t.length; n += 2)
                        e += String.fromCharCode(parseInt(t.substr(n, 2), 16));
                    return e;
                }),
                (util.bytesToHex = function (t) {
                    return util.createBuffer(t).toHex();
                }),
                (util.int32ToBytes = function (t) {
                    return (
                        String.fromCharCode((t >> 24) & 255) +
                        String.fromCharCode((t >> 16) & 255) +
                        String.fromCharCode((t >> 8) & 255) +
                        String.fromCharCode(255 & t)
                    );
                });
            var p =
                "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=",
                m = [
                    62, -1, -1, -1, 63, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, -1, -1,
                    -1, 64, -1, -1, -1, 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14,
                    15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, -1, -1, -1, -1, -1, -1,
                    26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42,
                    43, 44, 45, 46, 47, 48, 49, 50, 51,
                ],
                v = "123456789ABCDEFGHJKLMNPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz";
            (util.encode64 = function (input, t) {
                for (var line = "", e = "", n, i, o, a = 0; a < input.length;) {
                    if (
                        ((n = input.charCodeAt(a++)),
                            (i = input.charCodeAt(a++)),
                            (o = input.charCodeAt(a++)),
                            (line += p.charAt(n >> 2)),
                            (line += p.charAt(((3 & n) << 4) | (i >> 4))),
                            isNaN(i))
                    )
                        line += "==";
                    else
                        (line += p.charAt(((15 & i) << 2) | (o >> 6))),
                            (line += isNaN(o) ? "=" : p.charAt(63 & o));
                    if (t && line.length > t)
                        (e += line.substr(0, t) + "\r\n"), (line = line.substr(t));
                }
                return (e += line);
            }),
                (util.decode64 = function (input) {
                    input = input.replace(/[^A-Za-z0-9\+\/\=]/g, "");
                    for (var t = "", e, n, i, o, a = 0; a < input.length;)
                        if (
                            ((e = m[input.charCodeAt(a++) - 43]),
                                (n = m[input.charCodeAt(a++) - 43]),
                                (i = m[input.charCodeAt(a++) - 43]),
                                (o = m[input.charCodeAt(a++) - 43]),
                                (t += String.fromCharCode((e << 2) | (n >> 4))),
                                64 !== i)
                        )
                            if (
                                ((t += String.fromCharCode(((15 & n) << 4) | (i >> 2))),
                                    64 !== o)
                            )
                                t += String.fromCharCode(((3 & i) << 6) | o);
                    return t;
                }),
                (util.encodeUtf8 = function (t) {
                    return unescape(encodeURIComponent(t));
                }),
                (util.decodeUtf8 = function (t) {
                    return decodeURIComponent(escape(t));
                }),
                (util.binary = {
                    raw: {},
                    hex: {},
                    base64: {},
                    base58: {},
                    baseN: { encode: c.encode, decode: c.decode },
                }),
                (util.binary.raw.encode = function (t) {
                    return String.fromCharCode.apply(null, t);
                }),
                (util.binary.raw.decode = function (t, e, n) {
                    var i = e;
                    if (!i) i = new Uint8Array(t.length);
                    for (var o = (n = n || 0), a = 0; a < t.length; ++a)
                        i[o++] = t.charCodeAt(a);
                    return e ? o - n : i;
                }),
                (util.binary.hex.encode = util.bytesToHex),
                (util.binary.hex.decode = function (t, e, n) {
                    var i = e;
                    if (!i) i = new Uint8Array(Math.ceil(t.length / 2));
                    var o = 0,
                        a = (n = n || 0);
                    if (1 & t.length) (o = 1), (i[a++] = parseInt(t[0], 16));
                    for (; o < t.length; o += 2) i[a++] = parseInt(t.substr(o, 2), 16);
                    return e ? a - n : i;
                }),
                (util.binary.base64.encode = function (input, t) {
                    for (var line = "", e = "", n, i, o, a = 0; a < input.byteLength;) {
                        if (
                            ((n = input[a++]),
                                (i = input[a++]),
                                (o = input[a++]),
                                (line += p.charAt(n >> 2)),
                                (line += p.charAt(((3 & n) << 4) | (i >> 4))),
                                isNaN(i))
                        )
                            line += "==";
                        else
                            (line += p.charAt(((15 & i) << 2) | (o >> 6))),
                                (line += isNaN(o) ? "=" : p.charAt(63 & o));
                        if (t && line.length > t)
                            (e += line.substr(0, t) + "\r\n"), (line = line.substr(t));
                    }
                    return (e += line);
                }),
                (util.binary.base64.decode = function (input, t, e) {
                    var n = t,
                        i,
                        o,
                        a,
                        s;
                    if (!n) n = new Uint8Array(3 * Math.ceil(input.length / 4));
                    input = input.replace(/[^A-Za-z0-9\+\/\=]/g, "");
                    for (var u = 0, l = (e = e || 0); u < input.length;)
                        if (
                            ((i = m[input.charCodeAt(u++) - 43]),
                                (o = m[input.charCodeAt(u++) - 43]),
                                (a = m[input.charCodeAt(u++) - 43]),
                                (s = m[input.charCodeAt(u++) - 43]),
                                (n[l++] = (i << 2) | (o >> 4)),
                                64 !== a)
                        )
                            if (((n[l++] = ((15 & o) << 4) | (a >> 2)), 64 !== s))
                                n[l++] = ((3 & a) << 6) | s;
                    return t ? l - e : n.subarray(0, l);
                }),
                (util.binary.base58.encode = function (input, t) {
                    return util.binary.baseN.encode(input, v, t);
                }),
                (util.binary.base58.decode = function (input, t) {
                    return util.binary.baseN.decode(input, v, t);
                }),
                (util.text = { utf8: {}, utf16: {} }),
                (util.text.utf8.encode = function (t, e, n) {
                    t = util.encodeUtf8(t);
                    var i = e;
                    if (!i) i = new Uint8Array(t.length);
                    for (var o = (n = n || 0), a = 0; a < t.length; ++a)
                        i[o++] = t.charCodeAt(a);
                    return e ? o - n : i;
                }),
                (util.text.utf8.decode = function (t) {
                    return util.decodeUtf8(String.fromCharCode.apply(null, t));
                }),
                (util.text.utf16.encode = function (t, e, n) {
                    var i = e;
                    if (!i) i = new Uint8Array(2 * t.length);
                    for (
                        var view = new Uint16Array(i.buffer),
                        o = (n = n || 0),
                        a = n,
                        s = 0;
                        s < t.length;
                        ++s
                    )
                        (view[a++] = t.charCodeAt(s)), (o += 2);
                    return e ? o - n : i;
                }),
                (util.text.utf16.decode = function (t) {
                    return String.fromCharCode.apply(null, new Uint16Array(t.buffer));
                }),
                (util.deflate = function (t, e, n) {
                    if (((e = util.decode64(t.deflate(util.encode64(e)).rval)), n)) {
                        var i = 2,
                            o;
                        if (32 & e.charCodeAt(1)) i = 6;
                        e = e.substring(i, e.length - 4);
                    }
                    return e;
                }),
                (util.inflate = function (t, e, n) {
                    var i = t.inflate(util.encode64(e)).rval;
                    return null === i ? null : util.decode64(i);
                });
            var g = function (t, id, e) {
                if (!t) throw new Error("WebStorage not available.");
                var n;
                if (null === e) n = t.removeItem(id);
                else (e = util.encode64(JSON.stringify(e))), (n = t.setItem(id, e));
                if (void 0 !== n && true !== n.rval) {
                    var i = new Error(n.error.message);
                    throw ((i.id = n.error.id), (i.name = n.error.name), i);
                }
            },
                y = function (t, id) {
                    if (!t) throw new Error("WebStorage not available.");
                    var e = t.getItem(id);
                    if (t.init)
                        if (null === e.rval) {
                            if (e.error) {
                                var n = new Error(e.error.message);
                                throw ((n.id = e.error.id), (n.name = e.error.name), n);
                            }
                            e = null;
                        } else e = e.rval;
                    if (null !== e) e = JSON.parse(util.decode64(e));
                    return e;
                },
                w = function (t, id, e, data) {
                    var n = y(t, id);
                    if (null === n) n = {};
                    (n[e] = data), g(t, id, n);
                },
                b = function (t, id, e) {
                    var n = y(t, id);
                    if (null !== n) n = e in n ? n[e] : null;
                    return n;
                },
                C = function (t, id, e) {
                    var n = y(t, id);
                    if (null !== n && e in n) {
                        delete n[e];
                        var empty = true;
                        for (var i in n) {
                            empty = false;
                            break;
                        }
                        if (empty) n = null;
                        g(t, id, n);
                    }
                },
                x = function (t, id) {
                    g(t, id, null);
                },
                S = function (t, e, n) {
                    var i = null,
                        type;
                    if (void 0 === n) n = ["web", "flash"];
                    var o = false,
                        a = null;
                    for (var s in n) {
                        type = n[s];
                        try {
                            if ("flash" === type || "both" === type) {
                                if (null === e[0])
                                    throw new Error("Flash local storage not available.");
                                (i = t.apply(this, e)), (o = "flash" === type);
                            }
                            if ("web" === type || "both" === type)
                                (e[0] = localStorage), (i = t.apply(this, e)), (o = true);
                        } catch (t) {
                            a = t;
                        }
                        if (o) break;
                    }
                    if (!o) throw a;
                    return i;
                };
            (util.setItem = function (t, id, e, data, n) {
                S(w, arguments, n);
            }),
                (util.getItem = function (t, id, e, n) {
                    return S(b, arguments, n);
                }),
                (util.removeItem = function (t, id, e, n) {
                    S(C, arguments, n);
                }),
                (util.clearItems = function (t, id, e) {
                    S(x, arguments, e);
                }),
                (util.isEmpty = function (t) {
                    for (var e in t) if (t.hasOwnProperty(e)) return false;
                    return true;
                }),
                (util.format = function (format) {
                    for (
                        var t = /%./g, e, n, i = 0, o = [], a = 0;
                        (e = t.exec(format));

                    ) {
                        if ((n = format.substring(a, t.lastIndex - 2)).length > 0)
                            o.push(n);
                        a = t.lastIndex;
                        var s = e[0][1];
                        switch (s) {
                            case "s":
                            case "o":
                                if (i < arguments.length) o.push(arguments[i++ + 1]);
                                else o.push("<?>");
                                break;
                            case "%":
                                o.push("%");
                                break;
                            default:
                                o.push("<%" + s + "?>");
                        }
                    }
                    return o.push(format.substring(a)), o.join("");
                }),
                (util.formatNumber = function (t, e, n, i) {
                    var o = t,
                        a = isNaN((e = Math.abs(e))) ? 2 : e,
                        d = void 0 === n ? "," : n,
                        s = void 0 === i ? "." : i,
                        u = o < 0 ? "-" : "",
                        l = parseInt((o = Math.abs(+o || 0).toFixed(a)), 10) + "",
                        f = l.length > 3 ? l.length % 3 : 0;
                    return (
                        u +
                        (f ? l.substr(0, f) + s : "") +
                        l.substr(f).replace(/(\d{3})(?=\d)/g, "$1" + s) +
                        (a
                            ? d +
                            Math.abs(o - l)
                                .toFixed(a)
                                .slice(2)
                            : "")
                    );
                }),
                (util.formatSize = function (size) {
                    if (size >= 1073741824)
                        size = util.formatNumber(size / 1073741824, 2, ".", "") + " GiB";
                    else if (size >= 1048576)
                        size = util.formatNumber(size / 1048576, 2, ".", "") + " MiB";
                    else if (size >= 1024)
                        size = util.formatNumber(size / 1024, 0) + " KiB";
                    else size = util.formatNumber(size, 0) + " bytes";
                    return size;
                }),
                (util.bytesFromIP = function (t) {
                    if (-1 !== t.indexOf(".")) return util.bytesFromIPv4(t);
                    if (-1 !== t.indexOf(":")) return util.bytesFromIPv6(t);
                    else return null;
                }),
                (util.bytesFromIPv4 = function (t) {
                    if (4 !== (t = t.split(".")).length) return null;
                    for (var e = util.createBuffer(), n = 0; n < t.length; ++n) {
                        var i = parseInt(t[n], 10);
                        if (isNaN(i)) return null;
                        e.putByte(i);
                    }
                    return e.getBytes();
                }),
                (util.bytesFromIPv6 = function (t) {
                    for (
                        var e = 0,
                        n =
                            2 *
                            (8 -
                                (t = t.split(":").filter(function (t) {
                                    if (0 === t.length) ++e;
                                    return true;
                                })).length +
                                e),
                        i = util.createBuffer(),
                        o = 0;
                        o < 8;
                        ++o
                    )
                        if (t[o] && 0 !== t[o].length) {
                            var a = util.hexToBytes(t[o]);
                            if (a.length < 2) i.putByte(0);
                            i.putBytes(a);
                        } else i.fillWithByte(0, n), (n = 0);
                    return i.getBytes();
                }),
                (util.bytesToIP = function (t) {
                    if (4 === t.length) return util.bytesToIPv4(t);
                    if (16 === t.length) return util.bytesToIPv6(t);
                    else return null;
                }),
                (util.bytesToIPv4 = function (t) {
                    if (4 !== t.length) return null;
                    for (var e = [], n = 0; n < t.length; ++n) e.push(t.charCodeAt(n));
                    return e.join(".");
                }),
                (util.bytesToIPv6 = function (t) {
                    if (16 !== t.length) return null;
                    for (var e = [], n = [], i = 0, o = 0; o < t.length; o += 2) {
                        for (
                            var a = util.bytesToHex(t[o] + t[o + 1]);
                            "0" === a[0] && "0" !== a;

                        )
                            a = a.substr(1);
                        if ("0" === a) {
                            var s = n[n.length - 1],
                                u = e.length;
                            if (!s || u !== s.end + 1) n.push({ start: u, end: u });
                            else if (((s.end = u), s.end - s.start > n[i].end - n[i].start))
                                i = n.length - 1;
                        }
                        e.push(a);
                    }
                    if (n.length > 0) {
                        var group = n[i];
                        if (group.end - group.start > 0) {
                            if (
                                (e.splice(group.start, group.end - group.start + 1, ""),
                                    0 === group.start)
                            )
                                e.unshift("");
                            if (7 === group.end) e.push("");
                        }
                    }
                    return e.join(":");
                }),
                (util.estimateCores = function (t, e) {
                    function n(t, a, s) {
                        if (0 === a) {
                            var u = Math.floor(
                                t.reduce(function (t, e) {
                                    return t + e;
                                }, 0) / t.length
                            );
                            return (
                                (util.cores = Math.max(1, u)),
                                URL.revokeObjectURL(o),
                                e(null, util.cores)
                            );
                        }
                        map(s, function (e, o) {
                            t.push(i(s, o)), n(t, a - 1, s);
                        });
                    }
                    function map(t, e) {
                        for (var n = [], i = [], a = 0; a < t; ++a) {
                            var worker = new Worker(o);
                            worker.addEventListener("message", function (o) {
                                if ((i.push(o.data), i.length === t)) {
                                    for (var a = 0; a < t; ++a) n[a].terminate();
                                    e(null, i);
                                }
                            }),
                                n.push(worker);
                        }
                        for (var a = 0; a < t; ++a) n[a].postMessage(a);
                    }
                    function i(t, e) {
                        for (var n = [], i = 0; i < t; ++i)
                            for (var o = e[i], overlap = (n[i] = []), a = 0; a < t; ++a)
                                if (i !== a) {
                                    var s = e[a];
                                    if (
                                        (o.st > s.st && o.st < s.et) ||
                                        (s.st > o.st && s.st < o.et)
                                    )
                                        overlap.push(a);
                                }
                        return n.reduce(function (t, overlap) {
                            return Math.max(t, overlap.length);
                        }, 0);
                    }
                    if ("function" == typeof t) (e = t), (t = {});
                    if (((t = t || {}), "cores" in util && !t.update))
                        return e(null, util.cores);
                    if (
                        "undefined" != typeof navigator &&
                        "hardwareConcurrency" in navigator &&
                        navigator.hardwareConcurrency > 0
                    )
                        return (
                            (util.cores = navigator.hardwareConcurrency), e(null, util.cores)
                        );
                    if ("undefined" == typeof Worker)
                        return (util.cores = 1), e(null, util.cores);
                    if ("undefined" == typeof Blob)
                        return (util.cores = 2), e(null, util.cores);
                    var o = URL.createObjectURL(
                        new Blob(
                            [
                                "(",
                                function () {
                                    self.addEventListener("message", function (t) {
                                        for (var e = Date.now(), et = e + 4; Date.now() < et;);
                                        self.postMessage({ st: e, et: et });
                                    });
                                }.toString(),
                                ")()",
                            ],
                            { type: "application/javascript" }
                        )
                    );
                    n([], 5, 16);
                });
        }).call(e, n(86), n(248).setImmediate, n(41), n(42).Buffer);
    },
    160: function (t, e, n) {
        "use strict";
        function Accordion(link) {
            (this.selector = ".u-accordion"),
                (this.activeClass = "u-accordion-active"),
                (this._paneSelector = ".u-accordion-pane"),
                (this.activeSelector = "." + this.activeClass),
                (this._linkSelector = ".u-accordion-link"),
                (this.activeLinkClass = "active"),
                (this.activeLinkSelector = "." + this.activeLinkClass),
                (this._isCollapsedByDefaultSelector = ".u-collapsed-by-default"),
                (this._link = link),
                (this._accordion = this._link.closest(this.selector));
        }
        (t.exports = Accordion),
            (Accordion.prototype.show = function (t) {
                var link = this._link;
                if (link.is(this.activeLinkSelector) && !t)
                    return this._removeActiveLink(), this._hidePane(link), void 0;
                this._removeActiveLink(),
                    this._hidePane(link),
                    this._addActiveLink(link),
                    this._activatePane(link);
            }),
            (Accordion.prototype._removeActiveLink = function () {
                var t = this._getActiveLink();
                t.removeClass(this.activeLinkClass), t.attr("aria-selected", false);
            }),
            (Accordion.prototype._getActiveLink = function () {
                return this._accordion.find(this.activeLinkSelector);
            }),
            (Accordion.prototype._addActiveLink = function (link) {
                link.addClass(this.activeLinkClass), link.attr("aria-selected", true);
            }),
            (Accordion.prototype._activatePane = function (link) {
                var pane;
                this._accordion.find(this.activeSelector).removeClass(this.activeClass),
                    this._getPane(link).addClass(this.activeClass);
            }),
            (Accordion.prototype._getPane = function (link) {
                return link.siblings(this._paneSelector);
            }),
            (Accordion.prototype._hidePane = function (link) {
                var pane;
                this._getPane(link).removeClass(this.activeClass);
            }),
            (Accordion.prototype.closeAll = function () {
                this._accordion
                    .find(this._linkSelector + this.activeLinkSelector)
                    .removeClass(this.activeLinkClass)
                    .attr("aria-selected", false),
                    this._accordion
                        .find(this._paneSelector + this.activeSelector)
                        .removeClass(this.activeClass);
            }),
            (Accordion.prototype.isCollapsedByDefault = function () {
                return this._accordion.is(this._isCollapsedByDefaultSelector);
            });
    },
    180: function (t, e, n) {
        "use strict";
        function i() {
            (u = String.fromCharCode(128)),
                (u += a.util.fillString(String.fromCharCode(0), 64)),
                (f = [
                    1116352408, 1899447441, 3049323471, 3921009573, 961987163, 1508970993,
                    2453635748, 2870763221, 3624381080, 310598401, 607225278, 1426881987,
                    1925078388, 2162078206, 2614888103, 3248222580, 3835390401,
                    4022224774, 264347078, 604807628, 770255983, 1249150122, 1555081692,
                    1996064986, 2554220882, 2821834349, 2952996808, 3210313671,
                    3336571891, 3584528711, 113926993, 338241895, 666307205, 773529912,
                    1294757372, 1396182291, 1695183700, 1986661051, 2177026350,
                    2456956037, 2730485921, 2820302411, 3259730800, 3345764771,
                    3516065817, 3600352804, 4094571909, 275423344, 430227734, 506948616,
                    659060556, 883997877, 958139571, 1322822218, 1537002063, 1747873779,
                    1955562222, 2024104815, 2227730452, 2361852424, 2428436474,
                    2756734187, 3204031479, 3329325298,
                ]),
                (l = true);
        }
        function o(t, e, n) {
            for (
                var i, o, a, s, u, l, c, h, p, m, d, v, g, y, w, b = n.length();
                b >= 64;

            ) {
                for (c = 0; c < 16; ++c) e[c] = n.getInt32();
                for (; c < 64; ++c)
                    (i =
                        (((i = e[c - 2]) >>> 17) | (i << 15)) ^
                        ((i >>> 19) | (i << 13)) ^
                        (i >>> 10)),
                        (o =
                            (((o = e[c - 15]) >>> 7) | (o << 25)) ^
                            ((o >>> 18) | (o << 14)) ^
                            (o >>> 3)),
                        (e[c] = (i + e[c - 7] + o + e[c - 16]) | 0);
                for (
                    h = t.h0,
                    p = t.h1,
                    m = t.h2,
                    d = t.h3,
                    v = t.h4,
                    g = t.h5,
                    y = t.h6,
                    w = t.h7,
                    c = 0;
                    c < 64;
                    ++c
                )
                    (a =
                        ((h >>> 2) | (h << 30)) ^
                        ((h >>> 13) | (h << 19)) ^
                        ((h >>> 22) | (h << 10))),
                        (l = (h & p) | (m & (h ^ p))),
                        (i =
                            w +
                            (s =
                                ((v >>> 6) | (v << 26)) ^
                                ((v >>> 11) | (v << 21)) ^
                                ((v >>> 25) | (v << 7))) +
                            (u = y ^ (v & (g ^ y))) +
                            f[c] +
                            e[c]),
                        (w = y),
                        (y = g),
                        (g = v),
                        (v = (d + i) >>> 0),
                        (d = m),
                        (m = p),
                        (p = h),
                        (h = (i + (o = a + l)) >>> 0);
                (t.h0 = (t.h0 + h) | 0),
                    (t.h1 = (t.h1 + p) | 0),
                    (t.h2 = (t.h2 + m) | 0),
                    (t.h3 = (t.h3 + d) | 0),
                    (t.h4 = (t.h4 + v) | 0),
                    (t.h5 = (t.h5 + g) | 0),
                    (t.h6 = (t.h6 + y) | 0),
                    (t.h7 = (t.h7 + w) | 0),
                    (b -= 64);
            }
        }
        var a = n(8);
        n(56), n(12);
        var s = (t.exports = a.sha256 = a.sha256 || {});
        (a.md.sha256 = a.md.algorithms.sha256 = s),
            (s.create = function () {
                if (!l) i();
                var t = null,
                    e = a.util.createBuffer(),
                    n = new Array(64),
                    s = {
                        algorithm: "sha256",
                        blockLength: 64,
                        digestLength: 32,
                        messageLength: 0,
                        fullMessageLength: null,
                        messageLengthSize: 8,
                        start: function () {
                            (s.messageLength = 0),
                                (s.fullMessageLength = s.messageLength64 = []);
                            for (var n = s.messageLengthSize / 4, i = 0; i < n; ++i)
                                s.fullMessageLength.push(0);
                            return (
                                (e = a.util.createBuffer()),
                                (t = {
                                    h0: 1779033703,
                                    h1: 3144134277,
                                    h2: 1013904242,
                                    h3: 2773480762,
                                    h4: 1359893119,
                                    h5: 2600822924,
                                    h6: 528734635,
                                    h7: 1541459225,
                                }),
                                s
                            );
                        },
                    };
                return (
                    s.start(),
                    (s.update = function (i, u) {
                        if ("utf8" === u) i = a.util.encodeUtf8(i);
                        var l = i.length;
                        (s.messageLength += l), (l = [(l / 4294967296) >>> 0, l >>> 0]);
                        for (var f = s.fullMessageLength.length - 1; f >= 0; --f)
                            (s.fullMessageLength[f] += l[1]),
                                (l[1] = l[0] + ((s.fullMessageLength[f] / 4294967296) >>> 0)),
                                (s.fullMessageLength[f] = s.fullMessageLength[f] >>> 0),
                                (l[0] = (l[1] / 4294967296) >>> 0);
                        if ((e.putBytes(i), o(t, n, e), e.read > 2048 || 0 === e.length()))
                            e.compact();
                        return s;
                    }),
                    (s.digest = function () {
                        var i = a.util.createBuffer();
                        i.putBytes(e.bytes());
                        var l,
                            f =
                                (s.fullMessageLength[s.fullMessageLength.length - 1] +
                                    s.messageLengthSize) &
                                (s.blockLength - 1),
                            c,
                            h;
                        i.putBytes(u.substr(0, s.blockLength - f));
                        for (
                            var p = 8 * s.fullMessageLength[0], m = 0;
                            m < s.fullMessageLength.length - 1;
                            ++m
                        )
                            (p += h =
                                ((c = 8 * s.fullMessageLength[m + 1]) / 4294967296) >>> 0),
                                i.putInt32(p >>> 0),
                                (p = c >>> 0);
                        i.putInt32(p);
                        var v = {
                            h0: t.h0,
                            h1: t.h1,
                            h2: t.h2,
                            h3: t.h3,
                            h4: t.h4,
                            h5: t.h5,
                            h6: t.h6,
                            h7: t.h7,
                        };
                        o(v, n, i);
                        var g = a.util.createBuffer();
                        return (
                            g.putInt32(v.h0),
                            g.putInt32(v.h1),
                            g.putInt32(v.h2),
                            g.putInt32(v.h3),
                            g.putInt32(v.h4),
                            g.putInt32(v.h5),
                            g.putInt32(v.h6),
                            g.putInt32(v.h7),
                            g
                        );
                    }),
                    s
                );
            });
        var u = null,
            l = false,
            f = null;
    },
    189: function (t, e, n) {
        "use strict";
        function i() {
            (this.hint = null), (this.animations = []);
        }
        t.exports = i;
        var o = null;
        (i.instance = function instance() {
            if (!o) o = new i();
            return o;
        }),
            (i.prototype.createAnimation = function t(e) {
                for (var n = 0; n < this.animations.length; n++)
                    if (this.animations[n].isMatch(e))
                        return this.animations[n].create(e, this.hint);
                return null;
            }),
            (i.prototype.setHint = function t(e) {
                this.hint = e;
            }),
            (i.prototype.registerAnimation = function (animation) {
                this.animations.push(animation);
            }),
            (window.AnimationFactory = i);
    },
    190: function (t, e, n) {
        "use strict";
        function i(t, e) {
            if (!t) throw new Error("animationInfo is null or undefined");
            if (
                ((this.info = t),
                    (this.hint = e),
                    (this.animatedClass = ["animated"]),
                    (this.backstageClass = ["backstage"]),
                    (this.animationInClass = this.getAnimationClass()),
                    this.isInOutAnimation())
            )
                this.animationOutClass = this.getAnimationOutClass();
            (this._reqestId = null),
                (this._timeoutId = null),
                (this._animationInTimeoutId = null),
                (this._handleAnimationEnd = this._handleAnimationEnd.bind(this)),
                (this._playing = null),
                (this._playNext = null),
                (this._playNextDuration = null);
        }
        function o(t) {
            if (!t) return null;
            if (t < l) t = l;
            return t + "ms";
        }
        function a(t, e) {
            if ((e = o(e))) t.style["animation-duration"] = e;
        }
        function s(t) {
            switch (t) {
                case "Down":
                    return "Up";
                case "Up":
                    return "Down";
                default:
                    return t;
            }
        }
        var u = n(270);
        t.exports = i;
        var l = 100,
            f = 500,
            c = "In",
            h = "Out";
        (i.isMatch = function () {
            return true;
        }),
            (i.create = function (t, e) {
                return new i(t, e);
            }),
            (i.prototype._handleAnimationEnd = function t(e) {
                if (e.target === this.info.element) {
                    if (
                        ((this._playing = null),
                            a(this.info.element, this.info.duration),
                            this.info.element.classList.contains(this.animationInClass))
                    )
                        this.info.element.classList.remove(this.animationInClass),
                            this.info.element.classList.add(
                                this.animationInClass + "-played"
                            );
                    else
                        this.info.element.classList.remove(
                            this.animationInClass + "-played"
                        );
                    if (this._playNext) {
                        var n = this._playNext,
                            i = this._playNextDuration;
                        (this._playNext = null),
                            (this._playNextDuration = null),
                            this._play(n, i);
                    }
                }
            }),
            (i.prototype.subscribe = function t() {
                this.info.element.addEventListener(
                    "animationend",
                    this._handleAnimationEnd
                );
            }),
            (i.prototype.unsubscribe = function t() {
                this.info.element.removeEventListener(
                    "animationend",
                    this._handleAnimationEnd
                );
            }),
            (i.prototype.init = function init() {
                if (this.hint) this.hint.hintBrowser(this.info);
                this.subscribe(), this.reset();
            }),
            (i.prototype.clear = function t() {
                if (this.info) {
                    if (this.backstageClass)
                        this.info.element.classList.remove.apply(
                            this.info.element.classList,
                            this.backstageClass
                        );
                    if (this.animatedClass)
                        this.info.element.classList.remove.apply(
                            this.info.element.classList,
                            this.animatedClass
                        );
                    if (this.animationInClass)
                        this.info.element.classList.remove(this.animationInClass);
                    if (this.outAnimatedClass)
                        this.info.element.classList.remove(this.animationOutClass);
                    if (((this.info.element.style["animation-duration"] = ""), this.hint))
                        this.hint.removeHint(this.info);
                    if (this._animationInTimeoutId)
                        clearTimeout(this._animationInTimeoutId),
                            (this._animationInTimeoutId = null);
                    (this._playing = null), (this._playNext = null), this.unsubscribe();
                }
            }),
            (i.prototype.requestAnimationFrame = function t(e) {
                return u.requestAnimationFrame(e);
            }),
            (i.prototype.cancelAnimationFrame = function t(id) {
                if (window.cancelAnimationFrame)
                    return window.cancelAnimationFrame(id), void 0;
                if (window.mozCancelAnimationFrame) window.mozCancelAnimationFrame(id);
            }),
            (i.prototype.getAnimationClass = function t() {
                if (!this.info) return null;
                var e = this.info.name;
                if (this.info.direction) e += this.info.direction;
                return e;
            }),
            (i.prototype.getAnimationOutClass = function t() {
                if (!this.info) return null;
                var e = this.info.name;
                if (this.isInOutAnimation()) e = e.slice(0, 0 - c.length) + h;
                if (this.info.direction) e += s(this.info.direction);
                return e;
            }),
            (i.prototype.isInOutAnimation = function t() {
                if (!this.info || !this.info.name || !this.info.animationOut)
                    return false;
                else
                    return this.info.name.indexOf(c) + c.length === this.info.name.length;
            }),
            (i.prototype.start = function t() {
                if (this.info) {
                    var e = this.info.delay,
                        n = function () {
                            (this._animationInTimeoutId = null),
                                this._play(this.animationInClass);
                        }.bind(this);
                    if (this._animationInTimeoutId)
                        clearTimeout(this._animationInTimeoutId);
                    if (!e) return n(), void 0;
                    this._animationInTimeoutId = setTimeout(n, e);
                }
            }),
            (i.prototype.startOut = function t() {
                if (this.info)
                    if (this.animationOutClass)
                        if (this._animationInTimeoutId)
                            return (
                                clearInterval(this._animationInTimeoutId),
                                (this._animationInTimeoutId = null),
                                void 0
                            );
                        else return this._play(this.animationOutClass, f), void 0;
            }),
            (i.prototype._play = function t(animation, e) {
                if (!animation) animation = this.animationInClass;
                if (e) a(this.info.element, e);
                if (this._playing === animation) return (this._playNext = null), void 0;
                if (this._playing)
                    return (
                        (this._playNext = animation), (this._playNextDuration = e), void 0
                    );
                if (((this._playing = animation), this._reqestId))
                    this.cancelAnimationFrame(this._reqestId);
                this._reqestId = this.requestAnimationFrame(
                    function () {
                        if (((this._reqestId = null), this.backstageClass))
                            this.info.element.classList.remove.apply(
                                this.info.element.classList,
                                this.backstageClass
                            );
                        if (this.animationOutClass)
                            this.info.element.classList.remove(this.animationOutClass);
                        if (this.animationInClass)
                            this.info.element.classList.remove(this.animationInClass);
                        if (animation) this.info.element.classList.add(animation);
                    }.bind(this)
                );
            }),
            (i.prototype.reset = function t() {
                if (this.info) {
                    var e = this.info.duration;
                    if (
                        (a(this.info.element, e),
                            (this._playing = null),
                            (this._playNext = null),
                            this.backstageClass)
                    )
                        this.info.element.classList.add.apply(
                            this.info.element.classList,
                            this.backstageClass
                        );
                    if (this.animatedClass)
                        this.info.element.classList.add.apply(
                            this.info.element.classList,
                            this.animatedClass
                        );
                }
            }),
            (i.prototype.needOutAnimation = function t() {
                if (!this.isInOutAnimation()) return false;
                if (this._animationInTimeoutId) return true;
                else
                    return (
                        (this.info.element.classList.contains(this.animationInClass) ||
                            this.info.element.classList.contains(
                                this.animationInClass + "-played"
                            )) &&
                        !this.info.element.classList.contains(this.backstageClass[0])
                    );
            }),
            (i.prototype.getTime = function t() {
                if (!this.info) return 0;
                var e = this.info.duration,
                    n = this.info.delay;
                if (isNaN(n)) n = 0;
                return n + e;
            }),
            (i.prototype.getOutTime = function t() {
                if (!this.info || !this.isInOutAnimation()) return 0;
                else return f;
            });
    },
    191: function (t, e, n) {
        "use strict";
        function CountdownUpdater(t) {
            (this.$dom = t), (this.countdownCommon = new CountdownCommon(t));
        }
        t.exports = CountdownUpdater;
        var CountdownCommon = n(32);
        (CountdownUpdater.prototype.startUpdate = function (t) {
            var e = this.getUpdateTimeout();
            if (e) this.update(t, true), setInterval(this.update.bind(this), e, t);
        }),
            (CountdownUpdater.prototype.getUpdateTimeout = function () {
                if (this.countdownCommon.getAfterCountFinished()) return 0;
                var countdownType = this.countdownCommon.getType();
                if ("to-date" === countdownType || "to-time" === countdownType)
                    return 350;
                if ("to-number" === countdownType) {
                    var t = this.countdownCommon.getFrequency(),
                        e = CountdownCommon.timeStringToMilliseconds(t);
                    return (e = Math.max(e, 0)), (e = Math.min(e, 350));
                }
                return 0;
            }),
            (CountdownUpdater.prototype.getAnimationProps = function (t, e) {
                if (e) return { animation: "none" };
                else
                    return {
                        animation:
                            ("runtime" === t && this.countdownCommon.getCountAnimation()) ||
                            "none",
                        animationSpeed: this.getUpdateTimeout(),
                    };
            }),
            (CountdownUpdater.prototype.update = function (t, e) {
                if (!this.countdownCommon.getAfterCountFinished()) {
                    var countdownType = this.countdownCommon.getType();
                    if ("to-date" === countdownType || "to-time" === countdownType)
                        this.updateDateAndTime(t, e);
                    if ("to-number" === countdownType) this.updateNumber(t, e);
                }
            }),
            (CountdownUpdater.prototype.updateDateAndTime = function (t, e) {
                var n = this.countdownCommon.getDate(),
                    diff = this.getTimeDiff(n);
                if (!this.afterCount(diff, t)) {
                    var props = this.getAnimationProps(t, e);
                    this.countdownCommon.setValue("years", diff.years, false, props),
                        this.countdownCommon.setValue("days", diff.days, false, props),
                        this.countdownCommon.setValue("hours", diff.hours, false, props),
                        this.countdownCommon.setValue(
                            "minutes",
                            diff.minutes,
                            false,
                            props
                        ),
                        this.countdownCommon.setValue(
                            "seconds",
                            diff.seconds,
                            false,
                            props
                        ),
                        this.countdownCommon.showLabel("years", !!diff.years),
                        this.countdownCommon.showLabel("days", !!diff.days);
                }
            }),
            (CountdownUpdater.prototype.updateNumber = function (t, e) {
                var n = this.countdownCommon.getNumber(),
                    i = this.countdownCommon.getStartTime(),
                    o = this.countdownCommon.getFrequency(),
                    diff = this.countdownCommon.calcNumber(n, i, o);
                if ("per-visitor" === this.countdownCommon.getFor()) {
                    var a = this.countdownCommon.getTimerId();
                    (i = this.getStartDate(a)),
                        (diff = this.countdownCommon.calcNumber(n, i, o));
                }
                if (!this.afterCount(diff, t)) {
                    var props = this.getAnimationProps(t, e);
                    this.countdownCommon.setValue("numbers", diff, false, props);
                }
            }),
            (CountdownUpdater.prototype.getTimeDiff = function (t) {
                if ("everyone" === this.countdownCommon.getFor())
                    return this.countdownCommon.timeDiff(t);
                var e = this.getStartDate(),
                    n = this.countdownCommon.getTimeLeft();
                return (
                    (t = this.countdownCommon.parseTime(n, e)),
                    this.countdownCommon.timeDiff(t)
                );
            }),
            (CountdownUpdater.prototype.getStartDate = function () {
                var t = this.countdownCommon.getTimerKey(),
                    e = localStorage.getItem(t);
                if (e) return new Date(e);
                var n = new Date();
                return localStorage.setItem(t, n.toUTCString()), n;
            }),
            (CountdownUpdater.prototype.afterCount = function (diff, t) {
                var e = this.countdownCommon.getDirection(),
                    n = this.countdownCommon.getAfterCount();
                if (
                    ((t = t || ""),
                        "none" !== n && "down" === e && CountdownCommon.isEmptyDiff(diff))
                ) {
                    if ("message" === n) this.showMessage();
                    if ("redirect" === n)
                        if (
                            (this.$dom.find(".u-countdown-message").text("Redirecting..."),
                                this.showMessage(),
                                "preview" !== t)
                        ) {
                            var i = this.countdownCommon.getRedirectUrl();
                            window.location.href = i;
                        }
                    if ("preview" !== t) this.countdownCommon.setAfterCountFinished();
                    return true;
                }
                return false;
            }),
            (CountdownUpdater.prototype.showMessage = function () {
                if (this.$dom.find(".u-countdown-message").is(".u-hidden"))
                    this.$dom.find(".u-countdown-wrapper").addClass("u-invisible"),
                        this.$dom.find(".u-countdown-message").removeClass("u-hidden");
            }),
            (CountdownUpdater.prototype.hideMessage = function () {
                if (this.$dom.find(".u-countdown-message").not(".u-hidden"))
                    this.$dom.find(".u-countdown-wrapper").removeClass("u-invisible"),
                        this.$dom.find(".u-countdown-message").addClass("u-hidden");
            }),
            (CountdownUpdater.findAll = function () {
                return $(".u-countdown");
            });
    },
    195: function (t, e, n) {
        "use strict";
        function Dialog(t) {
            (this._openClass = "u-dialog-open"),
                (this._dialogBlockClass = "u-dialog-block"),
                (this._dialogBlockSelector = "." + this._dialogBlockClass),
                (this._dialog = t.closest(this._dialogBlockSelector));
        }
        function i(t) {
            if (!window._responsive) return false;
            var e = t.find(".u-dialog"),
                n = window._responsive.mode || "XL";
            return e.is(".u-hidden, .u-hidden-" + n.toLowerCase());
        }
        (t.exports = Dialog),
            (Dialog.prototype.open = function (t) {
                this._dialog.each(
                    function (e, block) {
                        var n = $(block);
                        if (!i(n)) {
                            if ((n.addClass(this._openClass), "function" == typeof t)) t(n);
                            n.trigger("opened.np.dialog", [this]);
                        }
                    }.bind(this)
                );
            }),
            (Dialog.prototype.close = function () {
                this._dialog.removeClass(this._openClass),
                    this._dialog.trigger("closed.np.dialog", [this]);
            }),
            (Dialog.prototype.getInterval = function () {
                return this._dialog.attr("data-dialog-show-interval") || 3e3;
            });
    },
    248: function (t, e, n) {
        "use strict";
        (function (t) {
            function i(id, t) {
                (this._id = id), (this._clearFn = t);
            }
            var o =
                (void 0 !== t && t) || ("undefined" != typeof self && self) || window,
                a = Function.prototype.apply;
            (e.setTimeout = function () {
                return new i(a.call(setTimeout, o, arguments), clearTimeout);
            }),
                (e.setInterval = function () {
                    return new i(a.call(setInterval, o, arguments), clearInterval);
                }),
                (e.clearTimeout = e.clearInterval =
                    function (t) {
                        if (t) t.close();
                    }),
                (i.prototype.unref = i.prototype.ref = function () { }),
                (i.prototype.close = function () {
                    this._clearFn.call(o, this._id);
                }),
                (e.enroll = function (t, e) {
                    clearTimeout(t._idleTimeoutId), (t._idleTimeout = e);
                }),
                (e.unenroll = function (t) {
                    clearTimeout(t._idleTimeoutId), (t._idleTimeout = -1);
                }),
                (e._unrefActive = e.active =
                    function (t) {
                        clearTimeout(t._idleTimeoutId);
                        var e = t._idleTimeout;
                        if (e >= 0)
                            t._idleTimeoutId = setTimeout(function e() {
                                if (t._onTimeout) t._onTimeout();
                            }, e);
                    }),
                n(381),
                (e.setImmediate =
                    ("undefined" != typeof self && self.setImmediate) ||
                    (void 0 !== t && t.setImmediate) ||
                    (this && this.setImmediate)),
                (e.clearImmediate =
                    ("undefined" != typeof self && self.clearImmediate) ||
                    (void 0 !== t && t.clearImmediate) ||
                    (this && this.clearImmediate));
        }).call(e, n(41));
    },
    2655: function (t, e, n) {
        "use strict";
        var FormMessage = (t.exports = {}),
            i = n(10);
        (FormMessage.showSuccess = function t(form) {
            form.trigger("reset");
            var e = form.find(".u-form-send-success"),
                n = e.find(".u-form-send-message-close");
            if (!n.length)
                (n = i('<a href="#" class="u-form-send-message-close">x</a>')),
                    e.append(n);
            e.show(),
                n.one("click", function (t) {
                    t.preventDefault(), e.hide();
                }),
                form.find('input[type="submit"]').prop("disabled", false);
        }),
            (FormMessage.showError = function t(form, e, n, o) {
                var a = e
                    ? form.find(".u-form-send-error").clone()
                    : form.find(".u-form-send-error");
                if (e) {
                    if (n)
                        if (560 === n && o)
                            e =
                                "Unable to submit the Contact Form, as the submission email is not verified.\n" +
                                "</br></br>" +
                                "If you are a site administrator, please open your inbox and confirm the " +
                                o +
                                " email in the message. Make sure also to check your spam folder.";
                    a.html(e), form.find(".u-form-send-error").parent().append(a);
                }
                var s = a.find(".u-form-send-message-close");
                if (!s.length)
                    (s = i('<a href="#" class="u-form-send-message-close">x</a>')),
                        a.append(s);
                s.one("click", function (t) {
                    if ((t.preventDefault(), a.hide(), e)) a.remove();
                }),
                    a.show(),
                    form.find('input[type="submit"]').prop("disabled", false);
            });
    },
    270: function (t, e, n) {
        "use strict";
        var i;
        t.exports.requestAnimationFrame = function t(e) {
            if (window.requestAnimationFrame) return window.requestAnimationFrame(e);
            if (window.mozRequestAnimationFrame)
                return window.mozRequestAnimationFrame(e);
            if (window.webkitRequestAnimationFrame)
                return window.webkitRequestAnimationFrame(e);
            if (window.msRequestAnimationFrame)
                return window.msRequestAnimationFrame(e);
            else return e(), void 0;
        };
    },
    271: function (t, e, n) {
        "use strict";
        function i(t, section) {
            if (
                ((this.element = t),
                    (this.section = section),
                    (this.name = t.getAttribute("data-animation-name")),
                    (this.event = "scroll"),
                    (this.durationRaw = t.getAttribute("data-animation-duration")),
                    (this.duration = Number(this.durationRaw)),
                    isNaN(this.duration) || !isFinite(this.duration) || this.duration < 0)
            )
                this.duration = 0;
            var e = t.getAttribute("data-animation-event");
            if (e) this.event = e;
            if (
                ((this.delayRaw = t.getAttribute("data-animation-delay")),
                    (this.delay = 0),
                    this.delayRaw)
            )
                if (
                    ((this.delay = Number(this.delayRaw)),
                        isNaN(this.delay) || !isFinite(this.delay) || this.delay < 0)
                )
                    this.delay = 0;
            var n = t.getAttribute("data-animation-cycle");
            if (n) if (((n = Number(n)), !isNaN(n))) this.animationCycle = n;
            var i = t.getAttribute("data-animation-direction");
            if (i && "customAnimationIn" !== this.name) this.direction = i;
            (this.animationOut =
                !t.hasAttribute("data-animation-out") ||
                parseFloat(t.getAttribute("data-animation-out"))),
                (this.infinite = t.classList.contains("infinite"));
        }
        (t.exports = i), (window.AnimationInfo = i);
    },
    273: function (t, e, n) {
        "use strict";
        function CountdownAnimate(t) {
            if (
                ((this.$dom = t),
                    (this.$html = this.$dom.find(".counter-animation")),
                    !this.$html.length)
            ) {
                var e = this.$dom.text();
                (this.$html = $(
                    '<div class="counter-animation" style="display: none;"></div>'
                )),
                    this.$html.append('<div class="counter-wrapper"></div>'),
                    this.$html
                        .find(".counter-wrapper")
                        .append('<div class="counter-html"></div>'),
                    this.$html
                        .find(".counter-html")
                        .append($('<div class="old-val"></div>')),
                    this.$html
                        .find(".counter-html")
                        .append($('<div class="new-val"></div>')),
                    this.$dom.empty(),
                    this.$dom.append($('<span class="start-val"></span>').text(e)),
                    this.$dom.append(this.$html);
            }
            this.onResize(),
                $(window).on(
                    "resize",
                    function () {
                        this.onResize();
                    }.bind(this)
                );
        }
        (t.exports = CountdownAnimate),
            (CountdownAnimate.prototype.rollNumber = function (t, props) {
                if (!this.$dom.is(".updating")) {
                    this.$dom.addClass("updating");
                    var e = this.getOldVal(),
                        n = this.$dom.find(".start-val"),
                        i = this.$dom.find(".counter-animation"),
                        o = 350;
                    if (props.animationSpeed)
                        o = props.animationSpeed > 20 ? props.animationSpeed - 20 : 0;
                    this.$html.find(".old-val").text(e),
                        this.$html.find(".new-val").text(t),
                        this.$html.find(".counter-html").css("top", 0),
                        requestAnimationFrame(
                            function () {
                                n.css("display", "none"), i.css("display", "flex");
                            }.bind(this)
                        ),
                        this.$html.find(".counter-html").animate(
                            { top: -this.height + "px" },
                            o,
                            "swing",
                            function () {
                                requestAnimationFrame(
                                    function () {
                                        n.text(t),
                                            n.css("display", "inline-block"),
                                            i.css("display", "none"),
                                            this.$dom.removeClass("updating");
                                    }.bind(this)
                                );
                            }.bind(this)
                        );
                }
            }),
            (CountdownAnimate.prototype.onResize = function () {
                (this.height = this.$dom.height()),
                    this.$html.find(".counter-wrapper").css("height", this.height + "px");
            }),
            (CountdownAnimate.prototype.getOldVal = function () {
                return this.$dom.find(".start-val").text();
            });
    },
    275: function (t, e, n) {
        "use strict";
        function TabsControl(t) {
            (this.tabsSelector = ".u-tabs"),
                (this.activeClass = "u-tab-active"),
                (this.activeSelector = "." + this.activeClass),
                (this.activeLinkClass = "active"),
                (this.activeLinkSelector = "." + this.activeLinkClass),
                (this.tabListSelector = ".u-tab-list"),
                (this.tabContentSelector = ".u-tab-content"),
                (this.tabLinkSelector = ".u-tab-link"),
                (this.tabPaneSelector = ".u-tab-pane"),
                (this._tabLink = this._getLink(t)),
                (this._tabList = this._tabLink.closest(this.tabListSelector)),
                (this._tabContent = this._tabLink
                    .closest(this.tabsSelector)
                    .children(this.tabContentSelector));
        }
        (TabsControl.prototype.show = function () {
            var link = this._tabLink;
            if (!link.is(this.activeLinkSelector))
                this._removeActiveLink(),
                    this._addActiveLink(link),
                    this._activateTabPane(link);
        }),
            (TabsControl.prototype._getLink = function (t) {
                if (t.is(this.tabPaneSelector)) return this._findLinkByPane(t);
                else
                    return t.is(this.tabLinkSelector)
                        ? t
                        : t.children(this.tabLinkSelector);
            }),
            (TabsControl.prototype._findLinkByPane = function (pane) {
                var t = pane.attr("aria-labelledby"),
                    tabList;
                return pane
                    .closest(this.tabsSelector)
                    .children(this.tabListSelector)
                    .find("#" + t);
            }),
            (TabsControl.prototype._removeActiveLink = function () {
                var t = this._getActiveLink();
                t.removeClass(this.activeLinkClass), t.attr("aria-selected", false);
            }),
            (TabsControl.prototype._getActiveLink = function () {
                return this._tabList.find(this.activeLinkSelector);
            }),
            (TabsControl.prototype._addActiveLink = function (link) {
                link.addClass(this.activeLinkClass), link.attr("aria-selected", true);
            }),
            (TabsControl.prototype._activateTabPane = function (link) {
                var t, e;
                this._tabContent
                    .children(this.activeSelector)
                    .removeClass(this.activeClass),
                    this.getTabPane(link).addClass(this.activeClass);
            }),
            (TabsControl.prototype.getTabPane = function (t) {
                var link,
                    e = this._getLink(t).attr("href");
                return this._tabContent.children(e);
            }),
            (TabsControl.prototype.getTabLink = function () {
                return this._tabLink;
            }),
            (TabsControl.prototype.removeId = function () {
                this._tabList.find(this.tabLinkSelector).removeAttr("id"),
                    this._tabContent.children().removeAttr("id");
            }),
            (t.exports = TabsControl),
            (window.TabsControl = TabsControl);
    },
    298: function (t, e, n) {
        "use strict";
        function HorizontalLayoutSlider(slider, t) {
            if (slider && slider.length) {
                var e = slider.children(".u-gallery-inner, .u-repeater");
                if (e.length) {
                    this.viewport = e;
                    var n = slider.children(".u-gallery-nav");
                    if (n.length) {
                        if (
                            ((this.controls = n),
                                (this.data = {
                                    offset: 0,
                                    width: 0,
                                    scrollWidth: 0,
                                    maxOffset: 0,
                                }),
                                t)
                        )
                            (this._onScroll = this.onScroll.bind(this)),
                                (this._onlazyloaded = this.onlazyloaded.bind(this)),
                                this.viewport.scroll(this._onScroll),
                                this.viewport.find("img.lazyload").each(
                                    function (t, e) {
                                        e.onload = this._onlazyloaded;
                                    }.bind(this)
                                );
                        if ((this.updateInnerData(), t)) this.updateControls();
                    }
                }
            }
        }
        (t.exports = HorizontalLayoutSlider),
            (HorizontalLayoutSlider.prototype.onScroll = function () {
                this.updateControls();
            }),
            (HorizontalLayoutSlider.prototype.onlazyloaded = function t() {
                this.updateInnerData(), this.updateControls();
            }),
            (HorizontalLayoutSlider.prototype.updateControls = function () {
                this.updateOffset();
                var data = this.data;
                this.controls.each(function () {
                    var t = $(this),
                        state = t.hasClass("u-gallery-nav-next")
                            ? data.offset >= data.maxOffset - 1
                            : data.offset <= 0;
                    t.toggleClass("u-hidden", state);
                });
            }),
            (HorizontalLayoutSlider.prototype.updateOffset = function () {
                this.data.offset = this.viewport.scrollLeft();
            }),
            (HorizontalLayoutSlider.prototype.updateInnerData = function () {
                if (this.data && this.viewport && this.viewport[0]) {
                    (this.data.scrollWidth = this.viewport[0].scrollWidth),
                        (this.data.width = this.viewport.innerWidth());
                    var t = this.viewport.scrollLeft();
                    this.scrollToEnd(),
                        (this.data.maxOffset = this.viewport.scrollLeft()),
                        this.viewport.scrollLeft(t);
                }
            }),
            (HorizontalLayoutSlider.prototype.navigate = function (t) {
                if (!t.hasClass("u-hidden") && this.viewport) {
                    this.updateInnerData(), this.updateOffset();
                    var e = this.data.offset,
                        n = this.data.width - 50,
                        i = 0.3 * this.data.width,
                        o = this.viewport
                            .children()
                            .toArray()
                            .map(function (t) {
                                return e + Math.round($(t).position().left);
                            });
                    o.push(this.data.maxOffset + this.data.width);
                    var a = function (t) {
                        return o.reduce(function (e, n) {
                            return Math.abs(n - t) < Math.abs(e - t) ? n : e;
                        });
                    };
                    if (t.hasClass("u-gallery-nav-next")) {
                        if (
                            ((e = a(e + n) - 1),
                                this.data.scrollWidth - (e + this.data.width) < i)
                        )
                            e = this.data.maxOffset + i;
                    } else if (e > 0)
                        if ((e = a(e + this.data.width - n) - this.data.width - 1) < i)
                            e = 0;
                    this.viewport.animate(
                        { scrollLeft: e },
                        500 * (Math.abs(this.data.offset - e) / n),
                        "swing"
                    );
                }
            }),
            (HorizontalLayoutSlider.prototype.scrollToEnd = function () {
                if (this.viewport) this.viewport.scrollLeft(this.data.scrollWidth);
            }),
            (window._npHorizontalLayoutSlider = HorizontalLayoutSlider);
    },
    299: function (t, e, n) {
        "use strict";
        var i = (t.exports = function t() {
            (this.expr = null), (this.tokens = []);
        });
        (i.prototype.replace = function replace(t, e) {
            (t = t.toUpperCase()),
                (this.tokens = this.getTokens(t, e).sort(function (t, e) {
                    return e.length - t.length;
                }));
            for (var n = 0; n < this.tokens.length; n++)
                t = t
                    .split(this.tokens[n].toUpperCase())
                    .join(" " + e[this.tokens[n]] + " ");
            return (this.expr = t), this;
        }),
            (i.prototype.getTokens = function t(e, n) {
                return (
                    (e = e.toUpperCase()),
                    Object.keys(n)
                        .filter(function (t) {
                            return /^[a-zA-Z_$][\w$-]*$/.test(t);
                        })
                        .filter(function (t) {
                            return e.includes(t.toUpperCase());
                        })
                );
            });
    },
    32: function (t, e, n) {
        "use strict";
        function CountdownCommon(t) {
            this.$dom = t;
        }
        t.exports = CountdownCommon;
        var CountdownAnimate = n(273);
        (CountdownCommon.prototype.getDate = function () {
            var t = this.$dom.attr("data-target-date");
            if (t) return new Date(t);
            else return new Date();
        }),
            (CountdownCommon.prototype.getDirection = function () {
                return this.$dom.attr("data-direction") || "down";
            }),
            (CountdownCommon.prototype.getTimeLeft = function () {
                return this.$dom.attr("data-time-left") || "750m";
            }),
            (CountdownCommon.prototype.getNumber = function () {
                var t = this.$dom.attr("data-target-number") || "100";
                return parseInt(t, 10);
            }),
            (CountdownCommon.prototype.getStartTime = function () {
                var t = this.$dom.attr("data-start-time");
                if (t) return new Date(t);
                else return new Date();
            }),
            (CountdownCommon.prototype.getFrequency = function () {
                return this.$dom.attr("data-frequency") || "1s";
            }),
            (CountdownCommon.prototype.getTimerId = function () {
                return this.$dom.attr("data-timer-id");
            }),
            (CountdownCommon.prototype.getTimerKey = function () {
                return "timer-" + this.getTimerId();
            }),
            (CountdownCommon.prototype.getFor = function () {
                return this.$dom.attr("data-for") || "everyone";
            }),
            (CountdownCommon.prototype.getType = function () {
                return this.$dom.attr("data-type") || "to-date";
            }),
            (CountdownCommon.prototype.setValue = function (t, e, n, props) {
                var i = this.$dom.find(".u-countdown-" + t),
                    o = e.toString(),
                    a = o.length;
                if ("to-number" === this.getType()) {
                    for (; i.find(".u-countdown-number").length < a + 1;) {
                        var itemDom = i.find(".u-countdown-number:eq(0)");
                        if (!itemDom.length) break;
                        itemDom.clone().insertAfter(itemDom).text("0");
                    }
                    for (; i.find(".u-countdown-number").length > a + 1;)
                        i.find(".u-countdown-number:eq(0)").remove();
                }
                var s = i.find(".u-countdown-number");
                if (
                    "hours" === t ||
                    "minutes" === t ||
                    "seconds" === t ||
                    "numbers" === t
                )
                    for (; o.length < s.length;) o = "0" + o;
                if (!(a > s.length))
                    for (var u = 0; u < s.length; u++) {
                        var l = $(s[u]);
                        if (
                            (this.doSetVal(l, o[u], props),
                                n && ("years" === t || "days" === t))
                        )
                            l.toggleClass("u-hidden", u >= a);
                    }
            }),
            (CountdownCommon.prototype.doSetVal = function (t, e, props) {
                if ((props = props || {}).animation && "none" !== props.animation) {
                    var n = new CountdownAnimate(t);
                    if (n.getOldVal() !== e) n.rollNumber(e, props);
                } else if (t.text() !== e) t.text(e);
            }),
            (CountdownCommon.prototype.showLabel = function (t, e) {
                var n = this.$dom.find(".u-countdown-" + t);
                n.toggleClass("u-hidden", !e),
                    n
                        .parent()
                        .children(".u-countdown-separator")
                        .each(function (t, el) {
                            var e = $(el),
                                n = e.prev(".u-countdown-item"),
                                i = e.nextAll(".u-countdown-item:not(.u-hidden)");
                            e.toggleClass(
                                "u-hidden",
                                !(n.is(":not(.u-hidden)") && i.is(":not(.u-hidden)"))
                            );
                        });
            }),
            (CountdownCommon.prototype.setAfterCountFinished = function () {
                this.$dom.attr("data-after-count-finished", true);
            }),
            (CountdownCommon.prototype.getAfterCountFinished = function () {
                var t = this.$dom.attr("data-after-count-finished") || "false";
                return (t && "true" === t) || false;
            }),
            (CountdownCommon.prototype.getAfterCount = function () {
                return this.$dom.attr("data-after-count") || "none";
            }),
            (CountdownCommon.prototype.getRedirectUrl = function () {
                return this.$dom.attr("data-redirect-url") || "https://";
            }),
            (CountdownCommon.prototype.getCountAnimation = function () {
                return this.$dom.attr("data-count-animation") || "none";
            }),
            (CountdownCommon.prototype.timeDiff = function (t) {
                var e = new Date(),
                    n;
                if ("down" === this.getDirection())
                    return CountdownCommon.calcTimeDiff(t, e);
                else return CountdownCommon.calcTimeDiff(e, t);
            }),
            (CountdownCommon.prototype.calcNumber = function (t, e, n) {
                var i = CountdownCommon.timeStringToMilliseconds(n);
                if (!i) return 0;
                var o = new Date(),
                    a = "up" === this.getDirection() ? 1 : -1,
                    s = t + Math.floor((o - e) / i) * a;
                if (s < 0) return 0;
                else return s;
            }),
            (CountdownCommon.prototype.parseTime = function (t, e) {
                var n = CountdownCommon.timeStringToMilliseconds(t),
                    i = "down" === this.getDirection() ? 1 : -1;
                return new Date(e.getTime() + n * i);
            }),
            (CountdownCommon.calcTimeDiff = function (t, e) {
                if (t <= e) return CountdownCommon.emptyDiff();
                var n = Math.abs(t - e) / 1e3,
                    i = Math.floor(n / 31536e3);
                n -= 31536e3 * i;
                var o = Math.floor(n / 86400);
                n -= 86400 * o;
                var a = Math.floor(n / 3600) % 24;
                n -= 3600 * a;
                var s = Math.floor(n / 60) % 60,
                    u;
                return (
                    (n -= 60 * s),
                    { years: i, days: o, hours: a, minutes: s, seconds: Math.floor(n) }
                );
            }),
            (CountdownCommon.emptyDiff = function () {
                return { years: 0, days: 0, hours: 0, minutes: 0, seconds: 0 };
            }),
            (CountdownCommon.isEmptyDiff = function (diff) {
                if ("number" == typeof diff) return 0 === diff;
                else
                    return (
                        0 === diff.years &&
                        0 === diff.days &&
                        0 === diff.hours &&
                        0 === diff.minutes &&
                        0 === diff.seconds
                    );
            }),
            (CountdownCommon.timeStringToMilliseconds = function (t) {
                var data = t.match(/(\d+)(ms|s|m|h|d|)/);
                if (data && 3 === data.length) {
                    var e = parseInt(data[1], 10);
                    switch (data[2]) {
                        case "ms":
                            return e;
                        case "s":
                            return 1e3 * e;
                        case "m":
                            return 60 * e * 1e3;
                        case "h":
                            return 3600 * e * 1e3;
                        case "d":
                            return 86400 * e * 1e3;
                        default:
                            return 0;
                    }
                }
                return 0;
            });
    },
    363: function (t, e) {
        var e = void 0,
            t = void 0;
        (function () {
            /*!
             * https://github.com/gilmoreorless/css-background-parser
             * Copyright © 2015 Gilmore Davidson under the MIT license: http://gilmoreorless.mit-license.org/
             */
            !(function (t) {
                function e(t) {
                    if (!(this instanceof e)) return new e();
                    this.backgrounds = t || [];
                }
                function Background(props) {
                    function t(t, n) {
                        e[t] = t in props ? props[t] : n;
                    }
                    if (!(this instanceof Background)) return new Background(props);
                    props = props || {};
                    var e = this;
                    t("color", ""),
                        t("image", ""),
                        t("attachment", ""),
                        t("clip", ""),
                        t("origin", ""),
                        t("position", ""),
                        t("repeat", ""),
                        t("size", "");
                }
                function n(t) {
                    var e = [],
                        n = /[,\(\)]/,
                        i = 0,
                        o = "";
                    if (null == t) return e;
                    for (; t.length;) {
                        var a = n.exec(t);
                        if (!a) break;
                        var s,
                            u = false;
                        switch (a[0]) {
                            case ",":
                                if (!i) e.push(o.trim()), (o = ""), (u = true);
                                break;
                            case "(":
                                i++;
                                break;
                            case ")":
                                i--;
                                break;
                        }
                        var index = a.index + 1;
                        (o += t.slice(0, u ? index - 1 : index)), (t = t.slice(index));
                    }
                    if (o.length || t.length) e.push((o + t).trim());
                    return e.filter(function (t) {
                        return "none" !== t;
                    });
                }
                function i(t) {
                    return t.trim();
                }
                function o(t) {
                    return (t || "").split(",").map(i);
                }
                (e.prototype.toString = function t(props) {
                    return this.backgrounds
                        .map(function (t) {
                            return t.toString(props);
                        })
                        .filter(function (t) {
                            return t;
                        })
                        .join(", ");
                }),
                    (Background.prototype.toString = function t(props) {
                        props = props || [
                            "image",
                            "repeat",
                            "attachment",
                            "position",
                            "size",
                            "origin",
                            "clip",
                        ];
                        var size =
                            (props = Array.isArray(props) ? props : [props]).includes(
                                "size"
                            ) && this.size
                                ? " / " + this.size
                                : "",
                            list = [
                                props.includes("image") ? this.image : "",
                                props.includes("repeat") ? this.repeat : "",
                                props.includes("attachment") ? this.attachment : "",
                                props.includes("position") ? this.position + size : "",
                                props.includes("origin") ? this.origin : "",
                                props.includes("clip") ? this.clip : "",
                            ];
                        if (this.color) list.unshift(this.color);
                        return list
                            .filter(function (t) {
                                return t;
                            })
                            .join(" ");
                    }),
                    (t.BackgroundList = e),
                    (t.Background = Background),
                    (t.parseElementStyle = function (t) {
                        var list = new e();
                        if (null == t) return list;
                        for (
                            var i = n(t.backgroundImage),
                            a = t.backgroundColor,
                            s = o(t.backgroundAttachment),
                            u = o(t.backgroundClip),
                            l = o(t.backgroundOrigin),
                            f = o(t.backgroundPosition),
                            c = o(t.backgroundRepeat),
                            h = o(t.backgroundSize),
                            background,
                            p = 0,
                            m = i.length;
                            p < m;
                            p++
                        ) {
                            if (
                                ((background = new Background({
                                    image: i[p],
                                    attachment: s[p % s.length],
                                    clip: u[p % u.length],
                                    origin: l[p % l.length],
                                    position: f[p % f.length],
                                    repeat: c[p % c.length],
                                    size: h[p % h.length],
                                })),
                                    p === m - 1)
                            )
                                background.color = a;
                            list.backgrounds.push(background);
                        }
                        return list;
                    });
            })(
                (function (e) {
                    if (void 0 !== t && void 0 !== t.exports) return t.exports;
                    else return (e.cssBgParser = {});
                })(this)
            );
        }).call(window);
    },
    375: function (t, e, n) {
        "use strict";
        function i(t) {
            var e = t.length;
            if (e % 4 > 0)
                throw new Error("Invalid string. Length must be a multiple of 4");
            var n = t.indexOf("="),
                i;
            if (-1 === n) n = e;
            return [n, n === e ? 0 : 4 - (n % 4)];
        }
        function o(t) {
            var e = i(t),
                n = e[0],
                o = e[1];
            return (3 * (n + o)) / 4 - o;
        }
        function a(t, e, n) {
            return (3 * (e + n)) / 4 - n;
        }
        function s(t) {
            var e,
                n = i(t),
                o = n[0],
                s = n[1],
                u = new p(a(t, o, s)),
                l = 0,
                f = s > 0 ? o - 4 : o,
                c;
            for (c = 0; c < f; c += 4)
                (e =
                    (h[t.charCodeAt(c)] << 18) |
                    (h[t.charCodeAt(c + 1)] << 12) |
                    (h[t.charCodeAt(c + 2)] << 6) |
                    h[t.charCodeAt(c + 3)]),
                    (u[l++] = (e >> 16) & 255),
                    (u[l++] = (e >> 8) & 255),
                    (u[l++] = 255 & e);
            if (2 === s)
                (e = (h[t.charCodeAt(c)] << 2) | (h[t.charCodeAt(c + 1)] >> 4)),
                    (u[l++] = 255 & e);
            if (1 === s)
                (e =
                    (h[t.charCodeAt(c)] << 10) |
                    (h[t.charCodeAt(c + 1)] << 4) |
                    (h[t.charCodeAt(c + 2)] >> 2)),
                    (u[l++] = (e >> 8) & 255),
                    (u[l++] = 255 & e);
            return u;
        }
        function u(t) {
            return (
                c[(t >> 18) & 63] + c[(t >> 12) & 63] + c[(t >> 6) & 63] + c[63 & t]
            );
        }
        function l(t, e, n) {
            for (var i, o = [], a = e; a < n; a += 3)
                (i =
                    ((t[a] << 16) & 16711680) +
                    ((t[a + 1] << 8) & 65280) +
                    (255 & t[a + 2])),
                    o.push(u(i));
            return o.join("");
        }
        function f(t) {
            for (
                var e, n = t.length, i = n % 3, o = [], a = 16383, s = 0, u = n - i;
                s < u;
                s += a
            )
                o.push(l(t, s, s + a > u ? u : s + a));
            if (1 === i) (e = t[n - 1]), o.push(c[e >> 2] + c[(e << 4) & 63] + "==");
            else if (2 === i)
                (e = (t[n - 2] << 8) + t[n - 1]),
                    o.push(c[e >> 10] + c[(e >> 4) & 63] + c[(e << 2) & 63] + "=");
            return o.join("");
        }
        (e.byteLength = o), (e.toByteArray = s), (e.fromByteArray = f);
        for (
            var c = [],
            h = [],
            p = "undefined" != typeof Uint8Array ? Uint8Array : Array,
            m = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/",
            v = 0,
            g = m.length;
            v < g;
            ++v
        )
            (c[v] = m[v]), (h[m.charCodeAt(v)] = v);
        (h["-".charCodeAt(0)] = 62), (h["_".charCodeAt(0)] = 63);
    },
    376: function (t, e, n) {
        "use strict";
    /*! ieee754. BSD-3-Clause License. Feross Aboukhadijeh <https://feross.org/opensource> */ (e.read =
            function (t, e, n, i, o) {
                var a,
                    s,
                    u = 8 * o - i - 1,
                    l = (1 << u) - 1,
                    f = l >> 1,
                    c = -7,
                    h = n ? o - 1 : 0,
                    d = n ? -1 : 1,
                    p = t[e + h];
                for (
                    h += d, a = p & ((1 << -c) - 1), p >>= -c, c += u;
                    c > 0;
                    a = 256 * a + t[e + h], h += d, c -= 8
                );
                for (
                    s = a & ((1 << -c) - 1), a >>= -c, c += i;
                    c > 0;
                    s = 256 * s + t[e + h], h += d, c -= 8
                );
                if (0 === a) a = 1 - f;
                else if (a === l) return s ? NaN : (p ? -1 : 1) * (1 / 0);
                else (s += Math.pow(2, i)), (a -= f);
                return (p ? -1 : 1) * s * Math.pow(2, a - i);
            }),
            (e.write = function (t, e, n, i, o, a) {
                var s,
                    u,
                    l,
                    f = 8 * a - o - 1,
                    c = (1 << f) - 1,
                    h = c >> 1,
                    p = 23 === o ? Math.pow(2, -24) - Math.pow(2, -77) : 0,
                    m = i ? 0 : a - 1,
                    d = i ? 1 : -1,
                    v = e < 0 || (0 === e && 1 / e < 0) ? 1 : 0;
                if (((e = Math.abs(e)), isNaN(e) || e === 1 / 0))
                    (u = isNaN(e) ? 1 : 0), (s = c);
                else {
                    if (
                        ((s = Math.floor(Math.log(e) / Math.LN2)),
                            e * (l = Math.pow(2, -s)) < 1)
                    )
                        s--, (l *= 2);
                    if (s + h >= 1) e += p / l;
                    else e += p * Math.pow(2, 1 - h);
                    if (e * l >= 2) s++, (l /= 2);
                    if (s + h >= c) (u = 0), (s = c);
                    else if (s + h >= 1) (u = (e * l - 1) * Math.pow(2, o)), (s += h);
                    else (u = e * Math.pow(2, h - 1) * Math.pow(2, o)), (s = 0);
                }
                for (; o >= 8; t[n + m] = 255 & u, m += d, u /= 256, o -= 8);
                for (
                    s = (s << o) | u, f += o;
                    f > 0;
                    t[n + m] = 255 & s, m += d, s /= 256, f -= 8
                );
                t[n + m - d] |= 128 * v;
            });
    },
    377: function (t, e, n) {
        "use strict";
        var i = {}.toString;
        t.exports =
            Array.isArray ||
            function (t) {
                return "[object Array]" == i.call(t);
            };
    },
    381: function (t, e, n) {
        "use strict";
        (function (t, e) {
            !(function (t, n) {
                function i(t) {
                    if ("function" != typeof t) t = new Function("" + t);
                    for (
                        var e = new Array(arguments.length - 1), n = 0;
                        n < e.length;
                        n++
                    )
                        e[n] = arguments[n + 1];
                    var i = { callback: t, args: e };
                    return (v[m] = i), w(m), m++;
                }
                function o(t) {
                    delete v[t];
                }
                function a(t) {
                    var e = t.callback,
                        i = t.args;
                    switch (i.length) {
                        case 0:
                            e();
                            break;
                        case 1:
                            e(i[0]);
                            break;
                        case 2:
                            e(i[0], i[1]);
                            break;
                        case 3:
                            e(i[0], i[1], i[2]);
                            break;
                        default:
                            e.apply(n, i);
                            break;
                    }
                }
                function s(t) {
                    if (g) setTimeout(s, 0, t);
                    else {
                        var e = v[t];
                        if (e) {
                            g = true;
                            try {
                                a(e);
                            } finally {
                                o(t), (g = false);
                            }
                        }
                    }
                }
                function u() {
                    w = function (t) {
                        e.nextTick(function () {
                            s(t);
                        });
                    };
                }
                function l() {
                    if (t.postMessage && !t.importScripts) {
                        var e = true,
                            n = t.onmessage;
                        return (
                            (t.onmessage = function () {
                                e = false;
                            }),
                            t.postMessage("", "*"),
                            (t.onmessage = n),
                            e
                        );
                    }
                }
                function f() {
                    var e = "setImmediate$" + Math.random() + "$",
                        n = function (n) {
                            if (
                                n.source === t &&
                                "string" == typeof n.data &&
                                0 === n.data.indexOf(e)
                            )
                                s(+n.data.slice(e.length));
                        };
                    if (t.addEventListener) t.addEventListener("message", n, false);
                    else t.attachEvent("onmessage", n);
                    w = function (n) {
                        t.postMessage(e + n, "*");
                    };
                }
                function c() {
                    var t = new MessageChannel();
                    (t.port1.onmessage = function (t) {
                        var e;
                        s(t.data);
                    }),
                        (w = function (e) {
                            t.port2.postMessage(e);
                        });
                }
                function h() {
                    var t = y.documentElement;
                    w = function (e) {
                        var n = y.createElement("script");
                        (n.onreadystatechange = function () {
                            s(e), (n.onreadystatechange = null), t.removeChild(n), (n = null);
                        }),
                            t.appendChild(n);
                    };
                }
                function p() {
                    w = function (t) {
                        setTimeout(s, 0, t);
                    };
                }
                if (!t.setImmediate) {
                    var m = 1,
                        v = {},
                        g = false,
                        y = t.document,
                        w,
                        b = Object.getPrototypeOf && Object.getPrototypeOf(t);
                    if (
                        ((b = b && b.setTimeout ? b : t),
                            "[object process]" === {}.toString.call(t.process))
                    )
                        u();
                    else if (l()) f();
                    else if (t.MessageChannel) c();
                    else if (y && "onreadystatechange" in y.createElement("script")) h();
                    else p();
                    (b.setImmediate = i), (b.clearImmediate = o);
                }
            })("undefined" == typeof self ? (void 0 === t ? this : t) : self);
        }).call(e, n(41), n(86));
    },
    382: function (t, e, n) {
        "use strict";
        (function (e) {
            function n(input, t) {
                var e = 0,
                    base = t.length,
                    n = t.charAt(0),
                    i = [0];
                for (e = 0; e < input.length(); ++e) {
                    for (var o = 0, a = input.at(e); o < i.length; ++o)
                        (a += i[o] << 8), (i[o] = a % base), (a = (a / base) | 0);
                    for (; a > 0;) i.push(a % base), (a = (a / base) | 0);
                }
                var s = "";
                for (e = 0; 0 === input.at(e) && e < input.length() - 1; ++e) s += n;
                for (e = i.length - 1; e >= 0; --e) s += t[i[e]];
                return s;
            }
            var i = {};
            t.exports = i;
            var o = {};
            (i.encode = function (input, t, e) {
                if ("string" != typeof t)
                    throw new TypeError('"alphabet" must be a string.');
                if (void 0 !== e && "number" != typeof e)
                    throw new TypeError('"maxline" must be a number.');
                var i = "";
                if (!(input instanceof Uint8Array)) i = n(input, t);
                else {
                    var o = 0,
                        base = t.length,
                        a = t.charAt(0),
                        s = [0];
                    for (o = 0; o < input.length; ++o) {
                        for (var u = 0, l = input[o]; u < s.length; ++u)
                            (l += s[u] << 8), (s[u] = l % base), (l = (l / base) | 0);
                        for (; l > 0;) s.push(l % base), (l = (l / base) | 0);
                    }
                    for (o = 0; 0 === input[o] && o < input.length - 1; ++o) i += a;
                    for (o = s.length - 1; o >= 0; --o) i += t[s[o]];
                }
                if (e) {
                    var f = new RegExp(".{1," + e + "}", "g");
                    i = i.match(f).join("\r\n");
                }
                return i;
            }),
                (i.decode = function (input, t) {
                    if ("string" != typeof input)
                        throw new TypeError('"input" must be a string.');
                    if ("string" != typeof t)
                        throw new TypeError('"alphabet" must be a string.');
                    var table = o[t];
                    if (!table) {
                        table = o[t] = [];
                        for (var n = 0; n < t.length; ++n) table[t.charCodeAt(n)] = n;
                    }
                    input = input.replace(/\s/g, "");
                    for (
                        var base = t.length, i = t.charAt(0), a = [0], n = 0;
                        n < input.length;
                        n++
                    ) {
                        var s = table[input.charCodeAt(n)];
                        if (void 0 === s) return;
                        for (var u = 0, l = s; u < a.length; ++u)
                            (l += a[u] * base), (a[u] = 255 & l), (l >>= 8);
                        for (; l > 0;) a.push(255 & l), (l >>= 8);
                    }
                    for (var f = 0; input[f] === i && f < input.length - 1; ++f)
                        a.push(0);
                    if (void 0 !== e) return e.from(a.reverse());
                    else return new Uint8Array(a.reverse());
                });
        }).call(e, n(42).Buffer);
    },
    41: function (t, e, n) {
        "use strict";
        var i;
        i = (function () {
            return this;
        })();
        try {
            i = i || Function("return this")() || (1, eval)("this");
        } catch (t) {
            if ("object" == typeof window) i = window;
        }
        t.exports = i;
    },
    42: function (t, e, n) {
        "use strict";
        (function (t) {
            function i() {
                try {
                    var t = new Uint8Array(1);
                    return (
                        (t.__proto__ = {
                            __proto__: Uint8Array.prototype,
                            foo: function () {
                                return 42;
                            },
                        }),
                        42 === t.foo() &&
                        "function" == typeof t.subarray &&
                        0 === t.subarray(1, 1).byteLength
                    );
                } catch (t) {
                    return false;
                }
            }
            function o() {
                return s.TYPED_ARRAY_SUPPORT ? 2147483647 : 1073741823;
            }
            function a(t, length) {
                if (o() < length) throw new RangeError("Invalid typed array length");
                if (s.TYPED_ARRAY_SUPPORT)
                    (t = new Uint8Array(length)).__proto__ = s.prototype;
                else {
                    if (null === t) t = new s(length);
                    t.length = length;
                }
                return t;
            }
            function s(t, e, length) {
                if (!(s.TYPED_ARRAY_SUPPORT || this instanceof s))
                    return new s(t, e, length);
                if ("number" == typeof t) {
                    if ("string" == typeof e)
                        throw new Error(
                            "If encoding is specified then the first argument must be a string"
                        );
                    return c(this, t);
                }
                return u(this, t, e, length);
            }
            function u(t, e, n, length) {
                if ("number" == typeof e)
                    throw new TypeError('"value" argument must not be a number');
                if ("undefined" != typeof ArrayBuffer && e instanceof ArrayBuffer)
                    return m(t, e, n, length);
                if ("string" == typeof e) return h(t, e, n);
                else return v(t, e);
            }
            function l(size) {
                if ("number" != typeof size)
                    throw new TypeError('"size" argument must be a number');
                else if (size < 0)
                    throw new RangeError('"size" argument must not be negative');
            }
            function f(t, size, e, n) {
                if ((l(size), size <= 0)) return a(t, size);
                if (void 0 !== e)
                    return "string" == typeof n
                        ? a(t, size).fill(e, n)
                        : a(t, size).fill(e);
                else return a(t, size);
            }
            function c(t, size) {
                if (
                    (l(size),
                        (t = a(t, size < 0 ? 0 : 0 | g(size))),
                        !s.TYPED_ARRAY_SUPPORT)
                )
                    for (var e = 0; e < size; ++e) t[e] = 0;
                return t;
            }
            function h(t, e, n) {
                if ("string" != typeof n || "" === n) n = "utf8";
                if (!s.isEncoding(n))
                    throw new TypeError('"encoding" must be a valid string encoding');
                var length = 0 | w(e, n),
                    i = (t = a(t, length)).write(e, n);
                if (i !== length) t = t.slice(0, i);
                return t;
            }
            function p(t, e) {
                var length = e.length < 0 ? 0 : 0 | g(e.length);
                t = a(t, length);
                for (var n = 0; n < length; n += 1) t[n] = 255 & e[n];
                return t;
            }
            function m(t, e, n, length) {
                if ((e.byteLength, n < 0 || e.byteLength < n))
                    throw new RangeError("'offset' is out of bounds");
                if (e.byteLength < n + (length || 0))
                    throw new RangeError("'length' is out of bounds");
                if (void 0 === n && void 0 === length) e = new Uint8Array(e);
                else if (void 0 === length) e = new Uint8Array(e, n);
                else e = new Uint8Array(e, n, length);
                if (s.TYPED_ARRAY_SUPPORT) (t = e).__proto__ = s.prototype;
                else t = p(t, e);
                return t;
            }
            function v(t, e) {
                if (s.isBuffer(e)) {
                    var n = 0 | g(e.length);
                    if (0 === (t = a(t, n)).length) return t;
                    else return e.copy(t, 0, 0, n), t;
                }
                if (e) {
                    if (
                        ("undefined" != typeof ArrayBuffer &&
                            e.buffer instanceof ArrayBuffer) ||
                        "length" in e
                    )
                        if ("number" != typeof e.length || rt(e.length)) return a(t, 0);
                        else return p(t, e);
                    if ("Buffer" === e.type && st(e.data)) return p(t, e.data);
                }
                throw new TypeError(
                    "First argument must be a string, Buffer, ArrayBuffer, Array, or array-like object."
                );
            }
            function g(length) {
                if (length >= o())
                    throw new RangeError(
                        "Attempt to allocate Buffer larger than maximum " +
                        "size: 0x" +
                        o().toString(16) +
                        " bytes"
                    );
                return 0 | length;
            }
            function y(length) {
                if (+length != length) length = 0;
                return s.alloc(+length);
            }
            function w(t, e) {
                if (s.isBuffer(t)) return t.length;
                if (
                    "undefined" != typeof ArrayBuffer &&
                    "function" == typeof ArrayBuffer.isView &&
                    (ArrayBuffer.isView(t) || t instanceof ArrayBuffer)
                )
                    return t.byteLength;
                if ("string" != typeof t) t = "" + t;
                var n = t.length;
                if (0 === n) return 0;
                for (var i = false; ;)
                    switch (e) {
                        case "ascii":
                        case "latin1":
                        case "binary":
                            return n;
                        case "utf8":
                        case "utf-8":
                        case void 0:
                            return X(t).length;
                        case "ucs2":
                        case "ucs-2":
                        case "utf16le":
                        case "utf-16le":
                            return 2 * n;
                        case "hex":
                            return n >>> 1;
                        case "base64":
                            return tt(t).length;
                        default:
                            if (i) return X(t).length;
                            (e = ("" + e).toLowerCase()), (i = true);
                    }
            }
            function b(t, e, n) {
                var i = false;
                if (void 0 === e || e < 0) e = 0;
                if (e > this.length) return "";
                if (void 0 === n || n > this.length) n = this.length;
                if (n <= 0) return "";
                if ((n >>>= 0) <= (e >>>= 0)) return "";
                if (!t) t = "utf8";
                for (; true;)
                    switch (t) {
                        case "hex":
                            return F(this, e, n);
                        case "utf8":
                        case "utf-8":
                            return L(this, e, n);
                        case "ascii":
                            return O(this, e, n);
                        case "latin1":
                        case "binary":
                            return P(this, e, n);
                        case "base64":
                            return M(this, e, n);
                        case "ucs2":
                        case "ucs-2":
                        case "utf16le":
                        case "utf-16le":
                            return N(this, e, n);
                        default:
                            if (i) throw new TypeError("Unknown encoding: " + t);
                            (t = (t + "").toLowerCase()), (i = true);
                    }
            }
            function C(t, e, n) {
                var i = t[e];
                (t[e] = t[n]), (t[n] = i);
            }
            function x(t, e, n, i, o) {
                if (0 === t.length) return -1;
                if ("string" == typeof n) (i = n), (n = 0);
                else if (n > 2147483647) n = 2147483647;
                else if (n < -2147483648) n = -2147483648;
                if (((n = +n), isNaN(n))) n = o ? 0 : t.length - 1;
                if (n < 0) n = t.length + n;
                if (n >= t.length)
                    if (o) return -1;
                    else n = t.length - 1;
                else if (n < 0)
                    if (o) n = 0;
                    else return -1;
                if ("string" == typeof e) e = s.from(e, i);
                if (s.isBuffer(e))
                    if (0 === e.length) return -1;
                    else return S(t, e, n, i, o);
                else if ("number" == typeof e) {
                    if (
                        ((e &= 255),
                            s.TYPED_ARRAY_SUPPORT &&
                            "function" == typeof Uint8Array.prototype.indexOf)
                    )
                        if (o) return Uint8Array.prototype.indexOf.call(t, e, n);
                        else return Uint8Array.prototype.lastIndexOf.call(t, e, n);
                    return S(t, [e], n, i, o);
                }
                throw new TypeError("val must be string, number or Buffer");
            }
            function S(t, e, n, i, o) {
                function a(t, e) {
                    if (1 === s) return t[e];
                    else return t.readUInt16BE(e * s);
                }
                var s = 1,
                    u = t.length,
                    l = e.length,
                    f;
                if (void 0 !== i)
                    if (
                        "ucs2" === (i = String(i).toLowerCase()) ||
                        "ucs-2" === i ||
                        "utf16le" === i ||
                        "utf-16le" === i
                    ) {
                        if (t.length < 2 || e.length < 2) return -1;
                        (s = 2), (u /= 2), (l /= 2), (n /= 2);
                    }
                if (o) {
                    var c = -1;
                    for (f = n; f < u; f++)
                        if (a(t, f) === a(e, -1 === c ? 0 : f - c)) {
                            if (-1 === c) c = f;
                            if (f - c + 1 === l) return c * s;
                        } else {
                            if (-1 !== c) f -= f - c;
                            c = -1;
                        }
                } else {
                    if (n + l > u) n = u - l;
                    for (f = n; f >= 0; f--) {
                        for (var h = true, p = 0; p < l; p++)
                            if (a(t, f + p) !== a(e, p)) {
                                h = false;
                                break;
                            }
                        if (h) return f;
                    }
                }
                return -1;
            }
            function A(t, e, n, length) {
                n = Number(n) || 0;
                var i = t.length - n;
                if (!length) length = i;
                else if ((length = Number(length)) > i) length = i;
                var o = e.length;
                if (o % 2 != 0) throw new TypeError("Invalid hex string");
                if (length > o / 2) length = o / 2;
                for (var a = 0; a < length; ++a) {
                    var s = parseInt(e.substr(2 * a, 2), 16);
                    if (isNaN(s)) return a;
                    t[n + a] = s;
                }
                return a;
            }
            function _(t, e, n, length) {
                return nt(X(e, t.length - n), t, n, length);
            }
            function T(t, e, n, length) {
                return nt(K(e), t, n, length);
            }
            function I(t, e, n, length) {
                return T(t, e, n, length);
            }
            function E(t, e, n, length) {
                return nt(tt(e), t, n, length);
            }
            function k(t, e, n, length) {
                return nt(J(e, t.length - n), t, n, length);
            }
            function M(t, e, n) {
                if (0 === e && n === t.length) return ot.fromByteArray(t);
                else return ot.fromByteArray(t.slice(e, n));
            }
            function L(t, e, n) {
                n = Math.min(t.length, n);
                for (var i = [], o = e; o < n;) {
                    var a = t[o],
                        s = null,
                        u = a > 239 ? 4 : a > 223 ? 3 : a > 191 ? 2 : 1;
                    if (o + u <= n) {
                        var l, f, c, h;
                        switch (u) {
                            case 1:
                                if (a < 128) s = a;
                                break;
                            case 2:
                                if (128 == (192 & (l = t[o + 1])))
                                    if ((h = ((31 & a) << 6) | (63 & l)) > 127) s = h;
                                break;
                            case 3:
                                if (
                                    ((l = t[o + 1]),
                                        (f = t[o + 2]),
                                        128 == (192 & l) && 128 == (192 & f))
                                )
                                    if (
                                        (h = ((15 & a) << 12) | ((63 & l) << 6) | (63 & f)) >
                                        2047 &&
                                        (h < 55296 || h > 57343)
                                    )
                                        s = h;
                                break;
                            case 4:
                                if (
                                    ((l = t[o + 1]),
                                        (f = t[o + 2]),
                                        (c = t[o + 3]),
                                        128 == (192 & l) && 128 == (192 & f) && 128 == (192 & c))
                                )
                                    if (
                                        (h =
                                            ((15 & a) << 18) |
                                            ((63 & l) << 12) |
                                            ((63 & f) << 6) |
                                            (63 & c)) > 65535 &&
                                        h < 1114112
                                    )
                                        s = h;
                        }
                    }
                    if (null === s) (s = 65533), (u = 1);
                    else if (s > 65535)
                        (s -= 65536),
                            i.push(((s >>> 10) & 1023) | 55296),
                            (s = 56320 | (1023 & s));
                    i.push(s), (o += u);
                }
                return B(i);
            }
            function B(t) {
                var e = t.length;
                if (e <= ut) return String.fromCharCode.apply(String, t);
                for (var n = "", i = 0; i < e;)
                    n += String.fromCharCode.apply(String, t.slice(i, (i += ut)));
                return n;
            }
            function O(t, e, n) {
                var i = "";
                n = Math.min(t.length, n);
                for (var o = e; o < n; ++o) i += String.fromCharCode(127 & t[o]);
                return i;
            }
            function P(t, e, n) {
                var i = "";
                n = Math.min(t.length, n);
                for (var o = e; o < n; ++o) i += String.fromCharCode(t[o]);
                return i;
            }
            function F(t, e, n) {
                var i = t.length;
                if (!e || e < 0) e = 0;
                if (!n || n < 0 || n > i) n = i;
                for (var o = "", a = e; a < n; ++a) o += Z(t[a]);
                return o;
            }
            function N(t, e, n) {
                for (var i = t.slice(e, n), o = "", a = 0; a < i.length; a += 2)
                    o += String.fromCharCode(i[a] + 256 * i[a + 1]);
                return o;
            }
            function z(t, e, length) {
                if (t % 1 != 0 || t < 0) throw new RangeError("offset is not uint");
                if (t + e > length)
                    throw new RangeError("Trying to access beyond buffer length");
            }
            function U(t, e, n, i, o, a) {
                if (!s.isBuffer(t))
                    throw new TypeError('"buffer" argument must be a Buffer instance');
                if (e > o || e < a)
                    throw new RangeError('"value" argument is out of bounds');
                if (n + i > t.length) throw new RangeError("Index out of range");
            }
            function H(t, e, n, i) {
                if (e < 0) e = 65535 + e + 1;
                for (var o = 0, a = Math.min(t.length - n, 2); o < a; ++o)
                    t[n + o] =
                        (e & (255 << (8 * (i ? o : 1 - o)))) >>> (8 * (i ? o : 1 - o));
            }
            function $(t, e, n, i) {
                if (e < 0) e = 4294967295 + e + 1;
                for (var o = 0, a = Math.min(t.length - n, 4); o < a; ++o)
                    t[n + o] = (e >>> (8 * (i ? o : 3 - o))) & 255;
            }
            function V(t, e, n, i, o, a) {
                if (n + i > t.length) throw new RangeError("Index out of range");
                if (n < 0) throw new RangeError("Index out of range");
            }
            function Y(t, e, n, i, o) {
                if (!o) V(t, e, n, 4, 34028234663852886e22, -34028234663852886e22);
                return at.write(t, e, n, i, 23, 4), n + 4;
            }
            function W(t, e, n, i, o) {
                if (!o) V(t, e, n, 8, 17976931348623157e292, -17976931348623157e292);
                return at.write(t, e, n, i, 52, 8), n + 8;
            }
            function j(t) {
                if ((t = G(t).replace(lt, "")).length < 2) return "";
                for (; t.length % 4 != 0;) t += "=";
                return t;
            }
            function G(t) {
                if (t.trim) return t.trim();
                else return t.replace(/^\s+|\s+$/g, "");
            }
            function Z(t) {
                if (t < 16) return "0" + t.toString(16);
                else return t.toString(16);
            }
            function X(t, e) {
                var n;
                e = e || 1 / 0;
                for (var length = t.length, i = null, o = [], a = 0; a < length; ++a) {
                    if ((n = t.charCodeAt(a)) > 55295 && n < 57344) {
                        if (!i) {
                            if (n > 56319) {
                                if ((e -= 3) > -1) o.push(239, 191, 189);
                                continue;
                            } else if (a + 1 === length) {
                                if ((e -= 3) > -1) o.push(239, 191, 189);
                                continue;
                            }
                            i = n;
                            continue;
                        }
                        if (n < 56320) {
                            if ((e -= 3) > -1) o.push(239, 191, 189);
                            i = n;
                            continue;
                        }
                        n = (((i - 55296) << 10) | (n - 56320)) + 65536;
                    } else if (i) if ((e -= 3) > -1) o.push(239, 191, 189);
                    if (((i = null), n < 128)) {
                        if ((e -= 1) < 0) break;
                        o.push(n);
                    } else if (n < 2048) {
                        if ((e -= 2) < 0) break;
                        o.push((n >> 6) | 192, (63 & n) | 128);
                    } else if (n < 65536) {
                        if ((e -= 3) < 0) break;
                        o.push((n >> 12) | 224, ((n >> 6) & 63) | 128, (63 & n) | 128);
                    } else if (n < 1114112) {
                        if ((e -= 4) < 0) break;
                        o.push(
                            (n >> 18) | 240,
                            ((n >> 12) & 63) | 128,
                            ((n >> 6) & 63) | 128,
                            (63 & n) | 128
                        );
                    } else throw new Error("Invalid code point");
                }
                return o;
            }
            function K(t) {
                for (var e = [], n = 0; n < t.length; ++n)
                    e.push(255 & t.charCodeAt(n));
                return e;
            }
            function J(t, e) {
                for (var n, i, o, a = [], s = 0; s < t.length && !((e -= 2) < 0); ++s)
                    (i = (n = t.charCodeAt(s)) >> 8), (o = n % 256), a.push(o), a.push(i);
                return a;
            }
            function tt(t) {
                return ot.toByteArray(j(t));
            }
            function nt(t, e, n, length) {
                for (
                    var i = 0;
                    i < length && !(i + n >= e.length || i >= t.length);
                    ++i
                )
                    e[i + n] = t[i];
                return i;
            }
            function rt(t) {
                return t != t;
            }
            var ot = n(375),
                at = n(376),
                st = n(377);
            if (
                ((e.Buffer = s),
                    (e.SlowBuffer = y),
                    (e.INSPECT_MAX_BYTES = 50),
                    (s.TYPED_ARRAY_SUPPORT =
                        void 0 !== t.TYPED_ARRAY_SUPPORT ? t.TYPED_ARRAY_SUPPORT : i()),
                    (e.kMaxLength = o()),
                    (s.poolSize = 8192),
                    (s._augment = function (t) {
                        return (t.__proto__ = s.prototype), t;
                    }),
                    (s.from = function (t, e, length) {
                        return u(null, t, e, length);
                    }),
                    s.TYPED_ARRAY_SUPPORT)
            )
                if (
                    ((s.prototype.__proto__ = Uint8Array.prototype),
                        (s.__proto__ = Uint8Array),
                        "undefined" != typeof Symbol &&
                        Symbol.species &&
                        s[Symbol.species] === s)
                )
                    Object.defineProperty(s, Symbol.species, {
                        value: null,
                        configurable: true,
                    });
            (s.alloc = function (size, t, e) {
                return f(null, size, t, e);
            }),
                (s.allocUnsafe = function (size) {
                    return c(null, size);
                }),
                (s.allocUnsafeSlow = function (size) {
                    return c(null, size);
                }),
                (s.isBuffer = function t(e) {
                    return !!(null != e && e._isBuffer);
                }),
                (s.compare = function compare(t, e) {
                    if (!s.isBuffer(t) || !s.isBuffer(e))
                        throw new TypeError("Arguments must be Buffers");
                    if (t === e) return 0;
                    for (
                        var n = t.length, i = e.length, o = 0, a = Math.min(n, i);
                        o < a;
                        ++o
                    )
                        if (t[o] !== e[o]) {
                            (n = t[o]), (i = e[o]);
                            break;
                        }
                    if (n < i) return -1;
                    if (i < n) return 1;
                    else return 0;
                }),
                (s.isEncoding = function t(e) {
                    switch (String(e).toLowerCase()) {
                        case "hex":
                        case "utf8":
                        case "utf-8":
                        case "ascii":
                        case "latin1":
                        case "binary":
                        case "base64":
                        case "ucs2":
                        case "ucs-2":
                        case "utf16le":
                        case "utf-16le":
                            return true;
                        default:
                            return false;
                    }
                }),
                (s.concat = function t(list, length) {
                    if (!st(list))
                        throw new TypeError('"list" argument must be an Array of Buffers');
                    if (0 === list.length) return s.alloc(0);
                    var e;
                    if (void 0 === length)
                        for (length = 0, e = 0; e < list.length; ++e)
                            length += list[e].length;
                    var n = s.allocUnsafe(length),
                        i = 0;
                    for (e = 0; e < list.length; ++e) {
                        var o = list[e];
                        if (!s.isBuffer(o))
                            throw new TypeError(
                                '"list" argument must be an Array of Buffers'
                            );
                        o.copy(n, i), (i += o.length);
                    }
                    return n;
                }),
                (s.byteLength = w),
                (s.prototype._isBuffer = true),
                (s.prototype.swap16 = function t() {
                    var e = this.length;
                    if (e % 2 != 0)
                        throw new RangeError("Buffer size must be a multiple of 16-bits");
                    for (var n = 0; n < e; n += 2) C(this, n, n + 1);
                    return this;
                }),
                (s.prototype.swap32 = function t() {
                    var e = this.length;
                    if (e % 4 != 0)
                        throw new RangeError("Buffer size must be a multiple of 32-bits");
                    for (var n = 0; n < e; n += 4)
                        C(this, n, n + 3), C(this, n + 1, n + 2);
                    return this;
                }),
                (s.prototype.swap64 = function t() {
                    var e = this.length;
                    if (e % 8 != 0)
                        throw new RangeError("Buffer size must be a multiple of 64-bits");
                    for (var n = 0; n < e; n += 8)
                        C(this, n, n + 7),
                            C(this, n + 1, n + 6),
                            C(this, n + 2, n + 5),
                            C(this, n + 3, n + 4);
                    return this;
                }),
                (s.prototype.toString = function t() {
                    var length = 0 | this.length;
                    if (0 === length) return "";
                    if (0 === arguments.length) return L(this, 0, length);
                    else return b.apply(this, arguments);
                }),
                (s.prototype.equals = function t(e) {
                    if (!s.isBuffer(e)) throw new TypeError("Argument must be a Buffer");
                    if (this === e) return true;
                    else return 0 === s.compare(this, e);
                }),
                (s.prototype.inspect = function t() {
                    var n = "",
                        i = e.INSPECT_MAX_BYTES;
                    if (this.length > 0)
                        if (
                            ((n = this.toString("hex", 0, i).match(/.{2}/g).join(" ")),
                                this.length > i)
                        )
                            n += " ... ";
                    return "<Buffer " + n + ">";
                }),
                (s.prototype.compare = function compare(t, e, n, i, o) {
                    if (!s.isBuffer(t)) throw new TypeError("Argument must be a Buffer");
                    if (void 0 === e) e = 0;
                    if (void 0 === n) n = t ? t.length : 0;
                    if (void 0 === i) i = 0;
                    if (void 0 === o) o = this.length;
                    if (e < 0 || n > t.length || i < 0 || o > this.length)
                        throw new RangeError("out of range index");
                    if (i >= o && e >= n) return 0;
                    if (i >= o) return -1;
                    if (e >= n) return 1;
                    if (this === t) return 0;
                    for (
                        var a = (o >>>= 0) - (i >>>= 0),
                        u = (n >>>= 0) - (e >>>= 0),
                        l = Math.min(a, u),
                        f = this.slice(i, o),
                        c = t.slice(e, n),
                        h = 0;
                        h < l;
                        ++h
                    )
                        if (f[h] !== c[h]) {
                            (a = f[h]), (u = c[h]);
                            break;
                        }
                    if (a < u) return -1;
                    if (u < a) return 1;
                    else return 0;
                }),
                (s.prototype.includes = function t(e, n, i) {
                    return -1 !== this.indexOf(e, n, i);
                }),
                (s.prototype.indexOf = function t(e, n, i) {
                    return x(this, e, n, i, true);
                }),
                (s.prototype.lastIndexOf = function t(e, n, i) {
                    return x(this, e, n, i, false);
                }),
                (s.prototype.write = function t(e, n, length, i) {
                    if (void 0 === n) (i = "utf8"), (length = this.length), (n = 0);
                    else if (void 0 === length && "string" == typeof n)
                        (i = n), (length = this.length), (n = 0);
                    else if (isFinite(n))
                        if (((n |= 0), isFinite(length))) {
                            if (((length |= 0), void 0 === i)) i = "utf8";
                        } else (i = length), (length = void 0);
                    else
                        throw new Error(
                            "Buffer.write(string, encoding, offset[, length]) is no longer supported"
                        );
                    var o = this.length - n;
                    if (void 0 === length || length > o) length = o;
                    if ((e.length > 0 && (length < 0 || n < 0)) || n > this.length)
                        throw new RangeError("Attempt to write outside buffer bounds");
                    if (!i) i = "utf8";
                    for (var a = false; ;)
                        switch (i) {
                            case "hex":
                                return A(this, e, n, length);
                            case "utf8":
                            case "utf-8":
                                return _(this, e, n, length);
                            case "ascii":
                                return T(this, e, n, length);
                            case "latin1":
                            case "binary":
                                return I(this, e, n, length);
                            case "base64":
                                return E(this, e, n, length);
                            case "ucs2":
                            case "ucs-2":
                            case "utf16le":
                            case "utf-16le":
                                return k(this, e, n, length);
                            default:
                                if (a) throw new TypeError("Unknown encoding: " + i);
                                (i = ("" + i).toLowerCase()), (a = true);
                        }
                }),
                (s.prototype.toJSON = function t() {
                    return {
                        type: "Buffer",
                        data: Array.prototype.slice.call(this._arr || this, 0),
                    };
                });
            var ut = 4096;
            (s.prototype.slice = function t(e, n) {
                var i = this.length,
                    o;
                if ((e = ~~e) < 0) {
                    if ((e += i) < 0) e = 0;
                } else if (e > i) e = i;
                if ((n = void 0 === n ? i : ~~n) < 0) {
                    if ((n += i) < 0) n = 0;
                } else if (n > i) n = i;
                if (n < e) n = e;
                if (s.TYPED_ARRAY_SUPPORT)
                    (o = this.subarray(e, n)).__proto__ = s.prototype;
                else {
                    var a = n - e;
                    o = new s(a, void 0);
                    for (var u = 0; u < a; ++u) o[u] = this[u + e];
                }
                return o;
            }),
                (s.prototype.readUIntLE = function t(e, n, i) {
                    if (((e |= 0), (n |= 0), !i)) z(e, n, this.length);
                    for (var o = this[e], a = 1, s = 0; ++s < n && (a *= 256);)
                        o += this[e + s] * a;
                    return o;
                }),
                (s.prototype.readUIntBE = function t(e, n, i) {
                    if (((e |= 0), (n |= 0), !i)) z(e, n, this.length);
                    for (var o = this[e + --n], a = 1; n > 0 && (a *= 256);)
                        o += this[e + --n] * a;
                    return o;
                }),
                (s.prototype.readUInt8 = function t(e, n) {
                    if (!n) z(e, 1, this.length);
                    return this[e];
                }),
                (s.prototype.readUInt16LE = function t(e, n) {
                    if (!n) z(e, 2, this.length);
                    return this[e] | (this[e + 1] << 8);
                }),
                (s.prototype.readUInt16BE = function t(e, n) {
                    if (!n) z(e, 2, this.length);
                    return (this[e] << 8) | this[e + 1];
                }),
                (s.prototype.readUInt32LE = function t(e, n) {
                    if (!n) z(e, 4, this.length);
                    return (
                        (this[e] | (this[e + 1] << 8) | (this[e + 2] << 16)) +
                        16777216 * this[e + 3]
                    );
                }),
                (s.prototype.readUInt32BE = function t(e, n) {
                    if (!n) z(e, 4, this.length);
                    return (
                        16777216 * this[e] +
                        ((this[e + 1] << 16) | (this[e + 2] << 8) | this[e + 3])
                    );
                }),
                (s.prototype.readIntLE = function t(e, n, i) {
                    if (((e |= 0), (n |= 0), !i)) z(e, n, this.length);
                    for (var o = this[e], a = 1, s = 0; ++s < n && (a *= 256);)
                        o += this[e + s] * a;
                    if (o >= (a *= 128)) o -= Math.pow(2, 8 * n);
                    return o;
                }),
                (s.prototype.readIntBE = function t(e, n, i) {
                    if (((e |= 0), (n |= 0), !i)) z(e, n, this.length);
                    for (var o = n, a = 1, s = this[e + --o]; o > 0 && (a *= 256);)
                        s += this[e + --o] * a;
                    if (s >= (a *= 128)) s -= Math.pow(2, 8 * n);
                    return s;
                }),
                (s.prototype.readInt8 = function t(e, n) {
                    if (!n) z(e, 1, this.length);
                    if (!(128 & this[e])) return this[e];
                    else return -1 * (255 - this[e] + 1);
                }),
                (s.prototype.readInt16LE = function t(e, n) {
                    if (!n) z(e, 2, this.length);
                    var i = this[e] | (this[e + 1] << 8);
                    return 32768 & i ? 4294901760 | i : i;
                }),
                (s.prototype.readInt16BE = function t(e, n) {
                    if (!n) z(e, 2, this.length);
                    var i = this[e + 1] | (this[e] << 8);
                    return 32768 & i ? 4294901760 | i : i;
                }),
                (s.prototype.readInt32LE = function t(e, n) {
                    if (!n) z(e, 4, this.length);
                    return (
                        this[e] |
                        (this[e + 1] << 8) |
                        (this[e + 2] << 16) |
                        (this[e + 3] << 24)
                    );
                }),
                (s.prototype.readInt32BE = function t(e, n) {
                    if (!n) z(e, 4, this.length);
                    return (
                        (this[e] << 24) |
                        (this[e + 1] << 16) |
                        (this[e + 2] << 8) |
                        this[e + 3]
                    );
                }),
                (s.prototype.readFloatLE = function t(e, n) {
                    if (!n) z(e, 4, this.length);
                    return at.read(this, e, true, 23, 4);
                }),
                (s.prototype.readFloatBE = function t(e, n) {
                    if (!n) z(e, 4, this.length);
                    return at.read(this, e, false, 23, 4);
                }),
                (s.prototype.readDoubleLE = function t(e, n) {
                    if (!n) z(e, 8, this.length);
                    return at.read(this, e, true, 52, 8);
                }),
                (s.prototype.readDoubleBE = function t(e, n) {
                    if (!n) z(e, 8, this.length);
                    return at.read(this, e, false, 52, 8);
                }),
                (s.prototype.writeUIntLE = function t(e, n, i, o) {
                    if (((e = +e), (n |= 0), (i |= 0), !o)) {
                        var a;
                        U(this, e, n, i, Math.pow(2, 8 * i) - 1, 0);
                    }
                    var s = 1,
                        u = 0;
                    for (this[n] = 255 & e; ++u < i && (s *= 256);)
                        this[n + u] = (e / s) & 255;
                    return n + i;
                }),
                (s.prototype.writeUIntBE = function t(e, n, i, o) {
                    if (((e = +e), (n |= 0), (i |= 0), !o)) {
                        var a;
                        U(this, e, n, i, Math.pow(2, 8 * i) - 1, 0);
                    }
                    var s = i - 1,
                        u = 1;
                    for (this[n + s] = 255 & e; --s >= 0 && (u *= 256);)
                        this[n + s] = (e / u) & 255;
                    return n + i;
                }),
                (s.prototype.writeUInt8 = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i)) U(this, e, n, 1, 255, 0);
                    if (!s.TYPED_ARRAY_SUPPORT) e = Math.floor(e);
                    return (this[n] = 255 & e), n + 1;
                }),
                (s.prototype.writeUInt16LE = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i)) U(this, e, n, 2, 65535, 0);
                    if (s.TYPED_ARRAY_SUPPORT)
                        (this[n] = 255 & e), (this[n + 1] = e >>> 8);
                    else H(this, e, n, true);
                    return n + 2;
                }),
                (s.prototype.writeUInt16BE = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i)) U(this, e, n, 2, 65535, 0);
                    if (s.TYPED_ARRAY_SUPPORT)
                        (this[n] = e >>> 8), (this[n + 1] = 255 & e);
                    else H(this, e, n, false);
                    return n + 2;
                }),
                (s.prototype.writeUInt32LE = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i)) U(this, e, n, 4, 4294967295, 0);
                    if (s.TYPED_ARRAY_SUPPORT)
                        (this[n + 3] = e >>> 24),
                            (this[n + 2] = e >>> 16),
                            (this[n + 1] = e >>> 8),
                            (this[n] = 255 & e);
                    else $(this, e, n, true);
                    return n + 4;
                }),
                (s.prototype.writeUInt32BE = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i)) U(this, e, n, 4, 4294967295, 0);
                    if (s.TYPED_ARRAY_SUPPORT)
                        (this[n] = e >>> 24),
                            (this[n + 1] = e >>> 16),
                            (this[n + 2] = e >>> 8),
                            (this[n + 3] = 255 & e);
                    else $(this, e, n, false);
                    return n + 4;
                }),
                (s.prototype.writeIntLE = function t(e, n, i, o) {
                    if (((e = +e), (n |= 0), !o)) {
                        var a = Math.pow(2, 8 * i - 1);
                        U(this, e, n, i, a - 1, -a);
                    }
                    var s = 0,
                        u = 1,
                        l = 0;
                    for (this[n] = 255 & e; ++s < i && (u *= 256);) {
                        if (e < 0 && 0 === l && 0 !== this[n + s - 1]) l = 1;
                        this[n + s] = (((e / u) >> 0) - l) & 255;
                    }
                    return n + i;
                }),
                (s.prototype.writeIntBE = function t(e, n, i, o) {
                    if (((e = +e), (n |= 0), !o)) {
                        var a = Math.pow(2, 8 * i - 1);
                        U(this, e, n, i, a - 1, -a);
                    }
                    var s = i - 1,
                        u = 1,
                        l = 0;
                    for (this[n + s] = 255 & e; --s >= 0 && (u *= 256);) {
                        if (e < 0 && 0 === l && 0 !== this[n + s + 1]) l = 1;
                        this[n + s] = (((e / u) >> 0) - l) & 255;
                    }
                    return n + i;
                }),
                (s.prototype.writeInt8 = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i)) U(this, e, n, 1, 127, -128);
                    if (!s.TYPED_ARRAY_SUPPORT) e = Math.floor(e);
                    if (e < 0) e = 255 + e + 1;
                    return (this[n] = 255 & e), n + 1;
                }),
                (s.prototype.writeInt16LE = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i)) U(this, e, n, 2, 32767, -32768);
                    if (s.TYPED_ARRAY_SUPPORT)
                        (this[n] = 255 & e), (this[n + 1] = e >>> 8);
                    else H(this, e, n, true);
                    return n + 2;
                }),
                (s.prototype.writeInt16BE = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i)) U(this, e, n, 2, 32767, -32768);
                    if (s.TYPED_ARRAY_SUPPORT)
                        (this[n] = e >>> 8), (this[n + 1] = 255 & e);
                    else H(this, e, n, false);
                    return n + 2;
                }),
                (s.prototype.writeInt32LE = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i))
                        U(this, e, n, 4, 2147483647, -2147483648);
                    if (s.TYPED_ARRAY_SUPPORT)
                        (this[n] = 255 & e),
                            (this[n + 1] = e >>> 8),
                            (this[n + 2] = e >>> 16),
                            (this[n + 3] = e >>> 24);
                    else $(this, e, n, true);
                    return n + 4;
                }),
                (s.prototype.writeInt32BE = function t(e, n, i) {
                    if (((e = +e), (n |= 0), !i))
                        U(this, e, n, 4, 2147483647, -2147483648);
                    if (e < 0) e = 4294967295 + e + 1;
                    if (s.TYPED_ARRAY_SUPPORT)
                        (this[n] = e >>> 24),
                            (this[n + 1] = e >>> 16),
                            (this[n + 2] = e >>> 8),
                            (this[n + 3] = 255 & e);
                    else $(this, e, n, false);
                    return n + 4;
                }),
                (s.prototype.writeFloatLE = function t(e, n, i) {
                    return Y(this, e, n, true, i);
                }),
                (s.prototype.writeFloatBE = function t(e, n, i) {
                    return Y(this, e, n, false, i);
                }),
                (s.prototype.writeDoubleLE = function t(e, n, i) {
                    return W(this, e, n, true, i);
                }),
                (s.prototype.writeDoubleBE = function t(e, n, i) {
                    return W(this, e, n, false, i);
                }),
                (s.prototype.copy = function copy(t, e, n, i) {
                    if (!n) n = 0;
                    if (!i && 0 !== i) i = this.length;
                    if (e >= t.length) e = t.length;
                    if (!e) e = 0;
                    if (i > 0 && i < n) i = n;
                    if (i === n) return 0;
                    if (0 === t.length || 0 === this.length) return 0;
                    if (e < 0) throw new RangeError("targetStart out of bounds");
                    if (n < 0 || n >= this.length)
                        throw new RangeError("sourceStart out of bounds");
                    if (i < 0) throw new RangeError("sourceEnd out of bounds");
                    if (i > this.length) i = this.length;
                    if (t.length - e < i - n) i = t.length - e + n;
                    var o = i - n,
                        a;
                    if (this === t && n < e && e < i)
                        for (a = o - 1; a >= 0; --a) t[a + e] = this[a + n];
                    else if (o < 1e3 || !s.TYPED_ARRAY_SUPPORT)
                        for (a = 0; a < o; ++a) t[a + e] = this[a + n];
                    else Uint8Array.prototype.set.call(t, this.subarray(n, n + o), e);
                    return o;
                }),
                (s.prototype.fill = function t(e, n, i, o) {
                    if ("string" == typeof e) {
                        if ("string" == typeof n) (o = n), (n = 0), (i = this.length);
                        else if ("string" == typeof i) (o = i), (i = this.length);
                        if (1 === e.length) {
                            var a = e.charCodeAt(0);
                            if (a < 256) e = a;
                        }
                        if (void 0 !== o && "string" != typeof o)
                            throw new TypeError("encoding must be a string");
                        if ("string" == typeof o && !s.isEncoding(o))
                            throw new TypeError("Unknown encoding: " + o);
                    } else if ("number" == typeof e) e &= 255;
                    if (n < 0 || this.length < n || this.length < i)
                        throw new RangeError("Out of range index");
                    if (i <= n) return this;
                    if (((n >>>= 0), (i = void 0 === i ? this.length : i >>> 0), !e))
                        e = 0;
                    var u;
                    if ("number" == typeof e) for (u = n; u < i; ++u) this[u] = e;
                    else {
                        var l = s.isBuffer(e) ? e : X(new s(e, o).toString()),
                            f = l.length;
                        for (u = 0; u < i - n; ++u) this[u + n] = l[u % f];
                    }
                    return this;
                });
            var lt = /[^+\/0-9A-Za-z-_]/g;
        }).call(e, n(41));
    },
    427: function (t, e, n) {
        "use strict";
        var i = n(189).instance();
        i.registerAnimation(n(428)),
            i.registerAnimation(n(431)),
            i.registerAnimation(n(190));
    },
    428: function (t, e, n) {
        "use strict";
        function i(t, e) {
            (this.info = t), (this.hint = e), (this.timeoutId = null);
        }
        var o = n(429);
        (t.exports = i),
            (i.isMatch = function (t) {
                return t && "counter" === t.name;
            }),
            (i.create = function (t, e) {
                return new i(t, e);
            }),
            (i.prototype.init = function init() {
                var t = this.info.element;
                if (!this.countUp && t) {
                    var e = /(\D*)(\d+(?:([.,])(\d+))?)(.*)/.exec(t.innerText),
                        n = 1,
                        i = 2,
                        a = 3,
                        s = 4,
                        u = 5;
                    if (null !== e && e[i] && !(e[i].length > 15)) {
                        var l = e[i];
                        if ("," === e[a]) l = l.replace(",", ".");
                        if ((l = Number(l)) && !isNaN(l) && isFinite(l)) {
                            if (this.hint) this.hint.hintBrowser(this.info);
                            var f = 0;
                            if (e[s]) f = e[s].length;
                            var c = {
                                element: t,
                                prefix: e[n],
                                decimal: e[a],
                                decimals: f,
                                suffix: e[u],
                                startVal: 0,
                                endVal: l,
                                duration: this.info.durationRaw,
                                cycle: this.info.animationCycle,
                                separator: "",
                            };
                            this.countUp = new o(c);
                        }
                    }
                }
            }),
            (i.prototype.start = function t() {
                if (this.countUp) {
                    if ((this.countUp.reset(), this._timeoutId))
                        clearTimeout(this._timeoutId);
                    var e = function () {
                        (this._timeoutId = null), this.countUp.start();
                    }.bind(this),
                        n = this.info.delay;
                    if (isNaN(n)) n = 0;
                    if (!n) return e(), void 0;
                    this._timeoutId = setTimeout(e, n);
                }
            }),
            (i.prototype.startOut = function t() {
                if (this._timeoutId)
                    clearTimeout(this._timeoutId), (this._timeoutId = null);
            }),
            (i.prototype.reset = function t() {
                if (this.countUp) this.countUp.reset();
            }),
            (i.prototype.isInOutAnimation = function t() {
                return true;
            }),
            (i.prototype.needOutAnimation = function t() {
                return false;
            }),
            (i.prototype.clear = function t() {
                if (this.hint) this.hint.removeHint(this.info);
            }),
            (i.prototype.getTime = function t() {
                if (!this.info) return 0;
                var e = this.info.duration,
                    n = this.info.delay;
                if (isNaN(n)) n = 0;
                return n + e;
            }),
            (i.prototype.getOutTime = function t() {
                return 0;
            });
    },
    429: function (t, e, n) {
        "use strict";
        function i(t) {
            this.initialize(t);
        }
        function o(countUp, t, e) {
            if (countUp) {
                if (((t = Number(t)), isNaN(t) || !isFinite(t) || 0 === t)) t = 1;
                var n = 0,
                    i = function () {
                        if (++n < t) countUp.reset(), countUp.start(i);
                        else if ("function" == typeof e) e();
                    };
                countUp.start(i);
            }
        }
        n(430),
            (i.prototype.initialize = function t(e) {
                if (!this.countUp && e.element) {
                    var n = e.startVal,
                        i = e.endVal,
                        o = e.decimals,
                        a = e.duration;
                    if ((n || 0 == +n) && (i || 0 == +i)) {
                        if (a) if (((a = Number(a) / 1e3), isNaN(a))) a = void 0;
                        (this.cycle = e.cycle),
                            (this.countUp = new CountUp(e.element, n, i, o, a, e)),
                            (this.started = false);
                    }
                }
            }),
            (i.prototype.reset = function t() {
                if (((this.started = false), this.countUp)) this.countUp.reset();
            }),
            (i.prototype.start = function t() {
                if (this.countUp && !this.started)
                    (this.started = true), o(this.countUp, this.cycle);
            }),
            (t.exports = i);
    },
    430: function (t, e) {
        var e = void 0,
            t = void 0;
        (function () {
            !(function (n, factory) {
                if ("function" == typeof define && define.amd) define(factory);
                else if ("object" == typeof e) t.exports = factory(require, e, t);
                else n.CountUp = factory();
            })(this, function (t, e, n) {
                var CountUp;
                return function (t, e, n, i, o, a) {
                    function s(t) {
                        var e, n, i, o, a, s;
                        if (
                            ((t = t.toFixed(f.decimals)),
                                (n = (e = (t += "").split("."))[0]),
                                (i = e.length > 1 ? f.options.decimal + e[1] : ""),
                                f.options.useGrouping)
                        ) {
                            for (o = "", a = 0, s = n.length; a < s; ++a) {
                                if (0 !== a && a % 3 == 0) o = f.options.separator + o;
                                o = n[s - a - 1] + o;
                            }
                            n = o;
                        }
                        if (f.options.numerals.length)
                            (n = n.replace(/[0-9]/g, function (t) {
                                return f.options.numerals[+t];
                            })),
                                (i = i.replace(/[0-9]/g, function (t) {
                                    return f.options.numerals[+t];
                                }));
                        return f.options.prefix + n + i + f.options.suffix;
                    }
                    function u(t, e, n, d) {
                        return (n * (-Math.pow(2, (-10 * t) / d) + 1) * 1024) / 1023 + e;
                    }
                    function l(t) {
                        return "number" == typeof t && !isNaN(t);
                    }
                    var f = this;
                    if (
                        ((f.version = function () {
                            return "1.9.2";
                        }),
                            (f.options = {
                                useEasing: true,
                                useGrouping: true,
                                separator: ",",
                                decimal: ".",
                                easingFn: u,
                                formattingFn: s,
                                prefix: "",
                                suffix: "",
                                numerals: [],
                            }),
                            a && "object" == typeof a)
                    )
                        for (var c in f.options)
                            if (a.hasOwnProperty(c) && null !== a[c]) f.options[c] = a[c];
                    if ("" === f.options.separator) f.options.useGrouping = false;
                    else f.options.separator = "" + f.options.separator;
                    for (
                        var h = 0, p = ["webkit", "moz", "ms", "o"], m = 0;
                        m < p.length && !window.requestAnimationFrame;
                        ++m
                    )
                        (window.requestAnimationFrame =
                            window[p[m] + "RequestAnimationFrame"]),
                            (window.cancelAnimationFrame =
                                window[p[m] + "CancelAnimationFrame"] ||
                                window[p[m] + "CancelRequestAnimationFrame"]);
                    if (!window.requestAnimationFrame)
                        window.requestAnimationFrame = function (t, e) {
                            var n = new Date().getTime(),
                                i = Math.max(0, 16 - (n - h)),
                                id = window.setTimeout(function () {
                                    t(n + i);
                                }, i);
                            return (h = n + i), id;
                        };
                    if (!window.cancelAnimationFrame)
                        window.cancelAnimationFrame = function (id) {
                            clearTimeout(id);
                        };
                    if (
                        ((f.initialize = function () {
                            if (f.initialized) return true;
                            if (
                                ((f.error = ""),
                                    (f.d = "string" == typeof t ? document.getElementById(t) : t),
                                    !f.d)
                            )
                                return (
                                    (f.error = "[CountUp] target is null or undefined"), false
                                );
                            if (
                                ((f.startVal = Number(e)),
                                    (f.endVal = Number(n)),
                                    l(f.startVal) && l(f.endVal))
                            )
                                return (
                                    (f.decimals = Math.max(0, i || 0)),
                                    (f.dec = Math.pow(10, f.decimals)),
                                    (f.duration = 1e3 * Number(o) || 2e3),
                                    (f.countDown = f.startVal > f.endVal),
                                    (f.frameVal = f.startVal),
                                    (f.initialized = true),
                                    true
                                );
                            else
                                return (
                                    (f.error =
                                        "[CountUp] startVal (" +
                                        e +
                                        ") or endVal (" +
                                        n +
                                        ") is not a number"),
                                    false
                                );
                        }),
                            (f.printValue = function (t) {
                                var e = f.options.formattingFn(t);
                                if ("INPUT" === f.d.tagName) this.d.value = e;
                                else if ("text" === f.d.tagName || "tspan" === f.d.tagName)
                                    this.d.textContent = e;
                                else this.d.innerHTML = e;
                            }),
                            (f.count = function (t) {
                                if (!f.startTime) f.startTime = t;
                                f.timestamp = t;
                                var e = t - f.startTime;
                                if (((f.remaining = f.duration - e), f.options.useEasing))
                                    if (f.countDown)
                                        f.frameVal =
                                            f.startVal -
                                            f.options.easingFn(e, 0, f.startVal - f.endVal, f.duration);
                                    else
                                        f.frameVal = f.options.easingFn(
                                            e,
                                            f.startVal,
                                            f.endVal - f.startVal,
                                            f.duration
                                        );
                                else if (f.countDown)
                                    f.frameVal =
                                        f.startVal - (f.startVal - f.endVal) * (e / f.duration);
                                else
                                    f.frameVal =
                                        f.startVal + (f.endVal - f.startVal) * (e / f.duration);
                                if (f.countDown)
                                    f.frameVal = f.frameVal < f.endVal ? f.endVal : f.frameVal;
                                else f.frameVal = f.frameVal > f.endVal ? f.endVal : f.frameVal;
                                if (
                                    ((f.frameVal = Math.round(f.frameVal * f.dec) / f.dec),
                                        f.printValue(f.frameVal),
                                        e < f.duration)
                                )
                                    f.rAF = requestAnimationFrame(f.count);
                                else if (f.callback) f.callback();
                            }),
                            (f.start = function (t) {
                                if (f.initialize())
                                    (f.callback = t), (f.rAF = requestAnimationFrame(f.count));
                            }),
                            (f.pauseResume = function () {
                                if (!f.paused) (f.paused = true), cancelAnimationFrame(f.rAF);
                                else
                                    (f.paused = false),
                                        delete f.startTime,
                                        (f.duration = f.remaining),
                                        (f.startVal = f.frameVal),
                                        requestAnimationFrame(f.count);
                            }),
                            (f.reset = function () {
                                if (
                                    ((f.paused = false),
                                        delete f.startTime,
                                        (f.initialized = false),
                                        f.initialize())
                                )
                                    cancelAnimationFrame(f.rAF), f.printValue(f.startVal);
                            }),
                            (f.update = function (t) {
                                if (f.initialize()) {
                                    if (!l((t = Number(t))))
                                        return (
                                            (f.error =
                                                "[CountUp] update() - new endVal is not a number: " + t),
                                            void 0
                                        );
                                    if (((f.error = ""), t !== f.frameVal))
                                        cancelAnimationFrame(f.rAF),
                                            (f.paused = false),
                                            delete f.startTime,
                                            (f.startVal = f.frameVal),
                                            (f.endVal = t),
                                            (f.countDown = f.startVal > f.endVal),
                                            (f.rAF = requestAnimationFrame(f.count));
                                }
                            }),
                            f.initialize())
                    )
                        f.printValue(f.startVal);
                };
            });
        }).call(window);
    },
    431: function (t, e, n) {
        "use strict";
        function i() {
            o.apply(this, arguments),
                (this.backstageClass = ["backstage", "u-backstage-hidden"]);
        }
        var o = n(190);
        Object.assign(i.prototype, o.prototype),
            (t.exports = i),
            (i.isMatch = function (t) {
                var e = ((t && t.name) || "").toLowerCase();
                return (
                    [
                        "fadein",
                        "flipin",
                        "bouncein",
                        "jackinthebox",
                        "lightspeedin",
                        "customanimationin",
                    ].indexOf(e) > -1
                );
            }),
            (i.create = function (t, e) {
                return new i(t, e);
            });
    },
    469: function (t, e) { },
    485: function (t, e, n) {
        "use strict";
        function i(t, e) {
            if ("string" != typeof t) return 0;
            var n = new u().replace(t, e).expr;
            if ("" === n.trim()) return 0;
            o(n);
            try {
                var i, l;
                return s(new Function('"use strict";return (' + n + ");")(), 4);
            } catch (e) {
                return a(e, t);
            }
        }
        function o(t) {
            var e = /[^-()\d\s/*+.]+|\/\/|\/\*/g.exec(t),
                n = 20,
                i;
            if (e) {
                var o = {
                    messageKey: "#FormCalc_UnexpectedToken",
                    expression: (i = e[0].substring(0, n)),
                    position: e.index,
                };
                throw Object.assign(
                    new Error("Unexpected token '" + i + "'", { cause: o }),
                    { args: o }
                );
            }
        }
        function a(t, e) {
            var n = { messageKey: "#FormCalc_EvaluationFailed", expression: e };
            throw Object.assign(new Error("Evaluation failed", { cause: n }), {
                args: n,
            });
        }
        function s(t, e) {
            if (((t = Number(t)), (e = Number(e)), isNaN(t) || !isFinite(t)))
                return t;
            var n = t.toString().split("e"),
                i = n[0],
                o = n[1] || 0,
                a,
                s,
                u = Math.round(Number(i + "e" + (+o + e)))
                    .toString()
                    .split("e")[0],
                l = n[1] || 0;
            return Number(u + "e" + (+l - e));
        }
        var u = n(299);
        t.exports.evaluate = i;
    },
    486: function (t, e, n) {
        "use strict";
        function i(el) {
            var t = el.getAttribute("name"),
                type;
            if (!t) return t;
            if (((t = t.trim()), "SELECT" === el.tagName)) return o(t);
            if ("checkbox" === el.getAttribute("type")) return o(t);
            else return t;
        }
        function o(t) {
            if (!t) return t;
            var e = t.lastIndexOf("[][]");
            if (e > 0 && e + 4 === t.length) return t.substring(0, t.length - 4);
            if ((e = t.lastIndexOf("[]")) > 0 && e + 2 === t.length)
                return t.substring(0, t.length - 2);
            else return t;
        }
        function a(el) {
            if ("OPTION" === el.tagName) return el.getAttribute("data-calc");
            var type = el.getAttribute("type");
            if ("number" === type || "range" === type) return el.value;
            if ("radio" === type) return el.getAttribute("data-calc");
            if ("checkbox" === type && null !== el.getAttribute("data-calc"))
                return el.getAttribute("data-calc");
            if ("checkbox" === type) return el.value;
            else return;
        }
        function s(el) {
            return Number(a(el));
        }
        function u(el) {
            if ("OPTION" === el.tagName) return el.selected;
            var type = el.getAttribute("type");
            if ("radio" === type || "checkbox" === type) return el.checked;
            else return true;
        }
        function l(el, t) {
            if (((t = t || 0), u(el))) return s(el);
            else return t;
        }
        var f = (t.exports = function t(form) {
            (this.fields = []),
                this.collectInputs(
                    form.querySelectorAll("[type=number], [type=range]")
                ),
                this.collectInputs(form.querySelectorAll("[type=radio]")),
                this.collectInputs(form.querySelectorAll('[type="checkbox"]')),
                this.collectSelects(form.querySelectorAll("select"));
        });
        (f.prototype.getScope = function t() {
            return this.fields.reduce(function (t, e) {
                if (!e || !e.name) return t;
                if (!t[e.name]) t[e.name] = 0;
                return (t[e.name] += e.value), t;
            }, {});
        }),
            (f.prototype.addField = function t(field) {
                return this.fields.push(field), field;
            }),
            (f.prototype.collectInputs = function (t) {
                for (var e = 0; e < t.length; e++)
                    this.addField({
                        name: i(t[e]),
                        value: l(t[e], 0),
                        rawValue: a(t[e]),
                    });
            }),
            (f.prototype.collectSelects = function (t) {
                for (var e = 0; e < t.length; e++)
                    this.collectOptions(i(t[e]), t[e].querySelectorAll("option"));
            }),
            (f.prototype.collectOptions = function (t, e) {
                for (var n = 0; n < e.length; n++)
                    this.addField({ name: t, value: l(e[n], 0), rawValue: a(e[n]) });
            });
    },
    487: function (t, e, n) {
        "use strict";
        function i(t, e, n) {
            var i = t.find(".u-form-progress-step");
            i.removeClass("active done"),
                o(i.find(".u-form-progress-icon"), "default"),
                o(i.find(".u-form-progress-icon"), "step");
            var a = t.find(".u-form-progress-step").eq(n);
            a.addClass("active");
            var s = a.prevAll(".u-form-progress-step");
            s.addClass("done"), o(s.find(".u-form-progress-icon"), "done");
        }
        function o(icon, type) {
            (type = type || "default"),
                icon.each(function () {
                    var t = $(this),
                        e = t.attr("data-step-icon-" + type);
                    if (e) t.html(e);
                });
        }
        function a(t, e, n) {
            var i = t.find(".u-form-progress-bar"),
                o =
                    "calc((100% - var(--step-icon-size)) / " +
                    (e.length - 1) +
                    " * " +
                    n +
                    ")";
            i.css("width", o);
        }
        var FormProgress;
        t.exports.update = function (form, t) {
            if (form.length) {
                var e = form.find(".u-form-progress"),
                    n = form.find(".u-carousel-inner").children();
                if (void 0 === t) t = n.filter(".u-active, .active").index();
                a(e, n, t), i(e, n, t);
            }
        };
    },
    488: function (t, e, n) {
        "use strict";
        var i;
        t.exports.update = function (form, t) {
            var e = form.find(".u-slide");
            if (void 0 === t) t = e.filter(".u-active, .active").index();
            var n = form.find(".u-btn-submit, .u-btn-step"),
                i = n.filter(".u-btn-submit"),
                o = n.filter(".u-btn-step-next"),
                a = n.filter(".u-btn-step-prev");
            if ((n.show(), 0 === t)) a.hide();
            if (t === e.length - 1) o.hide(), i.show();
            if (t < e.length - 1) o.show(), i.hide();
        };
    },
    489: function (t, e, n) {
        "use strict";
        var FormFileType = n(96),
            FormFileAccept = (t.exports = {});
        (FormFileAccept[FormFileType.IMAGES] =
            ".bmp,.dng,.eps,.gif,.jpg,.jpeg,.png,.ps,.raw,.svg,.tga,.tif,.tiff"),
            (FormFileAccept[FormFileType.DOCUMENTS] =
                ".ai,.cdr,.csv,.doc,.docb,.docx,.dot,.dotx,.dwg,.eps,.epub,.fla,.gpx,.ical,.icalendar,.ics,.ifb,.indd,.ipynb,.key,.kml,.kmz,.mobi,.mtf,.mtx,.numbers,.odg,.odp,.ods,.odt,.otp,.ots,.ott,.oxps,.pages,.pdf,.pdn,.pkg,.pot,.potx,.pps,.ppsx,.ppt,.pptx,.psd,.pub,.rtf,.sldx,.txt,.vcf,.xcf,.xls,.xlsx,.xlt,.xltx,.xlw,.xps,.zip"),
            (FormFileAccept[FormFileType.VIDEO] =
                ".3gp,.avi,.divx,.flv,.m1v,.m2ts,.m4v,.mkv,.mov,.mp4,.mpe,.mpeg,.mpg,.mxf,.ogv,.vob.webm,.wmv,.xvid"),
            (FormFileAccept[FormFileType.AUDIO] =
                ".aac,.aif,.aiff,.flac,.m4a,.mp3,.wav,.wma");
    },
    56: function (t, e, n) {
        "use strict";
        var i = n(8);
        (t.exports = i.md = i.md || {}), (i.md.algorithms = i.md.algorithms || {});
    },
    673: function (t, e, n) {
        "use strict";
        var i = n(674),
            bootstrap = {};
        (bootstrap.Util = (function (t) {
            function e(t) {
                return t && "object" == typeof t && "default" in t ? t : { default: t };
            }
            function n() {
                if (window.QUnit) return false;
                var el = document.createElement("bootstrap");
                for (var t in h) if (void 0 !== el.style[t]) return h[t];
                return false;
            }
            function i(t) {
                if (null == t) return "" + t;
                else
                    return {}.toString
                        .call(t)
                        .match(/\s([a-z]+)/i)[1]
                        .toLowerCase();
            }
            function o() {
                return {
                    bindType: l,
                    delegateType: l,
                    handle: function t(e) {
                        if (u["default"](e.target).is(this))
                            return e.handleObj.handler.apply(this, arguments);
                    },
                };
            }
            function a(t) {
                var e = this,
                    n = false;
                return (
                    u["default"](this).one(Util.TRANSITION_END, function () {
                        n = true;
                    }),
                    setTimeout(function () {
                        if (!n) Util.triggerTransitionEnd(e);
                    }, t),
                    this
                );
            }
            function s() {
                (l = n()),
                    (u["default"].fn.emulateTransitionEnd = a),
                    (u["default"].event.special[Util.TRANSITION_END] = o());
            }
            var u = e(t),
                l = false,
                f = 1e6,
                c = 1e3,
                h = {
                    WebkitTransition: "webkitTransitionEnd",
                    MozTransition: "transitionend",
                    OTransition: "oTransitionEnd otransitionend",
                    transition: "transitionend",
                },
                Util = {
                    TRANSITION_END: "bsTransitionEnd",
                    getUID: function t(e) {
                        do {
                            e += ~~(Math.random() * f);
                        } while (document.getElementById(e));
                        return e;
                    },
                    getSelectorFromElement: function t(e) {
                        var selector = e.getAttribute("data-u-target");
                        if (!selector || "#" === selector) {
                            var n = e.getAttribute("href");
                            selector = n && "#" !== n ? n.trim() : "";
                        }
                        try {
                            return document.querySelector(selector) ? selector : null;
                        } catch (t) {
                            return null;
                        }
                    },
                    getTransitionDurationFromElement: function t(e) {
                        if (!e) return 0;
                        var n = u["default"](e).css("transition-duration"),
                            i = u["default"](e).css("transition-delay"),
                            o = parseFloat(n),
                            a = parseFloat(i);
                        if (!o && !a) return 0;
                        else
                            return (
                                (n = n.split(",")[0]),
                                (i = i.split(",")[0]),
                                (parseFloat(n) + parseFloat(i)) * c
                            );
                    },
                    reflow: function t(e) {
                        return e.offsetHeight;
                    },
                    triggerTransitionEnd: function t(e) {
                        u["default"](e).trigger(l);
                    },
                    supportsTransitionEnd: function t() {
                        return Boolean(l);
                    },
                    isElement: function t(e) {
                        return (e[0] || e).nodeType;
                    },
                    typeCheckConfig: function t(e, n, o) {
                        for (var a in o)
                            if (Object.prototype.hasOwnProperty.call(o, a)) {
                                var s = o[a],
                                    u = n[a],
                                    l = u && Util.isElement(u) ? "element" : i(u);
                                if (!new RegExp(s).test(l))
                                    throw new Error(
                                        e.toUpperCase() +
                                        ": " +
                                        'Option "' +
                                        a +
                                        '" provided type "' +
                                        l +
                                        '" ' +
                                        'but expected type "' +
                                        s +
                                        '".'
                                    );
                            }
                    },
                    findShadowRoot: function t(e) {
                        if (!document.documentElement.attachShadow) return null;
                        if ("function" == typeof e.getRootNode) {
                            var n = e.getRootNode();
                            return n instanceof ShadowRoot ? n : null;
                        }
                        if (e instanceof ShadowRoot) return e;
                        if (!e.parentNode) return null;
                        else return Util.findShadowRoot(e.parentNode);
                    },
                };
            return s(), Util;
        })($)),
            (bootstrap.Carousel = (function (t, Util) {
                function e(t) {
                    return t && "object" == typeof t && "default" in t
                        ? t
                        : { default: t };
                }
                function n(t, props) {
                    for (var e = 0; e < props.length; e++) {
                        var n = props[e];
                        if (
                            ((n.enumerable = n.enumerable || false),
                                (n.configurable = true),
                                "value" in n)
                        )
                            n.writable = true;
                        Object.defineProperty(t, n.key, n);
                    }
                }
                function o(t, e, i) {
                    if (e) n(t.prototype, e);
                    if (i) n(t, i);
                    return t;
                }
                function a() {
                    return (
                        (a =
                            Object.assign ||
                            function (t) {
                                for (var e = 1; e < arguments.length; e++) {
                                    var n = arguments[e];
                                    for (var i in n)
                                        if (Object.prototype.hasOwnProperty.call(n, i)) t[i] = n[i];
                                }
                                return t;
                            }),
                        a.apply(this, arguments)
                    );
                }
                var s = e(t),
                    u = e(Util),
                    l = "u-carousel",
                    f = "4.6.0",
                    c = "bs.u-carousel",
                    h = "bs.u-carousel.swipe",
                    p = "." + c,
                    m = ".data-u-api",
                    v = s["default"].fn[l],
                    g = 37,
                    y = 39,
                    w = 500,
                    b = 40,
                    Default = {
                        interval: 5e3,
                        keyboard: true,
                        slide: false,
                        pause: "hover",
                        wrap: true,
                        touch: false,
                        swipe: true,
                    },
                    C = {
                        interval: "(number|boolean)",
                        keyboard: "boolean",
                        slide: "(boolean|string)",
                        pause: "(string|boolean)",
                        wrap: "boolean",
                        touch: "boolean",
                        swipe: "boolean",
                    },
                    x = "next",
                    S = "prev",
                    A = "left",
                    _ = "right",
                    T = "u-slide" + p,
                    I = "slid" + p,
                    E = "keydown" + p,
                    k = "mouseenter" + p,
                    M = "mouseleave" + p,
                    L = "touchstart" + p,
                    B = "touchmove" + p,
                    O = "touchend" + p,
                    P = "pointerdown" + p,
                    F = "pointerup" + p,
                    N = "dragstart" + p,
                    z = "load" + p + m,
                    U = "click" + p + m,
                    H = "u-carousel",
                    $ = "u-active",
                    V = "u-slide",
                    Y = "u-carousel-item-right",
                    W = "u-carousel-item-left",
                    j = "u-carousel-item-next",
                    G = "u-carousel-item-prev",
                    Z = "pointer-event",
                    X = ".u-active",
                    K = ".u-active.u-carousel-item",
                    J = ".u-carousel-item",
                    tt = ".u-carousel-item img",
                    nt = ".u-carousel-item-next, .u-carousel-item-prev",
                    rt = ".u-carousel-indicators, .u-carousel-thumbnails",
                    ot = "[data-u-slide], [data-u-slide-to]",
                    at = '[data-u-ride="carousel"]',
                    st = { TOUCH: "touch", PEN: "pen" },
                    Carousel = (function () {
                        function Carousel(t, e) {
                            var n =
                                "ontouchstart" in document.documentElement ||
                                navigator.maxTouchPoints > 0;
                            (this._items = null),
                                (this._interval = null),
                                (this._activeElement = null),
                                (this._isPaused = false),
                                (this._isSliding = false),
                                (this.touchTimeout = null),
                                (this.touchStartX = 0),
                                (this.touchDeltaX = 0),
                                (this._config = this._getConfig(e)),
                                (this._element = t),
                                (this._indicatorsElement = this._element.querySelector(rt)),
                                (this._touchSupported = !this._element.matches(".u-form") && n),
                                (this._pointerEvent = Boolean(
                                    window.PointerEvent || window.MSPointerEvent
                                )),
                                this._addEventListeners();
                        }
                        var e = Carousel.prototype;
                        return (
                            (e.next = function t() {
                                if (!this._isSliding) this._slide(x);
                            }),
                            (e.nextWhenVisible = function t() {
                                var e = s["default"](this._element);
                                if (
                                    !document.hidden &&
                                    e.is(":visible") &&
                                    "hidden" !== e.css("visibility")
                                )
                                    this.next();
                            }),
                            (e.prev = function t() {
                                if (!this._isSliding) this._slide(S);
                            }),
                            (e.pause = function t(e) {
                                if (!e) this._isPaused = true;
                                if (this._element.querySelector(nt))
                                    u["default"].triggerTransitionEnd(this._element),
                                        this.cycle(true);
                                clearInterval(this._interval), (this._interval = null);
                            }),
                            (e.cycle = function t(e) {
                                if (!e) this._isPaused = false;
                                if (this._interval)
                                    clearInterval(this._interval), (this._interval = null);
                                if (this._config.interval && !this._isPaused)
                                    this._updateInterval(),
                                        (this._interval = setInterval(
                                            (document.visibilityState
                                                ? this.nextWhenVisible
                                                : this.next
                                            ).bind(this),
                                            this._config.interval
                                        ));
                            }),
                            (e.to = function t(index) {
                                var e = this;
                                this._activeElement = this._element.querySelector(K);
                                var n = this._getItemIndex(this._activeElement);
                                if (!(index > this._items.length - 1 || index < 0)) {
                                    if (this._isSliding)
                                        return (
                                            s["default"](this._element).one(I, function () {
                                                return e.to(index);
                                            }),
                                            void 0
                                        );
                                    if (n === index) return this.pause(), this.cycle(), void 0;
                                    var i = index > n ? x : S;
                                    this._slide(i, this._items[index]);
                                }
                            }),
                            (e.dispose = function t() {
                                if (
                                    (s["default"](this._element).off(p),
                                        s["default"].removeData(this._element, c),
                                        s["default"].removeData(this._element, h),
                                        (this._items = null),
                                        (this._config = null),
                                        (this._element = null),
                                        this._interval)
                                )
                                    clearInterval(this._interval);
                                (this._interval = null),
                                    (this._isPaused = null),
                                    (this._isSliding = null),
                                    (this._activeElement = null),
                                    (this._indicatorsElement = null);
                            }),
                            (e._getConfig = function t(e) {
                                return (
                                    (e = a({}, Default, e)),
                                    u["default"].typeCheckConfig(l, e, C),
                                    e
                                );
                            }),
                            (e._handleSwipe = function t() {
                                var e = Math.abs(this.touchDeltaX);
                                if (!(e <= b)) {
                                    var n = e / this.touchDeltaX;
                                    if (((this.touchDeltaX = 0), n > 0)) this.prev();
                                    if (n < 0) this.next();
                                }
                            }),
                            (e._addEventListeners = function t() {
                                var e = this;
                                if (this._config.keyboard)
                                    s["default"](this._element).on(E, function (t) {
                                        return e._keydown(t);
                                    });
                                if ("hover" === this._config.pause)
                                    s["default"](this._element)
                                        .on(k, function (t) {
                                            return e.pause(t);
                                        })
                                        .on(M, function (t) {
                                            return e.cycle(t);
                                        });
                                if (this._config.touch) this._addTouchEventListeners();
                            }),
                            (e._addTouchEventListeners = function t() {
                                var e = this;
                                if (this._touchSupported) {
                                    var n = function t(n) {
                                        if (
                                            e._pointerEvent &&
                                            st[n.originalEvent.pointerType.toUpperCase()]
                                        )
                                            e.touchStartX = n.originalEvent.clientX;
                                        else if (!e._pointerEvent)
                                            e.touchStartX = n.originalEvent.touches[0].clientX;
                                    },
                                        move = function move(t) {
                                            if (
                                                t.originalEvent.touches &&
                                                t.originalEvent.touches.length > 1
                                            )
                                                e.touchDeltaX = 0;
                                            else
                                                e.touchDeltaX =
                                                    t.originalEvent.touches[0].clientX - e.touchStartX;
                                        },
                                        i = function t(n) {
                                            if (
                                                e._pointerEvent &&
                                                st[n.originalEvent.pointerType.toUpperCase()]
                                            )
                                                e.touchDeltaX = n.originalEvent.clientX - e.touchStartX;
                                            if ((e._handleSwipe(), "hover" === e._config.pause)) {
                                                if ((e.pause(), e.touchTimeout))
                                                    clearTimeout(e.touchTimeout);
                                                e.touchTimeout = setTimeout(function (t) {
                                                    return e.cycle(t);
                                                }, w + e._config.interval);
                                            }
                                        };
                                    if (
                                        (s["default"](this._element.querySelectorAll(tt)).on(
                                            N,
                                            function (t) {
                                                return t.preventDefault();
                                            }
                                        ),
                                            this._pointerEvent)
                                    )
                                        s["default"](this._element).on(P, function (t) {
                                            return n(t);
                                        }),
                                            s["default"](this._element).on(F, function (t) {
                                                return i(t);
                                            }),
                                            this._element.classList.add(Z);
                                    else
                                        s["default"](this._element).on(L, function (t) {
                                            return n(t);
                                        }),
                                            s["default"](this._element).on(B, function (t) {
                                                return move(t);
                                            }),
                                            s["default"](this._element).on(O, function (t) {
                                                return i(t);
                                            });
                                }
                            }),
                            (e._keydown = function t(e) {
                                if (!/input|textarea/i.test(e.target.tagName))
                                    switch (e.which) {
                                        case g:
                                            e.preventDefault(), this.prev();
                                            break;
                                        case y:
                                            e.preventDefault(), this.next();
                                            break;
                                    }
                            }),
                            (e._getItemIndex = function t(e) {
                                return (
                                    (this._items =
                                        e && e.parentNode
                                            ? [].slice.call(e.parentNode.querySelectorAll(J))
                                            : []),
                                    this._items.indexOf(e)
                                );
                            }),
                            (e._getItemByDirection = function t(e, n) {
                                var i = e === x,
                                    o = e === S,
                                    a = this._getItemIndex(n),
                                    s = this._items.length - 1,
                                    u;
                                if (((o && 0 === a) || (i && a === s)) && !this._config.wrap)
                                    return n;
                                var l,
                                    f = (a + (e === S ? -1 : 1)) % this._items.length;
                                return -1 === f
                                    ? this._items[this._items.length - 1]
                                    : this._items[f];
                            }),
                            (e._triggerSlideEvent = function t(e, n) {
                                var i = this._getItemIndex(e),
                                    o = this._getItemIndex(this._element.querySelector(K)),
                                    a = s["default"].Event(T, {
                                        relatedTarget: e,
                                        direction: n,
                                        from: o,
                                        to: i,
                                    });
                                return s["default"](this._element).trigger(a), a;
                            }),
                            (e._setActiveIndicatorElement = function t(e) {
                                if (this._indicatorsElement) {
                                    var n = [].slice.call(
                                        this._indicatorsElement.querySelectorAll(X)
                                    );
                                    s["default"](n).removeClass($);
                                    var i =
                                        this._indicatorsElement.children[this._getItemIndex(e)];
                                    if (i) s["default"](i).addClass($);
                                }
                            }),
                            (e._updateInterval = function t() {
                                var e = this._activeElement || this._element.querySelector(K);
                                if (e) {
                                    var n = parseInt(e.getAttribute("data-interval"), 10);
                                    if (n)
                                        (this._config.defaultInterval =
                                            this._config.defaultInterval || this._config.interval),
                                            (this._config.interval = n);
                                    else
                                        this._config.interval =
                                            this._config.defaultInterval || this._config.interval;
                                }
                            }),
                            (e._slide = function e(n, i) {
                                var o = this,
                                    a = this._element.querySelector(K),
                                    l = this._getItemIndex(a),
                                    f = i || (a && this._getItemByDirection(n, a)),
                                    c = this._getItemIndex(f),
                                    h = Boolean(this._interval),
                                    p,
                                    m,
                                    v,
                                    g;
                                if (n === x) (p = W), (m = j), (v = A);
                                else (p = Y), (m = G), (v = _);
                                if (f && s["default"](f).hasClass($))
                                    return (this._isSliding = false), void 0;
                                if (!this._triggerSlideEvent(f, v).isDefaultPrevented())
                                    if (a && f) {
                                        if (((this._isSliding = true), h)) this.pause();
                                        this._setActiveIndicatorElement(f),
                                            (this._activeElement = f);
                                        var y = s["default"].Event(I, {
                                            relatedTarget: f,
                                            direction: v,
                                            from: l,
                                            to: c,
                                        }),
                                            w = null;
                                        if (s["default"](this._element).hasClass(H)) {
                                            s["default"](f).addClass(m),
                                                u["default"].reflow(f),
                                                s["default"](a).addClass(p),
                                                s["default"](f).addClass(p);
                                            var b = u["default"].getTransitionDurationFromElement(a),
                                                C = this._element.className,
                                                S = /u-carousel-duration-(\d+)/.exec(C);
                                            if (S && 2 === S.length) b = parseFloat(S[1]) || 0;
                                            if (h) {
                                                var T =
                                                    parseFloat(t(this._element).attr("data-interval")) +
                                                    b;
                                                if (Number.isFinite(T) && T > 0)
                                                    (w = this._config.interval),
                                                        (this._config.interval = T);
                                            }
                                            s["default"](a)
                                                .one(u["default"].TRANSITION_END, function () {
                                                    s["default"](f)
                                                        .removeClass(p + " " + m)
                                                        .addClass($),
                                                        s["default"](a).removeClass($ + " " + m + " " + p),
                                                        (o._isSliding = false),
                                                        setTimeout(function () {
                                                            return s["default"](o._element).trigger(y);
                                                        }, 0);
                                                })
                                                .emulateTransitionEnd(b);
                                        } else
                                            s["default"](a).removeClass($),
                                                s["default"](f).addClass($),
                                                (this._isSliding = false),
                                                s["default"](this._element).trigger(y);
                                        if (h) this.cycle();
                                        if (w) this._config.interval = w;
                                    }
                            }),
                            (Carousel._jQueryInterface = function t(e) {
                                return this.each(function () {
                                    var data = s["default"](this).data(c),
                                        t = a({}, Default, s["default"](this).data());
                                    if ("object" == typeof e) t = a({}, t, e);
                                    var n = "string" == typeof e ? e : t.uSlide;
                                    if (!data) {
                                        var o;
                                        if (
                                            ((data = new Carousel(this, t)),
                                                s["default"](this).data(c, data),
                                                !s["default"](this).data(h))
                                        )
                                            s["default"](this).data(h, new i(this, t));
                                    }
                                    if ("number" == typeof e) data.to(e);
                                    else if ("string" == typeof n) {
                                        if (void 0 === data[n])
                                            throw new TypeError('No method named "' + n + '"');
                                        data[n]();
                                    } else if (t.interval && t.uRide) data.pause(), data.cycle();
                                });
                            }),
                            (Carousel._dataApiClickHandler = function t(e) {
                                var selector = u["default"].getSelectorFromElement(this);
                                if (selector) {
                                    var n = s["default"](selector)[0];
                                    if (n && s["default"](n).hasClass(H)) {
                                        var i = a(
                                            {},
                                            s["default"](n).data(),
                                            s["default"](this).data()
                                        ),
                                            o = this.getAttribute("data-u-slide-to");
                                        if (o) i.interval = false;
                                        if ((Carousel._jQueryInterface.call(s["default"](n), i), o))
                                            s["default"](n).data(c).to(o);
                                        e.preventDefault();
                                    }
                                }
                            }),
                            o(Carousel, null, [
                                {
                                    key: "VERSION",
                                    get: function t() {
                                        return f;
                                    },
                                },
                                {
                                    key: "Default",
                                    get: function t() {
                                        return Default;
                                    },
                                },
                            ]),
                            Carousel
                        );
                    })();
                return (
                    s["default"](document).on(U, ot, Carousel._dataApiClickHandler),
                    s["default"](window).on(z, function () {
                        for (
                            var t = [].slice.call(document.querySelectorAll(at)),
                            e = 0,
                            n = t.length;
                            e < n;
                            e++
                        ) {
                            var i = s["default"](t[e]);
                            Carousel._jQueryInterface.call(i, i.data());
                        }
                    }),
                    (s["default"].fn[l] = Carousel._jQueryInterface),
                    (s["default"].fn[l].Constructor = Carousel),
                    (s["default"].fn[l].noConflict = function () {
                        return (s["default"].fn[l] = v), Carousel._jQueryInterface;
                    }),
                    Carousel
                );
            })($, bootstrap.Util)),
            (window.bootstrap = bootstrap);
    },
    674: function (t, e, n) {
        "use strict";
        function i(t) {
            if (
                ((this.$element = o(t)),
                    (this.carousel = this.$element.data("bs.u-carousel")),
                    (this.options = o.extend({}, i.DEFAULTS, this.carousel._config)),
                    (this.startX = null),
                    (this.startY = null),
                    (this.startTime = null),
                    (this.cycling = null),
                    (this.$active = null),
                    (this.$items = null),
                    (this.$next = null),
                    (this.$prev = null),
                    (this.dx = null),
                    (this.sliding = false),
                    !this.$element.hasClass("u-form"))
            )
                this.$element
                    .on("touchstart.bs.u-carousel", this.touchstart.bind(this))
                    .on("touchmove.bs.u-carousel", this.touchmove.bind(this))
                    .on("touchend.bs.u-carousel", this.touchend.bind(this))
                    .on("u-slide.bs.u-carousel", this.startSliding.bind(this))
                    .on("slid.bs.u-carousel", this.stopSliding.bind(this));
        }
        t.exports = i;
        var o = n(10);
        (i.DEFAULTS = { swipe: 50 }),
            (i.prototype.startSliding = function () {
                this.sliding = true;
            }),
            (i.prototype.stopSliding = function () {
                this.sliding = false;
            }),
            (i.prototype.touchstart = function (t) {
                if (!this.sliding && this.options.swipe) {
                    var e = t.originalEvent.touches ? t.originalEvent.touches[0] : t;
                    (this.dx = 0),
                        (this.startX = e.pageX),
                        (this.startY = e.pageY),
                        (this.cycling = null),
                        (this.width = this.$element.width()),
                        (this.startTime = t.timeStamp);
                }
            }),
            (i.prototype.touchmove = function (t) {
                if (!this.sliding && this.options.swipe && this.startTime) {
                    var e = t.originalEvent.touches ? t.originalEvent.touches[0] : t,
                        n = e.pageX - this.startX,
                        i = e.pageY - this.startY;
                    if (!(Math.abs(n) < Math.abs(i))) {
                        if (null === this.cycling)
                            if (((this.cycling = !!this.carousel.interval), this.cycling))
                                this.carousel.pause();
                        t.preventDefault(),
                            (this.dx = (n / (this.width || 1)) * 100),
                            this.swipe(this.dx);
                    }
                }
            }),
            (i.prototype.touchend = function (t) {
                if (!this.sliding && this.options.swipe && this.startTime)
                    if (this.$active) {
                        var all = o()
                            .add(this.$active)
                            .add(this.$prev)
                            .add(this.$next)
                            .carousel_transition(true),
                            e = (t.timeStamp - this.startTime) / 1e3,
                            n = Math.abs(this.dx / e);
                        if (this.dx > 40 || (this.dx > 0 && n > this.options.swipe))
                            this.carousel.prev();
                        else if (this.dx < -40 || (this.dx < 0 && n > this.options.swipe))
                            this.carousel.next();
                        else
                            this.$active
                                .one(o.support.transition.end, function () {
                                    all.removeClass("u-carousel-item-prev u-carousel-item-next");
                                })
                                .emulateTransitionEnd(
                                    1e3 * this.$active.css("transition-duration").slice(0, -1)
                                );
                        if ((all.css("transform", ""), this.cycling)) this.carousel.cycle();
                        (this.$active = null), (this.startTime = null);
                    }
            }),
            (i.prototype.swipe = function (t) {
                var e = this.$active || this.getActive();
                if (t < 0) {
                    if (
                        (this.$prev
                            .css("transform", "translate3d(0,0,0)")
                            .removeClass("u-carousel-item-prev")
                            .carousel_transition(true),
                            !this.$next.length || this.$next.hasClass("u-active"))
                    )
                        return;
                    this.$next
                        .carousel_transition(false)
                        .addClass("u-carousel-item-next")
                        .css("transform", "translate3d(" + (t + 100) + "%,0,0)");
                } else {
                    if (
                        (this.$next
                            .css("transform", "")
                            .removeClass("u-carousel-item-next")
                            .carousel_transition(true),
                            !this.$prev.length || this.$prev.hasClass("u-active"))
                    )
                        return;
                    this.$prev
                        .carousel_transition(false)
                        .addClass("u-carousel-item-prev")
                        .css("transform", "translate3d(" + (t - 100) + "%,0,0)");
                }
                e.carousel_transition(false).css(
                    "transform",
                    "translate3d(" + t + "%, 0, 0)"
                );
            }),
            (i.prototype.getActive = function () {
                if (
                    ((this.$active = this.$element.find(".u-carousel-item.u-active")),
                        (this.$items = this.$active.parent().children()),
                        (this.$next = this.$active.next()),
                        !this.$next.length && this.options.wrap)
                )
                    this.$next = this.$items.first();
                if (
                    ((this.$prev = this.$active.prev()),
                        !this.$prev.length && this.options.wrap)
                )
                    this.$prev = this.$items.last();
                return this.$active;
            }),
            (o.fn.carousel_transition = function (t) {
                return (
                    (t = t ? "" : "none"),
                    this.each(function () {
                        o(this).css("transition", t);
                    })
                );
            });
    },
    691: function (t, e, n) {
        "use strict";
        function i(t) {
            var data = t.attr("data-map");
            if (data) {
                data = Utility.decodeJsonAttribute(data);
                var e = t.contents()[0],
                    n = e.createElement("script");
                (n.type = "text/javascript"),
                    (n.innerHTML =
                        "var data = " +
                        JSON.stringify(data) +
                        ";\n;" +
                        "var mapIframeApiReady = function () {\n" +
                        '   parent.mapIframeApiReady(google, document.getElementById("map"), data);\n' +
                        "}");
                var i = e.createElement("script");
                if (
                    ((i.type = "text/javascript"),
                        (i.src =
                            "//maps.google.com/maps/api/js?key=" +
                            data.apiKey +
                            "&callback=mapIframeApiReady"),
                        data.lang)
                )
                    i.src += "&language=" + data.lang;
                e.head.appendChild(n),
                    e.head.appendChild(i),
                    $(e.body).append(
                        "<style>" +
                        "   #map { width: 100%; height: 100%; }" +
                        "   body { margin: 0; }" +
                        "   .marker-internal { width: 180px; font-weight: normal; }" +
                        "   .marker-internal a { text-decoration: none; color:#427fed; }" +
                        "   .marker-internal strong { font-weight: 500; font-size: 14px; }" +
                        "</style>" +
                        '<div id="map"></div>'
                    );
            }
        }
        function o(t) {
            var e = "";
            if (t.title) e += "<strong>" + t.title + "</strong>";
            if (t.description)
                e += "<div>" + t.description.replace(/\n/g, "<br>") + "</div>";
            if (t.linkUrl) {
                var url, n;
                e +=
                    '<a href="' +
                    t.linkUrl +
                    '" target="_blank"><span>' +
                    (t.linkCaption || t.linkUrl) +
                    "</span></a>";
            }
            if (e) e = '<div class="marker-internal">' + e + "</div>";
            return e;
        }
        var MapsLoader = {};
        (window.loadMapsContent = function () {
            $("iframe.map-content").each(function () {
                var t = $(this);
                if (0 === t.contents().find("#map").length) i(t);
            });
        }),
            (window.mapIframeApiReady = function (google, t, data) {
                data.markers = data.markers || [];
                var e = data.zoom;
                if (!e && 1 === data.markers.length) e = data.markers[0].zoom;
                if (!e) e = 14;
                if (
                    ((e = parseInt(e, 10)),
                        (data.map = data.map || {}),
                        (data.map.zoom = e),
                        (data.map.mapTypeId =
                            "satellite" === data.typeId
                                ? google.maps.MapTypeId.HYBRID
                                : google.maps.MapTypeId.ROADMAP),
                        data.markers.length)
                )
                    data.map.center = data.markers[0].position;
                var map = new google.maps.Map(t, data.map || {}),
                    n = new google.maps.LatLngBounds();
                if (
                    (data.markers.forEach(function (t) {
                        t.map = map;
                        var e = new google.maps.Marker(t);
                        n.extend(new google.maps.LatLng(t.position.lat, t.position.lng));
                        var i = o(t);
                        if (i) {
                            var a = new google.maps.InfoWindow({
                                content: $("<textarea/>").html(i).text(),
                            });
                            e.addListener("click", function () {
                                a.open(e.get("map"), e);
                            });
                        }
                    }),
                        data.markers.length > 1 && e && !isNaN(e))
                ) {
                    map.fitBounds(n);
                    var i = google.maps.event.addListener(
                        map,
                        "zoom_changed",
                        function () {
                            if (
                                (google.maps.event.removeListener(i),
                                    map.getZoom() > e || 0 === map.getZoom())
                            )
                                map.setZoom(e);
                        }
                    );
                }
            }),
            (window.MapsLoader = MapsLoader);
    },
    692: function (t, e, n) {
        "use strict";
        function ResponsiveMenu(t, e) {
            (this.responsive = t), (this.root = e || i("body")), this.init();
        }
        t.exports = ResponsiveMenu;
        var i = window.jQuery;
        (ResponsiveMenu.prototype.init = function init() {
            if (this.root.is("body")) this.subscribe();
            this.initStyles();
        }),
            (ResponsiveMenu.prototype.subscribe = function t() {
                this.root.on(
                    "click",
                    ".u-menu .menu-collapse",
                    function (t) {
                        t.preventDefault();
                        var e = i(t.currentTarget).closest(".u-menu");
                        if (ResponsiveMenu.isActive(e)) this.close(e);
                        else this.open(e);
                    }.bind(this)
                ),
                    this.root.on(
                        "click",
                        ".u-menu .u-menu-close",
                        function (t) {
                            t.preventDefault();
                            var e = i(t.currentTarget).closest(".u-menu");
                            this.close(e);
                        }.bind(this)
                    ),
                    this.root.on(
                        "click",
                        ".u-menu .u-menu-overlay",
                        function (t) {
                            var e = i(t.currentTarget).closest(".u-menu.open");
                            this.close(e);
                        }.bind(this)
                    ),
                    this.root.find(".u-menu").on(
                        "click",
                        ".u-nav-container-collapse .u-nav-link",
                        function (t) {
                            var e = i(t.currentTarget),
                                n;
                            if (!e.siblings(".u-nav-popup").length) {
                                var o = e.attr("href");
                                if (o && -1 !== o.indexOf("#")) {
                                    var a = i(t.currentTarget).closest(".u-menu");
                                    this.close(a);
                                }
                            }
                        }.bind(this)
                    ),
                    this.root
                        .find(".u-menu:not(.u-menu-one-level)")
                        .on("click", ".u-nav-container-collapse .u-nav-link", function (t) {
                            var e = i(t.currentTarget).siblings(".u-nav-popup"),
                                nav,
                                n =
                                    e.closest(".u-menu").attr("data-submenu-level") || "on-click";
                            if (e.length && "on-click" === n) {
                                t.preventDefault(),
                                    t.stopPropagation(),
                                    (t.returnValue = false),
                                    e.one(
                                        "transitionend webkitTransitionEnd oTransitionEnd",
                                        function (t) {
                                            t.stopPropagation(),
                                                e.removeClass("animating"),
                                                e.toggleClass("open"),
                                                e.css({
                                                    "max-height": e.is(".open") ? "none" : "",
                                                    visibility: "",
                                                }),
                                                e
                                                    .find(".open")
                                                    .removeClass("open")
                                                    .css("max-height", "");
                                        }
                                    ),
                                    e.css({ "max-height": "none", visibility: "visible" });
                                var o = e.outerHeight();
                                e.css("max-height", e.is(".open") ? o : 0),
                                    e.addClass("animating"),
                                    e[0].offsetHeight,
                                    e.css("max-height", e.is(".open") ? 0 : o);
                            }
                        }),
                    i(window).on(
                        "resize",
                        function () {
                            if (this.screenWidth !== window.innerWidth)
                                i(".u-menu.open").each(
                                    function (t, el) {
                                        this.close(i(el));
                                    }.bind(this)
                                );
                        }.bind(this)
                    ),
                    i(document).keyup(
                        function (t) {
                            if (27 === t.keyCode)
                                i(".u-menu.open").each(
                                    function (t, el) {
                                        this.close(i(el));
                                    }.bind(this)
                                );
                        }.bind(this)
                    ),
                    i(this.root).on(
                        "mouseenter touchstart",
                        ".u-nav-container ul > li",
                        function (t) {
                            ResponsiveMenu.fixDirection(this.root, i(t.currentTarget));
                        }.bind(this)
                    );
            }),
            (ResponsiveMenu.prototype.initStyles = function t() {
                this.root.find(".u-menu").each(function () {
                    var menu = i(this),
                        style = menu.find(".offcanvas-style"),
                        t =
                            menu
                                .find(".u-nav-container-collapse .u-sidenav")
                                .attr("data-offcanvas-width") || 250;
                    if (!style.length)
                        (style = i('<style class="offcanvas-style"></style>')),
                            menu.append(style);
                    style.html(
                        "            .u-offcanvas .u-sidenav { flex-basis: {width} !important; }            .u-offcanvas:not(.u-menu-open-right) .u-sidenav { margin-left: -{width}; }            .u-offcanvas.u-menu-open-right .u-sidenav { margin-right: -{width}; }            @keyframes menu-shift-left    { from { left: 0;        } to { left: {width};  } }            @keyframes menu-unshift-left  { from { left: {width};  } to { left: 0;        } }            @keyframes menu-shift-right   { from { right: 0;       } to { right: {width}; } }            @keyframes menu-unshift-right { from { right: {width}; } to { right: 0;       } }            ".replace(
                            /\{width\}/g,
                            t + "px"
                        )
                    );
                });
            }),
            (ResponsiveMenu.prototype.onResponsiveResize = function t() {
                i(".u-menu").each(
                    function (t, el) {
                        var e = i(el).attr("data-responsive-from") || "MD",
                            n = this.responsive.modes.indexOf(e),
                            o = this.responsive.modes.slice(n);
                        ResponsiveMenu.toggleResponsive(
                            el,
                            -1 !== o.indexOf(this.responsive.mode)
                        ),
                            this.megaResize(el, 1);
                    }.bind(this)
                );
            }),
            (ResponsiveMenu.toggleResponsive = function t(e, n) {
                i(e).toggleClass("u-enable-responsive", n);
            }),
            (ResponsiveMenu.prototype.close = function close(menu, t) {
                if (!window.app || !window.app.modes) {
                    if (ResponsiveMenu.isActive(menu)) this.closeMenu(menu, t);
                } else if (
                    (this.closeMenu(menu, t),
                        this.setOverlayOpacity(menu),
                        ResponsiveMenu.isOffcanvasMode(menu))
                )
                    app.modes().resetOffCanvas();
            }),
            (ResponsiveMenu.prototype.closeMenu = function t(menu, e) {
                if ((this.enableScroll(), ResponsiveMenu.isOffcanvasMode(menu)))
                    this.offcanvasMenuClose(menu);
                else this.overlayMenuClose(menu);
                this.root.removeClass("menu-overlay"), this.hideOverlay(menu, e);
            }),
            (ResponsiveMenu.prototype.open = function open(menu) {
                if (
                    (this.root.addClass("menu-overlay"), !window.app || !window.app.modes)
                ) {
                    if (!ResponsiveMenu.isActive(menu)) this.openMenu(menu);
                } else if (
                    (this.setOverlayOpacity(menu),
                        this.openMenu(menu),
                        ResponsiveMenu.isOffcanvasMode(menu))
                )
                    app.modes().setOffCanvas();
            }),
            (ResponsiveMenu.prototype.setOverlayOpacity = function t(menu) {
                menu.find(".u-menu-overlay").css("opacity", "");
            }),
            (ResponsiveMenu.prototype.openMenu = function open(menu) {
                if (
                    ((this.screenWidth = window.innerWidth),
                        this.disableScroll(),
                        ResponsiveMenu.isOffcanvasMode(menu))
                )
                    this.offcanvasMenuOpen(menu);
                else this.overlayMenuOpen(menu);
                this.showOverlay(menu);
            }),
            (ResponsiveMenu.prototype.offcanvasMenuOpen = function t(menu) {
                var e = this.root;
                if (
                    (menu.addClass("open"),
                        e.addClass("u-offcanvas-opened"),
                        menu.is(".u-offcanvas-shift"))
                )
                    e.addClass(
                        "u-offcanvas-shifted-" +
                        (menu.hasClass("u-menu-open-right") ? "right" : "left")
                    );
            }),
            (ResponsiveMenu.prototype.offcanvasMenuClose = function t(menu) {
                if (
                    (menu.removeClass("open"),
                        this.root.removeClass(
                            "u-offcanvas-opened u-offcanvas-shifted-left u-offcanvas-shifted-right"
                        ),
                        menu.is(".u-offcanvas-shift"))
                )
                    this.root.addClass(
                        "u-offcanvas-unshifted-" +
                        (menu.hasClass("u-menu-open-right") ? "right" : "left")
                    );
            }),
            (ResponsiveMenu.prototype.megaResize = function t(menu, e) {
                if (((menu = i(menu)), (e = e || 1), menu.hasClass("u-menu-mega")))
                    menu.outerHeight(),
                        menu.each(function () {
                            var menu = i(this);
                            menu.find(".u-mega-popup").each(function () {
                                var t = i(this),
                                    n = t.attr("data-mega-width") || "content";
                                if ("custom" !== n && "content" !== n) {
                                    var o =
                                        "sheet" === n
                                            ? menu.closest(".u-sheet, .u-body")
                                            : menu.closest("body, .u-body"),
                                        a = o.offset(),
                                        s = o.outerWidth();
                                    if (
                                        (t.css({ left: "", width: "" }),
                                            t.removeClass("u-popup-left u-popup-right"),
                                            t.addClass("u-hidden"),
                                            menu.outerHeight(),
                                            t.removeClass("u-hidden"),
                                            menu.outerHeight(),
                                            "content" === n)
                                    )
                                        return t.css("width", "auto"), void 0;
                                    var u = t.offset(),
                                        l = (a.left - u.left) / e,
                                        f = parseFloat(t.css("left") || 0);
                                    t.css({ left: f + Math.round(l) + "px", width: s + "px" });
                                }
                            });
                        });
            }),
            (ResponsiveMenu.prototype.hideOverlay = function t(menu, e) {
                var overlay = menu.find(".u-menu-overlay"),
                    n = function () {
                        if (!ResponsiveMenu.isActive(menu))
                            menu.find(".u-nav-container-collapse").css("width", ""),
                                this.root.filter("body").find("header.u-sticky").css("top", "");
                    }.bind(this);
                if (e) n();
                else overlay.fadeOut(500, n);
            }),
            (ResponsiveMenu.prototype.showOverlay = function t(menu) {
                var overlay = menu.find(".u-menu-overlay");
                menu.find(".u-nav-container-collapse").css("width", "100%"),
                    overlay.fadeIn(500);
            }),
            (ResponsiveMenu.prototype.disableScroll = function t() {
                if (this.root.is("body"))
                    document.documentElement.style.overflow = "hidden";
            }),
            (ResponsiveMenu.prototype.enableScroll = function t() {
                if (this.root.is("body")) document.documentElement.style.overflow = "";
            }),
            (ResponsiveMenu.prototype.overlayMenuOpen = function t(menu) {
                menu.addClass("open");
            }),
            (ResponsiveMenu.prototype.overlayMenuClose = function t(menu) {
                menu.removeClass("open");
            }),
            (ResponsiveMenu.isOffcanvasMode = function (menu) {
                return menu.is(".u-offcanvas");
            }),
            (ResponsiveMenu.isActive = function (menu) {
                return menu.hasClass("open");
            }),
            (ResponsiveMenu.fixDirection = function t(e, el) {
                if (el && el.length) {
                    e = i(e);
                    var n = "u-popup-left",
                        o = "u-popup-right",
                        a;
                    i(el)
                        .children(".u-nav-popup")
                        .each(function () {
                            var t = i(this);
                            t.removeClass(n + " " + o);
                            var a = t.parent().closest(".u-nav-popup"),
                                s = t.attr("data-mega-width") || "content",
                                u = Boolean(a.length);
                            if ("content" === s) {
                                var l = "";
                                if (t.parents("." + n).length) l = n;
                                else if (t.parents("." + o).length) l = o;
                                if (l) t.addClass(l);
                                else {
                                    var f = t[0].getBoundingClientRect(),
                                        c = e[0].getBoundingClientRect(),
                                        h =
                                            "undefined" == typeof app ? 1 : app.editor.preview.scale,
                                        p = f.right - c.right,
                                        m = c.left - f.left;
                                    if (p > 1)
                                        t.css("left", u ? "" : (c.right - f.right) / h + "px"),
                                            t.css("right", u ? "" : "auto"),
                                            t.addClass(n);
                                    else if (m > 1)
                                        t.css("left", u ? "" : "0px"),
                                            t.css("right", u ? "" : "auto"),
                                            t.addClass(o);
                                }
                            }
                        });
                }
            }),
            (window.ResponsiveMenu = ResponsiveMenu);
    },
    8: function (t, e, n) {
        "use strict";
        t.exports = { options: { usePureJavaScript: false } };
    },
    86: function (t, e, n) {
        "use strict";
        function i() {
            throw new Error("setTimeout has not been defined");
        }
        function o() {
            throw new Error("clearTimeout has not been defined");
        }
        function a(t) {
            if (p === setTimeout) return setTimeout(t, 0);
            if ((p === i || !p) && setTimeout)
                return (p = setTimeout), setTimeout(t, 0);
            try {
                return p(t, 0);
            } catch (e) {
                try {
                    return p.call(null, t, 0);
                } catch (e) {
                    return p.call(this, t, 0);
                }
            }
        }
        function s(t) {
            if (m === clearTimeout) return clearTimeout(t);
            if ((m === o || !m) && clearTimeout)
                return (m = clearTimeout), clearTimeout(t);
            try {
                return m(t);
            } catch (e) {
                try {
                    return m.call(null, t);
                } catch (e) {
                    return m.call(this, t);
                }
            }
        }
        function u() {
            if (g && y) {
                if (((g = false), y.length)) v = y.concat(v);
                else w = -1;
                if (v.length) l();
            }
        }
        function l() {
            if (!g) {
                var t = a(u);
                g = true;
                for (var e = v.length; e;) {
                    for (y = v, v = []; ++w < e;) if (y) y[w].run();
                    (w = -1), (e = v.length);
                }
                (y = null), (g = false), s(t);
            }
        }
        function f(t, e) {
            (this.fun = t), (this.array = e);
        }
        function c() { }
        var h = (t.exports = {}),
            p,
            m;
        !(function () {
            try {
                if ("function" == typeof setTimeout) p = setTimeout;
                else p = i;
            } catch (t) {
                p = i;
            }
            try {
                if ("function" == typeof clearTimeout) m = clearTimeout;
                else m = o;
            } catch (t) {
                m = o;
            }
        })();
        var v = [],
            g = false,
            y,
            w = -1;
        (h.nextTick = function (t) {
            var e = new Array(arguments.length - 1);
            if (arguments.length > 1)
                for (var n = 1; n < arguments.length; n++) e[n - 1] = arguments[n];
            if ((v.push(new f(t, e)), 1 === v.length && !g)) a(l);
        }),
            (f.prototype.run = function () {
                this.fun.apply(null, this.array);
            }),
            (h.title = "browser"),
            (h.browser = true),
            (h.env = {}),
            (h.argv = []),
            (h.version = ""),
            (h.versions = {}),
            (h.on = c),
            (h.addListener = c),
            (h.once = c),
            (h.off = c),
            (h.removeListener = c),
            (h.removeAllListeners = c),
            (h.emit = c),
            (h.prependListener = c),
            (h.prependOnceListener = c),
            (h.listeners = function (t) {
                return [];
            }),
            (h.binding = function (t) {
                throw new Error("process.binding is not supported");
            }),
            (h.cwd = function () {
                return "/";
            }),
            (h.chdir = function (t) {
                throw new Error("process.chdir is not supported");
            }),
            (h.umask = function () {
                return 0;
            });
    },
    96: function (t, e, n) {
        "use strict";
        t.exports = {
            IMAGES: "IMAGES",
            DOCUMENTS: "DOCUMENTS",
            VIDEO: "VIDEO",
            AUDIO: "AUDIO",
            CUSTOM: "CUSTOM",
        };
    },
    9796: function (t, e, n) {
        "use strict";
        n(9797), n(9863);
    },
    9797: function (t, e, n) {
        "use strict";
        n(9798);
    },
    9798: function (t, e, n) {
        "use strict";
        n(9799),
            n(9800),
            n(363),
            n(9801),
            n(9802),
            n(9805),
            n(9806),
            n(9807),
            n(673),
            n(691),
            n(9808),
            n(9816),
            n(9817),
            n(9819),
            n(9821),
            n(9822),
            n(9823),
            n(9824),
            n(469),
            n(9825),
            n(9830),
            n(9831),
            n(9833),
            n(9834),
            n(9836),
            n(9838),
            n(9839),
            n(9841),
            n(9842),
            n(9843),
            n(9844),
            n(9845),
            n(9846),
            n(9847),
            n(9848),
            n(9849),
            n(9850),
            n(9851),
            n(9852),
            n(9855),
            n(9856),
            n(9857),
            n(9860),
            n(9862);
    },
    9799: function (t, e, n) {
        "use strict";
        function i() {
            if (window && document && "complete" !== document.readyState) {
                var t = document.body;
                if (
                    t &&
                    t.classList &&
                    "function" == typeof t.classList.add &&
                    "function" == typeof t.classList.remove &&
                    "function" == typeof t.appendChild &&
                    "function" == typeof document.createElement &&
                    "function" == typeof window.addEventListener
                ) {
                    var e = "u-disable-duration";
                    t.classList.add(e);
                    var styleNode = document.createElement("style");
                    (styleNode.innerHTML =
                        ".u-disable-duration * {transition-duration: 0s !important;}"),
                        t.appendChild(styleNode),
                        window.addEventListener("load", function () {
                            t.classList.remove(e);
                        });
                }
            }
        }
        i();
    },
    9800: function (t, e, n) {
        "use strict";
        if (!("CSS" in window)) window.CSS = {};
        if (!("supports" in window.CSS))
            "use strict",
                (window.CSS._cacheSupports = {}),
                (window.CSS.supports = function (t, e) {
                    function n(t, e) {
                        var style = document.createElement("div").style;
                        if (void 0 === e) {
                            var n = function (t, e) {
                                var n = t.split(e);
                                if (n.length > 1)
                                    return n
                                        .map(function (t, index, e) {
                                            return index % 2 == 0 ? t + e[index + 1] : "";
                                        })
                                        .filter(Boolean);
                            },
                                i = n(t, /([)])\s*or\s*([(])/gi);
                            if (i)
                                return i.some(function (t) {
                                    return window.CSS.supports(t);
                                });
                            var o = n(t, /([)])\s*and\s*([(])/gi);
                            if (o)
                                return o.every(function (t) {
                                    return window.CSS.supports(t);
                                });
                            style.cssText = t.replace("(", "").replace(/[)]$/, "");
                        } else style.cssText = t + ":" + e;
                        return !!style.length;
                    }
                    var i = [t, e].toString();
                    if (i in window.CSS._cacheSupports)
                        return window.CSS._cacheSupports[i];
                    else return (window.CSS._cacheSupports[i] = n(t, e));
                });
    },
    9801: function (t, e, n) {
        "use strict";
        function i(t) {
            if (
                ((this.prevMode = ""),
                    (this.resizeTimeout = 50),
                    (this.sheet = {
                        XS: 340,
                        SM: 540,
                        MD: 720,
                        LG: 940,
                        XL: 1140,
                        XXL: 1320,
                    }),
                    (this.mediaMax = { XS: 575, SM: 767, MD: 991, LG: 1199 }),
                    (this.modes = ["XL", "LG", "MD", "SM", "XS"]),
                    (this.defaultMode = "XL"),
                    document.body.classList.contains("u-xxl-mode"))
            )
                (this.mediaMax.XXL = 1399),
                    (this.defaultMode = "XXL"),
                    this.modes.splice(0, 0, "XXL");
            (this._handlers = []),
                this.modes.forEach(function (t) {
                    var e = document.body.style.getPropertyValue(
                        "--theme-sheet-width-" + t.toLowerCase()
                    );
                    if (((e = parseFloat(e)), Number.isFinite(e))) this.sheet[t] = e;
                }),
                this.init(t || []);
        }
        var ResponsiveMenu = n(692),
            o = n(10);
        Object.defineProperty(i.prototype, "mode", {
            get: function () {
                var t =
                    (document.documentElement || document.body).clientWidth ||
                    window.innerWidth;
                if (this.scrolbar)
                    document.documentElement.setAttribute("style", "overflow-y:hidden"),
                        (t =
                            (document.documentElement || document.body).clientWidth ||
                            window.innerWidth),
                        document.documentElement.removeAttribute("style");
                for (var e in this.mediaMax)
                    if (this.mediaMax.hasOwnProperty(e))
                        if (t <= this.mediaMax[e]) return e;
                return this.defaultMode;
            },
        }),
            (i.prototype.init = function init(t) {
                o(
                    function () {
                        this.update(true),
                            (this.scrolbar = !!(
                                document.body &&
                                document.body.clientWidth !== document.body.scrollWidth
                            ));
                    }.bind(this)
                ),
                    o(window).on(
                        "resize",
                        function () {
                            this.update(true);
                        }.bind(this)
                    ),
                    t.forEach(function (t) {
                        this._handlers.push(new t(this));
                    }, this),
                    this.update();
            }),
            (i.prototype.update = function update(t) {
                var e = function () {
                    if (
                        this.mode !== this.prevMode ||
                        this.getContentWidth() < this.sheet[this.mode]
                    )
                        this._handlers.forEach(function (t) {
                            if ("function" == typeof t.onResponsiveBefore)
                                t.onResponsiveBefore();
                        }),
                            this.responsiveClass(o("html")),
                            this._handlers.forEach(function (t) {
                                if ("function" == typeof t.onResponsiveAfter)
                                    t.onResponsiveAfter();
                            }),
                            (this.prevMode = this.mode);
                    this._handlers.forEach(function (t) {
                        if ("function" == typeof t.onResponsiveResize)
                            t.onResponsiveResize();
                    });
                }.bind(this);
                if (t)
                    clearTimeout(this._timeoutId),
                        (this._timeoutId = setTimeout(e, this.resizeTimeout));
                else e();
            }),
            (i.prototype.responsiveClass = function t(e) {
                var removeList = Object.keys(this.sheet)
                    .map(function (t) {
                        return "u-responsive-" + t.toLowerCase();
                    })
                    .join(" ");
                e.removeClass(removeList),
                    e.addClass("u-responsive-" + this.mode.toLowerCase());
            }),
            (i.prototype.getContentWidth = function () {
                return o(".u-body section:first").parent().width();
            }),
            o(function () {
                (window._responsive = new i([ResponsiveMenu])),
                    o(document).on(
                        "click",
                        "[data-href]:not(.u-back-to-top), [data-post-link]",
                        function (t) {
                            if (!t.isDefaultPrevented()) {
                                var e = o(this),
                                    url = e.attr("data-href") || e.attr("data-post-link"),
                                    n = e.attr("data-target") || "";
                                if (n) window.open(url, n);
                                else window.location.href = url;
                            }
                        }
                    );
            });
    },
    9802: function (t, e, n) {
        "use strict";
        function i() {
            return {
                submit: function (t) {
                    t.preventDefault(), t.stopPropagation();
                    var form = h(this);
                    form.find('input[type="submit"]').prop("disabled", true);
                    var url = form.attr("action"),
                        e = form.attr("source"),
                        n = form.attr("method") || "POST",
                        i = "";
                    if (
                        (c(form),
                            ("email" === e || "customphp" === e) &&
                            "true" === form.attr("redirect"))
                    )
                        i =
                            form.attr("redirect-url") &&
                                !h.isNumeric(form.attr("redirect-url"))
                                ? form.attr("redirect-url")
                                : form.attr("redirect-address");
                    if (
                        "email" === e &&
                        !h(form).find('input[name="npspec-referer"]').length
                    )
                        h(form).append(
                            '<input type="hidden" name="npspec-referer" value="' +
                            window.location.href +
                            '">'
                        );
                    var o = document.location && document.location.protocol,
                        u;
                    if (
                        navigator.userAgent &&
                        navigator.userAgent.match(/firefox|fxios/i) &&
                        "file:" === o
                    )
                        FormMessage.showError(
                            form,
                            "The page is opened as a file on disk and sending emails is not supported.\n" +
                            "Sending emails works only for pages opened from the domain."
                        );
                    else {
                        var services = form.find('input[name="formServices"]'),
                            l = Const.formActionUrl + "v2/form/process",
                            f = url === l;
                        if (services.length)
                            s(form, {
                                url: l,
                                method: "POST",
                                redirectAddress: i,
                                showSuccess: f,
                                success: function () {
                                    if (!f) a(form, { url: url, method: n, redirectAddress: i });
                                },
                            });
                        else a(form, { url: url, method: n, redirectAddress: i });
                    }
                },
                click: function (t) {
                    t.preventDefault(),
                        t.stopPropagation(),
                        h(this).find(".u-form-send-success").hide(),
                        h(this).find(".u-form-send-error").hide();
                    var form = h(this).closest("form");
                    if ((o(form), !p.signatureValidation(form)))
                        return (
                            FormMessage.showError(form, "The Signature field is required"),
                            void 0
                        );
                    if (!f(form))
                        return (
                            FormMessage.showError(form, "The File field is required"), void 0
                        );
                    else
                        return (
                            p.addSignatureFiles(form),
                            form.find('input[type="submit"]').click(),
                            void 0
                        );
                },
            };
        }
        function o(form) {
            form.find(".u-form-checkbox-group").each(function () {
                var t = h(this),
                    e = t.find("input"),
                    n = e.length,
                    i = n > 0 ? e[0] : null,
                    o;
                if (e.attr("required") || t.attr("data-required")) {
                    e.removeAttr("required"), t.attr("data-required", "required");
                    for (var a = false, s = 0; s < n; s++)
                        if (e[s].checked) {
                            a = true;
                            break;
                        }
                    var u = !a ? "At least one checkbox must be selected." : "";
                    i.setCustomValidity(u);
                }
            });
        }
        function a(form, t) {
            if (/list-manage[1-9]?.com/i.test(t.url)) return u(form, t.url), void 0;
            s(form, {
                url: t.url,
                method: t.method,
                redirectAddress: t.redirectAddress,
                success: l,
                showSuccess: true,
            });
        }
        function s(form, t) {
            var e = function () {
                h.ajax({
                    type: t.method,
                    url: t.url,
                    data: new FormData(form[0]),
                    dataType: "json",
                    processData: false,
                    contentType: false,
                })
                    .done(function (data, e) {
                        if (
                            (data && (data.success || data.ok)) ||
                            (!data && "success" === e)
                        ) {
                            if (t.showSuccess) FormMessage.showSuccess(form);
                            if (t.redirectAddress)
                                setTimeout(function () {
                                    window.location.replace(t.redirectAddress);
                                }, 2e3);
                            else t.success(form);
                        } else (data = data || {}), FormMessage.showError(form, data.error, data.errorId, data.email);
                    })
                    .fail(function () {
                        FormMessage.showError(form);
                    });
            };
            if (void 0 !== window.recaptchaObject)
                window.recaptchaObject.executeContact(e);
            else e();
        }
        function u(form, url) {
            var t = form.find("input[name=name]").val(),
                email = form.find("input[name=email]").val(),
                data = { Email: email, EMAIL: email };
            if (t) (data.Name = t), (data.FNAME = t);
            var e = form.find("input, textarea");
            h.each(e, function (index, t) {
                var e = h(t).attr("name"),
                    n = h(t).val();
                if (e && n) data[e.toUpperCase()] = n;
            });
            var n =
                (url = url.replace("/post?", "/post-json?") + "&c=?").indexOf("u=") + 2;
            n = url.substring(n, url.indexOf("&", n));
            var i = url.indexOf("id=") + 3;
            (i = url.substring(i, url.indexOf("&", i))),
                (data["b_" + n + "_" + i] = ""),
                h
                    .ajax({ url: url, data: data, dataType: "jsonp" })
                    .done(function (t) {
                        var e;
                        if ("success" === t.result || /already/.test(t.msg))
                            FormMessage.showSuccess(form), l(form);
                        else FormMessage.showError(form, t.msg);
                    })
                    .fail(function () {
                        FormMessage.showError(form);
                    });
        }
        function l(form) {
            var dialog = new Dialog(form);
            setTimeout(function () {
                dialog.close();
            }, 2e3);
        }
        function f(form) {
            var t = form.find('input[type="file"][required]');
            if (!t.length) return true;
            else
                return t.toArray().every(function (input) {
                    return input.files.length;
                });
        }
        function c(form) {
            var t;
            form.find("input[type=tel]").each(function () {
                var t = h(this),
                    e = t.parents(".iti").find(".iti__selected-flag").attr("title") || "";
                t.val(e + " " + t.val());
            });
        }
        var h = n(10),
            Dialog = n(195),
            p = n(9803),
            FormMessage = n(2655),
            Const = n(9804);
        h(function () {
            var form = new i();
            h(
                "form.u-form-vertical:not(.u-form-custom-backend), form.u-form-horizontal:not(.u-form-custom-backend)"
            ).submit(form.submit),
                h(".u-form .u-btn-submit").click(form.click);
        }),
            (window.MailChimpForm = i);
    },
    9803: function (t, e, n) {
        "use strict";
        function i(t) {
            var e = JSON.parse(t.getAttribute("data-canvas-default-options") || "{}");
            a(t, e);
        }
        function o(t) {
            var e,
                n = t.clone().get(0),
                i = JSON.parse(n.getAttribute("data-canvas-default-options") || "{}");
            return a(n, i), n.toDataURL();
        }
        function a(t, e) {
            var n = t.getContext("2d");
            n.clearRect(0, 0, e.width, e.height),
                (n.lineWidth = e.lineWidth),
                (n.strokeStyle = e.strokeStyle),
                (n.fillStyle = e.fillStyle),
                n.fillRect(0, 0, e.width, e.height),
                n.beginPath(),
                n.moveTo(e.signatureLine.startX, e.signatureLine.startY),
                n.lineTo(e.signatureLine.endX, e.signatureLine.endY),
                n.stroke();
        }
        function s(t, fileName) {
            for (
                var e = t.split(","),
                n = e[0].match(/:(.*?);/)[1],
                i = atob(e[1]),
                o = i.length,
                a = new Uint8Array(o);
                o--;

            )
                a[o] = i.charCodeAt(o);
            var s = new Blob([a], { type: n });
            return new File([s], fileName);
        }
        var u = (t.exports = {});
        (u.signatureValidation = function t(form) {
            var e = form.find("canvas"),
                n,
                data;
            if (!e.length) return true;
            if (!e.attr("data-required")) return true;
            else return o(e) !== e.get(0).toDataURL();
        }),
            (u.addSignatureFiles = function t(form) {
                form.find("canvas").each(function () {
                    var t = $(this).get(0),
                        e,
                        n = s(t.toDataURL(), "signature.png"),
                        o = form.find(".u-form-signature-file");
                    if (o.length) o.remove();
                    var file = $(
                        '<input class="u-form-signature-file" style="display:none" type="file" name="file">'
                    );
                    form.append(file);
                    var a = new DataTransfer();
                    a.items.add(n), (file[0].files = a.files), i(t);
                });
            });
    },
    9804: function (t, e, n) {
        "use strict";
        var Const;
        (t.exports = {}).formActionUrl = [
            "https://forms.",
            "n",
            "i",
            "c",
            "e",
            "p",
            "a",
            "g",
            "e",
            "srv.com/",
        ].join("");
    },
    9805: function (t, e, n) {
        "use strict";
        var i = n(485).evaluate,
            o = n(486);
        $(function () {
            function t(t) {
                var form;
                $(t && t.target)
                    .closest("form")
                    .each(function (index, form) {
                        var t = new o(form).getScope();
                        $(form)
                            .find("[data-expression]")
                            .each(function () {
                                var e = $(this),
                                    n = e.closest(".u-form-calc").find(".u-calc-input");
                                try {
                                    var o = e.attr("data-expression"),
                                        a = i(o, t);
                                    e.text(a), n.val(a);
                                } catch (t) {
                                    e.text(0), n.val(0);
                                }
                            });
                    });
            }
            $("body").on("input", "input[type=number][name]", t),
                $("body").on(
                    "change",
                    "input[type=range][name], input[type=radio][name], input[type=checkbox][name], select[name]",
                    t
                );
        });
    },
    9806: function (t, e, n) {
        "use strict";
        function i() {
            $(".u-form input[type=file]").change(function () {
                var form = $(this).closest(".u-form");
                l(form), f(form);
            });
        }
        function o() {
            $(".u-form .u-upload-button").click(function (t) {
                t.stopPropagation(),
                    t.preventDefault(),
                    $(this).closest(".u-form").find('input[type="file"]').click();
            });
        }
        function a() {
            $(".u-form").on("click", ".u-file-remove", function (t) {
                t.stopPropagation(), t.preventDefault();
                var e = $(this),
                    form = e.closest(".u-form"),
                    n = e.closest(".u-file-item"),
                    i = parseFloat(n.attr("data-i"));
                if (Number.isFinite(i)) c(form, i), f(form);
            });
        }
        function s() {
            $(".u-form").on("reset", function () {
                var form = $(this).closest(".u-form"),
                    input = form.find('input[type="file"]').get(0);
                if (input) (input.files = new DataTransfer().files), f(form);
            });
        }
        function u() {
            $('.u-form input[type="file"]').each(function () {
                var t = $(this),
                    e = t.attr("accept");
                if (e in FormFileAccept) e = FormFileAccept[e];
                t.attr("accept", e);
            });
        }
        function l(form) {
            var input = form.find('input[type="file"]').get(0),
                t = [];
            if (input)
                if (
                    (Array.from(input.files).forEach(function (file, e) {
                        if (file.size > h || e >= p) t.push({ i: e, name: file.name });
                    }),
                        t.length)
                ) {
                    c(
                        form,
                        t.map(function (t) {
                            return t.i;
                        })
                    );
                    var e = '"{files}" file(s) size exceeds maximum limit.',
                        n = t
                            .map(function (t) {
                                return t.name;
                            })
                            .join(", ");
                    FormMessage.showError(form, e.replace(/\{files\}/, n));
                }
        }
        function f(form) {
            form.find(".u-file-list .u-file-item:not(.u-file-template)").remove();
            var input = form.find('input[type="file"]').get(0),
                t = form.find(".u-file-template");
            if (input)
                Array.from(input.files).forEach(function (file, e) {
                    var n = t.clone();
                    n.removeClass("u-file-template"),
                        n.find(".u-file-name").text(file.name),
                        n.attr("data-i", e),
                        form.find(".u-file-list").append(n);
                });
        }
        function c(form, index) {
            var input = form.find('input[type="file"]').get(0),
                t = new DataTransfer();
            if (input) {
                if (!Array.isArray(index)) index = [index];
                Array.from(input.files).forEach(function (file, e) {
                    if (!index.includes(e)) t.items.add(file);
                }),
                    (input.files = t.files);
            }
        }
        var FormFileAccept = n(489),
            FormMessage = n(2655),
            h = 10 * 1024 * 1024,
            p = 10;
        $(function () {
            i(), o(), a(), s(), u();
        });
    },
    9807: function (t, e, n) {
        "use strict";
        function i(el) {
            var video;
            el.find(".u-video .embed-responsive-item").each(function () {
                if (this.matches("video")) this.pause();
                else if (this.matches("iframe")) {
                    var t = this.getAttribute("src");
                    this.setAttribute("src", t.replace(/autoplay=1?/gi, ""));
                }
            });
        }
        function o(t) {
            var video;
            (t.hasClass("u-video") ? t : t.find(".u-video"))
                .find(".embed-responsive-item[data-autoplay]")
                .each(function () {
                    a(s(this).closest(".u-video"));
                });
        }
        function a(video) {
            if (!video.closest(".u-dialog-block:not(.u-dialog-open)").length) {
                var t = video.find("iframe"),
                    e = t.attr("data-src") || t.attr("src"),
                    n = video.find("video");
                if (e)
                    video.addClass("active"),
                        (e += (-1 === e.indexOf("?") ? "?" : "&") + "autoplay=1"),
                        t.attr("src", e);
                else if (n.length) {
                    video.addClass("active");
                    var i = n[0];
                    if (i.paused) i.play();
                    else i.pause();
                }
            }
        }
        var s = n(10);
        s(document).on("click", ".u-video-poster, .u-video video", function (t) {
            var e, video;
            t.preventDefault(), a(s(this).closest(".u-video"));
        }),
            s(function () {
                s(
                    ".u-video-background .u-video-poster, .u-video-background .u-video video"
                ).each(function () {
                    a(s(this).closest(".u-video"));
                }),
                    s(
                        ".u-video .embed-responsive-item:not(.lazyloading, .lazyloaded) + .u-video-poster"
                    ).each(function () {
                        var t = this.getAttribute("data-src");
                        if (t) this.style.backgroundImage = "url(" + t + ")";
                        o(s(this).closest(".u-video"));
                    });
            }),
            s(document).on("opened.np.dialog", ".u-dialog-block", function (t) {
                o(s(t.currentTarget));
            }),
            s(document).on("closed.np.dialog", ".u-dialog-block", function (t) {
                i(s(t.currentTarget));
            });
    },
    9808: function (t, e, n) {
        "use strict";
        var i = n(10),
            o = n(9809);
        i(function () {
            new o().init();
        });
    },
    9809: function (t, e, n) {
        "use strict";
        function i() {
            (this.galleries = null),
                (this._pswpElement = null),
                (this._listeners = []),
                (this._onItemClick = this.onItemClick.bind(this));
        }
        var Utils = n(9810),
            o = n(9811),
            a = n(9812),
            s = n(9813),
            u = n(10),
            l = n(9814),
            f = n(9815);
        (t.exports = i),
            Object.defineProperty(i.prototype, "pswpElement", {
                get: function () {
                    if (!this._pswpElement) this._pswpElement = u(".pswp")[0];
                    if (!this._pswpElement) {
                        var t = u(a.PSWP_TEMPLATE).appendTo(".u-body");
                        this._pswpElement = t[0];
                    }
                    return this._pswpElement;
                },
            }),
            (i.prototype.init = function () {
                this.initGallery(), this.subscribe(), this.checkHashUrl();
            }),
            (i.prototype.initGallery = function () {
                var t = {};
                u(a.LIGHTBOX_SELECTOR).each(function (t) {
                    u(this).attr("data-pswp-uid", t + 1);
                }),
                    u(a.GALLERY_ITEM_SELECTOR).each(function () {
                        var e = this.closest(a.LIGHTBOX_SELECTOR);
                        if (e && this !== e) {
                            var n = e.getAttribute("data-pswp-uid"),
                                gallery = t[n];
                            if (!gallery) gallery = { dom: e, items: [] };
                            this.setAttribute("data-pswp-item-id", gallery.items.length),
                                this.setAttribute("data-gallery-uid", n),
                                gallery.items.push(this),
                                (t[n] = gallery);
                        }
                    }),
                    (this.galleries = t);
            }),
            (i.prototype.subscribe = function () {
                for (var t = Object.keys(this.galleries), e = 0; e < t.length; e++)
                    for (
                        var id = t[e], gallery = this.galleries[id], n = 0;
                        n < gallery.items.length;
                        n++
                    ) {
                        var i = gallery.items[n];
                        u(i).on("click", this._onItemClick);
                    }
            }),
            (i.prototype.onItemClick = function (t) {
                var e = t.currentTarget;
                if (!e.matches("[data-href]")) {
                    t.preventDefault(), t.stopPropagation(), (t.returnValue = false);
                    var index = e.getAttribute("data-pswp-item-id"),
                        n = e.getAttribute("data-gallery-uid"),
                        gallery = this.galleries[n];
                    if (gallery && index >= 0) this.openOnClick(index, gallery);
                }
            }),
            (i.prototype.listen = function (t, e) {
                this._listeners.push({ event: t, func: e });
            }),
            (i.prototype.checkHashUrl = function () {
                var t = Utils.parseHash();
                if (t.pid && t.gid) this.openFromUrl(t.pid, this.galleries[t.gid]);
            }),
            (i.prototype.openOnClick = function (index, gallery) {
                var t = gallery.dom.getAttribute("data-pswp-uid");
                o.gallery(
                    gallery,
                    function (items) {
                        var e = this.buildOptions(t, items);
                        (e.index = parseFloat(index)),
                            (e.showPreviews =
                                gallery.dom.classList.contains("u-product-control")),
                            this.showPswp(items, e);
                    },
                    this
                );
            }),
            (i.prototype.openFromUrl = function (index, gallery) {
                var t = gallery.dom.getAttribute("data-pswp-uid");
                o.gallery(
                    gallery,
                    function (items) {
                        var e = this.buildOptions(t, items);
                        if (
                            ((e.showAnimationDuration = 0),
                                (e.index = parseFloat(index) - 1),
                                (e.showPreviews =
                                    gallery.dom.classList.contains("u-product-control")),
                                e.galleryPIDs)
                        )
                            for (var n = 0; n < items.length; n++)
                                if (items[n].pid == index) {
                                    e.index = n;
                                    break;
                                }
                        this.showPswp(items, e);
                    },
                    this
                );
            }),
            (i.prototype.showPswp = function (items, t) {
                if (Number.isFinite(t.index)) {
                    var e = new l(this.pswpElement, f, items, t);
                    s.init(e, t),
                        this._listeners.forEach(function (t) {
                            e.listen(t.event, t.func);
                        }),
                        e.init();
                }
            }),
            (i.prototype.buildOptions = function (t, items) {
                var e;
                return {
                    galleryUID: t,
                    getThumbBoundsFn: function (index) {
                        var t = window.pageYOffset || document.documentElement.scrollTop,
                            rect = items[index].el.getBoundingClientRect();
                        return { x: rect.left, y: rect.top + t, w: rect.width };
                    },
                    addCaptionHTMLFn: function (t, e, n) {
                        if (n) return (e.children[0].innerHTML = "<br><br>"), true;
                        if (!t.title) return (e.children[0].innerHTML = ""), false;
                        var i = t.title;
                        if (t.desc) i += "<br><small>" + t.desc + "</small>";
                        return (e.children[0].innerHTML = i), true;
                    },
                    showHideOpacity: true,
                    history: window.location === window.parent.location,
                };
            }),
            (window.Lightbox = i);
    },
    9810: function (t, e, n) {
        "use strict";
        var Utils;
        (t.exports = {}).parseHash = function t() {
            var hash = window.location.hash.substring(1),
                e = {};
            if (hash.length < 5) return e;
            for (var n = hash.split("&"), i = 0; i < n.length; i++)
                if (n[i]) {
                    var o = n[i].split("=");
                    if (!(o.length < 2)) e[o[0]] = o[1];
                }
            if (e.gid) e.gid = parseInt(e.gid, 10);
            return e;
        };
    },
    9811: function (t, e, n) {
        "use strict";
        function i(t) {
            return new Promise(function (e, n) {
                if (t.is(".u-background-effect ~ .u-container-layout"))
                    i(
                        t.prev(".u-background-effect").find(".u-background-effect-image")
                    ).then(function (t) {
                        e(t);
                    }, n);
                else if (t.is("img")) {
                    var a =
                        t[0].naturalWidth ||
                        t.attr("data-image-width") ||
                        t.attr("imgwidth") ||
                        t.width(),
                        s =
                            t[0].naturalHeight ||
                            t.attr("data-image-height") ||
                            t.attr("imgheight") ||
                            t.height();
                    e({
                        el: t[0],
                        src: t.attr("src"),
                        msrc: t.attr("src"),
                        w: parseFloat(a),
                        h: parseFloat(s),
                    });
                } else if (t.is(".u-video"))
                    e({ el: t[0], html: t.find(".u-background-video").get(0).outerHTML });
                else if (t.is(".u-gallery-item"))
                    i(t.find(".u-back-slide")).then(function (t) {
                        e(t);
                    }, n);
                else if (t.is(".u-back-slide"))
                    i(t.find(".u-back-image")).then(function (n) {
                        var i = t.siblings(".u-over-slide"),
                            o = t.closest(".u-gallery").is(".u-layout-thumbnails");
                        if (i.length && !o)
                            (n.title = i.find(".u-gallery-heading").html()),
                                (n.desc = i.find(".u-gallery-text").html());
                        e(n);
                    }, n);
                else
                    o(t).then(function (n) {
                        e({ el: t[0], src: n.src, msrc: n.src, w: n.width, h: n.height });
                    }, n);
            });
        }
        function o(t) {
            var e = t.css("background-image"),
                n = e.match(/url\(['"]?(.+?)['"]?\)/);
            return new Promise(function (t, i) {
                if (n) {
                    var o = new Image();
                    (o.onload = t.bind(null, o)),
                        (o.onerror = o.onabort = i),
                        (o.src = n[1]);
                } else i(new Error("Invalid source: " + e));
            });
        }
        var a = n(10),
            s;
        (t.exports = {}).gallery = function gallery(gallery, t, e) {
            e = e || null;
            var n = gallery.items.map(function (t) {
                return i((t = a(t)));
            });
            Promise.all(n).then(t.bind(e), console.log);
        };
    },
    9812: function (t, e, n) {
        "use strict";
        var i = (t.exports = {});
        (i.LIGHTBOX_SELECTOR = ".u-lightbox"),
            (i.GALLERY_ITEM_SELECTOR = [
                ".u-image:not(.u-carousel-thumbnail-image):not(.u-background-effect-image)",
                ".u-gallery-item",
                ".u-background-effect ~ .u-container-layout",
            ].join(", ")),
            (i.PSWP_TEMPLATE =
                '<div class="pswp" tabindex="-1" role="dialog" aria-hidden="true">\n' +
                '  <div class="pswp__bg"></div>\n' +
                '  <div class="pswp__scroll-wrap">\n' +
                '    <div class="pswp__container">\n' +
                '     <div class="pswp__item"></div>\n' +
                '     <div class="pswp__item"></div>\n' +
                '      <div class="pswp__item"></div>\n' +
                "    </div>\n" +
                '    <div class="pswp__ui pswp__ui--hidden">\n' +
                '      <div class="pswp__top-bar">\n ' +
                '       <div class="pswp__counter"></div>\n' +
                '        <button class="pswp__button pswp__button--close" title="Close (Esc)"></button>\n' +
                '        <button class="pswp__button pswp__button--share" title="Share"></button>\n' +
                '        <button class="pswp__button pswp__button--fs" title="Toggle fullscreen"></button>\n' +
                '        <button class="pswp__button pswp__button--zoom" title="Zoom in/out"></button>\n' +
                '        <div class="pswp__preloader">\n' +
                '          <div class="pswp__preloader__icn">\n' +
                '            <div class="pswp__preloader__cut">\n' +
                '              <div class="pswp__preloader__donut"></div>\n' +
                "            </div>\n" +
                "          </div>\n" +
                "        </div>\n" +
                "      </div>\n" +
                '      <div class="pswp__share-modal pswp__share-modal--hidden pswp__single-tap">\n' +
                '        <div class="pswp__share-tooltip"></div>\n' +
                "      </div>\n" +
                '      <button class="pswp__button pswp__button--arrow--left" title="Previous (arrow left)"></button>\n' +
                '      <button class="pswp__button pswp__button--arrow--right" title="Next (arrow right)"></button>\n' +
                '      <div class="pswp__previews" data-previews="data-previews" style="display: none"></div>' +
                '      <div class="pswp__caption">\n' +
                '        <div class="pswp__caption__center"></div>\n' +
                "      </div>\n" +
                "    </div>\n" +
                "  </div>\n" +
                "</div>");
    },
    9813: function (t, e, n) {
        "use strict";
        function i(gallery, selector) {
            var t = gallery.scrollWrap,
                e = t.querySelector(selector),
                n;
            (t.querySelector(".pswp__caption").style.display = "none"),
                (e.style.display = "");
        }
        function o(gallery, selector) {
            var t = gallery.scrollWrap,
                e = t.querySelector(selector),
                n;
            (t.querySelector(".pswp__caption").style.display = ""),
                (e.style.display = "none");
        }
        function add(gallery, selector) {
            var t = gallery.scrollWrap,
                items = gallery.items,
                e = t.querySelector(selector);
            items.forEach(function (t) {
                var preview = t.msrc,
                    n = document.createElement("img");
                n.setAttribute("src", preview),
                    n.addEventListener("click", function () {
                        gallery.goTo(items.indexOf(t));
                    }),
                    e.appendChild(n);
            });
        }
        function remove(gallery, selector) {
            var t, e;
            gallery.scrollWrap.querySelector(selector).innerHTML = "";
        }
        function a(gallery, selector) {
            var t = gallery.scrollWrap,
                e,
                preview = gallery.currItem.msrc,
                n,
                i;
            t.querySelector(selector)
                .querySelectorAll("img")
                .forEach(function (t) {
                    var e,
                        n = "active";
                    if (t.getAttribute("src") === preview)
                        t.classList.add(n), t.scrollIntoView({ behavior: "smooth" });
                    else t.classList.remove(n);
                });
        }
        var s;
        t.exports.init = function init(gallery, t) {
            var e = false;
            gallery.listen("gettingData", function () {
                if (!e) {
                    if (((e = true), t.showPreviews)) i(gallery, "[data-previews]");
                    else o(gallery, "[data-previews]");
                    add(gallery, "[data-previews]");
                }
            }),
                gallery.listen("close", function () {
                    remove(gallery, "[data-previews]");
                }),
                gallery.listen("afterChange", function () {
                    a(gallery, "[data-previews]");
                });
        };
    },
    9814: function (t, e, n) {
        "use strict";
        var i, o;
    /*! PhotoSwipe - v4.1.3 - 2019-01-08
     * http://photoswipe.com
     * Copyright (c) 2019 Dmitry Semenov; */ !(function (a, factory) {
            if (true)
                !(
                    void 0 !==
                    (o = "function" == typeof (i = factory) ? i.call(e, n, e, t) : i) &&
                    (t.exports = o)
                );
            else if ("object" == typeof e) t.exports = factory();
            else a.PhotoSwipe = factory();
        })(this, function () {
            var t = function (template, t, items, e) {
                var n = {
                    features: null,
                    bind: function (t, type, e, n) {
                        var i = (n ? "remove" : "add") + "EventListener";
                        type = type.split(" ");
                        for (var o = 0; o < type.length; o++)
                            if (type[o]) t[i](type[o], e, false);
                    },
                    isArray: function (t) {
                        return t instanceof Array;
                    },
                    createEl: function (t, e) {
                        var el = document.createElement(e || "div");
                        if (t) el.className = t;
                        return el;
                    },
                    getScrollY: function () {
                        var t = window.pageYOffset;
                        return void 0 !== t ? t : document.documentElement.scrollTop;
                    },
                    unbind: function (t, type, e) {
                        n.bind(t, type, e, true);
                    },
                    removeClass: function (el, t) {
                        var e = new RegExp("(\\s|^)" + t + "(\\s|$)");
                        el.className = el.className
                            .replace(e, " ")
                            .replace(/^\s\s*/, "")
                            .replace(/\s\s*$/, "");
                    },
                    addClass: function (el, t) {
                        if (!n.hasClass(el, t))
                            el.className += (el.className ? " " : "") + t;
                    },
                    hasClass: function (el, t) {
                        return (
                            el.className &&
                            new RegExp("(^|\\s)" + t + "(\\s|$)").test(el.className)
                        );
                    },
                    getChildByClass: function (t, e) {
                        for (var i = t.firstChild; i;) {
                            if (n.hasClass(i, e)) return i;
                            i = i.nextSibling;
                        }
                    },
                    arraySearch: function (t, e, n) {
                        for (var i = t.length; i--;) if (t[i][n] === e) return i;
                        return -1;
                    },
                    extend: function (t, e, n) {
                        for (var i in e)
                            if (e.hasOwnProperty(i)) {
                                if (n && t.hasOwnProperty(i)) continue;
                                t[i] = e[i];
                            }
                    },
                    easing: {
                        sine: {
                            out: function (t) {
                                return Math.sin(t * (Math.PI / 2));
                            },
                            inOut: function (t) {
                                return -(Math.cos(Math.PI * t) - 1) / 2;
                            },
                        },
                        cubic: {
                            out: function (t) {
                                return --t * t * t + 1;
                            },
                        },
                    },
                    detectFeatures: function () {
                        if (n.features) return n.features;
                        var t,
                            e = n.createEl().style,
                            i = "",
                            o = {};
                        if (
                            ((o.oldIE = document.all && !document.addEventListener),
                                (o.touch = "ontouchstart" in window),
                                window.requestAnimationFrame)
                        )
                            (o.raf = window.requestAnimationFrame),
                                (o.caf = window.cancelAnimationFrame);
                        if (
                            ((o.pointerEvent =
                                !!window.PointerEvent || navigator.msPointerEnabled),
                                !o.pointerEvent)
                        ) {
                            var a = navigator.userAgent;
                            if (/iP(hone|od)/.test(navigator.platform)) {
                                var s = navigator.appVersion.match(/OS (\d+)_(\d+)_?(\d+)?/);
                                if (s && s.length > 0)
                                    if ((s = parseInt(s[1], 10)) >= 1 && s < 8)
                                        o.isOldIOSPhone = true;
                            }
                            var u = a.match(/Android\s([0-9\.]*)/),
                                l = u ? u[1] : 0;
                            if ((l = parseFloat(l)) >= 1) {
                                if (l < 4.4) o.isOldAndroid = true;
                                o.androidVersion = l;
                            }
                            o.isMobileOpera = /opera mini|opera mobi/i.test(a);
                        }
                        for (
                            var f = ["transform", "perspective", "animationName"],
                            c = ["", "webkit", "Moz", "ms", "O"],
                            h,
                            p,
                            m = 0;
                            m < 4;
                            m++
                        ) {
                            i = c[m];
                            for (var v = 0; v < 3; v++)
                                if (
                                    ((h = f[v]),
                                        (p = i + (i ? h.charAt(0).toUpperCase() + h.slice(1) : h)),
                                        !o[h] && p in e)
                                )
                                    o[h] = p;
                            if (i && !o.raf)
                                if (
                                    ((i = i.toLowerCase()),
                                        (o.raf = window[i + "RequestAnimationFrame"]),
                                        o.raf)
                                )
                                    o.caf =
                                        window[i + "CancelAnimationFrame"] ||
                                        window[i + "CancelRequestAnimationFrame"];
                        }
                        if (!o.raf) {
                            var g = 0;
                            (o.raf = function (t) {
                                var e = new Date().getTime(),
                                    n = Math.max(0, 16 - (e - g)),
                                    id = window.setTimeout(function () {
                                        t(e + n);
                                    }, n);
                                return (g = e + n), id;
                            }),
                                (o.caf = function (id) {
                                    clearTimeout(id);
                                });
                        }
                        return (
                            (o.svg =
                                !!document.createElementNS &&
                                !!document.createElementNS("http://www.w3.org/2000/svg", "svg")
                                    .createSVGRect),
                            (n.features = o),
                            o
                        );
                    },
                };
                if ((n.detectFeatures(), n.features.oldIE))
                    n.bind = function (t, type, e, n) {
                        type = type.split(" ");
                        for (
                            var i = (n ? "detach" : "attach") + "Event",
                            o,
                            a = function () {
                                e.handleEvent.call(e);
                            },
                            s = 0;
                            s < type.length;
                            s++
                        )
                            if ((o = type[s]))
                                if ("object" == typeof e && e.handleEvent) {
                                    if (!n) e["oldIE" + o] = a;
                                    else if (!e["oldIE" + o]) return false;
                                    t[i]("on" + o, e["oldIE" + o]);
                                } else t[i]("on" + o, e);
                    };
                var i = this,
                    o = 25,
                    a = 3,
                    s = {
                        allowPanToNext: true,
                        spacing: 0.12,
                        bgOpacity: 1,
                        mouseUsed: false,
                        loop: true,
                        pinchToClose: true,
                        closeOnScroll: true,
                        closeOnVerticalDrag: true,
                        verticalDragRange: 0.75,
                        hideAnimationDuration: 333,
                        showAnimationDuration: 333,
                        showHideOpacity: false,
                        focus: true,
                        escKey: true,
                        arrowKeys: true,
                        mainScrollEndFriction: 0.35,
                        panEndFriction: 0.35,
                        isClickableElement: function (el) {
                            return "A" === el.tagName;
                        },
                        getDoubleTapZoom: function (t, e) {
                            if (t) return 1;
                            else return e.initialZoomLevel < 0.7 ? 1 : 1.33;
                        },
                        maxSpreadZoom: 1.33,
                        modal: true,
                        scaleMode: "fit",
                    };
                n.extend(s, e);
                var u = function () {
                    return { x: 0, y: 0 };
                },
                    l,
                    f,
                    c,
                    h,
                    p,
                    m,
                    v = { x: 0, y: 0 },
                    g = { x: 0, y: 0 },
                    y = { x: 0, y: 0 },
                    w,
                    b,
                    C,
                    x = {},
                    S,
                    A,
                    _,
                    T,
                    I,
                    E,
                    k = 0,
                    M = {},
                    L = { x: 0, y: 0 },
                    B,
                    O,
                    P = 0,
                    F,
                    N,
                    z,
                    U,
                    H,
                    $,
                    V = true,
                    Y,
                    W = [],
                    j,
                    G,
                    Z,
                    X,
                    K,
                    J,
                    tt,
                    nt = {},
                    rt = false,
                    ot,
                    at = function (t, e) {
                        n.extend(i, e.publicMethods), W.push(t);
                    },
                    st = function (index) {
                        var t = wn();
                        if (index > t - 1) return index - t;
                        else if (index < 0) return t + index;
                        return index;
                    },
                    ut = {},
                    lt = function (t, e) {
                        if (!ut[t]) ut[t] = [];
                        return ut[t].push(e);
                    },
                    ft = function (t) {
                        var e = ut[t];
                        if (e) {
                            var n = Array.prototype.slice.call(arguments);
                            n.shift();
                            for (var o = 0; o < e.length; o++) e[o].apply(i, n);
                        }
                    },
                    ct = function () {
                        return new Date().getTime();
                    },
                    dt = function (t) {
                        (Le = t), (i.bg.style.opacity = t * s.bgOpacity);
                    },
                    ht = function (t, e, n, o, a) {
                        if (!rt || (a && a !== i.currItem))
                            o /= a ? a.fitRatio : i.currItem.fitRatio;
                        t[H] = _ + e + "px, " + n + "px" + T + " scale(" + o + ")";
                    },
                    pt = function (t) {
                        if (Se) {
                            if (t)
                                if (S > i.currItem.fitRatio) {
                                    if (!rt) In(i.currItem, false, true), (rt = true);
                                } else if (rt) In(i.currItem), (rt = false);
                            ht(Se, y.x, y.y, S);
                        }
                    },
                    mt = function (t) {
                        if (t.container)
                            ht(
                                t.container.style,
                                t.initialPosition.x,
                                t.initialPosition.y,
                                t.initialZoomLevel,
                                t
                            );
                    },
                    vt = function (t, e) {
                        e[H] = _ + t + "px, 0px" + T;
                    },
                    gt = function (t, e) {
                        if (!s.loop && e) {
                            var n = h + (L.x * k - t) / L.x,
                                i = Math.round(t - xe.x);
                            if ((n < 0 && i > 0) || (n >= wn() - 1 && i < 0))
                                t = xe.x + i * s.mainScrollEndFriction;
                        }
                        (xe.x = t), vt(t, p);
                    },
                    yt = function (t, e) {
                        var n = _e[t] - M[t];
                        return g[t] + v[t] + n - n * (e / A);
                    },
                    wt = function (t, e) {
                        if (((t.x = e.x), (t.y = e.y), e.id)) t.id = e.id;
                    },
                    bt = function (t) {
                        (t.x = Math.round(t.x)), (t.y = Math.round(t.y));
                    },
                    Ct = null,
                    xt = function () {
                        if (Ct)
                            n.unbind(document, "mousemove", xt),
                                n.addClass(template, "pswp--has_mouse"),
                                (s.mouseUsed = true),
                                ft("mouseUsed");
                        Ct = setTimeout(function () {
                            Ct = null;
                        }, 100);
                    },
                    St = function () {
                        if ((n.bind(document, "keydown", i), tt.transform))
                            n.bind(i.scrollWrap, "click", i);
                        if (!s.mouseUsed) n.bind(document, "mousemove", xt);
                        n.bind(window, "resize scroll orientationchange", i),
                            ft("bindEvents");
                    },
                    At = function () {
                        if (
                            (n.unbind(window, "resize scroll orientationchange", i),
                                n.unbind(window, "scroll", C.scroll),
                                n.unbind(document, "keydown", i),
                                n.unbind(document, "mousemove", xt),
                                tt.transform)
                        )
                            n.unbind(i.scrollWrap, "click", i);
                        if (ue) n.unbind(window, w, i);
                        clearTimeout(ot), ft("unbindEvents");
                    },
                    _t = function (t, update) {
                        var e = Sn(i.currItem, x, t);
                        if (update) Ce = e;
                        return e;
                    },
                    Tt = function (t) {
                        if (!t) t = i.currItem;
                        return t.initialZoomLevel;
                    },
                    Dt = function (t) {
                        if (!t) t = i.currItem;
                        return t.w > 0 ? s.maxSpreadZoom : 1;
                    },
                    kt = function (t, e, n, o) {
                        if (o === i.currItem.initialZoomLevel)
                            return (n[t] = i.currItem.initialPosition[t]), true;
                        else if (((n[t] = yt(t, o)), n[t] > e.min[t]))
                            return (n[t] = e.min[t]), true;
                        else if (n[t] < e.max[t]) return (n[t] = e.max[t]), true;
                        return false;
                    },
                    Mt = function () {
                        if (H) {
                            var t = tt.perspective && !Y;
                            return (
                                (_ = "translate" + (t ? "3d(" : "(")),
                                (T = tt.perspective ? ", 0px)" : ")"),
                                void 0
                            );
                        }
                        (H = "left"),
                            n.addClass(template, "pswp--ie"),
                            (vt = function (t, e) {
                                e.left = t + "px";
                            }),
                            (mt = function (t) {
                                var e = t.fitRatio > 1 ? 1 : t.fitRatio,
                                    n = t.container.style,
                                    i = e * t.w,
                                    o = e * t.h;
                                (n.width = i + "px"),
                                    (n.height = o + "px"),
                                    (n.left = t.initialPosition.x + "px"),
                                    (n.top = t.initialPosition.y + "px");
                            }),
                            (pt = function () {
                                if (Se) {
                                    var t = Se,
                                        e = i.currItem,
                                        n = e.fitRatio > 1 ? 1 : e.fitRatio,
                                        o = n * e.w,
                                        a = n * e.h;
                                    (t.width = o + "px"),
                                        (t.height = a + "px"),
                                        (t.left = y.x + "px"),
                                        (t.top = y.y + "px");
                                }
                            });
                    },
                    Lt = function (t) {
                        var e = "";
                        if (s.escKey && 27 === t.keyCode) e = "close";
                        else if (s.arrowKeys)
                            if (37 === t.keyCode) e = "prev";
                            else if (39 === t.keyCode) e = "next";
                        if (e)
                            if (!(t.ctrlKey || t.altKey || t.shiftKey || t.metaKey)) {
                                if (t.preventDefault) t.preventDefault();
                                else t.returnValue = false;
                                i[e]();
                            }
                    },
                    Bt = function (t) {
                        if (t)
                            if (ce || fe || Ae || ie) t.preventDefault(), t.stopPropagation();
                    },
                    Ot = function () {
                        i.setScrollOffset(0, n.getScrollY());
                    },
                    Pt = {},
                    Ft = 0,
                    Rt = function (t) {
                        if (Pt[t]) {
                            if (Pt[t].raf) G(Pt[t].raf);
                            Ft--, delete Pt[t];
                        }
                    },
                    Nt = function (t) {
                        if (Pt[t]) Rt(t);
                        if (!Pt[t]) Ft++, (Pt[t] = {});
                    },
                    zt = function () {
                        for (var t in Pt) if (Pt.hasOwnProperty(t)) Rt(t);
                    },
                    Ut = function (t, e, n, d, i, o, a) {
                        var s = ct(),
                            u;
                        Nt(t);
                        var l = function () {
                            if (Pt[t]) {
                                if ((u = ct() - s) >= d) {
                                    if ((Rt(t), o(n), a)) a();
                                    return;
                                }
                                o((n - e) * i(u / d) + e), (Pt[t].raf = j(l));
                            }
                        };
                        l();
                    },
                    qt = {
                        shout: ft,
                        listen: lt,
                        viewportSize: x,
                        options: s,
                        isMainScrollAnimating: function () {
                            return Ae;
                        },
                        getZoomLevel: function () {
                            return S;
                        },
                        getCurrentIndex: function () {
                            return h;
                        },
                        isDragging: function () {
                            return ue;
                        },
                        isZooming: function () {
                            return ye;
                        },
                        setScrollOffset: function (t, e) {
                            (M.x = t), (J = M.y = e), ft("updateScrollOffset", M);
                        },
                        applyZoomPan: function (t, e, n, i) {
                            (y.x = e), (y.y = n), (S = t), pt(i);
                        },
                        init: function () {
                            if (!l && !f) {
                                var e;
                                (i.framework = n),
                                    (i.template = template),
                                    (i.bg = n.getChildByClass(template, "pswp__bg")),
                                    (Z = template.className),
                                    (l = true),
                                    (tt = n.detectFeatures()),
                                    (j = tt.raf),
                                    (G = tt.caf),
                                    (H = tt.transform),
                                    (K = tt.oldIE),
                                    (i.scrollWrap = n.getChildByClass(
                                        template,
                                        "pswp__scroll-wrap"
                                    )),
                                    (i.container = n.getChildByClass(
                                        i.scrollWrap,
                                        "pswp__container"
                                    )),
                                    (p = i.container.style),
                                    (i.itemHolders = B =
                                        [
                                            { el: i.container.children[0], wrap: 0, index: -1 },
                                            { el: i.container.children[1], wrap: 0, index: -1 },
                                            { el: i.container.children[2], wrap: 0, index: -1 },
                                        ]),
                                    (B[0].el.style.display = B[2].el.style.display = "none"),
                                    Mt(),
                                    (C = {
                                        resize: i.updateSize,
                                        orientationchange: function () {
                                            clearTimeout(ot),
                                                (ot = setTimeout(function () {
                                                    if (x.x !== i.scrollWrap.clientWidth) i.updateSize();
                                                }, 500));
                                        },
                                        scroll: Ot,
                                        keydown: Lt,
                                        click: Bt,
                                    });
                                var o = tt.isOldIOSPhone || tt.isOldAndroid || tt.isMobileOpera;
                                if (!tt.animationName || !tt.transform || o)
                                    s.showAnimationDuration = s.hideAnimationDuration = 0;
                                for (e = 0; e < W.length; e++) i["init" + W[e]]();
                                if (t) {
                                    var u;
                                    (i.ui = new t(i, n)).init();
                                }
                                if (
                                    (ft("firstUpdate"),
                                        (h = h || s.index || 0),
                                        isNaN(h) || h < 0 || h >= wn())
                                )
                                    h = 0;
                                if (((i.currItem = yn(h)), tt.isOldIOSPhone || tt.isOldAndroid))
                                    V = false;
                                if ((template.setAttribute("aria-hidden", "false"), s.modal))
                                    if (!V)
                                        (template.style.position = "absolute"),
                                            (template.style.top = n.getScrollY() + "px");
                                    else template.style.position = "fixed";
                                if (void 0 === J) ft("initialLayout"), (J = X = n.getScrollY());
                                var c = "pswp--open ";
                                if (s.mainClass) c += s.mainClass + " ";
                                if (s.showHideOpacity) c += "pswp--animate_opacity ";
                                for (
                                    c += Y ? "pswp--touch" : "pswp--notouch",
                                    c += tt.animationName ? " pswp--css_animation" : "",
                                    c += tt.svg ? " pswp--svg" : "",
                                    n.addClass(template, c),
                                    i.updateSize(),
                                    m = -1,
                                    P = null,
                                    e = 0;
                                    e < a;
                                    e++
                                )
                                    vt((e + m) * L.x, B[e].el.style);
                                if (!K) n.bind(i.scrollWrap, b, i);
                                if (
                                    (lt("initialZoomInEnd", function () {
                                        if (
                                            (i.setContent(B[0], h - 1),
                                                i.setContent(B[2], h + 1),
                                                (B[0].el.style.display = B[2].el.style.display = "block"),
                                                s.focus)
                                        )
                                            template.focus();
                                        St();
                                    }),
                                        i.setContent(B[1], h),
                                        i.updateCurrItem(),
                                        ft("afterInit"),
                                        !V)
                                )
                                    I = setInterval(function () {
                                        if (!Ft && !ue && !ye && S === i.currItem.initialZoomLevel)
                                            i.updateSize();
                                    }, 1e3);
                                n.addClass(template, "pswp--visible");
                            }
                        },
                        close: function () {
                            if (l)
                                (l = false),
                                    (f = true),
                                    ft("close"),
                                    At(),
                                    cn(i.currItem, null, true, i.destroy);
                        },
                        destroy: function () {
                            if ((ft("destroy"), fn)) clearTimeout(fn);
                            if (
                                (template.setAttribute("aria-hidden", "true"),
                                    (template.className = Z),
                                    I)
                            )
                                clearInterval(I);
                            n.unbind(i.scrollWrap, b, i),
                                n.unbind(window, "scroll", i),
                                Re(),
                                zt(),
                                (ut = null);
                        },
                        panTo: function (t, e, n) {
                            if (!n) {
                                if (t > Ce.min.x) t = Ce.min.x;
                                else if (t < Ce.max.x) t = Ce.max.x;
                                if (e > Ce.min.y) e = Ce.min.y;
                                else if (e < Ce.max.y) e = Ce.max.y;
                            }
                            (y.x = t), (y.y = e), pt();
                        },
                        handleEvent: function (t) {
                            if (((t = t || window.event), C[t.type])) C[t.type](t);
                        },
                        goTo: function (index) {
                            var diff = (index = st(index)) - h;
                            (P = diff),
                                (h = index),
                                (i.currItem = yn(h)),
                                (k -= diff),
                                gt(L.x * k),
                                zt(),
                                (Ae = false),
                                i.updateCurrItem();
                        },
                        next: function () {
                            i.goTo(h + 1);
                        },
                        prev: function () {
                            i.goTo(h - 1);
                        },
                        updateCurrZoomItem: function (t) {
                            if (t) ft("beforeChange", 0);
                            if (B[1].el.children.length) {
                                var e = B[1].el.children[0];
                                if (n.hasClass(e, "pswp__zoom-wrap")) Se = e.style;
                                else Se = null;
                            } else Se = null;
                            if (
                                ((Ce = i.currItem.bounds),
                                    (A = S = i.currItem.initialZoomLevel),
                                    (y.x = Ce.center.x),
                                    (y.y = Ce.center.y),
                                    t)
                            )
                                ft("afterChange");
                        },
                        invalidateCurrItems: function () {
                            E = true;
                            for (var t = 0; t < a; t++)
                                if (B[t].item) B[t].item.needsUpdate = true;
                        },
                        updateCurrItem: function (t) {
                            if (0 !== P) {
                                var e = Math.abs(P),
                                    n;
                                if (!(t && e < 2)) {
                                    if (
                                        ((i.currItem = yn(h)),
                                            (rt = false),
                                            ft("beforeChange", P),
                                            e >= a)
                                    )
                                        (m += P + (P > 0 ? -a : a)), (e = a);
                                    for (var o = 0; o < e; o++)
                                        if (P > 0)
                                            (n = B.shift()),
                                                (B[a - 1] = n),
                                                m++,
                                                vt((m + 2) * L.x, n.el.style),
                                                i.setContent(n, h - e + o + 1 + 1);
                                        else
                                            (n = B.pop()),
                                                B.unshift(n),
                                                m--,
                                                vt(m * L.x, n.el.style),
                                                i.setContent(n, h + e - o - 1 - 1);
                                    if (Se && 1 === Math.abs(P)) {
                                        var s = yn(O);
                                        if (s.initialZoomLevel !== S) Sn(s, x), In(s), mt(s);
                                    }
                                    (P = 0), i.updateCurrZoomItem(), (O = h), ft("afterChange");
                                }
                            }
                        },
                        updateSize: function (t) {
                            if (!V && s.modal) {
                                var e = n.getScrollY();
                                if (J !== e) (template.style.top = e + "px"), (J = e);
                                if (
                                    !t &&
                                    nt.x === window.innerWidth &&
                                    nt.y === window.innerHeight
                                )
                                    return;
                                (nt.x = window.innerWidth),
                                    (nt.y = window.innerHeight),
                                    (template.style.height = nt.y + "px");
                            }
                            if (
                                ((x.x = i.scrollWrap.clientWidth),
                                    (x.y = i.scrollWrap.clientHeight),
                                    Ot(),
                                    (L.x = x.x + Math.round(x.x * s.spacing)),
                                    (L.y = x.y),
                                    gt(L.x * k),
                                    ft("beforeResize"),
                                    void 0 !== m)
                            ) {
                                for (var o, u, l, f = 0; f < a; f++) {
                                    if (
                                        ((o = B[f]),
                                            vt((f + m) * L.x, o.el.style),
                                            (l = h + f - 1),
                                            s.loop && wn() > 2)
                                    )
                                        l = st(l);
                                    if ((u = yn(l)) && (E || u.needsUpdate || !u.bounds)) {
                                        if ((i.cleanSlide(u), i.setContent(o, l), 1 === f))
                                            (i.currItem = u), i.updateCurrZoomItem(true);
                                        u.needsUpdate = false;
                                    } else if (-1 === o.index && l >= 0) i.setContent(o, l);
                                    if (u && u.container) Sn(u, x), In(u), mt(u);
                                }
                                E = false;
                            }
                            if (
                                ((A = S = i.currItem.initialZoomLevel),
                                    (Ce = i.currItem.bounds))
                            )
                                (y.x = Ce.center.x), (y.y = Ce.center.y), pt(true);
                            ft("resize");
                        },
                        zoomTo: function (t, e, i, o, a) {
                            if (e)
                                (A = S),
                                    (_e.x = Math.abs(e.x) - y.x),
                                    (_e.y = Math.abs(e.y) - y.y),
                                    wt(g, y);
                            var s = _t(t, false),
                                u = {};
                            kt("x", s, u, t), kt("y", s, u, t);
                            var l = S,
                                f = y.x,
                                c = y.y;
                            bt(u);
                            var h = function (e) {
                                if (1 === e) (S = t), (y.x = u.x), (y.y = u.y);
                                else
                                    (S = (t - l) * e + l),
                                        (y.x = (u.x - f) * e + f),
                                        (y.y = (u.y - c) * e + c);
                                if (a) a(e);
                                pt(1 === e);
                            };
                            if (i) Ut("customZoomTo", 0, 1, i, o || n.easing.sine.inOut, h);
                            else h(1);
                        },
                    },
                    Ht = 30,
                    $t = 10,
                    Vt,
                    Yt,
                    Wt = {},
                    jt = {},
                    Gt = {},
                    Zt = {},
                    Xt = {},
                    Kt = [],
                    Jt = {},
                    Qt,
                    te = [],
                    ee = {},
                    ne,
                    ie,
                    re,
                    oe = 0,
                    ae = { x: 0, y: 0 },
                    se = 0,
                    ue,
                    le,
                    fe,
                    ce,
                    pe,
                    ve,
                    ge,
                    ye,
                    we,
                    be,
                    Ce,
                    xe = { x: 0, y: 0 },
                    Se,
                    Ae,
                    _e = { x: 0, y: 0 },
                    Te = { x: 0, y: 0 },
                    Ie,
                    Ee,
                    ke,
                    Le,
                    Be,
                    Oe = function (t, e) {
                        return t.x === e.x && t.y === e.y;
                    },
                    Pe = function (t, e) {
                        return Math.abs(t.x - e.x) < o && Math.abs(t.y - e.y) < o;
                    },
                    Fe = function (t, e) {
                        return (
                            (ee.x = Math.abs(t.x - e.x)),
                            (ee.y = Math.abs(t.y - e.y)),
                            Math.sqrt(ee.x * ee.x + ee.y * ee.y)
                        );
                    },
                    Re = function () {
                        if (pe) G(pe), (pe = null);
                    },
                    Ne = function () {
                        if (ue) (pe = j(Ne)), nn();
                    },
                    ze = function () {
                        return !(
                            "fit" === s.scaleMode && S === i.currItem.initialZoomLevel
                        );
                    },
                    Ue = function (el, t) {
                        if (!el || el === document) return false;
                        if (
                            el.getAttribute("class") &&
                            el.getAttribute("class").indexOf("pswp__scroll-wrap") > -1
                        )
                            return false;
                        if (t(el)) return el;
                        else return Ue(el.parentNode, t);
                    },
                    qe = {},
                    $e = function (t, e) {
                        return (
                            (qe.prevent = !Ue(t.target, s.isClickableElement)),
                            ft("preventDragEvent", t, e, qe),
                            qe.prevent
                        );
                    },
                    Ve = function (t, e) {
                        return (e.x = t.pageX), (e.y = t.pageY), (e.id = t.identifier), e;
                    },
                    Ye = function (t, e, n) {
                        (n.x = 0.5 * (t.x + e.x)), (n.y = 0.5 * (t.y + e.y));
                    },
                    We = function (t, e, n) {
                        if (t - Yt > 50) {
                            var i = te.length > 2 ? te.shift() : {};
                            (i.x = e), (i.y = n), te.push(i), (Yt = t);
                        }
                    },
                    je = function () {
                        var t = y.y - i.currItem.initialPosition.y;
                        return 1 - Math.abs(t / (x.y / 2));
                    },
                    Ge = {},
                    Ze = {},
                    Xe = [],
                    Ke,
                    Je = function (t) {
                        for (; Xe.length > 0;) Xe.pop();
                        if (!$)
                            if (t.type.indexOf("touch") > -1) {
                                if (t.touches && t.touches.length > 0)
                                    if (((Xe[0] = Ve(t.touches[0], Ge)), t.touches.length > 1))
                                        Xe[1] = Ve(t.touches[1], Ze);
                            } else
                                (Ge.x = t.pageX), (Ge.y = t.pageY), (Ge.id = ""), (Xe[0] = Ge);
                        else
                            (Ke = 0),
                                Kt.forEach(function (t) {
                                    if (0 === Ke) Xe[0] = t;
                                    else if (1 === Ke) Xe[1] = t;
                                    Ke++;
                                });
                        return Xe;
                    },
                    Qe = function (t, e) {
                        var n,
                            o = 0,
                            a = y[t] + e[t],
                            u,
                            l = e[t] > 0,
                            f = xe.x + e.x,
                            c = xe.x - Jt.x,
                            h,
                            p;
                        if (a > Ce.min[t] || a < Ce.max[t]) n = s.panEndFriction;
                        else n = 1;
                        if (
                            ((a = y[t] + e[t] * n),
                                s.allowPanToNext || S === i.currItem.initialZoomLevel)
                        ) {
                            if (!Se) p = f;
                            else if ("h" === Ie && "x" === t && !fe)
                                if (l) {
                                    if (a > Ce.min[t])
                                        (n = s.panEndFriction),
                                            (o = Ce.min[t] - a),
                                            (u = Ce.min[t] - g[t]);
                                    if ((u <= 0 || c < 0) && wn() > 1) {
                                        if (((p = f), c < 0 && f > Jt.x)) p = Jt.x;
                                    } else if (Ce.min.x !== Ce.max.x) h = a;
                                } else {
                                    if (a < Ce.max[t])
                                        (n = s.panEndFriction),
                                            (o = a - Ce.max[t]),
                                            (u = g[t] - Ce.max[t]);
                                    if ((u <= 0 || c > 0) && wn() > 1) {
                                        if (((p = f), c > 0 && f < Jt.x)) p = Jt.x;
                                    } else if (Ce.min.x !== Ce.max.x) h = a;
                                }
                            if ("x" === t) {
                                if (void 0 !== p)
                                    if ((gt(p, true), p === Jt.x)) ve = false;
                                    else ve = true;
                                if (Ce.min.x !== Ce.max.x)
                                    if (void 0 !== h) y.x = h;
                                    else if (!ve) y.x += e.x * n;
                                return void 0 !== p;
                            }
                        }
                        if (!Ae) if (!ve) if (S > i.currItem.fitRatio) y[t] += e[t] * n;
                    },
                    tn = function (t) {
                        if (!("mousedown" === t.type && t.button > 0)) {
                            if (vn) return t.preventDefault(), void 0;
                            if (!re || "mousedown" !== t.type) {
                                if ($e(t, true)) t.preventDefault();
                                if ((ft("pointerDown"), $)) {
                                    var e = n.arraySearch(Kt, t.pointerId, "id");
                                    if (e < 0) e = Kt.length;
                                    Kt[e] = { x: t.pageX, y: t.pageY, id: t.pointerId };
                                }
                                var o = Je(t),
                                    a = o.length;
                                if (((ge = null), zt(), !ue || 1 === a))
                                    (ue = Ee = true),
                                        n.bind(window, w, i),
                                        (ne = Be = ke = ie = ve = ce = le = fe = false),
                                        (Ie = null),
                                        ft("firstTouchStart", o),
                                        wt(g, y),
                                        (v.x = v.y = 0),
                                        wt(Zt, o[0]),
                                        wt(Xt, Zt),
                                        (Jt.x = L.x * k),
                                        (te = [{ x: Zt.x, y: Zt.y }]),
                                        (Yt = Vt = ct()),
                                        _t(S, true),
                                        Re(),
                                        Ne();
                                if (!ye && a > 1 && !Ae && !ve)
                                    (A = S),
                                        (fe = false),
                                        (ye = le = true),
                                        (v.y = v.x = 0),
                                        wt(g, y),
                                        wt(Wt, o[0]),
                                        wt(jt, o[1]),
                                        Ye(Wt, jt, Te),
                                        (_e.x = Math.abs(Te.x) - y.x),
                                        (_e.y = Math.abs(Te.y) - y.y),
                                        (we = be = Fe(Wt, jt));
                            }
                        }
                    },
                    en = function (t) {
                        if ((t.preventDefault(), $)) {
                            var e = n.arraySearch(Kt, t.pointerId, "id");
                            if (e > -1) {
                                var i = Kt[e];
                                (i.x = t.pageX), (i.y = t.pageY);
                            }
                        }
                        if (ue) {
                            var o = Je(t);
                            if (!Ie && !ce && !ye)
                                if (xe.x !== L.x * k) Ie = "h";
                                else {
                                    var diff = Math.abs(o[0].x - Zt.x) - Math.abs(o[0].y - Zt.y);
                                    if (Math.abs(diff) >= $t)
                                        (Ie = diff > 0 ? "h" : "v"), (ge = o);
                                }
                            else ge = o;
                        }
                    },
                    nn = function () {
                        if (ge) {
                            var t = ge.length;
                            if (0 !== t)
                                if (
                                    (wt(Wt, ge[0]),
                                        (Gt.x = Wt.x - Zt.x),
                                        (Gt.y = Wt.y - Zt.y),
                                        ye && t > 1)
                                ) {
                                    if (
                                        ((Zt.x = Wt.x),
                                            (Zt.y = Wt.y),
                                            !Gt.x && !Gt.y && Oe(ge[1], jt))
                                    )
                                        return;
                                    if ((wt(jt, ge[1]), !fe))
                                        (fe = true), ft("zoomGestureStarted");
                                    var e = Fe(Wt, jt),
                                        n = un(e);
                                    if (
                                        n >
                                        i.currItem.initialZoomLevel +
                                        i.currItem.initialZoomLevel / 15
                                    )
                                        Be = true;
                                    var o = 1,
                                        a = Tt(),
                                        u = Dt();
                                    if (n < a)
                                        if (
                                            s.pinchToClose &&
                                            !Be &&
                                            A <= i.currItem.initialZoomLevel
                                        ) {
                                            var l,
                                                f = 1 - (a - n) / (a / 1.2);
                                            dt(f), ft("onPinchClose", f), (ke = true);
                                        } else {
                                            if ((o = (a - n) / a) > 1) o = 1;
                                            n = a - o * (a / 3);
                                        }
                                    else if (n > u) {
                                        if ((o = (n - u) / (6 * a)) > 1) o = 1;
                                        n = u + o * a;
                                    }
                                    if (o < 0) o = 0;
                                    (we = e),
                                        Ye(Wt, jt, ae),
                                        (v.x += ae.x - Te.x),
                                        (v.y += ae.y - Te.y),
                                        wt(Te, ae),
                                        (y.x = yt("x", n)),
                                        (y.y = yt("y", n)),
                                        (ne = n > S),
                                        (S = n),
                                        pt();
                                } else {
                                    if (!Ie) return;
                                    if (Ee) {
                                        if (((Ee = false), Math.abs(Gt.x) >= $t))
                                            Gt.x -= ge[0].x - Xt.x;
                                        if (Math.abs(Gt.y) >= $t) Gt.y -= ge[0].y - Xt.y;
                                    }
                                    if (((Zt.x = Wt.x), (Zt.y = Wt.y), 0 === Gt.x && 0 === Gt.y))
                                        return;
                                    if ("v" === Ie && s.closeOnVerticalDrag)
                                        if (!ze()) {
                                            (v.y += Gt.y), (y.y += Gt.y);
                                            var c = je();
                                            return (
                                                (ie = true),
                                                ft("onVerticalDrag", c),
                                                dt(c),
                                                pt(),
                                                void 0
                                            );
                                        }
                                    var h;
                                    if (
                                        (We(ct(), Wt.x, Wt.y),
                                            (ce = true),
                                            (Ce = i.currItem.bounds),
                                            !Qe("x", Gt))
                                    )
                                        Qe("y", Gt), bt(y), pt();
                                }
                        }
                    },
                    rn = function (t) {
                        if (tt.isOldAndroid) {
                            if (re && "mouseup" === t.type) return;
                            if (t.type.indexOf("touch") > -1)
                                clearTimeout(re),
                                    (re = setTimeout(function () {
                                        re = 0;
                                    }, 600));
                        }
                        if ((ft("pointerUp"), $e(t, false))) t.preventDefault();
                        var e;
                        if ($) {
                            var o = n.arraySearch(Kt, t.pointerId, "id");
                            if (o > -1)
                                if (((e = Kt.splice(o, 1)[0]), navigator.msPointerEnabled)) {
                                    var a = { 4: "mouse", 2: "touch", 3: "pen" };
                                    if (((e.type = a[t.pointerType]), !e.type))
                                        e.type = t.pointerType || "mouse";
                                } else e.type = t.pointerType || "mouse";
                        }
                        var u = Je(t),
                            l,
                            f = u.length;
                        if ("mouseup" === t.type) f = 0;
                        if (2 === f) return (ge = null), true;
                        if (1 === f) wt(Xt, u[0]);
                        if (0 === f && !Ie && !Ae) {
                            if (!e)
                                if ("mouseup" === t.type)
                                    e = { x: t.pageX, y: t.pageY, type: "mouse" };
                                else if (t.changedTouches && t.changedTouches[0])
                                    e = {
                                        x: t.changedTouches[0].pageX,
                                        y: t.changedTouches[0].pageY,
                                        type: "touch",
                                    };
                            ft("touchRelease", t, e);
                        }
                        var c = -1;
                        if (0 === f)
                            if (((ue = false), n.unbind(window, w, i), Re(), ye)) c = 0;
                            else if (-1 !== se) c = ct() - se;
                        if (((se = 1 === f ? ct() : -1), -1 !== c && c < 150)) l = "zoom";
                        else l = "swipe";
                        if (ye && f < 2) {
                            if (((ye = false), 1 === f)) l = "zoomPointerUp";
                            ft("zoomGestureEnded");
                        }
                        if (((ge = null), ce || fe || Ae || ie)) {
                            if ((zt(), !Qt)) Qt = on();
                            if ((Qt.calculateSwipeSpeed("x"), !ie)) {
                                if ((ve || Ae) && 0 === f) {
                                    var h;
                                    if (sn(l, Qt)) return;
                                    l = "zoomPointerUp";
                                }
                                if (!Ae) {
                                    if ("swipe" !== l) return ln(), void 0;
                                    if (!ve && S > i.currItem.fitRatio) an(Qt);
                                }
                            } else {
                                var p;
                                if (je() < s.verticalDragRange) i.close();
                                else {
                                    var m = y.y,
                                        v = Le;
                                    Ut(
                                        "verticalDrag",
                                        0,
                                        1,
                                        300,
                                        n.easing.cubic.out,
                                        function (t) {
                                            (y.y = (i.currItem.initialPosition.y - m) * t + m),
                                                dt((1 - v) * t + v),
                                                pt();
                                        }
                                    ),
                                        ft("onVerticalDrag", 1);
                                }
                            }
                        }
                    },
                    on = function () {
                        var t,
                            e,
                            i = {
                                lastFlickOffset: {},
                                lastFlickDist: {},
                                lastFlickSpeed: {},
                                slowDownRatio: {},
                                slowDownRatioReverse: {},
                                speedDecelerationRatio: {},
                                speedDecelerationRatioAbs: {},
                                distanceOffset: {},
                                backAnimDestination: {},
                                backAnimStarted: {},
                                calculateSwipeSpeed: function (n) {
                                    if (te.length > 1)
                                        (t = ct() - Yt + 50), (e = te[te.length - 2][n]);
                                    else (t = ct() - Vt), (e = Xt[n]);
                                    if (
                                        ((i.lastFlickOffset[n] = Zt[n] - e),
                                            (i.lastFlickDist[n] = Math.abs(i.lastFlickOffset[n])),
                                            i.lastFlickDist[n] > 20)
                                    )
                                        i.lastFlickSpeed[n] = i.lastFlickOffset[n] / t;
                                    else i.lastFlickSpeed[n] = 0;
                                    if (Math.abs(i.lastFlickSpeed[n]) < 0.1)
                                        i.lastFlickSpeed[n] = 0;
                                    (i.slowDownRatio[n] = 0.95),
                                        (i.slowDownRatioReverse[n] = 1 - i.slowDownRatio[n]),
                                        (i.speedDecelerationRatio[n] = 1);
                                },
                                calculateOverBoundsAnimOffset: function (t, e) {
                                    if (!i.backAnimStarted[t]) {
                                        if (y[t] > Ce.min[t]) i.backAnimDestination[t] = Ce.min[t];
                                        else if (y[t] < Ce.max[t])
                                            i.backAnimDestination[t] = Ce.max[t];
                                        if (void 0 !== i.backAnimDestination[t])
                                            if (
                                                ((i.slowDownRatio[t] = 0.7),
                                                    (i.slowDownRatioReverse[t] = 1 - i.slowDownRatio[t]),
                                                    i.speedDecelerationRatioAbs[t] < 0.05)
                                            )
                                                (i.lastFlickSpeed[t] = 0),
                                                    (i.backAnimStarted[t] = true),
                                                    Ut(
                                                        "bounceZoomPan" + t,
                                                        y[t],
                                                        i.backAnimDestination[t],
                                                        e || 300,
                                                        n.easing.sine.out,
                                                        function (e) {
                                                            (y[t] = e), pt();
                                                        }
                                                    );
                                    }
                                },
                                calculateAnimOffset: function (t) {
                                    if (!i.backAnimStarted[t])
                                        (i.speedDecelerationRatio[t] =
                                            i.speedDecelerationRatio[t] *
                                            (i.slowDownRatio[t] +
                                                i.slowDownRatioReverse[t] -
                                                (i.slowDownRatioReverse[t] * i.timeDiff) / 10)),
                                            (i.speedDecelerationRatioAbs[t] = Math.abs(
                                                i.lastFlickSpeed[t] * i.speedDecelerationRatio[t]
                                            )),
                                            (i.distanceOffset[t] =
                                                i.lastFlickSpeed[t] *
                                                i.speedDecelerationRatio[t] *
                                                i.timeDiff),
                                            (y[t] += i.distanceOffset[t]);
                                },
                                panAnimLoop: function () {
                                    if (Pt.zoomPan)
                                        if (
                                            ((Pt.zoomPan.raf = j(i.panAnimLoop)),
                                                (i.now = ct()),
                                                (i.timeDiff = i.now - i.lastNow),
                                                (i.lastNow = i.now),
                                                i.calculateAnimOffset("x"),
                                                i.calculateAnimOffset("y"),
                                                pt(),
                                                i.calculateOverBoundsAnimOffset("x"),
                                                i.calculateOverBoundsAnimOffset("y"),
                                                i.speedDecelerationRatioAbs.x < 0.05 &&
                                                i.speedDecelerationRatioAbs.y < 0.05)
                                        )
                                            return (
                                                (y.x = Math.round(y.x)),
                                                (y.y = Math.round(y.y)),
                                                pt(),
                                                Rt("zoomPan"),
                                                void 0
                                            );
                                },
                            };
                        return i;
                    },
                    an = function (t) {
                        if (
                            (t.calculateSwipeSpeed("y"),
                                (Ce = i.currItem.bounds),
                                (t.backAnimDestination = {}),
                                (t.backAnimStarted = {}),
                                Math.abs(t.lastFlickSpeed.x) <= 0.05 &&
                                Math.abs(t.lastFlickSpeed.y) <= 0.05)
                        )
                            return (
                                (t.speedDecelerationRatioAbs.x = t.speedDecelerationRatioAbs.y =
                                    0),
                                t.calculateOverBoundsAnimOffset("x"),
                                t.calculateOverBoundsAnimOffset("y"),
                                true
                            );
                        Nt("zoomPan"), (t.lastNow = ct()), t.panAnimLoop();
                    },
                    sn = function (t, e) {
                        var o, a, u;
                        if (!Ae) oe = h;
                        if ("swipe" === t) {
                            var l = Zt.x - Xt.x,
                                f = e.lastFlickDist.x < 10;
                            if (l > Ht && (f || e.lastFlickOffset.x > 20)) a = -1;
                            else if (l < -Ht && (f || e.lastFlickOffset.x < -20)) a = 1;
                        }
                        if (a) {
                            if ((h += a) < 0) (h = s.loop ? wn() - 1 : 0), (u = true);
                            else if (h >= wn()) (h = s.loop ? 0 : wn() - 1), (u = true);
                            if (!u || s.loop) (P += a), (k -= a), (o = true);
                        }
                        var c = L.x * k,
                            p = Math.abs(c - xe.x),
                            m;
                        if (!o && c > xe.x != e.lastFlickSpeed.x > 0) m = 333;
                        else
                            (m =
                                Math.abs(e.lastFlickSpeed.x) > 0
                                    ? p / Math.abs(e.lastFlickSpeed.x)
                                    : 333),
                                (m = Math.min(m, 400)),
                                (m = Math.max(m, 250));
                        if (oe === h) o = false;
                        if (
                            ((Ae = true),
                                ft("mainScrollAnimStart"),
                                Ut("mainScroll", xe.x, c, m, n.easing.cubic.out, gt, function () {
                                    if ((zt(), (Ae = false), (oe = -1), o || oe !== h))
                                        i.updateCurrItem();
                                    ft("mainScrollAnimComplete");
                                }),
                                o)
                        )
                            i.updateCurrItem(true);
                        return o;
                    },
                    un = function (t) {
                        return (1 / be) * t * A;
                    },
                    ln = function () {
                        var t = S,
                            e = Tt(),
                            o = Dt();
                        if (S < e) t = e;
                        else if (S > o) t = o;
                        var a = 1,
                            s,
                            u = Le;
                        if (ke && !ne && !Be && S < e) return i.close(), true;
                        if (ke)
                            s = function (t) {
                                dt((a - u) * t + u);
                            };
                        return i.zoomTo(t, 0, 200, n.easing.cubic.out, s), true;
                    };
                at("Gestures", {
                    publicMethods: {
                        initGestures: function () {
                            var t = function (t, e, move, n, i) {
                                if (((F = t + e), (N = t + move), (z = t + n), i)) U = t + i;
                                else U = "";
                            };
                            if (($ = tt.pointerEvent) && tt.touch) tt.touch = false;
                            if ($)
                                if (navigator.msPointerEnabled)
                                    t("MSPointer", "Down", "Move", "Up", "Cancel");
                                else t("pointer", "down", "move", "up", "cancel");
                            else if (tt.touch)
                                t("touch", "start", "move", "end", "cancel"), (Y = true);
                            else t("mouse", "down", "move", "up");
                            if (((w = N + " " + z + " " + U), (b = F), $ && !Y))
                                Y =
                                    navigator.maxTouchPoints > 1 ||
                                    navigator.msMaxTouchPoints > 1;
                            if (
                                ((i.likelyTouchDevice = Y),
                                    (C[F] = tn),
                                    (C[N] = en),
                                    (C[z] = rn),
                                    U)
                            )
                                C[U] = C[z];
                            if (tt.touch)
                                (b += " mousedown"),
                                    (w += " mousemove mouseup"),
                                    (C.mousedown = C[F]),
                                    (C.mousemove = C[N]),
                                    (C.mouseup = C[z]);
                            if (!Y) s.allowPanToNext = false;
                        },
                    },
                });
                var fn,
                    cn = function (t, e, o, a) {
                        if (fn) clearTimeout(fn);
                        var u;
                        if (((vn = true), (mn = true), t.initialLayout))
                            (u = t.initialLayout), (t.initialLayout = null);
                        else u = s.getThumbBoundsFn && s.getThumbBoundsFn(h);
                        var l = o ? s.hideAnimationDuration : s.showAnimationDuration,
                            f = function () {
                                if ((Rt("initialZoom"), !o)) {
                                    if ((dt(1), e)) e.style.display = "block";
                                    n.addClass(template, "pswp--animated-in"),
                                        ft("initialZoom" + (o ? "OutEnd" : "InEnd"));
                                } else
                                    i.template.removeAttribute("style"),
                                        i.bg.removeAttribute("style");
                                if (a) a();
                                vn = false;
                            };
                        if (l && u && void 0 !== u.x) {
                            var p;
                            (function () {
                                var e = c,
                                    a =
                                        !i.currItem.src ||
                                        i.currItem.loadError ||
                                        s.showHideOpacity;
                                if (t.miniImg)
                                    t.miniImg.style.webkitBackfaceVisibility = "hidden";
                                if (!o)
                                    (S = u.w / t.w),
                                        (y.x = u.x),
                                        (y.y = u.y - X),
                                        (i[a ? "template" : "bg"].style.opacity = 0.001),
                                        pt();
                                if ((Nt("initialZoom"), o && !e))
                                    n.removeClass(template, "pswp--animated-in");
                                if (a)
                                    if (o)
                                        n[(e ? "remove" : "add") + "Class"](
                                            template,
                                            "pswp--animate_opacity"
                                        );
                                    else
                                        setTimeout(function () {
                                            n.addClass(template, "pswp--animate_opacity");
                                        }, 30);
                                fn = setTimeout(
                                    function () {
                                        if ((ft("initialZoom" + (o ? "Out" : "In")), !o)) {
                                            if (
                                                ((S = t.initialZoomLevel),
                                                    wt(y, t.initialPosition),
                                                    pt(),
                                                    dt(1),
                                                    a)
                                            )
                                                template.style.opacity = 1;
                                            else dt(1);
                                            fn = setTimeout(f, l + 20);
                                        } else {
                                            var i = u.w / t.w,
                                                s = { x: y.x, y: y.y },
                                                c = S,
                                                h = Le,
                                                p = function (t) {
                                                    if (1 === t) (S = i), (y.x = u.x), (y.y = u.y - J);
                                                    else
                                                        (S = (i - c) * t + c),
                                                            (y.x = (u.x - s.x) * t + s.x),
                                                            (y.y = (u.y - J - s.y) * t + s.y);
                                                    if ((pt(), a)) template.style.opacity = 1 - t;
                                                    else dt(h - t * h);
                                                };
                                            if (e)
                                                Ut("initialZoom", 0, 1, l, n.easing.cubic.out, p, f);
                                            else p(1), (fn = setTimeout(f, l + 20));
                                        }
                                    },
                                    o ? 25 : 90
                                );
                            })();
                        } else if (
                            (ft("initialZoom" + (o ? "Out" : "In")),
                                (S = t.initialZoomLevel),
                                wt(y, t.initialPosition),
                                pt(),
                                (template.style.opacity = o ? 0 : 1),
                                dt(1),
                                l)
                        )
                            setTimeout(function () {
                                f();
                            }, l);
                        else f();
                    },
                    dn,
                    hn = {},
                    pn = [],
                    mn,
                    vn,
                    gn = {
                        index: 0,
                        errorMsg:
                            '<div class="pswp__error-msg"><a href="%url%" target="_blank">The image</a> could not be loaded.</div>',
                        forceProgressiveLoading: false,
                        preload: [1, 1],
                        getNumItemsFn: function () {
                            return dn.length;
                        },
                    },
                    yn,
                    wn,
                    bn,
                    Cn = function () {
                        return {
                            center: { x: 0, y: 0 },
                            max: { x: 0, y: 0 },
                            min: { x: 0, y: 0 },
                        };
                    },
                    xn = function (t, e, n) {
                        var i = t.bounds;
                        (i.center.x = Math.round((hn.x - e) / 2)),
                            (i.center.y = Math.round((hn.y - n) / 2) + t.vGap.top),
                            (i.max.x = e > hn.x ? Math.round(hn.x - e) : i.center.x),
                            (i.max.y =
                                n > hn.y ? Math.round(hn.y - n) + t.vGap.top : i.center.y),
                            (i.min.x = e > hn.x ? 0 : i.center.x),
                            (i.min.y = n > hn.y ? t.vGap.top : i.center.y);
                    },
                    Sn = function (t, e, n) {
                        if (t.src && !t.loadError) {
                            var i = !n;
                            if (i) {
                                if (!t.vGap) t.vGap = { top: 0, bottom: 0 };
                                ft("parseVerticalMargin", t);
                            }
                            if (
                                ((hn.x = e.x), (hn.y = e.y - t.vGap.top - t.vGap.bottom), i)
                            ) {
                                var o = hn.x / t.w,
                                    a = hn.y / t.h;
                                t.fitRatio = o < a ? o : a;
                                var u = s.scaleMode;
                                if ("orig" === u) n = 1;
                                else if ("fit" === u) n = t.fitRatio;
                                if (n > 1) n = 1;
                                if (((t.initialZoomLevel = n), !t.bounds))
                                    t.bounds = {
                                        center: { x: 0, y: 0 },
                                        max: { x: 0, y: 0 },
                                        min: { x: 0, y: 0 },
                                    };
                            }
                            if (!n) return;
                            if ((xn(t, t.w * n, t.h * n), i && n === t.initialZoomLevel))
                                t.initialPosition = t.bounds.center;
                            return t.bounds;
                        } else
                            return (
                                (t.w = t.h = 0),
                                (t.initialZoomLevel = t.fitRatio = 1),
                                (t.bounds = {
                                    center: { x: 0, y: 0 },
                                    max: { x: 0, y: 0 },
                                    min: { x: 0, y: 0 },
                                }),
                                (t.initialPosition = t.bounds.center),
                                t.bounds
                            );
                    },
                    An = function (index, t, e, n, o, a) {
                        if (!t.loadError)
                            if (n)
                                if (
                                    ((t.imageAppended = true),
                                        In(t, n, t === i.currItem && rt),
                                        e.appendChild(n),
                                        a)
                                )
                                    setTimeout(function () {
                                        if (t && t.loaded && t.placeholder)
                                            (t.placeholder.style.display = "none"),
                                                (t.placeholder = null);
                                    }, 500);
                    },
                    _n = function (t) {
                        (t.loading = true), (t.loaded = false);
                        var e = (t.img = n.createEl("pswp__img", "img")),
                            i = function () {
                                if (((t.loading = false), (t.loaded = true), t.loadComplete))
                                    t.loadComplete(t);
                                else t.img = null;
                                (e.onload = e.onerror = null), (e = null);
                            };
                        return (
                            (e.onload = i),
                            (e.onerror = function () {
                                (t.loadError = true), i();
                            }),
                            (e.src = t.src),
                            e
                        );
                    },
                    Tn = function (t, e) {
                        if (t.src && t.loadError && t.container) {
                            if (e) t.container.innerHTML = "";
                            return (
                                (t.container.innerHTML = s.errorMsg.replace("%url%", t.src)),
                                true
                            );
                        }
                    },
                    In = function (t, e, n) {
                        if (t.src) {
                            if (!e) e = t.container.lastChild;
                            var i = n ? t.w : Math.round(t.w * t.fitRatio),
                                o = n ? t.h : Math.round(t.h * t.fitRatio);
                            if (t.placeholder && !t.loaded)
                                (t.placeholder.style.width = i + "px"),
                                    (t.placeholder.style.height = o + "px");
                            (e.style.width = i + "px"), (e.style.height = o + "px");
                        }
                    },
                    En = function () {
                        if (pn.length) {
                            for (var t, e = 0; e < pn.length; e++)
                                if ((t = pn[e]).holder.index === t.index)
                                    An(
                                        t.index,
                                        t.item,
                                        t.baseDiv,
                                        t.img,
                                        false,
                                        t.clearPlaceholder
                                    );
                            pn = [];
                        }
                    };
                at("Controller", {
                    publicMethods: {
                        lazyLoadItem: function (index) {
                            index = st(index);
                            var t = yn(index);
                            if (t && ((!t.loaded && !t.loading) || E))
                                if ((ft("gettingData", index, t), t.src)) _n(t);
                        },
                        initController: function () {
                            if (
                                (n.extend(s, gn, true),
                                    (i.items = dn = items),
                                    (yn = i.getItemAt),
                                    (wn = s.getNumItemsFn),
                                    (bn = s.loop),
                                    wn() < 3)
                            )
                                s.loop = false;
                            lt("beforeChange", function (diff) {
                                var t = s.preload,
                                    e = null === diff ? true : diff >= 0,
                                    n = Math.min(t[0], wn()),
                                    o = Math.min(t[1], wn()),
                                    a;
                                for (a = 1; a <= (e ? o : n); a++) i.lazyLoadItem(h + a);
                                for (a = 1; a <= (e ? n : o); a++) i.lazyLoadItem(h - a);
                            }),
                                lt("initialLayout", function () {
                                    i.currItem.initialLayout =
                                        s.getThumbBoundsFn && s.getThumbBoundsFn(h);
                                }),
                                lt("mainScrollAnimComplete", En),
                                lt("initialZoomInEnd", En),
                                lt("destroy", function () {
                                    for (var t, e = 0; e < dn.length; e++) {
                                        if ((t = dn[e]).container) t.container = null;
                                        if (t.placeholder) t.placeholder = null;
                                        if (t.img) t.img = null;
                                        if (t.preloader) t.preloader = null;
                                        if (t.loadError) t.loaded = t.loadError = false;
                                    }
                                    pn = null;
                                });
                        },
                        getItemAt: function (index) {
                            if (index >= 0) return void 0 !== dn[index] ? dn[index] : false;
                            else return false;
                        },
                        allowProgressiveImg: function () {
                            return (
                                s.forceProgressiveLoading ||
                                !Y ||
                                s.mouseUsed ||
                                screen.width > 1200
                            );
                        },
                        setContent: function (t, index) {
                            if (s.loop) index = st(index);
                            var e = i.getItemAt(t.index);
                            if (e) e.container = null;
                            var o = i.getItemAt(index),
                                a;
                            if (!o) return (t.el.innerHTML = ""), void 0;
                            ft("gettingData", index, o), (t.index = index), (t.item = o);
                            var u = (o.container = n.createEl("pswp__zoom-wrap"));
                            if (!o.src && o.html)
                                if (o.html.tagName) u.appendChild(o.html);
                                else u.innerHTML = o.html;
                            if ((Tn(o), Sn(o, x), o.src && !o.loadError && !o.loaded)) {
                                if (
                                    ((o.loadComplete = function (e) {
                                        if (l) {
                                            if (t && t.index === index) {
                                                if (Tn(e, true)) {
                                                    if (
                                                        ((e.loadComplete = e.img = null),
                                                            Sn(e, x),
                                                            mt(e),
                                                            t.index === h)
                                                    )
                                                        i.updateCurrZoomItem();
                                                    return;
                                                }
                                                if (!e.imageAppended)
                                                    if (tt.transform && (Ae || vn))
                                                        pn.push({
                                                            item: e,
                                                            baseDiv: u,
                                                            img: e.img,
                                                            index: index,
                                                            holder: t,
                                                            clearPlaceholder: true,
                                                        });
                                                    else An(index, e, u, e.img, Ae || vn, true);
                                                else if (!vn && e.placeholder)
                                                    (e.placeholder.style.display = "none"),
                                                        (e.placeholder = null);
                                            }
                                            (e.loadComplete = null),
                                                (e.img = null),
                                                ft("imageLoadComplete", index, e);
                                        }
                                    }),
                                        n.features.transform)
                                ) {
                                    var f = "pswp__img pswp__img--placeholder";
                                    f += o.msrc ? "" : " pswp__img--placeholder--blank";
                                    var placeholder = n.createEl(f, o.msrc ? "img" : "");
                                    if (o.msrc) placeholder.src = o.msrc;
                                    In(o, placeholder),
                                        u.appendChild(placeholder),
                                        (o.placeholder = placeholder);
                                }
                                if (!o.loading) _n(o);
                                if (i.allowProgressiveImg())
                                    if (!mn && tt.transform)
                                        pn.push({
                                            item: o,
                                            baseDiv: u,
                                            img: o.img,
                                            index: index,
                                            holder: t,
                                        });
                                    else An(index, o, u, o.img, true, true);
                            } else if (o.src && !o.loadError)
                                ((a = n.createEl("pswp__img", "img")).style.opacity = 1),
                                    (a.src = o.src),
                                    In(o, a),
                                    An(index, o, u, a, true);
                            if (!mn && index === h) (Se = u.style), cn(o, a || o.img);
                            else mt(o);
                            (t.el.innerHTML = ""), t.el.appendChild(u);
                        },
                        cleanSlide: function (t) {
                            if (t.img) t.img.onload = t.img.onerror = null;
                            t.loaded = t.loading = t.img = t.imageAppended = false;
                        },
                    },
                });
                var Dn,
                    kn = {},
                    Mn = function (t, e, n) {
                        var i = document.createEvent("CustomEvent"),
                            o = {
                                origEvent: t,
                                target: t.target,
                                releasePoint: e,
                                pointerType: n || "touch",
                            };
                        i.initCustomEvent("pswpTap", true, true, o),
                            t.target.dispatchEvent(i);
                    },
                    Ln;
                at("Tap", {
                    publicMethods: {
                        initTap: function () {
                            lt("firstTouchStart", i.onTapStart),
                                lt("touchRelease", i.onTapRelease),
                                lt("destroy", function () {
                                    (kn = {}), (Dn = null);
                                });
                        },
                        onTapStart: function (t) {
                            if (t.length > 1) clearTimeout(Dn), (Dn = null);
                        },
                        onTapRelease: function (t, e) {
                            if (e)
                                if (!ce && !le && !Ft) {
                                    var i = e,
                                        o;
                                    if (Dn)
                                        if ((clearTimeout(Dn), (Dn = null), Pe(i, kn)))
                                            return ft("doubleTap", i), void 0;
                                    if ("mouse" === e.type) return Mn(t, e, "mouse"), void 0;
                                    if (
                                        "BUTTON" === t.target.tagName.toUpperCase() ||
                                        n.hasClass(t.target, "pswp__single-tap")
                                    )
                                        return Mn(t, e), void 0;
                                    wt(kn, i),
                                        (Dn = setTimeout(function () {
                                            Mn(t, e), (Dn = null);
                                        }, 300));
                                }
                        },
                    },
                }),
                    at("DesktopZoom", {
                        publicMethods: {
                            initDesktopZoom: function () {
                                if (!K)
                                    if (Y)
                                        lt("mouseUsed", function () {
                                            i.setupDesktopZoom();
                                        });
                                    else i.setupDesktopZoom(true);
                            },
                            setupDesktopZoom: function (t) {
                                Ln = {};
                                var events = "wheel mousewheel DOMMouseScroll";
                                lt("bindEvents", function () {
                                    n.bind(template, events, i.handleMouseWheel);
                                }),
                                    lt("unbindEvents", function () {
                                        if (Ln) n.unbind(template, events, i.handleMouseWheel);
                                    }),
                                    (i.mouseZoomedIn = false);
                                var e,
                                    o = function () {
                                        if (i.mouseZoomedIn)
                                            n.removeClass(template, "pswp--zoomed-in"),
                                                (i.mouseZoomedIn = false);
                                        if (S < 1) n.addClass(template, "pswp--zoom-allowed");
                                        else n.removeClass(template, "pswp--zoom-allowed");
                                        a();
                                    },
                                    a = function () {
                                        if (e)
                                            n.removeClass(template, "pswp--dragging"), (e = false);
                                    };
                                if (
                                    (lt("resize", o),
                                        lt("afterChange", o),
                                        lt("pointerDown", function () {
                                            if (i.mouseZoomedIn)
                                                (e = true), n.addClass(template, "pswp--dragging");
                                        }),
                                        lt("pointerUp", a),
                                        !t)
                                )
                                    o();
                            },
                            handleMouseWheel: function (t) {
                                if (S <= i.currItem.fitRatio) {
                                    if (s.modal)
                                        if (!s.closeOnScroll || Ft || ue) t.preventDefault();
                                        else if (H && Math.abs(t.deltaY) > 2) (c = true), i.close();
                                    return true;
                                }
                                if ((t.stopPropagation(), (Ln.x = 0), "deltaX" in t))
                                    if (1 === t.deltaMode)
                                        (Ln.x = 18 * t.deltaX), (Ln.y = 18 * t.deltaY);
                                    else (Ln.x = t.deltaX), (Ln.y = t.deltaY);
                                else if ("wheelDelta" in t) {
                                    if (t.wheelDeltaX) Ln.x = -0.16 * t.wheelDeltaX;
                                    if (t.wheelDeltaY) Ln.y = -0.16 * t.wheelDeltaY;
                                    else Ln.y = -0.16 * t.wheelDelta;
                                } else if ("detail" in t) Ln.y = t.detail;
                                else return;
                                _t(S, true);
                                var e = y.x - Ln.x,
                                    n = y.y - Ln.y;
                                if (
                                    s.modal ||
                                    (e <= Ce.min.x &&
                                        e >= Ce.max.x &&
                                        n <= Ce.min.y &&
                                        n >= Ce.max.y)
                                )
                                    t.preventDefault();
                                i.panTo(e, n);
                            },
                            toggleDesktopZoom: function (t) {
                                t = t || { x: x.x / 2 + M.x, y: x.y / 2 + M.y };
                                var e = s.getDoubleTapZoom(true, i.currItem),
                                    o = S === e;
                                (i.mouseZoomedIn = !o),
                                    i.zoomTo(o ? i.currItem.initialZoomLevel : e, t, 333),
                                    n[(!o ? "add" : "remove") + "Class"](
                                        template,
                                        "pswp--zoomed-in"
                                    );
                            },
                        },
                    });
                var Bn = { history: true, galleryUID: 1 },
                    On,
                    Pn,
                    Fn,
                    Rn,
                    Nn,
                    zn,
                    Un,
                    qn,
                    Hn,
                    $n,
                    Vn,
                    Yn,
                    Wn = function () {
                        return Vn.hash.substring(1);
                    },
                    jn = function () {
                        if (On) clearTimeout(On);
                        if (Fn) clearTimeout(Fn);
                    },
                    Gn = function () {
                        var hash = Wn(),
                            t = {};
                        if (hash.length < 5) return t;
                        var e,
                            n = hash.split("&");
                        for (e = 0; e < n.length; e++)
                            if (n[e]) {
                                var i = n[e].split("=");
                                if (!(i.length < 2)) t[i[0]] = i[1];
                            }
                        if (s.galleryPIDs) {
                            var o = t.pid;
                            for (t.pid = 0, e = 0; e < dn.length; e++)
                                if (dn[e].pid === o) {
                                    t.pid = e;
                                    break;
                                }
                        } else t.pid = parseInt(t.pid, 10) - 1;
                        if (t.pid < 0) t.pid = 0;
                        return t;
                    },
                    Zn = function () {
                        if (Fn) clearTimeout(Fn);
                        if (Ft || ue) return (Fn = setTimeout(Zn, 500)), void 0;
                        if (Rn) clearTimeout(Pn);
                        else Rn = true;
                        var t = h + 1,
                            e = yn(h);
                        if (e.hasOwnProperty("pid")) t = e.pid;
                        var n = Un + "&" + "gid=" + s.galleryUID + "&" + "pid=" + t;
                        if (!qn) if (-1 === Vn.hash.indexOf(n)) $n = true;
                        var i = Vn.href.split("#")[0] + "#" + n;
                        if (Yn) {
                            if ("#" + n !== window.location.hash)
                                history[qn ? "replaceState" : "pushState"](
                                    "",
                                    document.title,
                                    i
                                );
                        } else if (qn) Vn.replace(i);
                        else Vn.hash = n;
                        (qn = true),
                            (Pn = setTimeout(function () {
                                Rn = false;
                            }, 60));
                    };
                at("History", {
                    publicMethods: {
                        initHistory: function () {
                            if ((n.extend(s, Bn, true), s.history)) {
                                if (
                                    ((Vn = window.location),
                                        ($n = false),
                                        (Hn = false),
                                        (qn = false),
                                        (Un = Wn()),
                                        (Yn = "pushState" in history),
                                        Un.indexOf("gid=") > -1)
                                )
                                    Un = (Un = Un.split("&gid=")[0]).split("?gid=")[0];
                                lt("afterChange", i.updateURL),
                                    lt("unbindEvents", function () {
                                        n.unbind(window, "hashchange", i.onHashChange);
                                    });
                                var t = function () {
                                    if (((zn = true), !Hn))
                                        if ($n) history.back();
                                        else if (Un) Vn.hash = Un;
                                        else if (Yn)
                                            history.pushState(
                                                "",
                                                document.title,
                                                Vn.pathname + Vn.search
                                            );
                                        else Vn.hash = "";
                                    jn();
                                };
                                lt("unbindEvents", function () {
                                    if (c) t();
                                }),
                                    lt("destroy", function () {
                                        if (!zn) t();
                                    }),
                                    lt("firstUpdate", function () {
                                        h = Gn().pid;
                                    });
                                var index = Un.indexOf("pid=");
                                if (index > -1)
                                    if ("&" === (Un = Un.substring(0, index)).slice(-1))
                                        Un = Un.slice(0, -1);
                                setTimeout(function () {
                                    if (l) n.bind(window, "hashchange", i.onHashChange);
                                }, 40);
                            }
                        },
                        onHashChange: function () {
                            if (Wn() === Un) return (Hn = true), i.close(), void 0;
                            if (!Rn) (Nn = true), i.goTo(Gn().pid), (Nn = false);
                        },
                        updateURL: function () {
                            if ((jn(), !Nn))
                                if (!qn) Zn();
                                else On = setTimeout(Zn, 800);
                        },
                    },
                }),
                    n.extend(i, qt);
            };
            return t;
        });
    },
    9815: function (t, e, n) {
        "use strict";
        var i, o;
    /*! PhotoSwipe Default UI - 4.1.3 - 2019-01-08
     * http://photoswipe.com
     * Copyright (c) 2019 Dmitry Semenov; */ !(function (a, factory) {
            if (true)
                !(
                    void 0 !==
                    (o = "function" == typeof (i = factory) ? i.call(e, n, e, t) : i) &&
                    (t.exports = o)
                );
            else if ("object" == typeof e) t.exports = factory();
            else a.PhotoSwipeUI_Default = factory();
        })(this, function () {
            var t;
            return function (t, e) {
                var n = this,
                    i = false,
                    o = true,
                    a,
                    s,
                    u,
                    l,
                    f,
                    c,
                    h,
                    p = true,
                    m,
                    v,
                    g,
                    y,
                    w,
                    b,
                    C,
                    x,
                    S = {
                        barsSize: { top: 44, bottom: "auto" },
                        closeElClasses: ["item", "caption", "zoom-wrap", "ui", "top-bar"],
                        timeToIdle: 4e3,
                        timeToIdleOutside: 1e3,
                        loadingIndicatorDelay: 1e3,
                        addCaptionHTMLFn: function (t, e) {
                            if (!t.title) return (e.children[0].innerHTML = ""), false;
                            else return (e.children[0].innerHTML = t.title), true;
                        },
                        closeEl: true,
                        captionEl: true,
                        fullscreenEl: true,
                        zoomEl: true,
                        shareEl: true,
                        counterEl: true,
                        arrowEl: true,
                        preloaderEl: true,
                        tapToClose: false,
                        tapToToggleControls: true,
                        clickToCloseNonZoomable: true,
                        shareButtons: [
                            {
                                id: "facebook",
                                label: "Share on Facebook",
                                url: "https://www.facebook.com/sharer/sharer.php?u={{url}}",
                            },
                            {
                                id: "twitter",
                                label: "Tweet",
                                url: "https://twitter.com/intent/tweet?text={{text}}&url={{url}}",
                            },
                            {
                                id: "pinterest",
                                label: "Pin it",
                                url:
                                    "http://www.pinterest.com/pin/create/button/" +
                                    "?url={{url}}&media={{image_url}}&description={{text}}",
                            },
                            {
                                id: "download",
                                label: "Download image",
                                url: "{{raw_image_url}}",
                                download: true,
                            },
                        ],
                        getImageURLForShare: function () {
                            return t.currItem.src || "";
                        },
                        getPageURLForShare: function () {
                            return window.location.href;
                        },
                        getTextForShare: function () {
                            return t.currItem.title || "";
                        },
                        indexIndicatorSep: " / ",
                        fitControlsWidth: 1200,
                    },
                    A,
                    _,
                    T = function (t) {
                        if (A) return true;
                        if (((t = t || window.event), x.timeToIdle && x.mouseUsed && !v))
                            U();
                        for (
                            var n,
                            i,
                            o = (t.target || t.srcElement).getAttribute("class") || "",
                            a,
                            s = 0;
                            s < Z.length;
                            s++
                        )
                            if ((i = Z[s]).onTap && o.indexOf("pswp__" + i.name) > -1)
                                i.onTap(), (a = true);
                        if (a) {
                            if (t.stopPropagation) t.stopPropagation();
                            A = true;
                            var u = e.features.isOldAndroid ? 600 : 30;
                            _ = setTimeout(function () {
                                A = false;
                            }, u);
                        }
                    },
                    I = function () {
                        return (
                            !t.likelyTouchDevice ||
                            x.mouseUsed ||
                            screen.width > x.fitControlsWidth
                        );
                    },
                    E = function (el, t, add) {
                        e[(add ? "add" : "remove") + "Class"](el, "pswp__" + t);
                    },
                    k = function () {
                        var t = 1 === x.getNumItemsFn();
                        if (t !== C) E(s, "ui--one-slide", t), (C = t);
                    },
                    M = function () {
                        E(h, "share-modal--hidden", p);
                    },
                    L = function () {
                        if (!(p = !p))
                            M(),
                                setTimeout(function () {
                                    if (!p) e.addClass(h, "pswp__share-modal--fade-in");
                                }, 30);
                        else
                            e.removeClass(h, "pswp__share-modal--fade-in"),
                                setTimeout(function () {
                                    if (p) M();
                                }, 300);
                        if (!p) O();
                        return false;
                    },
                    B = function (e) {
                        var n = (e = e || window.event).target || e.srcElement;
                        if ((t.shout("shareLinkClick", e, n), !n.href)) return false;
                        if (n.hasAttribute("download")) return true;
                        if (
                            (window.open(
                                n.href,
                                "pswp_share",
                                "scrollbars=yes,resizable=yes,toolbar=no," +
                                "location=yes,width=550,height=420,top=100,left=" +
                                (window.screen ? Math.round(screen.width / 2 - 275) : 100)
                            ),
                                !p)
                        )
                            L();
                        return false;
                    },
                    O = function () {
                        for (
                            var t = "", e, n, i, o, a, s = 0;
                            s < x.shareButtons.length;
                            s++
                        )
                            if (
                                ((e = x.shareButtons[s]),
                                    (i = x.getImageURLForShare(e)),
                                    (o = x.getPageURLForShare(e)),
                                    (a = x.getTextForShare(e)),
                                    (t +=
                                        '<a href="' +
                                        (n = e.url
                                            .replace("{{url}}", encodeURIComponent(o))
                                            .replace("{{image_url}}", encodeURIComponent(i))
                                            .replace("{{raw_image_url}}", i)
                                            .replace("{{text}}", encodeURIComponent(a))) +
                                        '" target="_blank" ' +
                                        'class="pswp__share--' +
                                        e.id +
                                        '"' +
                                        (e.download ? "download" : "") +
                                        ">" +
                                        e.label +
                                        "</a>"),
                                    x.parseShareButtonOut)
                            )
                                t = x.parseShareButtonOut(e, t);
                        (h.children[0].innerHTML = t), (h.children[0].onclick = B);
                    },
                    P = function (t) {
                        for (var n = 0; n < x.closeElClasses.length; n++)
                            if (e.hasClass(t, "pswp__" + x.closeElClasses[n])) return true;
                    },
                    F,
                    N,
                    z = 0,
                    U = function () {
                        if ((clearTimeout(N), (z = 0), v)) n.setIdle(false);
                    },
                    H = function (t) {
                        var e = (t = t ? t : window.event).relatedTarget || t.toElement;
                        if (!e || "HTML" === e.nodeName)
                            clearTimeout(N),
                                (N = setTimeout(function () {
                                    n.setIdle(true);
                                }, x.timeToIdleOutside));
                    },
                    $ = function () {
                        if (x.fullscreenEl && !e.features.isOldAndroid) {
                            if (!a) a = n.getFullscreenAPI();
                            if (a)
                                e.bind(document, a.eventK, n.updateFullscreen),
                                    n.updateFullscreen(),
                                    e.addClass(t.template, "pswp--supports-fs");
                            else e.removeClass(t.template, "pswp--supports-fs");
                        }
                    },
                    V = function () {
                        if (x.preloaderEl)
                            Y(true),
                                g("beforeChange", function () {
                                    clearTimeout(b),
                                        (b = setTimeout(function () {
                                            if (t.currItem && t.currItem.loading) {
                                                if (
                                                    !t.allowProgressiveImg() ||
                                                    (t.currItem.img && !t.currItem.img.naturalWidth)
                                                )
                                                    Y(false);
                                            } else Y(true);
                                        }, x.loadingIndicatorDelay));
                                }),
                                g("imageLoadComplete", function (index, e) {
                                    if (t.currItem === e) Y(true);
                                });
                    },
                    Y = function (t) {
                        if (w !== t) E(y, "preloader--active", !t), (w = t);
                    },
                    W = function (t) {
                        var n = t.vGap;
                        if (I()) {
                            var i = x.barsSize;
                            if (x.captionEl && "auto" === i.bottom) {
                                if (!l)
                                    (l = e.createEl(
                                        "pswp__caption pswp__caption--fake"
                                    )).appendChild(e.createEl("pswp__caption__center")),
                                        s.insertBefore(l, u),
                                        e.addClass(s, "pswp__ui--fit");
                                if (x.addCaptionHTMLFn(t, l, true)) {
                                    var o = l.clientHeight;
                                    n.bottom = parseInt(o, 10) || 44;
                                } else n.bottom = i.top;
                            } else n.bottom = "auto" === i.bottom ? 0 : i.bottom;
                            n.top = i.top;
                        } else n.top = n.bottom = 0;
                    },
                    j = function () {
                        if (x.timeToIdle)
                            g("mouseUsed", function () {
                                e.bind(document, "mousemove", U),
                                    e.bind(document, "mouseout", H),
                                    (F = setInterval(function () {
                                        if (2 === ++z) n.setIdle(true);
                                    }, x.timeToIdle / 2));
                            });
                    },
                    G = function () {
                        var t;
                        g("onVerticalDrag", function (t) {
                            if (o && t < 0.95) n.hideControls();
                            else if (!o && t >= 0.95) n.showControls();
                        }),
                            g("onPinchClose", function (e) {
                                if (o && e < 0.9) n.hideControls(), (t = true);
                                else if (t && !o && e > 0.9) n.showControls();
                            }),
                            g("zoomGestureEnded", function () {
                                if ((t = false) && !o) n.showControls();
                            });
                    },
                    Z = [
                        {
                            name: "caption",
                            option: "captionEl",
                            onInit: function (el) {
                                u = el;
                            },
                        },
                        {
                            name: "share-modal",
                            option: "shareEl",
                            onInit: function (el) {
                                h = el;
                            },
                            onTap: function () {
                                L();
                            },
                        },
                        {
                            name: "button--share",
                            option: "shareEl",
                            onInit: function (el) {
                                c = el;
                            },
                            onTap: function () {
                                L();
                            },
                        },
                        {
                            name: "button--zoom",
                            option: "zoomEl",
                            onTap: t.toggleDesktopZoom,
                        },
                        {
                            name: "counter",
                            option: "counterEl",
                            onInit: function (el) {
                                f = el;
                            },
                        },
                        { name: "button--close", option: "closeEl", onTap: t.close },
                        { name: "button--arrow--left", option: "arrowEl", onTap: t.prev },
                        { name: "button--arrow--right", option: "arrowEl", onTap: t.next },
                        {
                            name: "button--fs",
                            option: "fullscreenEl",
                            onTap: function () {
                                if (a.isFullscreen()) a.exit();
                                else a.enter();
                            },
                        },
                        {
                            name: "preloader",
                            option: "preloaderEl",
                            onInit: function (el) {
                                y = el;
                            },
                        },
                    ],
                    X = function () {
                        var t,
                            n,
                            i,
                            o = function (o) {
                                if (o)
                                    for (var a = o.length, s = 0; s < a; s++) {
                                        (t = o[s]), (n = t.className);
                                        for (var u = 0; u < Z.length; u++)
                                            if (((i = Z[u]), n.indexOf("pswp__" + i.name) > -1))
                                                if (x[i.option]) {
                                                    if (
                                                        (e.removeClass(t, "pswp__element--disabled"),
                                                            i.onInit)
                                                    )
                                                        i.onInit(t);
                                                } else e.addClass(t, "pswp__element--disabled");
                                    }
                            };
                        o(s.children);
                        var a = e.getChildByClass(s, "pswp__top-bar");
                        if (a) o(a.children);
                    };
                (n.init = function () {
                    if (
                        (e.extend(t.options, S, true),
                            (x = t.options),
                            (s = e.getChildByClass(t.scrollWrap, "pswp__ui")),
                            (g = t.listen),
                            G(),
                            g("beforeChange", n.update),
                            g("doubleTap", function (e) {
                                var n = t.currItem.initialZoomLevel;
                                if (t.getZoomLevel() !== n) t.zoomTo(n, e, 333);
                                else t.zoomTo(x.getDoubleTapZoom(false, t.currItem), e, 333);
                            }),
                            g("preventDragEvent", function (t, e, n) {
                                var i = t.target || t.srcElement;
                                if (
                                    i &&
                                    i.getAttribute("class") &&
                                    t.type.indexOf("mouse") > -1 &&
                                    (i.getAttribute("class").indexOf("__caption") > 0 ||
                                        /(SMALL|STRONG|EM)/i.test(i.tagName))
                                )
                                    n.prevent = false;
                            }),
                            g("bindEvents", function () {
                                if (
                                    (e.bind(s, "pswpTap click", T),
                                        e.bind(t.scrollWrap, "pswpTap", n.onGlobalTap),
                                        !t.likelyTouchDevice)
                                )
                                    e.bind(t.scrollWrap, "mouseover", n.onMouseOver);
                            }),
                            g("unbindEvents", function () {
                                if (!p) L();
                                if (F) clearInterval(F);
                                if (
                                    (e.unbind(document, "mouseout", H),
                                        e.unbind(document, "mousemove", U),
                                        e.unbind(s, "pswpTap click", T),
                                        e.unbind(t.scrollWrap, "pswpTap", n.onGlobalTap),
                                        e.unbind(t.scrollWrap, "mouseover", n.onMouseOver),
                                        a)
                                ) {
                                    if (
                                        (e.unbind(document, a.eventK, n.updateFullscreen),
                                            a.isFullscreen())
                                    )
                                        (x.hideAnimationDuration = 0), a.exit();
                                    a = null;
                                }
                            }),
                            g("destroy", function () {
                                if (x.captionEl) {
                                    if (l) s.removeChild(l);
                                    e.removeClass(u, "pswp__caption--empty");
                                }
                                if (h) h.children[0].onclick = null;
                                e.removeClass(s, "pswp__ui--over-close"),
                                    e.addClass(s, "pswp__ui--hidden"),
                                    n.setIdle(false);
                            }),
                            !x.showAnimationDuration)
                    )
                        e.removeClass(s, "pswp__ui--hidden");
                    if (
                        (g("initialZoomIn", function () {
                            if (x.showAnimationDuration) e.removeClass(s, "pswp__ui--hidden");
                        }),
                            g("initialZoomOut", function () {
                                e.addClass(s, "pswp__ui--hidden");
                            }),
                            g("parseVerticalMargin", W),
                            X(),
                            x.shareEl && c && h)
                    )
                        p = true;
                    k(), j(), $(), V();
                }),
                    (n.setIdle = function (t) {
                        (v = t), E(s, "ui--idle", t);
                    }),
                    (n.update = function () {
                        if (o && t.currItem) {
                            if ((n.updateIndexIndicator(), x.captionEl))
                                x.addCaptionHTMLFn(t.currItem, u),
                                    E(u, "caption--empty", !t.currItem.title);
                            i = true;
                        } else i = false;
                        if (!p) L();
                        k();
                    }),
                    (n.updateFullscreen = function (n) {
                        if (n)
                            setTimeout(function () {
                                t.setScrollOffset(0, e.getScrollY());
                            }, 50);
                        e[(a.isFullscreen() ? "add" : "remove") + "Class"](
                            t.template,
                            "pswp--fs"
                        );
                    }),
                    (n.updateIndexIndicator = function () {
                        if (x.counterEl)
                            f.innerHTML =
                                t.getCurrentIndex() +
                                1 +
                                x.indexIndicatorSep +
                                x.getNumItemsFn();
                    }),
                    (n.onGlobalTap = function (i) {
                        var a = (i = i || window.event).target || i.srcElement;
                        if (!A)
                            if (i.detail && "mouse" === i.detail.pointerType) {
                                if (P(a)) return t.close(), void 0;
                                if (e.hasClass(a, "pswp__img"))
                                    if (
                                        1 === t.getZoomLevel() &&
                                        t.getZoomLevel() <= t.currItem.fitRatio
                                    ) {
                                        if (x.clickToCloseNonZoomable) t.close();
                                    } else t.toggleDesktopZoom(i.detail.releasePoint);
                            } else {
                                if (x.tapToToggleControls)
                                    if (o) n.hideControls();
                                    else n.showControls();
                                if (x.tapToClose && (e.hasClass(a, "pswp__img") || P(a)))
                                    return t.close(), void 0;
                            }
                    }),
                    (n.onMouseOver = function (t) {
                        var e = (t = t || window.event).target || t.srcElement;
                        E(s, "ui--over-close", P(e));
                    }),
                    (n.hideControls = function () {
                        e.addClass(s, "pswp__ui--hidden"), (o = false);
                    }),
                    (n.showControls = function () {
                        if (((o = true), !i)) n.update();
                        e.removeClass(s, "pswp__ui--hidden");
                    }),
                    (n.supportsFullscreen = function () {
                        var d = document;
                        return !!(
                            d.exitFullscreen ||
                            d.mozCancelFullScreen ||
                            d.webkitExitFullscreen ||
                            d.msExitFullscreen
                        );
                    }),
                    (n.getFullscreenAPI = function () {
                        var e = document.documentElement,
                            n,
                            i = "fullscreenchange";
                        if (e.requestFullscreen)
                            n = {
                                enterK: "requestFullscreen",
                                exitK: "exitFullscreen",
                                elementK: "fullscreenElement",
                                eventK: i,
                            };
                        else if (e.mozRequestFullScreen)
                            n = {
                                enterK: "mozRequestFullScreen",
                                exitK: "mozCancelFullScreen",
                                elementK: "mozFullScreenElement",
                                eventK: "moz" + i,
                            };
                        else if (e.webkitRequestFullscreen)
                            n = {
                                enterK: "webkitRequestFullscreen",
                                exitK: "webkitExitFullscreen",
                                elementK: "webkitFullscreenElement",
                                eventK: "webkit" + i,
                            };
                        else if (e.msRequestFullscreen)
                            n = {
                                enterK: "msRequestFullscreen",
                                exitK: "msExitFullscreen",
                                elementK: "msFullscreenElement",
                                eventK: "MSFullscreenChange",
                            };
                        if (n)
                            (n.enter = function () {
                                if (
                                    ((m = x.closeOnScroll),
                                        (x.closeOnScroll = false),
                                        "webkitRequestFullscreen" === this.enterK)
                                )
                                    t.template[this.enterK](Element.ALLOW_KEYBOARD_INPUT);
                                else return t.template[this.enterK]();
                            }),
                                (n.exit = function () {
                                    return (x.closeOnScroll = m), document[this.exitK]();
                                }),
                                (n.isFullscreen = function () {
                                    return document[this.elementK];
                                });
                        return n;
                    });
            };
        });
    },
    9816: function (t, e, n) {
        "use strict";
        var i = n(10);
        if (!window.Utility) window.Utility = {};
        (Utility.decodeJsonAttribute = function (t) {
            return JSON.parse(decodeURIComponent(atob(t)));
        }),
            i(window.loadMapsContent);
    },
    9817: function (t, e, n) {
        "use strict";
        var i = n(10);
        n(9818),
            i(window).on("load", function () {
                var t;
                if (
                    !/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(
                        navigator.userAgent || navigator.vendor || window.opera
                    )
                ) {
                    var items = i(".u-parallax");
                    if (items.length > 0) {
                        items.each(function () {
                            var t = i(this);
                            if (
                                (t.css("background-attachment", "fixed"),
                                    t.hasClass("u-shading"))
                            )
                                t.attr(
                                    "data-bottom-top",
                                    "background-position: 50% 0, 50% 0vh;"
                                ),
                                    t.attr(
                                        "data-top-bottom",
                                        "background-position: 50% 0, 50% -20vh"
                                    );
                            else
                                t.attr("data-bottom-top", "background-position: 50% 0vh;"),
                                    t.attr("data-top-bottom", "background-position: 50% -20vh");
                        });
                        var e = { forceHeight: false };
                        skrollr.init(e);
                    }
                }
            });
    },
    9818: function (t, e) {
        var e = void 0,
            t = void 0;
        (function () {
            /*!
             * skrollr core
             *
             * Alexander Prinzhorn - https://github.com/Prinzhorn/skrollr
             *
             * Free to use under terms of MIT license
             */
            !(function (e, n, i) {
                "use strict";
                function o(t) {
                    if (
                        ((f = n.documentElement),
                            (c = n.body),
                            K(),
                            (Mt = this),
                            (Nt = (t = t || {}).constants || {}),
                            t.easing)
                    )
                        for (var i in t.easing) nt[i] = t.easing[i];
                    if (
                        ((Jt = t.edgeStrategy || "set"),
                            (Ot = {
                                beforerender: t.beforerender,
                                render: t.render,
                                keyframe: t.keyframe,
                            }),
                            (Pt = false !== t.forceHeight))
                    )
                        Rt = t.scale || 1;
                    if (
                        ((zt = t.mobileDeceleration || I),
                            (jt = false !== t.smoothScrolling),
                            (Gt = t.smoothScrollingDuration || k),
                            (Zt = { targetTop: Mt.getScrollTop() }),
                            (Qt = (
                                t.mobileCheck ||
                                function () {
                                    return /Android|iPhone|iPad|iPod|BlackBerry/i.test(
                                        navigator.userAgent || navigator.vendor || e.opera
                                    );
                                }
                            )()))
                    ) {
                        if ((Bt = n.getElementById(t.skrollrBody || E))) mt();
                        rt(), At(f, [C, A], [x]);
                    } else At(f, [C, S], [x]);
                    Mt.refresh(),
                        vt(e, "resize orientationchange", function () {
                            var t = f.clientWidth,
                                e = f.clientHeight;
                            if (e !== Vt || t !== $t) (Vt = e), ($t = t), (Yt = true);
                        });
                    var o = J();
                    return (
                        !(function t() {
                            st(), (ie = o(t));
                        })(),
                        Mt
                    );
                }
                var a = {
                    get: function () {
                        return Mt;
                    },
                    init: function (t) {
                        return Mt || new o(t);
                    },
                    VERSION: "0.6.30",
                },
                    s = Object.prototype.hasOwnProperty,
                    u = e.Math,
                    l = e.getComputedStyle,
                    f,
                    c,
                    h = "touchstart",
                    p = "touchmove",
                    m = "touchcancel",
                    v = "touchend",
                    g = "skrollable",
                    y = g + "-before",
                    w = g + "-between",
                    b = g + "-after",
                    C = "skrollr",
                    x = "no-" + C,
                    S = C + "-desktop",
                    A = C + "-mobile",
                    _ = "linear",
                    T = 1e3,
                    I = 0.004,
                    E = "skrollr-body",
                    k = 200,
                    M = "start",
                    L = "end",
                    B = "center",
                    O = "bottom",
                    P = "___skrollable_id",
                    F = /^(?:input|textarea|button|select)$/i,
                    N = /^\s+|\s+$/g,
                    z =
                        /^data(?:-(_\w+))?(?:-?(-?\d*\.?\d+p?))?(?:-?(start|end|top|center|bottom))?(?:-?(top|center|bottom))?$/,
                    U = /\s*(@?[\w\-\[\]]+)\s*:\s*(.+?)\s*(?:;|$)/gi,
                    H = /^(@?[a-z\-]+)\[(\w+)\]$/,
                    $ = /-([a-z0-9_])/g,
                    V = function (t, e) {
                        return e.toUpperCase();
                    },
                    Y = /[\-+]?[\d]*\.?[\d]+/g,
                    W = /\{\?\}/g,
                    j = /rgba?\(\s*-?\d+\s*,\s*-?\d+\s*,\s*-?\d+/g,
                    G = /[a-z\-]+-gradient/g,
                    Z = "",
                    X = "",
                    K = function () {
                        var t = /^(?:O|Moz|webkit|ms)|(?:-(?:o|moz|webkit|ms)-)/;
                        if (l) {
                            var style = l(c, null);
                            for (var e in style)
                                if ((Z = e.match(t) || (+e == e && style[e].match(t)))) break;
                            if (!Z) return (Z = X = ""), void 0;
                            if ("-" === (Z = Z[0]).slice(0, 1))
                                (X = Z),
                                    (Z = {
                                        "-webkit-": "webkit",
                                        "-moz-": "Moz",
                                        "-ms-": "ms",
                                        "-o-": "O",
                                    }[Z]);
                            else X = "-" + Z.toLowerCase() + "-";
                        }
                    },
                    J = function () {
                        var t =
                            e.requestAnimationFrame ||
                            e[Z.toLowerCase() + "RequestAnimationFrame"],
                            n = Dt();
                        if (Qt || !t)
                            t = function (t) {
                                var i = Dt() - n,
                                    o = u.max(0, 1e3 / 60 - i);
                                return e.setTimeout(function () {
                                    (n = Dt()), t();
                                }, o);
                            };
                        return t;
                    },
                    tt = function () {
                        var t =
                            e.cancelAnimationFrame ||
                            e[Z.toLowerCase() + "CancelAnimationFrame"];
                        if (Qt || !t)
                            t = function (t) {
                                return e.clearTimeout(t);
                            };
                        return t;
                    },
                    nt = {
                        begin: function () {
                            return 0;
                        },
                        end: function () {
                            return 1;
                        },
                        linear: function (t) {
                            return t;
                        },
                        quadratic: function (t) {
                            return t * t;
                        },
                        cubic: function (t) {
                            return t * t * t;
                        },
                        swing: function (t) {
                            return -u.cos(t * u.PI) / 2 + 0.5;
                        },
                        sqrt: function (t) {
                            return u.sqrt(t);
                        },
                        outCubic: function (t) {
                            return u.pow(t - 1, 3) + 1;
                        },
                        bounce: function (t) {
                            var e;
                            if (t <= 0.5083) e = 3;
                            else if (t <= 0.8489) e = 9;
                            else if (t <= 0.96208) e = 27;
                            else if (t <= 0.99981) e = 91;
                            else return 1;
                            return 1 - u.abs((3 * u.cos(t * e * 1.028)) / e);
                        },
                    };
                (o.prototype.refresh = function (t) {
                    var e,
                        o,
                        a = false;
                    if (t === i)
                        (a = true), (Lt = []), (Kt = 0), (t = n.getElementsByTagName("*"));
                    else if (t.length === i) t = [t];
                    for (e = 0, o = t.length; e < o; e++) {
                        var el = t[e],
                            s = el,
                            u = [],
                            l = jt,
                            f = Jt,
                            c = false;
                        if (a && P in el) delete el[P];
                        if (el.attributes) {
                            for (var h = 0, p = el.attributes.length; h < p; h++) {
                                var m = el.attributes[h];
                                if ("data-anchor-target" !== m.name)
                                    if ("data-smooth-scrolling" !== m.name)
                                        if ("data-edge-strategy" !== m.name)
                                            if ("data-emit-events" !== m.name) {
                                                var v = m.name.match(z);
                                                if (null !== v) {
                                                    var y = {
                                                        props: m.value,
                                                        element: el,
                                                        eventType: m.name.replace($, V),
                                                    };
                                                    u.push(y);
                                                    var w = v[1];
                                                    if (w) y.constant = w.substr(1);
                                                    var b = v[2];
                                                    if (/p$/.test(b))
                                                        (y.isPercentage = true),
                                                            (y.offset = (0 | b.slice(0, -1)) / 100);
                                                    else y.offset = 0 | b;
                                                    var C = v[3],
                                                        x = v[4] || C;
                                                    if (!C || C === M || C === L) {
                                                        if (((y.mode = "absolute"), C === L))
                                                            y.isEnd = true;
                                                        else if (!y.isPercentage) y.offset = y.offset * Rt;
                                                    } else (y.mode = "relative"), (y.anchors = [C, x]);
                                                }
                                            } else c = true;
                                        else f = m.value;
                                    else l = "off" !== m.value;
                                else if (null === (s = n.querySelector(m.value)))
                                    throw 'Unable to find anchor target "' + m.value + '"';
                            }
                            if (u.length) {
                                var S, A, id;
                                if (!a && P in el)
                                    (id = el[P]), (S = Lt[id].styleAttr), (A = Lt[id].classAttr);
                                else (id = el[P] = Kt++), (S = el.style.cssText), (A = St(el));
                                (Lt[id] = {
                                    element: el,
                                    styleAttr: S,
                                    classAttr: A,
                                    anchorTarget: s,
                                    keyFrames: u,
                                    smoothScrolling: l,
                                    edgeStrategy: f,
                                    emitEvents: c,
                                    lastFrameIndex: -1,
                                }),
                                    At(el, [g], []);
                            }
                        }
                    }
                    for (bt(), e = 0, o = t.length; e < o; e++) {
                        var sk = Lt[t[e][P]];
                        if (sk !== i) ut(sk), ft(sk);
                    }
                    return Mt;
                }),
                    (o.prototype.relativeToAbsolute = function (t, e, n) {
                        var i = f.clientHeight,
                            o = t.getBoundingClientRect(),
                            a = o.top,
                            s = o.bottom - o.top;
                        if (e === O) a -= i;
                        else if (e === B) a -= i / 2;
                        if (n === O) a += s;
                        else if (n === B) a += s / 2;
                        return ((a += Mt.getScrollTop()) + 0.5) | 0;
                    }),
                    (o.prototype.animateTo = function (t, e) {
                        e = e || {};
                        var n = Dt(),
                            o = Mt.getScrollTop(),
                            a = e.duration === i ? T : e.duration;
                        if (
                            !(Wt = {
                                startTop: o,
                                topDiff: t - o,
                                targetTop: t,
                                duration: a,
                                startTime: n,
                                endTime: n + a,
                                easing: nt[e.easing || _],
                                done: e.done,
                            }).topDiff
                        ) {
                            if (Wt.done) Wt.done.call(Mt, false);
                            Wt = i;
                        }
                        return Mt;
                    }),
                    (o.prototype.stopAnimateTo = function () {
                        if (Wt && Wt.done) Wt.done.call(Mt, true);
                        Wt = i;
                    }),
                    (o.prototype.isAnimatingTo = function () {
                        return !!Wt;
                    }),
                    (o.prototype.isMobile = function () {
                        return Qt;
                    }),
                    (o.prototype.setScrollTop = function (t, n) {
                        if (((Xt = true === n), Qt)) te = u.min(u.max(t, 0), Ft);
                        else e.scrollTo(0, t);
                        return Mt;
                    }),
                    (o.prototype.getScrollTop = function () {
                        if (Qt) return te;
                        else return e.pageYOffset || f.scrollTop || c.scrollTop || 0;
                    }),
                    (o.prototype.getMaxScrollTop = function () {
                        return Ft;
                    }),
                    (o.prototype.on = function (t, e) {
                        return (Ot[t] = e), Mt;
                    }),
                    (o.prototype.off = function (t) {
                        return delete Ot[t], Mt;
                    }),
                    (o.prototype.destroy = function () {
                        var t;
                        tt()(ie), yt(), At(f, [x], [C, S, A]);
                        for (var e = 0, n = Lt.length; e < n; e++) pt(Lt[e].element);
                        if (
                            ((f.style.overflow = c.style.overflow = ""),
                                (f.style.height = c.style.height = ""),
                                Bt)
                        )
                            a.setStyle(Bt, "transform", "none");
                        (Mt = i),
                            (Bt = i),
                            (Ot = i),
                            (Pt = i),
                            (Ft = 0),
                            (Rt = 1),
                            (Nt = i),
                            (zt = i),
                            (Ut = "down"),
                            (qt = -1),
                            ($t = 0),
                            (Vt = 0),
                            (Yt = false),
                            (Wt = i),
                            (jt = i),
                            (Gt = i),
                            (Zt = i),
                            (Xt = i),
                            (Kt = 0),
                            (Jt = i),
                            (Qt = false),
                            (te = 0),
                            (ee = i);
                    });
                var rt = function () {
                    var t, o, a, s, l, g, y, w, b, C, x, S;
                    vt(f, [h, p, m, v].join(" "), function (e) {
                        var f = e.changedTouches[0];
                        for (s = e.target; 3 === s.nodeType;) s = s.parentNode;
                        if (
                            ((l = f.clientY),
                                (g = f.clientX),
                                (C = e.timeStamp),
                                !F.test(s.tagName))
                        )
                            e.preventDefault();
                        switch (e.type) {
                            case h:
                                if (t) t.blur();
                                Mt.stopAnimateTo(), (t = s), (o = y = l), (a = g), (b = C);
                                break;
                            case p:
                                if (F.test(s.tagName) && n.activeElement !== s)
                                    e.preventDefault();
                                (w = l - y),
                                    (S = C - x),
                                    Mt.setScrollTop(te - w, true),
                                    (y = l),
                                    (x = C);
                                break;
                            default:
                            case m:
                            case v:
                                var c = o - l,
                                    A = a - g,
                                    _;
                                if (A * A + c * c < 49) {
                                    if (!F.test(t.tagName)) {
                                        t.focus();
                                        var T = n.createEvent("MouseEvents");
                                        T.initMouseEvent(
                                            "click",
                                            true,
                                            true,
                                            e.view,
                                            1,
                                            f.screenX,
                                            f.screenY,
                                            f.clientX,
                                            f.clientY,
                                            e.ctrlKey,
                                            e.altKey,
                                            e.shiftKey,
                                            e.metaKey,
                                            0,
                                            null
                                        ),
                                            t.dispatchEvent(T);
                                    }
                                    return;
                                }
                                t = i;
                                var I = w / S;
                                I = u.max(u.min(I, 3), -3);
                                var E = u.abs(I / zt),
                                    k = I * E + 0.5 * zt * E * E,
                                    M = Mt.getScrollTop() - k,
                                    L = 0;
                                if (M > Ft) (L = (Ft - M) / k), (M = Ft);
                                else if (M < 0) (L = -M / k), (M = 0);
                                (E *= 1 - L),
                                    Mt.animateTo((M + 0.5) | 0, {
                                        easing: "outCubic",
                                        duration: E,
                                    });
                                break;
                        }
                    }),
                        e.scrollTo(0, 0),
                        (f.style.overflow = c.style.overflow = "hidden");
                },
                    ot = function () {
                        var t = f.clientHeight,
                            e = Ct(),
                            n,
                            i,
                            o,
                            a,
                            s,
                            l,
                            c,
                            h,
                            p,
                            m,
                            v;
                        for (h = 0, p = Lt.length; h < p; h++)
                            for (
                                i = (n = Lt[h]).element,
                                o = n.anchorTarget,
                                s = 0,
                                l = (a = n.keyFrames).length;
                                s < l;
                                s++
                            ) {
                                if (
                                    ((m = (c = a[s]).offset),
                                        (v = e[c.constant] || 0),
                                        (c.frame = m),
                                        c.isPercentage)
                                )
                                    (m *= t), (c.frame = m);
                                if ("relative" === c.mode)
                                    pt(i),
                                        (c.frame =
                                            Mt.relativeToAbsolute(o, c.anchors[0], c.anchors[1]) - m),
                                        pt(i, true);
                                if (((c.frame += v), Pt))
                                    if (!c.isEnd && c.frame > Ft) Ft = c.frame;
                            }
                        for (Ft = u.max(Ft, xt()), h = 0, p = Lt.length; h < p; h++) {
                            for (s = 0, l = (a = (n = Lt[h]).keyFrames).length; s < l; s++)
                                if (((v = e[(c = a[s]).constant] || 0), c.isEnd))
                                    c.frame = Ft - c.offset + v;
                            n.keyFrames.sort(kt);
                        }
                    },
                    at = function (t, e) {
                        for (var n = 0, i = Lt.length; n < i; n++) {
                            var o = Lt[n],
                                u = o.element,
                                l = o.smoothScrolling ? t : e,
                                f = o.keyFrames,
                                c = f.length,
                                h = f[0],
                                p = f[f.length - 1],
                                m = l < h.frame,
                                v = l > p.frame,
                                C = m ? h : p,
                                x = o.emitEvents,
                                S = o.lastFrameIndex,
                                A,
                                _;
                            if (m || v) {
                                if ((m && -1 === o.edge) || (v && 1 === o.edge)) continue;
                                if (m) {
                                    if ((At(u, [y], [b, w]), x && S > -1))
                                        wt(u, h.eventType, Ut), (o.lastFrameIndex = -1);
                                } else if ((At(u, [b], [y, w]), x && S < c))
                                    wt(u, p.eventType, Ut), (o.lastFrameIndex = c);
                                switch (((o.edge = m ? -1 : 1), o.edgeStrategy)) {
                                    case "reset":
                                        pt(u);
                                        continue;
                                    case "ease":
                                        l = C.frame;
                                        break;
                                    default:
                                    case "set":
                                        var props = C.props;
                                        for (A in props)
                                            if (s.call(props, A))
                                                if (((_ = ht(props[A].value)), 0 === A.indexOf("@")))
                                                    u.setAttribute(A.substr(1), _);
                                                else a.setStyle(u, A, _);
                                        continue;
                                }
                            } else if (0 !== o.edge) At(u, [g, w], [y, b]), (o.edge = 0);
                            for (var T = 0; T < c - 1; T++)
                                if (l >= f[T].frame && l <= f[T + 1].frame) {
                                    var I = f[T],
                                        E = f[T + 1];
                                    for (A in I.props)
                                        if (s.call(I.props, A)) {
                                            var k = (l - I.frame) / (E.frame - I.frame);
                                            if (
                                                ((k = I.props[A].easing(k)),
                                                    (_ = dt(I.props[A].value, E.props[A].value, k)),
                                                    (_ = ht(_)),
                                                    0 === A.indexOf("@"))
                                            )
                                                u.setAttribute(A.substr(1), _);
                                            else a.setStyle(u, A, _);
                                        }
                                    if (x)
                                        if (S !== T) {
                                            if ("down" === Ut) wt(u, I.eventType, Ut);
                                            else wt(u, E.eventType, Ut);
                                            o.lastFrameIndex = T;
                                        }
                                    break;
                                }
                        }
                    },
                    st = function () {
                        if (Yt) (Yt = false), bt();
                        var t = Mt.getScrollTop(),
                            e,
                            n = Dt(),
                            o;
                        if (Wt) {
                            if (n >= Wt.endTime) (t = Wt.targetTop), (e = Wt.done), (Wt = i);
                            else
                                (o = Wt.easing((n - Wt.startTime) / Wt.duration)),
                                    (t = (Wt.startTop + o * Wt.topDiff) | 0);
                            Mt.setScrollTop(t, true);
                        } else if (!Xt) {
                            var s;
                            if (Zt.targetTop - t)
                                Zt = {
                                    startTop: qt,
                                    topDiff: t - qt,
                                    targetTop: t,
                                    startTime: Ht,
                                    endTime: Ht + Gt,
                                };
                            if (n <= Zt.endTime)
                                (o = nt.sqrt((n - Zt.startTime) / Gt)),
                                    (t = (Zt.startTop + o * Zt.topDiff) | 0);
                        }
                        if (Xt || qt !== t) {
                            Xt = false;
                            var u = {
                                curTop: t,
                                lastTop: qt,
                                maxTop: Ft,
                                direction: (Ut = t > qt ? "down" : t < qt ? "up" : Ut),
                            },
                                l;
                            if (false !== (Ot.beforerender && Ot.beforerender.call(Mt, u))) {
                                if ((at(t, Mt.getScrollTop()), Qt && Bt))
                                    a.setStyle(
                                        Bt,
                                        "transform",
                                        "translate(0, " + -te + "px) " + ee
                                    );
                                if (((qt = t), Ot.render)) Ot.render.call(Mt, u);
                            }
                            if (e) e.call(Mt, false);
                        }
                        Ht = n;
                    },
                    ut = function (t) {
                        for (var e = 0, n = t.keyFrames.length; e < n; e++) {
                            for (
                                var i = t.keyFrames[e], o, a, s, props = {}, u;
                                null !== (u = U.exec(i.props));

                            ) {
                                if (((s = u[1]), (a = u[2]), null !== (o = s.match(H))))
                                    (s = o[1]), (o = o[2]);
                                else o = _;
                                (a = a.indexOf("!") ? lt(a) : [a.slice(1)]),
                                    (props[s] = { value: a, easing: nt[o] });
                            }
                            i.props = props;
                        }
                    },
                    lt = function (t) {
                        var e = [];
                        if (
                            ((j.lastIndex = 0),
                                (t = t.replace(j, function (t) {
                                    return t.replace(Y, function (t) {
                                        return (t / 255) * 100 + "%";
                                    });
                                })),
                                X)
                        )
                            (G.lastIndex = 0),
                                (t = t.replace(G, function (t) {
                                    return X + t;
                                }));
                        return (
                            (t = t.replace(Y, function (t) {
                                return e.push(+t), "{?}";
                            })),
                            e.unshift(t),
                            e
                        );
                    },
                    ft = function (sk) {
                        var t = {},
                            e,
                            n;
                        for (e = 0, n = sk.keyFrames.length; e < n; e++)
                            ct(sk.keyFrames[e], t);
                        for (t = {}, e = sk.keyFrames.length - 1; e >= 0; e--)
                            ct(sk.keyFrames[e], t);
                    },
                    ct = function (t, e) {
                        var n;
                        for (n in e) if (!s.call(t.props, n)) t.props[n] = e[n];
                        for (n in t.props) e[n] = t.props[n];
                    },
                    dt = function (t, e, n) {
                        var i,
                            o = t.length;
                        if (o !== e.length)
                            throw (
                                "Can't interpolate between \"" + t[0] + '" and "' + e[0] + '"'
                            );
                        var a = [t[0]];
                        for (i = 1; i < o; i++) a[i] = t[i] + (e[i] - t[i]) * n;
                        return a;
                    },
                    ht = function (t) {
                        var e = 1;
                        return (
                            (W.lastIndex = 0),
                            t[0].replace(W, function () {
                                return t[e++];
                            })
                        );
                    },
                    pt = function (t, e) {
                        for (var n, i, o = 0, a = (t = [].concat(t)).length; o < a; o++)
                            if (((i = t[o]), (n = Lt[i[P]])))
                                if (e)
                                    (i.style.cssText = n.dirtyStyleAttr), At(i, n.dirtyClassAttr);
                                else
                                    (n.dirtyStyleAttr = i.style.cssText),
                                        (n.dirtyClassAttr = St(i)),
                                        (i.style.cssText = n.styleAttr),
                                        At(i, n.classAttr);
                    },
                    mt = function () {
                        (ee = "translateZ(0)"), a.setStyle(Bt, "transform", ee);
                        var t = l(Bt),
                            e = t.getPropertyValue("transform"),
                            n = t.getPropertyValue(X + "transform"),
                            i;
                        if (!((e && "none" !== e) || (n && "none" !== n))) ee = "";
                    };
                a.setStyle = function (el, t, e) {
                    var style = el.style;
                    if ("zIndex" === (t = t.replace($, V).replace("-", "")))
                        if (isNaN(e)) style[t] = e;
                        else style[t] = "" + (0 | e);
                    else if ("float" === t) style.styleFloat = style.cssFloat = e;
                    else
                        try {
                            if (Z) style[Z + t.slice(0, 1).toUpperCase() + t.slice(1)] = e;
                            style[t] = e;
                        } catch (t) { }
                };
                var vt = (a.addEvent = function (t, names, n) {
                    for (
                        var i = function (t) {
                            if (!(t = t || e.event).target) t.target = t.srcElement;
                            if (!t.preventDefault)
                                t.preventDefault = function () {
                                    (t.returnValue = false), (t.defaultPrevented = true);
                                };
                            return n.call(this, t);
                        },
                        o,
                        a = 0,
                        s = (names = names.split(" ")).length;
                        a < s;
                        a++
                    ) {
                        if (((o = names[a]), t.addEventListener))
                            t.addEventListener(o, n, false);
                        else t.attachEvent("on" + o, i);
                        ne.push({ element: t, name: o, listener: n });
                    }
                }),
                    gt = (a.removeEvent = function (t, names, e) {
                        for (var n = 0, i = (names = names.split(" ")).length; n < i; n++)
                            if (t.removeEventListener)
                                t.removeEventListener(names[n], e, false);
                            else t.detachEvent("on" + names[n], e);
                    }),
                    yt = function () {
                        for (var t, e = 0, n = ne.length; e < n; e++)
                            (t = ne[e]), gt(t.element, t.name, t.listener);
                        ne = [];
                    },
                    wt = function (t, e, n) {
                        if (Ot.keyframe) Ot.keyframe.call(Mt, t, e, n);
                    },
                    bt = function () {
                        var t = Mt.getScrollTop();
                        if (((Ft = 0), Pt && !Qt)) c.style.height = "";
                        if ((ot(), Pt && !Qt)) c.style.height = Ft + f.clientHeight + "px";
                        if (Qt) Mt.setScrollTop(u.min(Mt.getScrollTop(), Ft));
                        else Mt.setScrollTop(t, true);
                        Xt = true;
                    },
                    Ct = function () {
                        var t = f.clientHeight,
                            copy = {},
                            e,
                            n;
                        for (e in Nt) {
                            if ("function" == typeof (n = Nt[e])) n = n.call(Mt);
                            else if (/p$/.test(n)) n = (n.slice(0, -1) / 100) * t;
                            copy[e] = n;
                        }
                        return copy;
                    },
                    xt = function () {
                        var t = 0,
                            e;
                        if (Bt) t = u.max(Bt.offsetHeight, Bt.scrollHeight);
                        return (
                            (e = u.max(
                                t,
                                c.scrollHeight,
                                c.offsetHeight,
                                f.scrollHeight,
                                f.offsetHeight,
                                f.clientHeight
                            )) - f.clientHeight
                        );
                    },
                    St = function (t) {
                        var n = "className";
                        if (e.SVGElement && t instanceof e.SVGElement)
                            (t = t[n]), (n = "baseVal");
                        return t[n];
                    },
                    At = function (t, add, remove) {
                        var n = "className";
                        if (e.SVGElement && t instanceof e.SVGElement)
                            (t = t[n]), (n = "baseVal");
                        if (remove === i) return (t[n] = add), void 0;
                        for (var o = t[n], a = 0, s = remove.length; a < s; a++)
                            o = Tt(o).replace(Tt(remove[a]), " ");
                        o = _t(o);
                        for (var u = 0, l = add.length; u < l; u++)
                            if (-1 === Tt(o).indexOf(Tt(add[u]))) o += " " + add[u];
                        t[n] = _t(o);
                    },
                    _t = function (t) {
                        return t.replace(N, "");
                    },
                    Tt = function (t) {
                        return " " + t + " ";
                    },
                    Dt =
                        Date.now ||
                        function () {
                            return +new Date();
                        },
                    kt = function (t, e) {
                        return t.frame - e.frame;
                    },
                    Mt,
                    Lt,
                    Bt,
                    Ot,
                    Pt,
                    Ft = 0,
                    Rt = 1,
                    Nt,
                    zt,
                    Ut = "down",
                    qt = -1,
                    Ht = Dt(),
                    $t = 0,
                    Vt = 0,
                    Yt = false,
                    Wt,
                    jt,
                    Gt,
                    Zt,
                    Xt,
                    Kt = 0,
                    Jt,
                    Qt = false,
                    te = 0,
                    ee,
                    ne = [],
                    ie;
                if ("function" == typeof define && define.amd)
                    define([], function () {
                        return a;
                    });
                else if (void 0 !== t && t.exports) t.exports = a;
                else e.skrollr = a;
            })(window, document);
        }).call(window);
    },
    9819: function (t, e, n) {
        "use strict";
        function i(t) {
            this.initialize(t);
        }
        function o(t) {
            if (!window.getComputedStyle) return null;
            var transform = getComputedStyle(t).transform,
                e = /matrix\(([^)]+)\)/.exec(transform);
            if (!e || e.length < 2) return null;
            if ((e = e[1].split(",")).length < 6) return null;
            else
                return {
                    a: parseFloat(e[0], 10),
                    b: parseFloat(e[1], 10),
                    c: parseFloat(e[2], 10),
                    d: parseFloat(e[3], 10),
                    tx: parseFloat(e[4], 10),
                    ty: parseFloat(e[5], 10),
                };
        }
        function a(t, e, n, i) {
            var a = o(e),
                s = 0,
                u = 0,
                l,
                f;
            if (a && !isNaN(a.tx)) s = a.tx;
            if (a && !isNaN(a.ty)) u = a.ty;
            if ("horizontal" === n) (l = t.innerWidth()), (f = s);
            else (l = t.innerHeight()), (f = u);
            return Math.ceil(l * i + f);
        }
        function s(t) {
            if (!t && !t.element) return false;
            var e = t.element.getAttribute("data-animation-name");
            if (e && "slidein" === e.toLowerCase()) return true;
            else return false;
        }
        function u(t) {
            if (!s(t)) return t;
            var e = t.offset;
            if ("string" == typeof e)
                if (((e = parseFloat(e)), t.offset.indexOf("%") > -1)) e /= 100;
            return (
                ((t = $.extend({}, t)).offset = function () {
                    return a(this.context, this.element, this.axis, e);
                }),
                t
            );
        }
        n(9820),
            (i.prototype.initialize = function t(e) {
                if (!this.waypoint)
                    if (e && e.element && "function" == typeof e.handler)
                        (e = u(e)), (this.waypoint = new Waypoint(e));
            }),
            (i.prototype.destroy = function t() {
                if (this.waypoint) this.waypoint.destroy(), (this.waypoint = null);
            }),
            (window.WaypointAdapter = i);
    },
    9820: function (t, e) {
        var e = void 0,
            t = void 0;
        (function () {
            /*!
      Waypoints - 4.0.1
      Copyright © 2011-2016 Caleb Troughton
      Licensed under the MIT license.
      https://github.com/imakewebthings/waypoints/blob/master/licenses.txt
      */
            !(function () {
                "use strict";
                function t(i) {
                    if (!i) throw new Error("No options passed to Waypoint constructor");
                    if (!i.element)
                        throw new Error("No element option passed to Waypoint constructor");
                    if (!i.handler)
                        throw new Error("No handler option passed to Waypoint constructor");
                    if (
                        ((this.key = "waypoint-" + e),
                            (this.options = t.Adapter.extend({}, t.defaults, i)),
                            (this.element = this.options.element),
                            (this.adapter = new t.Adapter(this.element)),
                            (this.callback = i.handler),
                            (this.axis = this.options.horizontal ? "horizontal" : "vertical"),
                            (this.enabled = this.options.enabled),
                            (this.triggerPoint = null),
                            (this.group = t.Group.findOrCreate({
                                name: this.options.group,
                                axis: this.axis,
                            })),
                            (this.context = t.Context.findOrCreateByElement(
                                this.options.context
                            )),
                            t.offsetAliases[this.options.offset])
                    )
                        this.options.offset = t.offsetAliases[this.options.offset];
                    this.group.add(this),
                        this.context.add(this),
                        (n[this.key] = this),
                        (e += 1);
                }
                var e = 0,
                    n = {};
                (t.prototype.queueTrigger = function (t) {
                    this.group.queueTrigger(this, t);
                }),
                    (t.prototype.trigger = function (t) {
                        if (this.enabled) if (this.callback) this.callback.apply(this, t);
                    }),
                    (t.prototype.destroy = function () {
                        this.context.remove(this),
                            this.group.remove(this),
                            delete n[this.key];
                    }),
                    (t.prototype.disable = function () {
                        return (this.enabled = false), this;
                    }),
                    (t.prototype.enable = function () {
                        return this.context.refresh(), (this.enabled = true), this;
                    }),
                    (t.prototype.next = function () {
                        return this.group.next(this);
                    }),
                    (t.prototype.previous = function () {
                        return this.group.previous(this);
                    }),
                    (t.invokeAll = function (t) {
                        var e = [];
                        for (var i in n) e.push(n[i]);
                        for (var o = 0, a = e.length; o < a; o++) e[o][t]();
                    }),
                    (t.destroyAll = function () {
                        t.invokeAll("destroy");
                    }),
                    (t.disableAll = function () {
                        t.invokeAll("disable");
                    }),
                    (t.enableAll = function () {
                        for (var e in (t.Context.refreshAll(), n)) n[e].enabled = true;
                        return this;
                    }),
                    (t.refreshAll = function () {
                        t.Context.refreshAll();
                    }),
                    (t.viewportHeight = function () {
                        return window.innerHeight || document.documentElement.clientHeight;
                    }),
                    (t.viewportWidth = function () {
                        return document.documentElement.clientWidth;
                    }),
                    (t.adapters = []),
                    (t.defaults = {
                        context: window,
                        continuous: true,
                        enabled: true,
                        group: "default",
                        horizontal: false,
                        offset: 0,
                    }),
                    (t.offsetAliases = {
                        "bottom-in-view": function () {
                            return this.context.innerHeight() - this.adapter.outerHeight();
                        },
                        "right-in-view": function () {
                            return this.context.innerWidth() - this.adapter.outerWidth();
                        },
                    }),
                    (window.Waypoint = t);
            })(),
                (function () {
                    "use strict";
                    function t(t) {
                        window.setTimeout(t, 1e3 / 60);
                    }
                    function e(t) {
                        if (
                            ((this.element = t),
                                (this.Adapter = o.Adapter),
                                (this.adapter = new this.Adapter(t)),
                                (this.key = "waypoint-context-" + n),
                                (this.didScroll = false),
                                (this.didResize = false),
                                (this.oldScroll = {
                                    x: this.adapter.scrollLeft(),
                                    y: this.adapter.scrollTop(),
                                }),
                                (this.waypoints = { vertical: {}, horizontal: {} }),
                                (t.waypointContextKey = this.key),
                                (i[t.waypointContextKey] = this),
                                (n += 1),
                                !o.windowContext)
                        )
                            (o.windowContext = true), (o.windowContext = new e(window));
                        this.createThrottledScrollHandler(),
                            this.createThrottledResizeHandler();
                    }
                    var n = 0,
                        i = {},
                        o = window.Waypoint,
                        a = window.onload;
                    (e.prototype.add = function (t) {
                        var e = t.options.horizontal ? "horizontal" : "vertical";
                        (this.waypoints[e][t.key] = t), this.refresh();
                    }),
                        (e.prototype.checkEmpty = function () {
                            var t = this.Adapter.isEmptyObject(this.waypoints.horizontal),
                                e = this.Adapter.isEmptyObject(this.waypoints.vertical),
                                n = this.element == this.element.window;
                            if (t && e && !n)
                                this.adapter.off(".waypoints"), delete i[this.key];
                        }),
                        (e.prototype.createThrottledResizeHandler = function () {
                            function t() {
                                e.handleResize(), (e.didResize = false);
                            }
                            var e = this;
                            this.adapter.on("resize.waypoints", function () {
                                if (!e.didResize)
                                    (e.didResize = true), o.requestAnimationFrame(t);
                            });
                        }),
                        (e.prototype.createThrottledScrollHandler = function () {
                            function t() {
                                e.handleScroll(), (e.didScroll = false);
                            }
                            var e = this;
                            this.adapter.on("scroll.waypoints", function () {
                                if (!e.didScroll || o.isTouch)
                                    (e.didScroll = true), o.requestAnimationFrame(t);
                            });
                        }),
                        (e.prototype.handleResize = function () {
                            o.Context.refreshAll();
                        }),
                        (e.prototype.handleScroll = function () {
                            var t = {},
                                e = {
                                    horizontal: {
                                        newScroll: this.adapter.scrollLeft(),
                                        oldScroll: this.oldScroll.x,
                                        forward: "right",
                                        backward: "left",
                                    },
                                    vertical: {
                                        newScroll: this.adapter.scrollTop(),
                                        oldScroll: this.oldScroll.y,
                                        forward: "down",
                                        backward: "up",
                                    },
                                };
                            for (var n in e) {
                                var i = e[n],
                                    o,
                                    a = i.newScroll > i.oldScroll ? i.forward : i.backward;
                                for (var s in this.waypoints[n]) {
                                    var u = this.waypoints[n][s];
                                    if (null !== u.triggerPoint) {
                                        var l = i.oldScroll < u.triggerPoint,
                                            f = i.newScroll >= u.triggerPoint,
                                            c,
                                            h;
                                        if ((l && f) || (!l && !f))
                                            u.queueTrigger(a), (t[u.group.id] = u.group);
                                    }
                                }
                            }
                            for (var p in t) t[p].flushTriggers();
                            this.oldScroll = {
                                x: e.horizontal.newScroll,
                                y: e.vertical.newScroll,
                            };
                        }),
                        (e.prototype.innerHeight = function () {
                            if (this.element == this.element.window)
                                return o.viewportHeight();
                            else return this.adapter.innerHeight();
                        }),
                        (e.prototype.remove = function (t) {
                            delete this.waypoints[t.axis][t.key], this.checkEmpty();
                        }),
                        (e.prototype.innerWidth = function () {
                            if (this.element == this.element.window) return o.viewportWidth();
                            else return this.adapter.innerWidth();
                        }),
                        (e.prototype.destroy = function () {
                            var t = [];
                            for (var e in this.waypoints)
                                for (var n in this.waypoints[e]) t.push(this.waypoints[e][n]);
                            for (var i = 0, o = t.length; i < o; i++) t[i].destroy();
                        }),
                        (e.prototype.refresh = function () {
                            var t = this.element == this.element.window,
                                e = t ? void 0 : this.adapter.offset(),
                                n = {},
                                i;
                            for (var a in (this.handleScroll(),
                                (i = {
                                    horizontal: {
                                        contextOffset: t ? 0 : e.left,
                                        contextScroll: t ? 0 : this.oldScroll.x,
                                        contextDimension: this.innerWidth(),
                                        oldScroll: this.oldScroll.x,
                                        forward: "right",
                                        backward: "left",
                                        offsetProp: "left",
                                    },
                                    vertical: {
                                        contextOffset: t ? 0 : e.top,
                                        contextScroll: t ? 0 : this.oldScroll.y,
                                        contextDimension: this.innerHeight(),
                                        oldScroll: this.oldScroll.y,
                                        forward: "down",
                                        backward: "up",
                                        offsetProp: "top",
                                    },
                                }))) {
                                var s = i[a];
                                for (var u in this.waypoints[a]) {
                                    var l = this.waypoints[a][u],
                                        f = l.options.offset,
                                        c = l.triggerPoint,
                                        h = 0,
                                        p = null == c,
                                        m,
                                        v,
                                        g,
                                        y,
                                        w;
                                    if (l.element !== l.element.window)
                                        h = l.adapter.offset()[s.offsetProp];
                                    if ("function" == typeof f) f = f.apply(l);
                                    else if ("string" == typeof f)
                                        if (
                                            ((f = parseFloat(f)), l.options.offset.indexOf("%") > -1)
                                        )
                                            f = Math.ceil((s.contextDimension * f) / 100);
                                    if (
                                        ((m = s.contextScroll - s.contextOffset),
                                            (l.triggerPoint = Math.floor(h + m - f)),
                                            (v = c < s.oldScroll),
                                            (g = l.triggerPoint >= s.oldScroll),
                                            (w = !v && !g),
                                            !p && (y = v && g))
                                    )
                                        l.queueTrigger(s.backward), (n[l.group.id] = l.group);
                                    else if (!p && w)
                                        l.queueTrigger(s.forward), (n[l.group.id] = l.group);
                                    else if (p && s.oldScroll >= l.triggerPoint)
                                        l.queueTrigger(s.forward), (n[l.group.id] = l.group);
                                }
                            }
                            return (
                                o.requestAnimationFrame(function () {
                                    for (var t in n) n[t].flushTriggers();
                                }),
                                this
                            );
                        }),
                        (e.findOrCreateByElement = function (t) {
                            return e.findByElement(t) || new e(t);
                        }),
                        (e.refreshAll = function () {
                            for (var t in i) i[t].refresh();
                        }),
                        (e.findByElement = function (t) {
                            return i[t.waypointContextKey];
                        }),
                        (window.onload = function () {
                            if (a) a();
                            e.refreshAll();
                        }),
                        (o.requestAnimationFrame = function (e) {
                            var n;
                            (
                                window.requestAnimationFrame ||
                                window.mozRequestAnimationFrame ||
                                window.webkitRequestAnimationFrame ||
                                t
                            ).call(window, e);
                        }),
                        (o.Context = e);
                })(),
                (function () {
                    "use strict";
                    function t(t, e) {
                        return t.triggerPoint - e.triggerPoint;
                    }
                    function e(t, e) {
                        return e.triggerPoint - t.triggerPoint;
                    }
                    function Group(t) {
                        (this.name = t.name),
                            (this.axis = t.axis),
                            (this.id = this.name + "-" + this.axis),
                            (this.waypoints = []),
                            this.clearTriggerQueues(),
                            (n[this.axis][this.name] = this);
                    }
                    var n = { vertical: {}, horizontal: {} },
                        i = window.Waypoint;
                    (Group.prototype.add = function (t) {
                        this.waypoints.push(t);
                    }),
                        (Group.prototype.clearTriggerQueues = function () {
                            this.triggerQueues = { up: [], down: [], left: [], right: [] };
                        }),
                        (Group.prototype.flushTriggers = function () {
                            for (var n in this.triggerQueues) {
                                var i = this.triggerQueues[n],
                                    o = "up" === n || "left" === n;
                                i.sort(o ? e : t);
                                for (var a = 0, s = i.length; a < s; a += 1) {
                                    var u = i[a];
                                    if (u.options.continuous || a === i.length - 1)
                                        u.trigger([n]);
                                }
                            }
                            this.clearTriggerQueues();
                        }),
                        (Group.prototype.next = function (e) {
                            this.waypoints.sort(t);
                            var index = i.Adapter.inArray(e, this.waypoints),
                                n;
                            return index === this.waypoints.length - 1
                                ? null
                                : this.waypoints[index + 1];
                        }),
                        (Group.prototype.previous = function (e) {
                            this.waypoints.sort(t);
                            var index = i.Adapter.inArray(e, this.waypoints);
                            return index ? this.waypoints[index - 1] : null;
                        }),
                        (Group.prototype.queueTrigger = function (t, e) {
                            this.triggerQueues[e].push(t);
                        }),
                        (Group.prototype.remove = function (t) {
                            var index = i.Adapter.inArray(t, this.waypoints);
                            if (index > -1) this.waypoints.splice(index, 1);
                        }),
                        (Group.prototype.first = function () {
                            return this.waypoints[0];
                        }),
                        (Group.prototype.last = function () {
                            return this.waypoints[this.waypoints.length - 1];
                        }),
                        (Group.findOrCreate = function (t) {
                            return n[t.axis][t.name] || new Group(t);
                        }),
                        (i.Group = Group);
                })(),
                (function () {
                    "use strict";
                    function t(t) {
                        return t === t.window;
                    }
                    function e(e) {
                        if (t(e)) return e;
                        else return e.defaultView;
                    }
                    function n(t) {
                        (this.element = t), (this.handlers = {});
                    }
                    var i = window.Waypoint;
                    (n.prototype.innerHeight = function () {
                        var e;
                        return t(this.element)
                            ? this.element.innerHeight
                            : this.element.clientHeight;
                    }),
                        (n.prototype.innerWidth = function () {
                            var e;
                            return t(this.element)
                                ? this.element.innerWidth
                                : this.element.clientWidth;
                        }),
                        (n.prototype.off = function (t, e) {
                            function n(t, e, n) {
                                for (var i = 0, o = e.length - 1; i < o; i++) {
                                    var a = e[i];
                                    if (!n || n === a) t.removeEventListener(a);
                                }
                            }
                            var i = t.split("."),
                                o = i[0],
                                a = i[1],
                                s = this.element;
                            if (a && this.handlers[a] && o)
                                n(s, this.handlers[a][o], e), (this.handlers[a][o] = []);
                            else if (o)
                                for (var u in this.handlers)
                                    n(s, this.handlers[u][o] || [], e),
                                        (this.handlers[u][o] = []);
                            else if (a && this.handlers[a]) {
                                for (var type in this.handlers[a])
                                    n(s, this.handlers[a][type], e);
                                this.handlers[a] = {};
                            }
                        }),
                        (n.prototype.offset = function () {
                            if (!this.element.ownerDocument) return null;
                            var t = this.element.ownerDocument.documentElement,
                                n = e(this.element.ownerDocument),
                                rect = { top: 0, left: 0 };
                            if (this.element.getBoundingClientRect)
                                rect = this.element.getBoundingClientRect();
                            return {
                                top: rect.top + n.pageYOffset - t.clientTop,
                                left: rect.left + n.pageXOffset - t.clientLeft,
                            };
                        }),
                        (n.prototype.on = function (t, e) {
                            var n = t.split("."),
                                i = n[0],
                                o = n[1] || "__default",
                                a = (this.handlers[o] = this.handlers[o] || {}),
                                s;
                            (a[i] = a[i] || []).push(e), this.element.addEventListener(i, e);
                        }),
                        (n.prototype.outerHeight = function (e) {
                            var n = this.innerHeight(),
                                i;
                            if (e && !t(this.element))
                                (i = window.getComputedStyle(this.element)),
                                    (n += parseInt(i.marginTop, 10)),
                                    (n += parseInt(i.marginBottom, 10));
                            return n;
                        }),
                        (n.prototype.outerWidth = function (e) {
                            var n = this.innerWidth(),
                                i;
                            if (e && !t(this.element))
                                (i = window.getComputedStyle(this.element)),
                                    (n += parseInt(i.marginLeft, 10)),
                                    (n += parseInt(i.marginRight, 10));
                            return n;
                        }),
                        (n.prototype.scrollLeft = function () {
                            var t = e(this.element);
                            return t ? t.pageXOffset : this.element.scrollLeft;
                        }),
                        (n.prototype.scrollTop = function () {
                            var t = e(this.element);
                            return t ? t.pageYOffset : this.element.scrollTop;
                        }),
                        (n.extend = function () {
                            function merge(t, e) {
                                if ("object" == typeof t && "object" == typeof e)
                                    for (var n in e) if (e.hasOwnProperty(n)) t[n] = e[n];
                                return t;
                            }
                            for (
                                var t = Array.prototype.slice.call(arguments),
                                e = 1,
                                n = t.length;
                                e < n;
                                e++
                            )
                                merge(t[0], t[e]);
                            return t[0];
                        }),
                        (n.inArray = function (t, e, n) {
                            return null == e ? -1 : e.indexOf(t, n);
                        }),
                        (n.isEmptyObject = function (t) {
                            for (var e in t) return false;
                            return true;
                        }),
                        i.adapters.push({ name: "noframework", Adapter: n }),
                        (i.Adapter = n);
                })();
        }).call(window);
    },
    9821: function (t, e, n) {
        "use strict";
        var i = n(10);
        i(document).ready(function () {
            function t(t) {
                return e() ? 0 : n(t);
            }
            function e() {
                return a.hasClass("u-overlap");
            }
            function n(t) {
                var rect;
                return t[0].getBoundingClientRect().height;
            }
            var o = i("header.u-sticky");
            if (
                o.length &&
                !o.closest(".u-overlap").length &&
                !CSS.supports("position", "sticky") &&
                !CSS.supports("position", "-webkit-sticky")
            ) {
                o.css("width", "100%");
                var update = function () {
                    o.each(function () {
                        var t = i(this),
                            e = t.height(),
                            n = t.data("additionalMargin") || 0;
                        if (e !== n) {
                            t.data("additionalMargin", e);
                            var o = t;
                            do {
                                o = o.next();
                            } while (o.length > 0 && "none" === o.css("display"));
                            o.css(
                                "margin-top",
                                parseFloat(o.css("margin-top")) - n + e + "px"
                            );
                        }
                    });
                };
                update(), i(window).load(update), i(window).resize(update);
            }
            var a = i(".u-body");
            if (a.hasClass("u-overlap-transparent"))
                a.data("overlap-transparent", true);
            if (a.hasClass("u-overlap-contrast")) a.data("overlap-contrast", true);
            i(window).scroll(function e() {
                i("header.u-sticky").each(function () {
                    var e = i(this),
                        n = e.nextAll(":visible:first");
                    if (n.length) {
                        var o = n.offset().top,
                            s = e.offset().top,
                            u,
                            l = s + t(e) > o,
                            f;
                        if ((a.toggleClass("u-sticky-fixed", l), s > o))
                            a.addClass("u-sticky-scroll"),
                                a.removeClass("u-overlap-transparent u-overlap-contrast");
                        else
                            a.toggleClass(
                                "u-overlap-transparent",
                                !!a.data("overlap-transparent")
                            ),
                                a.toggleClass(
                                    "u-overlap-contrast",
                                    !!a.data("overlap-contrast")
                                ),
                                a.removeClass("u-sticky-scroll");
                    }
                });
            });
        });
    },
    9822: function (t, e, n) {
        "use strict";
        function i(t) {
            function e() {
                f = [];
                var e = o("html").scrollTop();
                t.each(function () {
                    var rect = this.getBoundingClientRect();
                    f.push({ height: rect.height, top: rect.top + e });
                });
            }
            function n(index) {
                for (var e = 0, n = 0; n < index; n++) {
                    var i;
                    if (t.eq(n).hasClass(c)) {
                        var rect;
                        e += (f[n] || {}).height || 0;
                    }
                }
                return e;
            }
            function i() {
                l.refresh();
            }
            function a() {
                clearTimeout(p),
                    (p = setTimeout(function () {
                        for (var n = 0; n < t.length; n++) {
                            var i;
                            u(t.eq(n));
                        }
                        e(), l.refresh();
                    }, 25));
            }
            function s(t, e, n) {
                if (!(t = o(t)).hasClass(c)) {
                    var i = o("<div></div>");
                    i.addClass(h),
                        i.css("height", e + "px"),
                        t.after(i),
                        t.addClass(c),
                        t.css("top", n + "px");
                }
            }
            function u(t) {
                (t = o(t)).nextAll("." + h).remove(),
                    t.removeClass(c),
                    t.css("top", "");
            }
            var l = {},
                f = [],
                c = "u-sticky-fixed",
                h = "u-sticky-placeholder",
                p = null;
            return (
                (l.init = function init() {
                    o(window).on("scroll", i), o(window).on("resize", a), e();
                }),
                (l.destroy = function t() {
                    o(window).off("scroll", i), o(window).off("resize", a);
                }),
                (l.refresh = function e() {
                    var i = o("html").scrollTop();
                    t.each(function (t, el) {
                        var e = n(t);
                        if (i + e > f[t].top) s(el, f[t].height, e);
                        else u(el);
                    });
                }),
                l
            );
        }
        var o = n(10);
        o(window).on("load", function () {
            var t,
                sticky = i(o(".u-section-row.u-sticky"));
            sticky.init(), sticky.refresh();
        }),
            (window._npStickyStack = i);
    },
    9823: function (t, e, n) {
        "use strict";
        var i = n(10);
        i(function () {
            i(".u-nav-container .u-nav-link").each(function () {
                window._npInitMenuLink(i(this));
            }),
                i(".u-nav-container-collapse .u-nav-link").each(function () {
                    window._npInitMenuLink(i(this), true);
                });
        }),
            (window._npInitMenuLink = function t(e, n) {
                var o = i("body"),
                    a = /#.*?$/,
                    s = o.attr("data-home-page-name"),
                    homePage = o.attr("data-home-page"),
                    pageTitle = i("title").text().trim(),
                    nav = e.closest(".u-menu"),
                    u = nav.attr("data-submenu-level") || "on-click",
                    l = nav.is(".u-menu-mega"),
                    f = e.attr("href") || "",
                    c = (e[0].href || "").replace(a, ""),
                    h = f.replace(a, ""),
                    p = s || pageTitle,
                    m = e.text().trim(),
                    hash = f.replace(/^[^#]+/, "");
                if (!hash || "#" === hash || !i(hash).length) {
                    var v = c.split(".").slice(0, -1).join("."),
                        pageName = h.replace(".html", ""),
                        g = new RegExp(pageName + "_[\\s\\S]+?.html", "gm");
                    if (
                        (h && window.location.href.toString() === c) ||
                        (h && window.location.href.toString() === v) ||
                        (h && window.location.href.toString().search(g) > -1) ||
                        (m && p === m) ||
                        (homePage && h === homePage)
                    ) {
                        var y = e;
                        if (!l || n) y = e.parents(".u-nav-item").children(".u-nav-link");
                        if ((y.addClass("active"), "with-reload" === u && n))
                            y.siblings(".u-nav-popup")
                                .addClass("open")
                                .css("max-height", "none");
                    }
                }
            });
    },
    9824: function (t, e, n) {
        "use strict";
        var i = n(10),
            o;
        if (
            "Microsoft Internet Explorer" === navigator.appName ||
            !!(
                navigator.userAgent.match(/Trident/) ||
                navigator.userAgent.match(/rv:11/)
            ) ||
            (void 0 !== i.browser && 1 === i.browser.msie)
        )
            i(function () {
                i(".u-social-icons, .u-language").each(function (t, e) {
                    var n = i(e),
                        size = n.css("height");
                    n.find(".u-svg-link").css("width", size);
                });
            });
    },
    9825: function (t, e, n) {
        "use strict";
        var Animation = n(9826),
            i = n(189);
        n(427), (window.uAnimation = new Animation(i.instance()).init());
    },
    9826: function (t, e, n) {
        "use strict";
        function Animation(factory) {
            (this.factory = factory),
                (this.animationElements = null),
                (this.animationEvents = []),
                (this._section = null),
                (this._sliderNode = null),
                (this._slideNumber = null),
                (this._slideEvent = null),
                (this._animationInfo = null),
                (this._animation = null),
                (this._subscribeQueue = []),
                (this.status = "loading"),
                (this._onDOMContentLoaded = this._onDOMContentLoaded.bind(this)),
                (this._onLoadingComplete = this._onLoadingComplete.bind(this));
        }
        function i(t) {
            var e =
                window.requestAnimationFrame ||
                window.mozRequestAnimationFrame ||
                window.webkitRequestAnimationFrame ||
                window.msRequestAnimationFrame;
            if (!e) return t(), void 0;
            e.apply(window, arguments);
        }
        function o(t) {
            return (
                "string" == typeof t.name && -1 !== m.indexOf(t.name.toLowerCase())
            );
        }
        function a(t) {
            return (
                "string" == typeof t.direction &&
                -1 !== v.indexOf(t.direction.toLowerCase())
            );
        }
        function s(section, t) {
            if (t && t.length)
                if (u())
                    for (var e = 0; e < t.length; e++)
                        if (a(t[e]) || o(t[e])) {
                            section.style.overflow = "hidden";
                            break;
                        }
        }
        function u() {
            return /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(
                navigator.userAgent || navigator.vendor || window.opera
            );
        }
        var l = n(270),
            f = n(271),
            c = n(9827),
            h = n(9828),
            p = n(9829);
        (Animation.utils = l),
            (Animation.prototype.init = function init() {
                if ("loading" !== document.readyState)
                    return this._onDOMContentLoaded(), void 0;
                else
                    return (
                        document.addEventListener(
                            "DOMContentLoaded",
                            this._onDOMContentLoaded
                        ),
                        this
                    );
            }),
            (Animation.prototype.start = function t() {
                var e = this._subscribeQueue;
                i(function () {
                    e.forEach(function (el) {
                        if (el.event && el.animation) el.event.subscribe(el.animation);
                    }),
                        (e.length = 0);
                });
            }),
            (Animation.prototype.visitSection = function t(e) {
                if (e.classList.contains("u-carousel"))
                    return this.visitSlider(e), void 0;
                (this._section = e),
                    this._visitElementsInContentSlider(e),
                    this._visitElementsNotInSlider(e),
                    (this._section = null);
            }),
            (Animation.prototype._visitElementsInContentSlider = function (t) {
                for (
                    var e = t.querySelectorAll(".u-carousel"), n = 0;
                    n < e.length;
                    n++
                )
                    this.visitSlider(e[n]);
            }),
            (Animation.prototype._visitElementsNotInSlider = function (t) {
                for (
                    var e = [], n = t.querySelectorAll("[data-animation-name]"), o = 0;
                    o < n.length;
                    o++
                ) {
                    var a = n[o];
                    if (
                        a.closest &&
                        null === a.closest(".u-carousel") &&
                        a.getAttribute("data-animation-name")
                    )
                        this.visitAnimatedElement(a),
                            e.push(this._animationInfo),
                            this._subscribeQueue.push({
                                animation: this._animation,
                                event: c,
                            }),
                            i(this._animation.init.bind(this._animation));
                }
                s(t, e);
            }),
            (Animation.prototype.visitSlider = function t(e) {
                this._sliderNode = e;
                for (
                    var n = e.querySelectorAll(".u-carousel-item"), i = 0;
                    i < n.length;
                    i++
                )
                    (this._slideNumber = i), this.visitSlide(n[i]);
            }),
            (Animation.prototype.visitSlide = function t(e) {
                var n = e.querySelectorAll("[data-animation-name]"),
                    i = [];
                this._slideEvent = new h(this._sliderNode, e, this._slideNumber);
                for (var o = 0; o < n.length; o++)
                    if (n[o].getAttribute("data-animation-name"))
                        this.visitAnimatedElement(n[o]),
                            i.push(this._animationInfo),
                            this._animation.init(),
                            this._slideEvent.animations.push(this._animation);
                this._slideEvent.init(), s(e, i);
            }),
            (Animation.prototype.visitAnimatedElement = function t(e) {
                (this._animationInfo = new f(e, this._section)),
                    (this._animation = this.factory.createAnimation(this._animationInfo)),
                    this.animationElements.push(this._animation);
            }),
            (Animation.prototype._onDOMContentLoaded = function () {
                if (
                    ((this.status = "DOMContentLoaded"),
                        document.removeEventListener(
                            "DOMContentLoaded",
                            this._onDOMContentLoaded
                        ),
                        !this.animationElements)
                ) {
                    (this.animationElements = []), this.factory.setHint(p);
                    var sections = $("section, header, footer"),
                        length = sections.length;
                    if (
                        (sections.each(
                            function (index, t) {
                                if ((this.visitSection(t), !--length))
                                    this.factory.setHint(null);
                            }.bind(this)
                        ),
                            "interactive" !== document.readyState)
                    )
                        return this._onLoadingComplete(), void 0;
                    window.addEventListener("load", this._onLoadingComplete);
                }
            }),
            (Animation.prototype._onLoadingComplete = function () {
                (this.status = "complete"),
                    window.removeEventListener("load", this._onLoadingComplete),
                    this.start();
            });
        var m = ["lightspeedin", "flipin", "flipout"],
            v = ["right", "downright", "upright"];
        (t.exports = Animation), (window.Animation = Animation);
    },
    9827: function (t, e, n) {
        "use strict";
        function i(animation) {
            if (
                (animation.start(),
                    !animation.isInOutAnimation() && !animation.info.infinite)
            ) {
                var t = animation.info.duration,
                    e = animation.info.delay;
                setTimeout(function () {
                    animation.clear();
                }, t + e);
            }
        }
        function o(animation) {
            if (animation.isInOutAnimation()) animation.startOut();
        }
        var a = {
            subscribe: function t(animation) {
                var e = (animation && animation.info) || {},
                    n = e.section || e.element;
                animation.info.eventObject = new WaypointAdapter({
                    element: n,
                    handler: function (t) {
                        if (animation)
                            if ("up" === t) return o(animation), void 0;
                            else return i(animation), void 0;
                    },
                    offset: "70%",
                });
            },
        };
        (t.exports = a), (window.AnimationEventScroll = a);
    },
    9828: function (t, e, n) {
        "use strict";
        function i(carousel, slide, t) {
            (this.carousel = $(carousel)),
                (this.slide = $(slide)),
                (this.slideNum = t),
                (this.animations = []),
                (this._delays = []),
                (this._autoplayPaused = false),
                (this._handleSlide = o.bind(this)),
                (this._handleSlid = a.bind(this));
        }
        function o(t) {
            if (t) if (t.from === this.slideNum) this.slideOut(t);
        }
        function a(t) {
            if (t && t.to === this.slideNum)
                this.pauseAutoplayWhileInAnimation(), this.startInAnimation();
        }
        (i.prototype.init = function init() {
            if (
                ($(this.carousel).on("u-slide.bs.u-carousel", this._handleSlide),
                    $(this.carousel).on("slid.bs.u-carousel", this._handleSlid),
                    this.slide.is(".u-active"))
            ) {
                if (this._isAutoplayOnStart()) this.pauseAutoplayWhileInAnimation();
                this.startInAnimation();
            }
        }),
            (i.prototype.deinit = function t() {
                $(this.carousel).off("slid.bs.u-carousel", this._handleSlid),
                    $(this.carousel).off("u-slide.bs.u-carousel", this._handleSlide);
            }),
            (i.prototype.resetAnimations = function t() {
                for (var e = 0; e < this.animations.length; e++)
                    if (this.animations[e].reset) this.animations[e].reset();
            }),
            (i.prototype.pauseAutoplayWhileInAnimation = function t() {
                var e = this.countMaxInAnimationTime();
                if (e > 0)
                    this._pauseAutoplay(),
                        this._delay(
                            e,
                            function () {
                                this._continueAutoplay(), this._clearDelays();
                            }.bind(this)
                        );
            }),
            (i.prototype.startInAnimation = function t() {
                this.animations.forEach(
                    function (animation) {
                        animation.start();
                    }.bind(this)
                );
            }),
            (i.prototype.needOutAnimation = function t() {
                for (var e = 0, length = this.animations.length; e < length; e++)
                    if (
                        this.animations[e].needOutAnimation &&
                        this.animations[e].needOutAnimation()
                    )
                        return true;
                return false;
            }),
            (i.prototype.startOutAnimations = function t() {
                for (var e = 0; e < this.animations.length; e++)
                    if (this.animations[e].startOut) this.animations[e].startOut();
            }),
            (i.prototype.countMaxOutAnimationTime = function t() {
                if (!this.animations || !this.animations.length) return 0;
                var e = this.animations.map(function (animation) {
                    return animation.getOutTime();
                });
                return Math.max.apply(null, e);
            }),
            (i.prototype.countMaxInAnimationTime = function t() {
                if (!this.animations || !this.animations.length) return 0;
                var e = this.animations.map(function (animation) {
                    return animation.getTime();
                });
                return Math.max.apply(null, e);
            }),
            (i.prototype.slideOut = function t(e) {
                if (this._delays.length > 0) this._cancelDelays();
                if ((this._continueAutoplay(), !this.needOutAnimation()))
                    return this.resetAnimations(), void 0;
                e.preventDefault();
                var n = this.countMaxOutAnimationTime(),
                    i = "number" == typeof e.to ? e.to : null,
                    o = e.direction;
                setTimeout(
                    function () {
                        if ((this.resetAnimations(), null !== i))
                            return $(e.target)["u-carousel"](i), void 0;
                        if ("left" === o) return $(e.target)["u-carousel"]("next"), void 0;
                        if ("right" === o) $(e.target)["u-carousel"]("prev");
                    }.bind(this),
                    n
                ),
                    this.startOutAnimations();
            }),
            (i.prototype._delay = function t(e, n) {
                this._delays.push(
                    setTimeout(function () {
                        n();
                    }, e)
                );
            }),
            (i.prototype._cancelDelays = function t() {
                this._delays.forEach(function (id) {
                    clearTimeout(id);
                }),
                    (this._delays.length = 0);
            }),
            (i.prototype._clearDelays = function t() {
                this._delays.length = 0;
            }),
            (i.prototype._isAutoplayOnStart = function t() {
                var e = this.carousel.attr("data-u-ride");
                if (!e) return false;
                else return "carousel" === (e = e.toLowerCase());
            }),
            (i.prototype._pauseAutoplay = function t() {
                this.carousel["u-carousel"]("pause"), (this._autoplayPaused = true);
            }),
            (i.prototype._continueAutoplay = function t() {
                if (this._autoplayPaused)
                    this.carousel["u-carousel"]("cycle"), (this._autoplayPaused = false);
            }),
            (t.exports = i),
            (window.AnimationEventSlider = i);
    },
    9829: function (t, e, n) {
        "use strict";
        function i(t) {
            var e = [];
            if (-1 !== a.indexOf(t.name) || t.direction) e.push("transform");
            if (-1 !== s.indexOf(t.name)) e.push("opacity");
            if (-1 !== u.indexOf(t.name)) e.push("contents");
            if (0 === e.length) e.push("auto");
            return e.join(", ");
        }
        var o = {},
            a = [
                "bounce",
                "headShake",
                "heartBeat",
                "jello",
                "pulse",
                "rubberBand",
                "shake",
                "swing",
                "tada",
                "wobble",
                "bounceIn",
                "flip",
                "flipInX",
                "flipInY",
                "flipOutX",
                "flipOutY",
                "lightSpeedIn",
                "rotateIn",
                "slideIn",
                "hinge",
                "jackInTheBox",
                "rollIn",
                "zoomIn",
                "customAnimationIn",
                "customAnimationOut",
            ],
            s = [
                "flash",
                "bounceIn",
                "fadeIn",
                "flipInX",
                "flipInY",
                "flipOutX",
                "flipOutY",
                "lightSpeedIn",
                "rotateIn",
                "hinge",
                "jackInTheBox",
                "rollIn",
                "zoomIn",
                "customAnimationIn",
                "customAnimationOut",
            ],
            u = ["counter"];
        (o.hintBrowser = function t(e) {
            if (e && e.element) e.element.style.willChange = i(e);
        }),
            (o.removeHint = function t(e) {
                e.element.style.willChange = "auto";
            }),
            (t.exports = o),
            (window.WillChangeHint = o);
    },
    9830: function (t, e, n) {
        "use strict";
        function i() { }
        function o(t, props) {
            document.body.classList.add("u-scrollspy-prevent"),
                t.animate(props, {
                    done: function () {
                        document.body.classList.remove("u-scrollspy-prevent");
                    },
                });
        }
        var a = n(10);
        (i.prototype.scroll = function (t) {
            var e = 1,
                n = a(".u-sticky")
                    .toArray()
                    .reduce(function (t, el) {
                        return t + (a(el).outerHeight(true) || 0) - e;
                    }, 0);
            o(a("html, body"), { scrollTop: t.offset().top - n });
        }),
            (i.prototype.scrollTop = function () {
                o(a("html, body"), { scrollTop: 0 });
            }),
            (i.prototype.update = function (t) {
                var e = "string" == typeof t ? t : a(t.currentTarget).attr("href");
                if ((e = (e || "").replace(/^[^#]+/, "")).match(/^#[\d\w-_]+$/i)) {
                    var n = a(e);
                    if (n.length) {
                        if (t.preventDefault) t.preventDefault();
                        this.scroll(n);
                    }
                }
            }),
            (window._npScrollAnchor = new i()),
            a(window).on("load", function () {
                window._npScrollAnchor.update(window.location.hash),
                    a("body").on(
                        "click",
                        "a:not([data-u-slide], [data-u-slide-to], [data-toggle], .u-tab-link, .u-quantity-button)",
                        function (t) {
                            if (!a(this).is(".u-dialog-link"))
                                window._npScrollAnchor.update(t);
                        }
                    ),
                    a("body").on("click", ".u-back-to-top", function () {
                        window._npScrollAnchor.scrollTop();
                    });
            });
    },
    9831: function (t, e, n) {
        "use strict";
        var i = n(10),
            o = n(9832),
            a = "u-gdpr-cookie",
            s = "u-cookies-consent",
            u = "u-button-confirm",
            l = "u-button-decline",
            f = "_u_GDPRConfirmCode";
        i(function () {
            var t;
            try {
                t = o.get(a);
            } catch (e) {
                t = false;
            }
            var e = window[f] || function () { };
            if (!t) {
                var n = i("." + s);
                n.addClass("show"),
                    n.find("." + u).on("click", function (t) {
                        t.preventDefault(),
                            o.set(a, true, { expires: 365, secure: true }),
                            n.removeClass("show"),
                            e();
                    }),
                    n.find("." + l).on("click", function (t) {
                        t.preventDefault(),
                            o.set(a, false, { expires: 365, secure: false }),
                            n.removeClass("show");
                    });
            } else if ("true" === t) e();
        });
    },
    9832: function (t, e, n) {
        "use strict";
        var i, o;
    /*!
     * JavaScript Cookie v2.2.1
     * https://github.com/js-cookie/js-cookie
     *
     * Copyright 2006, 2015 Klaus Hartl & Fagner Brack
     * Released under the MIT license
     */ !(function (factory) {
            var a;
            if (true)
                !(
                    void 0 !==
                    (o = "function" == typeof (i = factory) ? i.call(e, n, e, t) : i) &&
                    (t.exports = o)
                ),
                    (a = true);
            if (true) (t.exports = factory()), (a = true);
            if (!a) {
                var s = window.Cookies,
                    u = (window.Cookies = factory());
                u.noConflict = function () {
                    return (window.Cookies = s), u;
                };
            }
        })(function () {
            function t() {
                for (var t = 0, e = {}; t < arguments.length; t++) {
                    var n = arguments[t];
                    for (var i in n) e[i] = n[i];
                }
                return e;
            }
            function e(t) {
                return t.replace(/(%[0-9A-Z]{2})+/g, decodeURIComponent);
            }
            function init(n) {
                function i() { }
                function o(e, o, a) {
                    if ("undefined" != typeof document) {
                        if (
                            "number" == typeof (a = t({ path: "/" }, i.defaults, a)).expires
                        )
                            a.expires = new Date(1 * new Date() + 864e5 * a.expires);
                        a.expires = a.expires ? a.expires.toUTCString() : "";
                        try {
                            var s = JSON.stringify(o);
                            if (/^[\{\[]/.test(s)) o = s;
                        } catch (t) { }
                        (o = n.write
                            ? n.write(o, e)
                            : encodeURIComponent(String(o)).replace(
                                /%(23|24|26|2B|3A|3C|3E|3D|2F|3F|40|5B|5D|5E|60|7B|7D|7C)/g,
                                decodeURIComponent
                            )),
                            (e = encodeURIComponent(String(e))
                                .replace(/%(23|24|26|2B|5E|60|7C)/g, decodeURIComponent)
                                .replace(/[\(\)]/g, escape));
                        var u = "";
                        for (var l in a)
                            if (a[l])
                                if (((u += "; " + l), true !== a[l]))
                                    u += "=" + a[l].split(";")[0];
                        return (document.cookie = e + "=" + o + u);
                    }
                }
                function a(t, i) {
                    if ("undefined" != typeof document) {
                        for (
                            var o = {},
                            a = document.cookie ? document.cookie.split("; ") : [],
                            s = 0;
                            s < a.length;
                            s++
                        ) {
                            var u = a[s].split("="),
                                l = u.slice(1).join("=");
                            if (!i && '"' === l.charAt(0)) l = l.slice(1, -1);
                            try {
                                var f = e(u[0]);
                                if (((l = (n.read || n)(l, f) || e(l)), i))
                                    try {
                                        l = JSON.parse(l);
                                    } catch (t) { }
                                if (((o[f] = l), t === f)) break;
                            } catch (t) { }
                        }
                        return t ? o[t] : o;
                    }
                }
                return (
                    (i.set = o),
                    (i.get = function (t) {
                        return a(t, false);
                    }),
                    (i.getJSON = function (t) {
                        return a(t, true);
                    }),
                    (i.remove = function (e, n) {
                        o(e, "", t(n, { expires: -1 }));
                    }),
                    (i.defaults = {}),
                    (i.withConverter = init),
                    i
                );
            }
            return init(function () { });
        });
    },
    9833: function (t, e, n) {
        "use strict";
        $(function () {
            var selector = ".u-back-to-top";
            $(selector).hide(),
                $(window).scroll(function () {
                    if ($(this).scrollTop() > 100)
                        $(selector).fadeIn().css("display", "block");
                    else $(selector).fadeOut();
                });
        });
    },
    9834: function (t, e, n) {
        "use strict";
        var i = n(10),
            o = n(9835);
        (window._npScrollSpyInit = function () {
            var t = '.u-menu .u-nav-container .u-nav-link[href*="#"]',
                e = '.u-menu .u-nav-container-collapse .u-nav-link[href*="#"]',
                n;
            if (document.querySelectorAll(t).length)
                try {
                    o(t, {
                        nested: true,
                        offset: function () {
                            var t, e;
                            return (i(".u-header.u-sticky").outerHeight(true) || 0) + 1;
                        },
                    }),
                        o(e, {
                            nested: true,
                            offset: function () {
                                return i(".u-header.u-sticky").outerHeight(true) || 0;
                            },
                        });
                } catch (t) {
                    console.warn("ScrollSpy: has no items");
                }
        }),
            document.addEventListener(
                "gumshoeActivate",
                function (t) {
                    var link;
                    t.detail.link.classList.add("active");
                },
                false
            ),
            document.addEventListener(
                "gumshoeDeactivate",
                function (t) {
                    var link;
                    t.detail.link.classList.remove("active");
                },
                false
            ),
            i(function () {
                window._npScrollSpyInit();
            });
    },
    9835: function (t, e, n) {
        "use strict";
        (function (n) {
            var i, o;
      /*!
       * gumshoejs v5.1.2
       * A simple, framework-agnostic scrollspy script.
       * (c) 2019 Chris Ferdinandi
       * MIT License
       * http://github.com/cferdinandi/gumshoe
       */ !(function (n, factory) {
                if (true)
                    !(
                        void 0 !==
                        (o = function () {
                            return factory(n);
                        }.apply(e, (i = []))) && (t.exports = o)
                    );
                else if ("object" == typeof e) t.exports = factory(n);
                else n.Gumshoe = factory(n);
            })(
                void 0 !== n ? n : "undefined" != typeof window ? window : this,
                function (t) {
                    var e = {
                        navClass: "active",
                        contentClass: "active",
                        nested: false,
                        nestedClass: "active",
                        offset: 0,
                        reflow: false,
                        events: true,
                    },
                        n = function () {
                            var t = {};
                            return (
                                Array.prototype.forEach.call(arguments, function (e) {
                                    for (var n in e) if (e.hasOwnProperty(n)) t[n] = e[n];
                                }),
                                t
                            );
                        },
                        i = function (type, t, e) {
                            if (e.settings.events) {
                                var n = new CustomEvent(type, {
                                    bubbles: true,
                                    cancelable: true,
                                    detail: e,
                                });
                                t.dispatchEvent(n);
                            }
                        },
                        o = function (t) {
                            var e = 0;
                            if (t.offsetParent)
                                for (; t;) (e += t.offsetTop), (t = t.offsetParent);
                            return e >= 0 ? e : 0;
                        },
                        a = function (t) {
                            if (t)
                                t.sort(function (t, e) {
                                    var n, i;
                                    if (o(t.content) < o(e.content)) return -1;
                                    else return 1;
                                });
                        },
                        s = function (settings) {
                            if ("function" == typeof settings.offset)
                                return parseFloat(settings.offset());
                            else return parseFloat(settings.offset);
                        },
                        u = function () {
                            return Math.max(
                                document.body.scrollHeight,
                                document.documentElement.scrollHeight,
                                document.body.offsetHeight,
                                document.documentElement.offsetHeight,
                                document.body.clientHeight,
                                document.documentElement.clientHeight
                            );
                        },
                        l = function (e, settings, n) {
                            var i = e.getBoundingClientRect(),
                                o = s(settings);
                            if (n)
                                return (
                                    parseInt(i.bottom, 10) <
                                    (t.innerHeight || document.documentElement.clientHeight)
                                );
                            else return parseInt(i.top, 10) <= o;
                        },
                        f = function () {
                            if (t.innerHeight + t.pageYOffset >= u()) return true;
                            else return false;
                        },
                        c = function (t, settings) {
                            if (f() && l(t.content, settings, true)) return true;
                            else return false;
                        },
                        h = function (t, settings) {
                            if (t.length) {
                                var e = t[t.length - 1];
                                if (c(e, settings)) return e;
                                for (var n = t.length - 1; n >= 0; n--)
                                    if (l(t[n].content, settings)) return t[n];
                            }
                        },
                        p = function (nav, settings) {
                            if (settings.nested && nav.parentNode) {
                                var t = nav.parentNode.closest("li");
                                if (t) t.classList.remove(settings.nestedClass), p(t, settings);
                            }
                        },
                        m = function (items, settings) {
                            if (items) {
                                var t = items.nav.closest("li");
                                if (t)
                                    t.classList.remove(settings.navClass),
                                        items.content.classList.remove(settings.contentClass),
                                        p(t, settings),
                                        i("gumshoeDeactivate", t, {
                                            link: items.nav,
                                            content: items.content,
                                            settings: settings,
                                        });
                            }
                        },
                        v = function (nav, settings) {
                            if (settings.nested) {
                                var t = nav.parentNode.closest("li");
                                if (t) t.classList.add(settings.nestedClass), v(t, settings);
                            }
                        },
                        g = function (items, settings) {
                            if (items) {
                                var t = items.nav.closest("li");
                                if (t)
                                    t.classList.add(settings.navClass),
                                        items.content.classList.add(settings.contentClass),
                                        v(t, settings),
                                        i("gumshoeActivate", t, {
                                            link: items.nav,
                                            content: items.content,
                                            settings: settings,
                                        });
                            }
                        },
                        y;
                    return function (selector, i) {
                        var o = {},
                            s,
                            u,
                            l,
                            f,
                            settings;
                        (o.setup = function () {
                            (s = document.querySelectorAll(selector)),
                                (u = []),
                                Array.prototype.forEach.call(s, function (t) {
                                    var e = document.getElementById(
                                        decodeURIComponent(t.hash.substr(1))
                                    );
                                    if (e) u.push({ nav: t, content: e });
                                }),
                                a(u);
                        }),
                            (o.detect = function () {
                                if (!document.body.classList.contains("u-scrollspy-prevent")) {
                                    var t = h(u, settings);
                                    if (t) {
                                        if (!l || t.content !== l.content)
                                            m(l, settings), g(t, settings), (l = t);
                                    } else if (l) m(l, settings), (l = null);
                                }
                            });
                        var c = function () {
                            if (f) t.cancelAnimationFrame(f);
                            f = t.requestAnimationFrame(o.detect);
                        },
                            p = function () {
                                if (f) t.cancelAnimationFrame(f);
                                f = t.requestAnimationFrame(function () {
                                    a(u), o.detect();
                                });
                            },
                            init;
                        return (
                            (o.destroy = function () {
                                if (l) m(l, settings);
                                if (
                                    (t.removeEventListener("scroll", c, false), settings.reflow)
                                )
                                    t.removeEventListener("resize", p, false);
                                (u = null),
                                    (s = null),
                                    (l = null),
                                    (f = null),
                                    (settings = null);
                            }),
                            (function () {
                                if (
                                    ((settings = n(e, i || {})),
                                        o.setup(),
                                        o.detect(),
                                        t.addEventListener("scroll", c, false),
                                        settings.reflow)
                                )
                                    t.addEventListener("resize", p, false);
                            })(),
                            o
                        );
                    };
                }
            );
        }).call(e, n(41));
    },
    9836: function (t, e, n) {
        "use strict";
        var i = n(10),
            o = n(9837),
            HorizontalLayoutSlider = n(298);
        i(window).on("load", function () {
            setTimeout(function () {
                i(".u-gallery").removeClass("u-no-transition"),
                    i(".u-layout-horizontal").each(function () {
                        var gallery = i(this),
                            slider = new HorizontalLayoutSlider(gallery, true);
                        gallery.children(".u-gallery-nav").click(function (t) {
                            t.preventDefault();
                            var e = i(t.currentTarget);
                            slider.navigate(e);
                        });
                    });
            }, 250);
        }),
            i(function () {
                var t;
                i("body").on("mouseenter", ".u-gallery.u-no-transition", function () {
                    i(this).closest(".u-gallery").removeClass("u-no-transition");
                }),
                    new o([
                        ".u-gallery.u-product-zoom.u-layout-thumbnails",
                        ".u-gallery.u-product-zoom.u-layout-carousel",
                    ]).init();
            });
    },
    9837: function (t, e, n) {
        "use strict";
        function i(t) {
            this.galleryZoomSelector = t;
        }
        function o(t) {
            var e = t.currentTarget,
                n,
                i = u(e).closest(".u-gallery-item").data("zoom_click"),
                o = e.getBoundingClientRect(),
                a = e.querySelector("img"),
                s = t.clientX,
                l = t.clientY,
                f = t.originalEvent.changedTouches;
            if (!i && !f) {
                u(e).addClass("hover");
                var c = s - o.x,
                    h = l - o.y;
                requestAnimationFrame(function () {
                    var t = c * (1 - a.offsetWidth / e.offsetWidth),
                        n = h * (1 - a.offsetHeight / e.offsetHeight);
                    (a.style.left = t + "px"), (a.style.top = n + "px");
                });
            }
        }
        function a(t) {
            var e = u(t.currentTarget),
                n;
            u(e).removeClass("hover"),
                u(e).closest(".u-gallery-item").data("zoom_click");
        }
        function s(t) {
            var e = u(t.currentTarget);
            u(e).removeClass("hover");
        }
        var u = n(10);
        (t.exports = i),
            (i.prototype.init = function () {
                var t = this.galleryZoomSelector
                    .map(function (selector) {
                        return selector + " .u-back-slide";
                    })
                    .join(", "),
                    e = this.galleryZoomSelector
                        .map(function (selector) {
                            return selector + " .u-back-image";
                        })
                        .join(", ");
                u("body").on("mousedown touchstart", t, a),
                    u("body").on("mousemove touchmove", t, o),
                    u("body").on("click mouseup mouseout touchend touchcancel", t, s),
                    u(e).each(function (t, e) {
                        var url = e.getAttribute("src");
                        u(e)
                            .parent()
                            .css("background-image", "url(" + url + ")");
                    });
            }),
            (window.ImageZoom = i);
    },
    9838: function (t, e, n) {
        "use strict";
        var i = n(10),
            TabsControl = n(275);
        (window._npTabsInit = function () {
            function t(t) {
                t.preventDefault(), t.stopPropagation();
                var link = i(t.currentTarget),
                    tabsControl;
                new TabsControl(link).show();
            }
            i("body").on("click", ".u-tab-link", t);
        }),
            i(function () {
                window._npTabsInit();
            });
    },
    9839: function (t, e, n) {
        "use strict";
        var i = n(9840);
        (window._npLazyImages = {
            setup: function () {
                (window.lazySizesConfig = window.lazySizesConfig || {}),
                    (window.lazySizesConfig.init = false),
                    document.addEventListener("lazybeforeunveil", function (t) {
                        var el = t.target;
                        if (el.matches("video")) {
                            var e = el.getAttribute("data-src"),
                                n = el.querySelector("source");
                            if (n && e) n.setAttribute("src", e);
                        } else {
                            var i = el.getAttribute("data-bg");
                            if (i) {
                                var list = cssBgParser.parseElementStyle(getComputedStyle(el));
                                if (list.backgrounds.length) list.backgrounds[0].color = "";
                                list.backgrounds.push(new cssBgParser.Background({ image: i })),
                                    (el.style.backgroundImage = list.toString("image"));
                            }
                        }
                    });
            },
            init: function () {
                i.init();
            },
        }),
            window._npLazyImages.setup(),
            $(function () {
                window._npLazyImages.init();
            });
    },
    9840: function (t, e, n) {
        "use strict";
        !(function (e, factory) {
            var n = factory(e, e.document, Date);
            if (((e.lazySizes = n), "object" == typeof t && t.exports)) t.exports = n;
        })("undefined" != typeof window ? window : {}, function t(e, n, i) {
            var o, a;
            if (
                (!(function () {
                    var t,
                        n = {
                            lazyClass: "lazyload",
                            loadedClass: "lazyloaded",
                            loadingClass: "lazyloading",
                            preloadClass: "lazypreload",
                            errorClass: "lazyerror",
                            autosizesClass: "lazyautosizes",
                            srcAttr: "data-src",
                            srcsetAttr: "data-srcset",
                            sizesAttr: "data-sizes",
                            minSize: 40,
                            customMedia: {},
                            init: true,
                            expFactor: 1.5,
                            hFac: 0.8,
                            loadMode: 2,
                            loadHidden: true,
                            ricTimeout: 0,
                            throttleDelay: 125,
                        };
                    for (t in ((a = e.lazySizesConfig || e.lazysizesConfig || {}), n))
                        if (!(t in a)) a[t] = n[t];
                })(),
                    !n || !n.getElementsByClassName)
            )
                return { init: function () { }, cfg: a, noSupport: true };
            var s = n.documentElement,
                u = e.HTMLPictureElement,
                l = "addEventListener",
                f = "getAttribute",
                c = e[l].bind(e),
                h = e.setTimeout,
                p = e.requestAnimationFrame || h,
                m = e.requestIdleCallback,
                v = /^picture$/i,
                g = ["load", "error", "lazyincluded", "_lazyloaded"],
                y = {},
                w = Array.prototype.forEach,
                b = function (t, e) {
                    if (!y[e]) y[e] = new RegExp("(\\s|^)" + e + "(\\s|$)");
                    return y[e].test(t[f]("class") || "") && y[e];
                },
                C = function (t, e) {
                    if (!b(t, e))
                        t.setAttribute("class", (t[f]("class") || "").trim() + " " + e);
                },
                x = function (t, e) {
                    var n;
                    if ((n = b(t, e)))
                        t.setAttribute("class", (t[f]("class") || "").replace(n, " "));
                },
                S = function (t, e, add) {
                    var n = add ? l : "removeEventListener";
                    if (add) S(t, e);
                    g.forEach(function (i) {
                        t[n](i, e);
                    });
                },
                A = function (t, e, i, a, s) {
                    var u = n.createEvent("Event");
                    if (!i) i = {};
                    return (
                        (i.instance = o),
                        u.initEvent(e, !a, !s),
                        (u.detail = i),
                        t.dispatchEvent(u),
                        u
                    );
                },
                _ = function (el, t) {
                    var n;
                    if (!u && (n = e.picturefill || a.pf)) {
                        if (t && t.src && !el[f]("srcset"))
                            el.setAttribute("srcset", t.src);
                        n({ reevaluate: true, elements: [el] });
                    } else if (t && t.src) el.src = t.src;
                },
                T = function (t, style) {
                    return (getComputedStyle(t, null) || {})[style];
                },
                I = function (t, e, n) {
                    for (
                        n = n || t.offsetWidth;
                        n < a.minSize && e && !t._lazysizesWidth;

                    )
                        (n = e.offsetWidth), (e = e.parentNode);
                    return n;
                },
                E =
                    ((B = []),
                        (O = L = []),
                        (F = function (t, e) {
                            if (k && !e) t.apply(this, arguments);
                            else if ((O.push(t), !M)) (M = true), (n.hidden ? h : p)(P);
                        }),
                        (F._lsFlush = P =
                            function () {
                                var t = O;
                                for (O = L.length ? B : L, k = true, M = false; t.length;)
                                    t.shift()();
                                k = false;
                            }),
                        F),
                k,
                M,
                L,
                B,
                O,
                P,
                F,
                N = function (t, simple) {
                    return simple
                        ? function () {
                            E(t);
                        }
                        : function () {
                            var e = this,
                                n = arguments;
                            E(function () {
                                t.apply(e, n);
                            });
                        };
                },
                z = function (t) {
                    var e,
                        n = 0,
                        o = a.throttleDelay,
                        s = a.ricTimeout,
                        u = function () {
                            (e = false), (n = i.now()), t();
                        },
                        l =
                            m && s > 49
                                ? function () {
                                    if ((m(u, { timeout: s }), s !== a.ricTimeout))
                                        s = a.ricTimeout;
                                }
                                : N(function () {
                                    h(u);
                                }, true);
                    return function (t) {
                        var a;
                        if ((t = true === t)) s = 33;
                        if (!e) {
                            if (((e = true), (a = o - (i.now() - n)) < 0)) a = 0;
                            if (t || a < 9) l();
                            else h(l, a);
                        }
                    };
                },
                U = function (t) {
                    var e,
                        n,
                        o = 99,
                        a = function () {
                            (e = null), t();
                        },
                        s = function () {
                            var t = i.now() - n;
                            if (t < o) h(s, o - t);
                            else (m || a)(a);
                        };
                    return function () {
                        if (((n = i.now()), !e)) e = h(s, o);
                    };
                },
                loader =
                    ((nt = /^img$/i),
                        (rt = /^iframe$/i),
                        (ot = "onscroll" in e && !/(gle|ing)bot/.test(navigator.userAgent)),
                        (at = 0),
                        (st = 0),
                        (ut = 0),
                        (lt = -1),
                        (ft = function (t) {
                            if ((ut--, !t || ut < 0 || !t.target)) ut = 0;
                        }),
                        (ct = function (t) {
                            if (null == tt) tt = "hidden" == T(n.body, "visibility");
                            return (
                                tt ||
                                !(
                                    "hidden" == T(t.parentNode, "visibility") &&
                                    "hidden" == T(t, "visibility")
                                )
                            );
                        }),
                        (dt = function (t, e) {
                            var i,
                                o = t,
                                visible = ct(t);
                            for (
                                Z -= e, J += e, X -= e, K += e;
                                visible && (o = o.offsetParent) && o != n.body && o != s;

                            )
                                if (
                                    (visible = (T(o, "opacity") || 1) > 0) &&
                                    "visible" != T(o, "overflow")
                                )
                                    (i = o.getBoundingClientRect()),
                                        (visible =
                                            K > i.left &&
                                            X < i.right &&
                                            J > i.top - 1 &&
                                            Z < i.bottom + 1);
                            return visible;
                        }),
                        (pt = z(
                            (ht = function () {
                                var t,
                                    e,
                                    rect,
                                    i,
                                    u,
                                    l,
                                    c,
                                    h,
                                    p,
                                    m,
                                    v,
                                    g,
                                    y = o.elements;
                                if ((Y = a.loadMode) && ut < 8 && (t = y.length)) {
                                    for (e = 0, lt++; e < t; e++)
                                        if (y[e] && !y[e]._lazyRace)
                                            if (
                                                !(!ot || (o.prematureUnveil && o.prematureUnveil(y[e])))
                                            ) {
                                                if (!(h = y[e][f]("data-expand")) || !(l = 1 * h)) l = st;
                                                if (!m)
                                                    if (
                                                        ((m =
                                                            !a.expand || a.expand < 1
                                                                ? s.clientHeight > 500 && s.clientWidth > 500
                                                                    ? 500
                                                                    : 370
                                                                : a.expand),
                                                            (o._defEx = m),
                                                            (v = m * a.expFactor),
                                                            (g = a.hFac),
                                                            (tt = null),
                                                            st < v && ut < 1 && lt > 2 && Y > 2 && !n.hidden)
                                                    )
                                                        (st = v), (lt = 0);
                                                    else if (Y > 1 && lt > 1 && ut < 6) st = m;
                                                    else st = at;
                                                if (p !== l)
                                                    (j = innerWidth + l * g),
                                                        (G = innerHeight + l),
                                                        (c = -1 * l),
                                                        (p = l);
                                                if (
                                                    ((rect = y[e].getBoundingClientRect()),
                                                        (J = rect.bottom) >= c &&
                                                        (Z = rect.top) <= G &&
                                                        (K = rect.right) >= c * g &&
                                                        (X = rect.left) <= j &&
                                                        (J || K || X || Z) &&
                                                        (a.loadHidden || ct(y[e])) &&
                                                        (($ && ut < 3 && !h && (Y < 3 || lt < 4)) ||
                                                            dt(y[e], l)))
                                                ) {
                                                    if ((Ct(y[e]), (u = true), ut > 9)) break;
                                                } else if (
                                                    !u &&
                                                    $ &&
                                                    !i &&
                                                    ut < 4 &&
                                                    lt < 4 &&
                                                    Y > 2 &&
                                                    (H[0] || a.preloadAfterLoad) &&
                                                    (H[0] ||
                                                        (!h &&
                                                            (J ||
                                                                K ||
                                                                X ||
                                                                Z ||
                                                                "auto" != y[e][f](a.sizesAttr))))
                                                )
                                                    i = H[0] || y[e];
                                            } else Ct(y[e]);
                                    if (i && !u) Ct(i);
                                }
                            })
                        )),
                        (vt = N(
                            (mt = function (t) {
                                var e = t.target;
                                if (e._lazyCache) return delete e._lazyCache, void 0;
                                ft(t),
                                    C(e, a.loadedClass),
                                    x(e, a.loadingClass),
                                    S(e, gt),
                                    A(e, "lazyloaded");
                            })
                        )),
                        (gt = function (t) {
                            vt({ target: t.target });
                        }),
                        (yt = function (t, e) {
                            try {
                                t.contentWindow.location.replace(e);
                            } catch (n) {
                                t.src = e;
                            }
                        }),
                        (wt = function (t) {
                            var e,
                                n = t[f](a.srcsetAttr);
                            if ((e = a.customMedia[t[f]("data-media") || t[f]("media")]))
                                t.setAttribute("media", e);
                            if (n) t.setAttribute("srcset", n);
                        }),
                        (bt = N(function (t, e, n, i, o) {
                            var s, u, l, c, p, m;
                            if (!(p = A(t, "lazybeforeunveil", e)).defaultPrevented) {
                                if (i)
                                    if (n) C(t, a.autosizesClass);
                                    else t.setAttribute("sizes", i);
                                if (((u = t[f](a.srcsetAttr)), (s = t[f](a.srcAttr)), o))
                                    c = (l = t.parentNode) && v.test(l.nodeName || "");
                                if (
                                    ((m = e.firesLoad || ("src" in t && (u || s || c))),
                                        (p = { target: t }),
                                        C(t, a.loadingClass),
                                        m)
                                )
                                    clearTimeout(V), (V = h(ft, 2500)), S(t, gt, true);
                                if (c) w.call(l.getElementsByTagName("source"), wt);
                                if (u) t.setAttribute("srcset", u);
                                else if (s && !c)
                                    if (rt.test(t.nodeName)) yt(t, s);
                                    else t.src = s;
                                if (o && (u || c)) _(t, { src: s });
                            }
                            if (t._lazyRace) delete t._lazyRace;
                            x(t, a.lazyClass),
                                E(function () {
                                    var e = t.complete && t.naturalWidth > 1;
                                    if (!m || e) {
                                        if (e) C(t, "ls-is-cached");
                                        mt(p),
                                            (t._lazyCache = true),
                                            h(function () {
                                                if ("_lazyCache" in t) delete t._lazyCache;
                                            }, 9);
                                    }
                                    if ("lazy" == t.loading) ut--;
                                }, true);
                        })),
                        (Ct = function (t) {
                            if (!t._lazyRace) {
                                var e,
                                    n = nt.test(t.nodeName),
                                    i = n && (t[f](a.sizesAttr) || t[f]("sizes")),
                                    o = "auto" == i;
                                if (
                                    (!o && $) ||
                                    !n ||
                                    (!t[f]("src") && !t.srcset) ||
                                    t.complete ||
                                    b(t, a.errorClass) ||
                                    !b(t, a.lazyClass)
                                ) {
                                    if (((e = A(t, "lazyunveilread").detail), o))
                                        _t.updateElem(t, true, t.offsetWidth);
                                    (t._lazyRace = true), ut++, bt(t, e, o, i, n);
                                }
                            }
                        }),
                        (xt = U(function () {
                            (a.loadMode = 3), pt();
                        })),
                        (At = function () {
                            if (!$) {
                                if (i.now() - W < 999) return h(At, 999), void 0;
                                ($ = true), (a.loadMode = 3), pt(), c("scroll", St, true);
                            }
                        }),
                    {
                        _: function () {
                            if (
                                ((W = i.now()),
                                    (o.elements = n.getElementsByClassName(a.lazyClass)),
                                    (H = n.getElementsByClassName(
                                        a.lazyClass + " " + a.preloadClass
                                    )),
                                    c("scroll", pt, true),
                                    c("resize", pt, true),
                                    c("pageshow", function (t) {
                                        if (t.persisted) {
                                            var e = n.querySelectorAll("." + a.loadingClass);
                                            if (e.length && e.forEach)
                                                p(function () {
                                                    e.forEach(function (t) {
                                                        if (t.complete) Ct(t);
                                                    });
                                                });
                                        }
                                    }),
                                    e.MutationObserver)
                            )
                                new MutationObserver(pt).observe(s, {
                                    childList: true,
                                    subtree: true,
                                    attributes: true,
                                });
                            else
                                s[l]("DOMNodeInserted", pt, true),
                                    s[l]("DOMAttrModified", pt, true),
                                    setInterval(pt, 999);
                            if (
                                (c("hashchange", pt, true),
                                    [
                                        "focus",
                                        "mouseover",
                                        "click",
                                        "load",
                                        "transitionend",
                                        "animationend",
                                    ].forEach(function (t) {
                                        n[l](t, pt, true);
                                    }),
                                    /d$|^c/.test(n.readyState))
                            )
                                At();
                            else c("load", At), n[l]("DOMContentLoaded", pt), h(At, 2e4);
                            if (o.elements.length) ht(), E._lsFlush();
                            else pt();
                        },
                        checkElems: pt,
                        unveil: Ct,
                        _aLSL: (St = function () {
                            if (3 == a.loadMode) a.loadMode = 2;
                            xt();
                        }),
                    }),
                H,
                $,
                V,
                Y,
                W,
                j,
                G,
                Z,
                X,
                K,
                J,
                tt,
                nt,
                rt,
                ot,
                at,
                st,
                ut,
                lt,
                ft,
                ct,
                dt,
                ht,
                pt,
                mt,
                vt,
                gt,
                yt,
                wt,
                bt,
                Ct,
                xt,
                St,
                At,
                _t =
                    ((Dt = N(function (t, e, n, i) {
                        var o, a, s;
                        if (
                            ((t._lazysizesWidth = i),
                                (i += "px"),
                                t.setAttribute("sizes", i),
                                v.test(e.nodeName || ""))
                        )
                            for (
                                a = 0, s = (o = e.getElementsByTagName("source")).length;
                                a < s;
                                a++
                            )
                                o[a].setAttribute("sizes", i);
                        if (!n.detail.dataAttr) _(t, n.detail);
                    })),
                        (kt = function (t, e, n) {
                            var i,
                                o = t.parentNode;
                            if (o)
                                if (
                                    ((n = I(t, o, n)),
                                        !(i = A(t, "lazybeforesizes", { width: n, dataAttr: !!e }))
                                            .defaultPrevented)
                                )
                                    if ((n = i.detail.width) && n !== t._lazysizesWidth)
                                        Dt(t, o, i, n);
                        }),
                    {
                        _: function () {
                            (Tt = n.getElementsByClassName(a.autosizesClass)),
                                c("resize", Lt);
                        },
                        checkElems: (Lt = U(function () {
                            var t,
                                e = Tt.length;
                            if (e) for (t = 0; t < e; t++) kt(Tt[t]);
                        })),
                        updateElem: kt,
                    }),
                Tt,
                Dt,
                kt,
                Mt,
                Lt,
                init = function () {
                    if (!init.i && n.getElementsByClassName)
                        (init.i = true), _t._(), loader._();
                };
            return (
                h(function () {
                    if (a.init) init();
                }),
                (o = {
                    cfg: a,
                    autoSizer: _t,
                    loader: loader,
                    init: init,
                    uP: _,
                    aC: C,
                    rC: x,
                    hC: b,
                    fire: A,
                    gW: I,
                    rAF: E,
                })
            );
        });
    },
    9841: function (t, e, n) {
        "use strict";
        var i = n(10),
            Dialog = n(195);
        (window._npDialogsInit = function () {
            function t(t) {
                var dialog;
                t.preventDefault(), t.stopPropagation(), n(t).open();
            }
            function e(t) {
                var dialog;
                t.preventDefault(), t.stopPropagation(), n(t).close();
            }
            function n(t) {
                var link = i(t.currentTarget),
                    e = link.attr("href") || link.attr("data-href"),
                    n = i(e);
                return (n = n.length ? n : link), new Dialog(n);
            }
            function o() {
                return new Dialog(i('[data-dialog-show-on="page_exit"]'));
            }
            function a() {
                return new Dialog(i('[data-dialog-show-on="timer"]'));
            }
            function s(t) {
                if (
                    t.clientY < 50 &&
                    null == t.relatedTarget &&
                    "select" !== t.target.nodeName.toLowerCase()
                ) {
                    var dialog;
                    o().open(function () {
                        document.removeEventListener("mouseout", s);
                    });
                }
            }
            function u() {
                var dialog = a();
                setTimeout(function () {
                    dialog.open();
                }, dialog.getInterval());
            }
            function l(t) {
                var e = i(t.currentTarget);
                setTimeout(function () {
                    new Dialog(e).close();
                });
            }
            i("body").on("click", ".u-dialog-link", t),
                i("body").on("click", ".u-dialog-close-button", e),
                i("body").on("click", ".u-dialog .u-btn:not(.u-btn-step)", l),
                document.addEventListener("mouseout", s),
                u();
        }),
            i(function () {
                window._npDialogsInit();
            });
    },
    9842: function (t, e, n) {
        "use strict";
        var i = n(10),
            CountdownUpdater = n(191);
        i(window).on("load", function () {
            function update() {
                t.each(function (t, el) {
                    var countdownUpdater;
                    new CountdownUpdater(i(el)).startUpdate("runtime");
                });
            }
            var t = CountdownUpdater.findAll();
            if (t.length) update();
        });
    },
    9843: function (t, e, n) {
        "use strict";
        var i = n(10);
        i(function () {
            i(document).on("click", ".u-quantity-input a", function (t) {
                var e;
                t.preventDefault();
                var n = i(this),
                    o = n.siblings("input");
                if (n.hasClass("minus"))
                    (e = (e = parseFloat(o.val()) - 1) < 1 ? 1 : e), o.val(e);
                if (n.hasClass("plus")) (e = parseFloat(o.val()) + 1), o.val(e);
                n
                    .siblings(".minus")
                    .addBack(".minus")
                    .toggleClass("disabled", 1 === e),
                    o.change();
            });
        });
    },
    9844: function (t, e, n) {
        "use strict";
        var i = n(10),
            Accordion = n(160);
        (window._npAccordionInit = function () {
            function t(t) {
                t.preventDefault(), t.stopPropagation();
                var link = i(t.currentTarget),
                    accordion;
                new Accordion(link).show();
            }
            i("body").on("click", ".u-accordion-link", t);
        }),
            i(function () {
                window._npAccordionInit();
            });
    },
    9845: function (t, e, n) {
        "use strict";
        function i(t) {
            t.preventDefault(), t.stopPropagation();
            var form = l(this),
                password;
            a(form.find("input[name=password]").val() || "", function () {
                s(form);
            });
        }
        function o() {
            a(localStorage.getItem(f)), l("#password-redirect-style").remove();
        }
        function a(password, t) {
            if (password) {
                var e = l("body"),
                    n = e.attr("data-salt"),
                    i = e.attr("data-salted-password"),
                    hash = u.create().update(password).digest().toHex(),
                    o = u
                        .create()
                        .update(password + n)
                        .digest()
                        .toHex(),
                    homePage,
                    url = (e.attr("data-home-page") || window.location.pathname).replace(
                        /\.html(\?[\s\S]*)?$/,
                        "_" + hash + ".html$1"
                    );
                if (o === i)
                    localStorage.setItem(f, password), window.location.replace(url);
                else if ("function" == typeof t) t();
            }
        }
        function s(form) {
            var t = form.find(".u-form-send-error");
            t.show(),
                setTimeout(function () {
                    t.hide();
                }, 2e3);
        }
        var u = n(180),
            l = n(10),
            f = "auth_key";
        (window.sha256 = u),
            (window._npAuthInit = function () {
                var form = l(".u-password-control form"),
                    t = form.find("input[name=password_hash]");
                if (t.length)
                    form.find(".u-form-submit a").click(function (e) {
                        e.preventDefault(), e.stopPropagation();
                        var password = form.find("input[name=password]").val() || "",
                            hash = u.create().update(password).digest().toHex();
                        t.val(hash), l(this).closest("form").find(":submit").click();
                    });
                else form.submit(i);
            }),
            l(function () {
                window._npAuthInit(), o();
            });
    },
    9846: function (t, e, n) {
        "use strict";
        var i = n(10);
        i(function () {
            i("body").on("click", ".u-language-active", function (t) {
                t.preventDefault();
            });
        });
    },
    9847: function (t, e, n) {
        "use strict";
        var FormRating = (t.exports = {}),
            i = n(10),
            o = ".u-form-rating-item:visible";
        i(function () {
            FormRating.init();
        }),
            (FormRating.selectStars = function t(e, n) {
                var o = e.find(".u-active-icon"),
                    a = e.find(".u-passive-icon"),
                    s = o.length;
                o.hide(),
                    a.hide(),
                    i(o.toArray().slice(0, n)).show(),
                    i(a.toArray().slice(0, s - n)).show();
            }),
            (FormRating.onStarClick = function t(e) {
                var n = i(e.currentTarget),
                    a = n.parents(".u-form-rating").find("input"),
                    s,
                    u = n.prevAll(o).length + 1,
                    l = a.val() + "";
                if (u.toString() === l) return a.val(""), void 0;
                a.val(u);
            }),
            (FormRating.onStarHover = function t(e) {
                var n = i(e.currentTarget),
                    a = n.prevAll(o);
                FormRating.selectStars(n.parent(), a.length + 1);
            }),
            (FormRating.onLeave = function t(e) {
                var n = i(e.currentTarget),
                    o,
                    a = n.find("input").val() || 0;
                FormRating.selectStars(n, a);
            }),
            (FormRating.init = function init() {
                var t = ".u-form .u-form-rating .u-form-rating-item",
                    e = i(".u-form .u-form-rating");
                FormRating.onLeave({ currentTarget: e }),
                    e.mouseleave(FormRating.onLeave),
                    i(t).hover(FormRating.onStarHover),
                    i(t).click(FormRating.onStarClick);
                var n = e.find("input[type=hidden][required]");
                if (n && n.length) n.addClass("u-input-hidden"), n.attr("type", "text");
            });
    },
    9848: function (t, e, n) {
        "use strict";
        var i = n(10);
        i(function () {
            i("body").on("click", ".u-form .u-gallery-item", function (t) {
                if (!i(t.target).is("input, label")) {
                    var input = i(this).find("input");
                    input.prop("checked", !input.prop("checked"));
                }
            });
        });
    },
    9849: function (t, e, n) {
        "use strict";
        function i(input) {
            var t = parseFloat(input.prop("max")),
                e = parseFloat(input.prop("min")),
                n = parseFloat(input.prop("value")),
                i = 0;
            if (n) i = (100 * (n - e)) / (t - e);
            var formField = input.closest(".u-form-number");
            if (formField.length)
                formField[0].style.setProperty("--progress", i + "%");
        }
        function o(t, e) {
            if (e.length && t.length)
                e.prop("value", t.prop("value")), e.trigger("change");
        }
        function a(t) {
            if (t.length) {
                var e = t.prop("value");
                t.closest(".u-input-row").attr("data-value", e);
            }
        }
        var s = n(10);
        s(function () {
            var t = s("body");
            t.on("input", '.u-form .u-form-number input[type="range"]', function () {
                var input = s(this),
                    t = input.siblings("input");
                if (t.length) o(input, t);
                i(input), a(input);
            }),
                t.on(
                    "input",
                    '.u-form .u-form-number input[type="number"]',
                    function () {
                        var input = s(this),
                            t = input.siblings("input");
                        if (t.length) o(input, t), i(t);
                        a(input);
                    }
                );
        });
    },
    9850: function (t, e, n) {
        "use strict";
        function i(t, dependency) {
            var e = [
                '[name="' + dependency.field + '"]',
                '[name="' + dependency.field + '[]"]',
            ].join(", "),
                n = t.find(e);
            if (!n.length) return false;
            if (!(dependency.condition in f)) return false;
            else return f[dependency.condition](n, dependency.value);
        }
        function o(t, e) {
            if (e in l) l[e](t);
        }
        function a(t) {
            return t
                .toArray()
                .filter(function (el) {
                    return el.checked;
                })
                .map(function (el) {
                    var t = el.value;
                    if (!t) t = el.getAttribute("data-calc") || "";
                    return String(t).trim();
                });
        }
        function s(t, e) {
            return String(t).trim() === String(e).trim();
        }
        var FormDependency = (t.exports = {}),
            u = n(10);
        u(function () {
            u(".u-form").each(function () {
                FormDependency.process(u(this));
            });
            var t = function () {
                FormDependency.process(u(this).closest(".u-form"));
            };
            u("body")
                .on("input", ".u-form input[name], .u-form input[name]", t)
                .on("change", ".u-form input[name], .u-form select[name]", t);
        }),
            (FormDependency.process = function t(e) {
                e.find("[data-dependency]").each(function () {
                    var t = u(this),
                        dependency;
                    try {
                        dependency = JSON.parse(t.attr("data-dependency"))[0];
                    } catch (t) {
                        dependency = null;
                    }
                    if (dependency)
                        if (i(e, dependency)) o(t, dependency.action);
                        else {
                            var n;
                            o(t, { hide: "show", show: "hide" }[dependency.action]);
                        }
                });
            });
        var l = {
            show: function (t) {
                t.closest(".u-form-group").show();
            },
            hide: function (t) {
                t.closest(".u-form-group").hide();
            },
        },
            f = {
                equal: function (t, e) {
                    if (t.is('input[type="checkbox"], input[type="radio"]'))
                        return this.has.apply(this, arguments);
                    else return s(t.val(), e);
                },
                "not-equal": function () {
                    return !this.equal.apply(this, arguments);
                },
                contain: function (t, e) {
                    if (t.is('input[type="checkbox"], input[type="radio"]')) {
                        var n;
                        return a(t).some(function (t) {
                            return String(t).includes(e);
                        }, this);
                    }
                    return String(t.val()).includes(e);
                },
                "not-contain": function () {
                    return !this.contain.apply(this, arguments);
                },
                has: function (t, e) {
                    return a(t).includes(String(e).trim());
                },
                "not-has": function () {
                    return !this.has.apply(this, arguments);
                },
                "number-equal": function (t, e) {
                    var n = parseFloat(t.val());
                    if (n === (e = parseFloat(e))) return true;
                    var diff = Math.abs(n - e),
                        i;
                    if (diff < Number.EPSILON) return true;
                    else
                        return diff <= Math.min(Math.abs(n), Math.abs(e)) * Number.EPSILON;
                },
                "number-not-equal": function () {
                    return this["="].apply(this, arguments);
                },
                "number-greater": function (t, e) {
                    var n;
                    return parseFloat(t.val()) > (e = parseFloat(e));
                },
                "number-greater-or-equal": function () {
                    return (
                        this[">"].apply(this, arguments) || this["="].apply(this, arguments)
                    );
                },
                "number-less": function (t, e) {
                    var n;
                    return parseFloat(t.val()) < (e = parseFloat(e));
                },
                "number-less-or-equal": function () {
                    return (
                        this["<"].apply(this, arguments) || this["="].apply(this, arguments)
                    );
                },
            };
    },
    9851: function (t, e, n) {
        "use strict";
        function i(form) {
            var activeSlide, t;
            return form
                .find(".u-slide.active, .u-slide.u-active")
                .find("input, textarea, select")
                .toArray()
                .every(function (input) {
                    return input.reportValidity();
                });
        }
        var o = n(10),
            FormProgress = n(487),
            a = n(488),
            s = "u-carousel";
        o(function () {
            var t = o("body"),
                e = o(".u-form.u-carousel");
            e.find(".u-carousel-inner").css("overflow", "unset"),
                a.update(e),
                FormProgress.update(e),
                t.on("click", ".u-btn-step", function (t) {
                    t.preventDefault();
                    var button = o(this),
                        e = button.closest(".u-carousel");
                    if (e.length)
                        if (button.hasClass("u-btn-step-next")) e[s]("next");
                        else if (button.hasClass("u-btn-step-prev")) e[s]("prev");
                }),
                e
                    .on("u-slide.bs.u-carousel", function (t) {
                        var form = o(this);
                        if (0 !== t.to && t.to > t.from && !i(form))
                            return t.preventDefault(), void 0;
                        a.update(o(this), t.to),
                            FormProgress.update(o(this), t.to),
                            form.find(".u-carousel-inner").css("overflow", "");
                    })
                    .on("slid.bs.u-carousel", function () {
                        var form;
                        o(this).find(".u-carousel-inner").css("overflow", "unset");
                    })
                    .on("reset", function () {
                        o(this)[s]("to", 0);
                    });
        });
    },
    9852: function (t, e, n) {
        "use strict";
        function i() {
            return (
                -1 !== (u("html").attr("class") || "").search(/u-responsive-(xs|sm)/)
            );
        }
        function o() {
            var t = 0;
            if (
                Intl &&
                Intl.Locale &&
                navigator.language &&
                new Intl.Locale(navigator.language).weekInfo
            )
                t = new Intl.Locale(navigator.language).weekInfo.firstDay || 0;
            return t;
        }
        var a = n(9853),
            s = n(9854),
            u = n(10),
            l = {
                init: function (el) {
                    if (i()) return l.switchToDate(el), null;
                    else return l.create(el);
                },
                create: function (el) {
                    return (
                        l.switchToText(el),
                        a(el, {
                            formatter: function (input, t) {
                                var format = input.getAttribute("data-date-format");
                                if ("local" === format && Intl && Intl.DateTimeFormat)
                                    t = Intl.DateTimeFormat().format(t);
                                else t = s(t, format || "default");
                                input.setAttribute("value", t);
                            },
                            startDay: o(),
                        })
                    );
                },
                remove: function (el, t) {
                    if (t) t.remove();
                    l.switchToDate(el);
                },
                switchToDate: function (el) {
                    el.removeAttribute("value"),
                        el.removeAttribute("readonly"),
                        (el.type = "date");
                },
                switchToText: function (el) {
                    el.setAttribute("readonly", "readonly"), (el.type = "text");
                },
            };
        u(function () {
            var selector;
            u("form input[data-date-format]").each(function () {
                var t = l.init(this);
                u(this).focus(function (e) {
                    var n = e.target;
                    if (!i()) {
                        if (!t) t = l.create(n);
                    } else if (t) l.remove(n, t), (t = null);
                });
            });
        });
    },
    9853: function (t, e, n) {
        "use strict";
        var i, o;
        (i = window),
            (o = function () {
                return (function (t) {
                    function e(i) {
                        if (n[i]) return n[i].exports;
                        var r = (n[i] = { i: i, l: !1, exports: {} });
                        return t[i].call(r.exports, r, r.exports, e), (r.l = !0), r.exports;
                    }
                    var n = {};
                    return (
                        (e.m = t),
                        (e.c = n),
                        (e.d = function (t, n, i) {
                            e.o(t, n) ||
                                Object.defineProperty(t, n, { enumerable: !0, get: i });
                        }),
                        (e.r = function (t) {
                            "undefined" != typeof Symbol &&
                                Symbol.toStringTag &&
                                Object.defineProperty(t, Symbol.toStringTag, {
                                    value: "Module",
                                }),
                                Object.defineProperty(t, "__esModule", { value: !0 });
                        }),
                        (e.t = function (t, n) {
                            if ((1 & n && (t = e(t)), 8 & n)) return t;
                            if (4 & n && "object" == typeof t && t && t.__esModule) return t;
                            var i = Object.create(null);
                            if (
                                (e.r(i),
                                    Object.defineProperty(i, "default", {
                                        enumerable: !0,
                                        value: t,
                                    }),
                                    2 & n && "string" != typeof t)
                            )
                                for (var r in t)
                                    e.d(
                                        i,
                                        r,
                                        function (e) {
                                            return t[e];
                                        }.bind(null, r)
                                    );
                            return i;
                        }),
                        (e.n = function (t) {
                            var n =
                                t && t.__esModule
                                    ? function () {
                                        return t.default;
                                    }
                                    : function () {
                                        return t;
                                    };
                            return e.d(n, "a", n), n;
                        }),
                        (e.o = function (t, e) {
                            return Object.prototype.hasOwnProperty.call(t, e);
                        }),
                        (e.p = ""),
                        e((e.s = 0))
                    );
                })([
                    function (t, e, n) {
                        function i() { }
                        function d(t) {
                            z.forEach(function (e) {
                                t.addEventListener(e, t === document ? x : S);
                            });
                        }
                        function o(t) {
                            return Array.isArray(t)
                                ? t.map(o)
                                : "[object Object]" === b(t)
                                    ? Object.keys(t).reduce(function (e, n) {
                                        return (e[n] = o(t[n])), e;
                                    }, {})
                                    : t;
                        }
                        function a(t, e) {
                            var n = t.calendar.querySelector(".qs-overlay"),
                                i = n && !n.classList.contains("qs-hidden");
                            (e = e || new Date(t.currentYear, t.currentMonth)),
                                (t.calendar.innerHTML = [s(e, t, i), u(e, t, i), l(t, i)].join(
                                    ""
                                )),
                                i &&
                                window.requestAnimationFrame(function () {
                                    y(!0, t);
                                });
                        }
                        function s(t, e, n) {
                            return [
                                '<div class="qs-controls' + (n ? " qs-blur" : "") + '">',
                                '<div class="qs-arrow qs-left"></div>',
                                '<div class="qs-month-year">',
                                '<span class="qs-month">' + e.months[t.getMonth()] + "</span>",
                                '<span class="qs-year">' + t.getFullYear() + "</span>",
                                "</div>",
                                '<div class="qs-arrow qs-right"></div>',
                                "</div>",
                            ].join("");
                        }
                        function u(t, e, n) {
                            var i = e.currentMonth,
                                r = e.currentYear,
                                o = e.dateSelected,
                                a = e.maxDate,
                                s = e.minDate,
                                u = e.showAllDates,
                                d = e.days,
                                l = e.disabledDates,
                                f = e.startDay,
                                c = e.weekendIndices,
                                h = e.events,
                                p = e.getRange ? e.getRange() : {},
                                m = +p.start,
                                g = +p.end,
                                y = v(new Date(t).setDate(1)),
                                w = y.getDay() - f,
                                D = w < 0 ? 7 : 0;
                            y.setMonth(y.getMonth() + 1), y.setDate(0);
                            var b = y.getDate(),
                                q = [],
                                C = D + 7 * (((w + b) / 7) | 0);
                            C += (w + b) % 7 ? 7 : 0;
                            for (var x = 1; x <= C; x++) {
                                var S = (x - 1) % 7,
                                    A = d[S],
                                    _ = x - (w >= 0 ? w : 7 + w),
                                    T = new Date(r, i, _),
                                    I = h[+T],
                                    E = _ < 1 || _ > b,
                                    k = E ? (_ < 1 ? -1 : 1) : 0,
                                    M = E && !u,
                                    L = M ? "" : T.getDate(),
                                    B = +T == +o,
                                    O = S === c[0] || S === c[1],
                                    P = m !== g,
                                    F = "qs-square " + A;
                                I && !M && (F += " qs-event"),
                                    E && (F += " qs-outside-current-month"),
                                    (!u && E) || (F += " qs-num"),
                                    B && (F += " qs-active"),
                                    (l[+T] ||
                                        e.disabler(T) ||
                                        (O && e.noWeekends) ||
                                        (s && +T < +s) ||
                                        (a && +T > +a)) &&
                                    !M &&
                                    (F += " qs-disabled"),
                                    +v(new Date()) == +T && (F += " qs-current"),
                                    +T === m && g && P && (F += " qs-range-start"),
                                    +T > m && +T < g && (F += " qs-range-middle"),
                                    +T === g && m && P && (F += " qs-range-end"),
                                    M && ((F += " qs-empty"), (L = "")),
                                    q.push(
                                        '<div class="' +
                                        F +
                                        '" data-direction="' +
                                        k +
                                        '">' +
                                        L +
                                        "</div>"
                                    );
                            }
                            var R = d
                                .map(function (t) {
                                    return '<div class="qs-square qs-day">' + t + "</div>";
                                })
                                .concat(q);
                            return (
                                R.unshift(
                                    '<div class="qs-squares' + (n ? " qs-blur" : "") + '">'
                                ),
                                R.push("</div>"),
                                R.join("")
                            );
                        }
                        function l(t, e) {
                            var n = t.overlayPlaceholder,
                                i = t.overlayButton;
                            return [
                                '<div class="qs-overlay' + (e ? "" : " qs-hidden") + '">',
                                "<div>",
                                '<input class="qs-overlay-year" placeholder="' +
                                n +
                                '" inputmode="numeric" />',
                                '<div class="qs-close">&#10005;</div>',
                                "</div>",
                                '<div class="qs-overlay-month-container">' +
                                t.overlayMonths
                                    .map(function (t, e) {
                                        return (
                                            '<div class="qs-overlay-month" data-month-num="' +
                                            e +
                                            '">' +
                                            t +
                                            "</div>"
                                        );
                                    })
                                    .join("") +
                                "</div>",
                                '<div class="qs-submit qs-disabled">' + i + "</div>",
                                "</div>",
                            ].join("");
                        }
                        function f(t, e, n) {
                            var i = e.el,
                                r = e.calendar.querySelector(".qs-active"),
                                o = t.textContent,
                                s = e.sibling;
                            ((i.disabled || i.readOnly) && e.respectDisabledReadOnly) ||
                                ((e.dateSelected = n
                                    ? void 0
                                    : new Date(e.currentYear, e.currentMonth, o)),
                                    r && r.classList.remove("qs-active"),
                                    n || t.classList.add("qs-active"),
                                    h(i, e, n),
                                    n || q(e),
                                    s &&
                                    (c({ instance: e, deselect: n }),
                                        e.first &&
                                        !s.dateSelected &&
                                        ((s.currentYear = e.currentYear),
                                            (s.currentMonth = e.currentMonth),
                                            (s.currentMonthName = e.currentMonthName)),
                                        a(e),
                                        a(s)),
                                    e.onSelect(e, n ? void 0 : new Date(e.dateSelected)));
                        }
                        function c(t) {
                            var e = t.instance.first ? t.instance : t.instance.sibling,
                                n = e.sibling;
                            e === t.instance
                                ? t.deselect
                                    ? ((e.minDate = e.originalMinDate),
                                        (n.minDate = n.originalMinDate))
                                    : (n.minDate = e.dateSelected)
                                : t.deselect
                                    ? ((n.maxDate = n.originalMaxDate),
                                        (e.maxDate = e.originalMaxDate))
                                    : (e.maxDate = n.dateSelected);
                        }
                        function h(t, e, n) {
                            if (!e.nonInput)
                                return n
                                    ? (t.value = "")
                                    : e.formatter !== i
                                        ? e.formatter(t, e.dateSelected, e)
                                        : void (t.value = e.dateSelected.toDateString());
                        }
                        function p(t, e, n, i) {
                            n || i
                                ? (n && (e.currentYear = +n), i && (e.currentMonth = +i))
                                : ((e.currentMonth += t.contains("qs-right") ? 1 : -1),
                                    12 === e.currentMonth
                                        ? ((e.currentMonth = 0), e.currentYear++)
                                        : -1 === e.currentMonth &&
                                        ((e.currentMonth = 11), e.currentYear--)),
                                (e.currentMonthName = e.months[e.currentMonth]),
                                a(e),
                                e.onMonthChange(e);
                        }
                        function D(t) {
                            if (!t.noPosition) {
                                var e = t.position.top,
                                    n = t.position.right;
                                if (t.position.centered)
                                    return t.calendarContainer.classList.add("qs-centered");
                                var i = t.positionedEl.getBoundingClientRect(),
                                    r = t.el.getBoundingClientRect(),
                                    o = t.calendarContainer.getBoundingClientRect(),
                                    a = r.top - i.top + (e ? -1 * o.height : r.height) + "px",
                                    s = r.left - i.left + (n ? r.width - o.width : 0) + "px";
                                t.calendarContainer.style.setProperty("top", a),
                                    t.calendarContainer.style.setProperty("left", s);
                            }
                        }
                        function m(t) {
                            return (
                                "[object Date]" === b(t) && "Invalid Date" !== t.toString()
                            );
                        }
                        function v(t) {
                            if (m(t) || ("number" == typeof t && !isNaN(t))) {
                                var e = new Date(+t);
                                return new Date(e.getFullYear(), e.getMonth(), e.getDate());
                            }
                        }
                        function q(t) {
                            t.disabled ||
                                (!t.calendarContainer.classList.contains("qs-hidden") &&
                                    !t.alwaysShow &&
                                    ("overlay" !== t.defaultView && y(!0, t),
                                        t.calendarContainer.classList.add("qs-hidden"),
                                        t.onHide(t)));
                        }
                        function g(t) {
                            t.disabled ||
                                (t.calendarContainer.classList.remove("qs-hidden"),
                                    "overlay" === t.defaultView && y(!1, t),
                                    D(t),
                                    t.onShow(t));
                        }
                        function y(t, e) {
                            var n = e.calendar,
                                i = n.querySelector(".qs-overlay"),
                                r = i.querySelector(".qs-overlay-year"),
                                o = n.querySelector(".qs-controls"),
                                a = n.querySelector(".qs-squares");
                            t
                                ? (i.classList.add("qs-hidden"),
                                    o.classList.remove("qs-blur"),
                                    a.classList.remove("qs-blur"),
                                    (r.value = ""))
                                : (i.classList.remove("qs-hidden"),
                                    o.classList.add("qs-blur"),
                                    a.classList.add("qs-blur"),
                                    r.focus());
                        }
                        function w(t, e, n, i) {
                            var r = isNaN(+new Date().setFullYear(e.value || void 0)),
                                o = r ? null : e.value;
                            if (13 === t.which || 13 === t.keyCode || "click" === t.type)
                                i
                                    ? p(null, n, o, i)
                                    : r || e.classList.contains("qs-disabled") || p(null, n, o);
                            else if (n.calendar.contains(e))
                                n.calendar
                                    .querySelector(".qs-submit")
                                    .classList[r ? "add" : "remove"]("qs-disabled");
                        }
                        function b(t) {
                            return {}.toString.call(t);
                        }
                        function C(t) {
                            P.forEach(function (e) {
                                e !== t && q(e);
                            });
                        }
                        function x(t) {
                            if (!t.__qs_shadow_dom) {
                                var e = t.which || t.keyCode,
                                    n = t.type,
                                    r = t.target,
                                    i = r.classList,
                                    o = P.filter(function (t) {
                                        return t.calendar.contains(r) || t.el === r;
                                    })[0],
                                    s = o && o.calendar.contains(r);
                                if (!(o && o.isMobile && o.disableMobile))
                                    if ("click" === n) {
                                        if (!o) return P.forEach(q);
                                        if (o.disabled) return;
                                        var d = o.calendar,
                                            u = o.calendarContainer,
                                            l = o.disableYearOverlay,
                                            c = o.nonInput,
                                            h = d.querySelector(".qs-overlay-year"),
                                            m = !!d.querySelector(".qs-hidden"),
                                            v = d.querySelector(".qs-month-year").contains(r),
                                            D = r.dataset.monthNum;
                                        if (o.noPosition && !s)
                                            (u.classList.contains("qs-hidden") ? g : q)(o);
                                        else if (i.contains("qs-arrow")) p(i, o);
                                        else if (v || i.contains("qs-close")) l || y(!m, o);
                                        else if (D) w(t, h, o, D);
                                        else {
                                            if (i.contains("qs-disabled")) return;
                                            if (i.contains("qs-num")) {
                                                var b = r.textContent,
                                                    x = +r.dataset.direction,
                                                    S = new Date(o.currentYear, o.currentMonth + x, b);
                                                if (x) {
                                                    (o.currentYear = S.getFullYear()),
                                                        (o.currentMonth = S.getMonth()),
                                                        (o.currentMonthName = F[o.currentMonth]),
                                                        a(o);
                                                    for (
                                                        var A,
                                                        _ = o.calendar.querySelectorAll(
                                                            '[data-direction="0"]'
                                                        ),
                                                        T = 0;
                                                        !A;

                                                    ) {
                                                        var I = _[T];
                                                        I.textContent === b && (A = I), T++;
                                                    }
                                                    r = A;
                                                }
                                                return void (+S == +o.dateSelected
                                                    ? f(r, o, !0)
                                                    : r.classList.contains("qs-disabled") || f(r, o));
                                            }
                                            i.contains("qs-submit")
                                                ? w(t, h, o)
                                                : c && r === o.el && (g(o), C(o));
                                        }
                                    } else if ("focusin" === n && o) g(o), C(o);
                                    else if ("keydown" === n && 9 === e && o) q(o);
                                    else if ("keydown" === n && o && !o.disabled) {
                                        var E = !o.calendar
                                            .querySelector(".qs-overlay")
                                            .classList.contains("qs-hidden");
                                        13 === e && E && s
                                            ? w(t, r, o)
                                            : 27 === e && E && s && y(!0, o);
                                    } else if ("input" === n) {
                                        if (!o || !o.calendar.contains(r)) return;
                                        var k = o.calendar.querySelector(".qs-submit"),
                                            M = r.value
                                                .split("")
                                                .reduce(function (t, e) {
                                                    return t || "0" !== e
                                                        ? t + (e.match(/[0-9]/) ? e : "")
                                                        : "";
                                                }, "")
                                                .slice(0, 4);
                                        (r.value = M),
                                            k.classList[4 === M.length ? "remove" : "add"](
                                                "qs-disabled"
                                            );
                                    }
                            }
                        }
                        function S(t) {
                            x(t), (t.__qs_shadow_dom = !0);
                        }
                        function A(t, e) {
                            z.forEach(function (n) {
                                t.removeEventListener(n, e);
                            });
                        }
                        function _() {
                            g(this);
                        }
                        function T() {
                            q(this);
                        }
                        function I(t, e) {
                            var n = v(t),
                                i = this.currentYear,
                                r = this.currentMonth,
                                o = this.sibling;
                            if (null == t)
                                return (
                                    (this.dateSelected = void 0),
                                    h(this.el, this, !0),
                                    o && (c({ instance: this, deselect: !0 }), a(o)),
                                    a(this),
                                    this
                                );
                            if (!m(t))
                                throw new Error("`setDate` needs a JavaScript Date object.");
                            if (
                                this.disabledDates[+n] ||
                                n < this.minDate ||
                                n > this.maxDate
                            )
                                throw new Error(
                                    "You can't manually set a date that's disabled."
                                );
                            (this.dateSelected = n),
                                e &&
                                ((this.currentYear = n.getFullYear()),
                                    (this.currentMonth = n.getMonth()),
                                    (this.currentMonthName = this.months[n.getMonth()])),
                                h(this.el, this),
                                o && (c({ instance: this }), a(o));
                            var s = i === n.getFullYear() && r === n.getMonth();
                            return (
                                s || e ? a(this, n) : s || a(this, new Date(i, r, 1)), this
                            );
                        }
                        function E(t) {
                            return M(this, t, !0);
                        }
                        function k(t) {
                            return M(this, t);
                        }
                        function M(t, e, n) {
                            function i() {
                                return "original" + d + "Date";
                            }
                            function o() {
                                return d.toLowerCase() + "Date";
                            }
                            function s() {
                                return "set" + d;
                            }
                            function u() {
                                throw new Error("Out-of-range date passed to " + s());
                            }
                            var l = t.dateSelected,
                                r = t.first,
                                f = t.sibling,
                                c = t.minDate,
                                h = t.maxDate,
                                p = v(e),
                                d = n ? "Min" : "Max";
                            if (null == e)
                                (t[i()] = void 0),
                                    f
                                        ? ((f[i()] = void 0),
                                            n
                                                ? ((r && !l) || (!r && !f.dateSelected)) &&
                                                ((t.minDate = void 0), (f.minDate = void 0))
                                                : ((r && !f.dateSelected) || (!r && !l)) &&
                                                ((t.maxDate = void 0), (f.maxDate = void 0)))
                                        : (t[o()] = void 0);
                            else {
                                if (!m(e)) throw new Error("Invalid date passed to " + s());
                                f
                                    ? (((r && n && p > (l || h)) ||
                                        (r && !n && p < (f.dateSelected || c)) ||
                                        (!r && n && p > (f.dateSelected || h)) ||
                                        (!r && !n && p < (l || c))) &&
                                        u(),
                                        (t[i()] = p),
                                        (f[i()] = p),
                                        ((n && ((r && !l) || (!r && !f.dateSelected))) ||
                                            (!n && ((r && !f.dateSelected) || (!r && !l)))) &&
                                        ((t[o()] = p), (f[o()] = p)))
                                    : (((n && p > (l || h)) || (!n && p < (l || c))) && u(),
                                        (t[o()] = p));
                            }
                            return f && a(f), a(t), t;
                        }
                        function L() {
                            var t = this.first ? this : this.sibling,
                                e = t.sibling;
                            return { start: t.dateSelected, end: e.dateSelected };
                        }
                        function R() {
                            var t = this.shadowDom,
                                e = this.positionedEl,
                                n = this.calendarContainer,
                                r = this.sibling,
                                i = this;
                            this.inlinePosition &&
                                (P.some(function (t) {
                                    return t !== i && t.positionedEl === e;
                                }) ||
                                    e.style.setProperty("position", null)),
                                n.remove(),
                                (P = P.filter(function (t) {
                                    return t !== i;
                                })),
                                r && delete r.sibling,
                                P.length || A(document, x);
                            var o = P.some(function (e) {
                                return e.shadowDom === t;
                            });
                            for (var a in (t && !o && A(t, S), this)) delete this[a];
                            P.length ||
                                z.forEach(function (t) {
                                    document.removeEventListener(t, x);
                                });
                        }
                        function B(t, e) {
                            var n = new Date(t);
                            if (!m(n)) throw new Error("Invalid date passed to `navigate`");
                            (this.currentYear = n.getFullYear()),
                                (this.currentMonth = n.getMonth()),
                                a(this),
                                e && this.onMonthChange(this);
                        }
                        function O() {
                            var t = !this.calendarContainer.classList.contains("qs-hidden"),
                                e = !this.calendarContainer
                                    .querySelector(".qs-overlay")
                                    .classList.contains("qs-hidden");
                            t && y(e, this);
                        }
                        n.r(e);
                        var P = [],
                            r = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"],
                            F = [
                                "January",
                                "February",
                                "March",
                                "April",
                                "May",
                                "June",
                                "July",
                                "August",
                                "September",
                                "October",
                                "November",
                                "December",
                            ],
                            N = {
                                t: "top",
                                r: "right",
                                b: "bottom",
                                l: "left",
                                c: "centered",
                            },
                            z = ["click", "focusin", "keydown", "input"];
                        e.default = function (t, e) {
                            var n = (function (t, e) {
                                var n,
                                    a,
                                    d = (function (t) {
                                        function e(t) {
                                            throw new Error(
                                                '"dateSelected" in options is ' +
                                                (t ? "less" : "greater") +
                                                ' than "' +
                                                (t || "max") +
                                                'Date".'
                                            );
                                        }
                                        var n = o(t);
                                        n.events &&
                                            (n.events = n.events.reduce(function (t, e) {
                                                if (!m(e))
                                                    throw new Error(
                                                        '"options.events" must only contain valid JavaScript Date objects.'
                                                    );
                                                return (t[+v(e)] = !0), t;
                                            }, {})),
                                            [
                                                "startDate",
                                                "dateSelected",
                                                "minDate",
                                                "maxDate",
                                            ].forEach(function (t) {
                                                var e = n[t];
                                                if (e && !m(e))
                                                    throw new Error(
                                                        '"options.' +
                                                        t +
                                                        '" needs to be a valid JavaScript Date object.'
                                                    );
                                                n[t] = v(e);
                                            });
                                        var a = n.position,
                                            s = n.maxDate,
                                            u = n.minDate,
                                            d = n.dateSelected,
                                            l = n.overlayPlaceholder,
                                            f = n.overlayButton,
                                            c = n.startDay,
                                            h = n.id;
                                        if (
                                            ((n.startDate = v(n.startDate || d || new Date())),
                                                (n.disabledDates = (n.disabledDates || []).reduce(
                                                    function (t, e) {
                                                        var n = +v(e);
                                                        if (!m(e))
                                                            throw new Error(
                                                                'You supplied an invalid date to "options.disabledDates".'
                                                            );
                                                        if (n === +v(d))
                                                            throw new Error(
                                                                '"disabledDates" cannot contain the same date as "dateSelected".'
                                                            );
                                                        return (t[n] = 1), t;
                                                    },
                                                    {}
                                                )),
                                                n.hasOwnProperty("id") && null == h)
                                        )
                                            throw new Error("`id` cannot be `null` or `undefined`");
                                        if (null != h) {
                                            var p = P.filter(function (t) {
                                                return t.id === h;
                                            });
                                            if (p.length > 1)
                                                throw new Error(
                                                    "Only two datepickers can share an id."
                                                );
                                            p.length
                                                ? ((n.second = !0), (n.sibling = p[0]))
                                                : (n.first = !0);
                                        }
                                        var g = ["tr", "tl", "br", "bl", "c"].some(function (t) {
                                            return a === t;
                                        });
                                        if (a && !g)
                                            throw new Error(
                                                '"options.position" must be one of the following: tl, tr, bl, br, or c.'
                                            );
                                        if (
                                            ((n.position = (function (t) {
                                                var e = t[0],
                                                    n = t[1],
                                                    i = {};
                                                return (i[N[e]] = 1), n && (i[N[n]] = 1), i;
                                            })(a || "bl")),
                                                s < u)
                                        )
                                            throw new Error(
                                                '"maxDate" in options is less than "minDate".'
                                            );
                                        if (
                                            (d && (u > d && e("min"), s < d && e()),
                                                [
                                                    "onSelect",
                                                    "onShow",
                                                    "onHide",
                                                    "onMonthChange",
                                                    "formatter",
                                                    "disabler",
                                                ].forEach(function (t) {
                                                    "function" != typeof n[t] && (n[t] = i);
                                                }),
                                                [
                                                    "customDays",
                                                    "customMonths",
                                                    "customOverlayMonths",
                                                ].forEach(function (t, e) {
                                                    var i = n[t],
                                                        r = e ? 12 : 7;
                                                    if (i) {
                                                        if (
                                                            !Array.isArray(i) ||
                                                            i.length !== r ||
                                                            i.some(function (t) {
                                                                return "string" != typeof t;
                                                            })
                                                        )
                                                            throw new Error(
                                                                '"' +
                                                                t +
                                                                '" must be an array with ' +
                                                                r +
                                                                " strings."
                                                            );
                                                        n[e ? (e < 2 ? "months" : "overlayMonths") : "days"] =
                                                            i;
                                                    }
                                                }),
                                                c && c > 0 && c < 7)
                                        ) {
                                            var y = (n.customDays || r).slice(),
                                                D = y.splice(0, c);
                                            (n.customDays = y.concat(D)),
                                                (n.startDay = +c),
                                                (n.weekendIndices = [y.length - 1, y.length]);
                                        } else (n.startDay = 0), (n.weekendIndices = [6, 0]);
                                        "string" != typeof l && delete n.overlayPlaceholder,
                                            "string" != typeof f && delete n.overlayButton;
                                        var q = n.defaultView;
                                        if (q && "calendar" !== q && "overlay" !== q)
                                            throw new Error(
                                                'options.defaultView must either be "calendar" or "overlay".'
                                            );
                                        return (n.defaultView = q || "calendar"), n;
                                    })(
                                        e || {
                                            startDate: v(new Date()),
                                            position: "bl",
                                            defaultView: "calendar",
                                        }
                                    ),
                                    s = t;
                                if ("string" == typeof s)
                                    s =
                                        "#" === s[0]
                                            ? document.getElementById(s.slice(1))
                                            : document.querySelector(s);
                                else {
                                    if ("[object ShadowRoot]" === b(s))
                                        throw new Error(
                                            "Using a shadow DOM as your selector is not supported."
                                        );
                                    for (var u, l = s.parentNode; !u;) {
                                        var f = b(l);
                                        "[object HTMLDocument]" === f
                                            ? (u = !0)
                                            : "[object ShadowRoot]" === f
                                                ? ((u = !0), (n = l), (a = l.host))
                                                : (l = l.parentNode);
                                    }
                                }
                                if (!s) throw new Error("No selector / element found.");
                                if (
                                    P.some(function (t) {
                                        return t.el === s;
                                    })
                                )
                                    throw new Error(
                                        "A datepicker already exists on that element."
                                    );
                                var c = s === document.body,
                                    p = n
                                        ? s.parentElement || n
                                        : c
                                            ? document.body
                                            : s.parentElement,
                                    y = n ? s.parentElement || a : p,
                                    D = document.createElement("div"),
                                    q = document.createElement("div");
                                (D.className = "qs-datepicker-container qs-hidden"),
                                    (q.className = "qs-datepicker");
                                var w = {
                                    shadowDom: n,
                                    customElement: a,
                                    positionedEl: y,
                                    el: s,
                                    parent: p,
                                    nonInput: "INPUT" !== s.nodeName,
                                    noPosition: c,
                                    position: !c && d.position,
                                    startDate: d.startDate,
                                    dateSelected: d.dateSelected,
                                    disabledDates: d.disabledDates,
                                    minDate: d.minDate,
                                    maxDate: d.maxDate,
                                    noWeekends: !!d.noWeekends,
                                    weekendIndices: d.weekendIndices,
                                    calendarContainer: D,
                                    calendar: q,
                                    currentMonth: (d.startDate || d.dateSelected).getMonth(),
                                    currentMonthName: (d.months || F)[
                                        (d.startDate || d.dateSelected).getMonth()
                                    ],
                                    currentYear: (d.startDate || d.dateSelected).getFullYear(),
                                    events: d.events || {},
                                    defaultView: d.defaultView,
                                    setDate: I,
                                    remove: R,
                                    setMin: E,
                                    setMax: k,
                                    show: _,
                                    hide: T,
                                    navigate: B,
                                    toggleOverlay: O,
                                    onSelect: d.onSelect,
                                    onShow: d.onShow,
                                    onHide: d.onHide,
                                    onMonthChange: d.onMonthChange,
                                    formatter: d.formatter,
                                    disabler: d.disabler,
                                    months: d.months || F,
                                    days: d.customDays || r,
                                    startDay: d.startDay,
                                    overlayMonths:
                                        d.overlayMonths ||
                                        (d.months || F).map(function (t) {
                                            return t.slice(0, 3);
                                        }),
                                    overlayPlaceholder: d.overlayPlaceholder || "4-digit year",
                                    overlayButton: d.overlayButton || "Submit",
                                    disableYearOverlay: !!d.disableYearOverlay,
                                    disableMobile: !!d.disableMobile,
                                    isMobile: "ontouchstart" in window,
                                    alwaysShow: !!d.alwaysShow,
                                    id: d.id,
                                    showAllDates: !!d.showAllDates,
                                    respectDisabledReadOnly: !!d.respectDisabledReadOnly,
                                    first: d.first,
                                    second: d.second,
                                };
                                if (d.sibling) {
                                    var C = d.sibling,
                                        x = w,
                                        S = C.minDate || x.minDate,
                                        A = C.maxDate || x.maxDate;
                                    (x.sibling = C),
                                        (C.sibling = x),
                                        (C.minDate = S),
                                        (C.maxDate = A),
                                        (x.minDate = S),
                                        (x.maxDate = A),
                                        (C.originalMinDate = S),
                                        (C.originalMaxDate = A),
                                        (x.originalMinDate = S),
                                        (x.originalMaxDate = A),
                                        (C.getRange = L),
                                        (x.getRange = L);
                                }
                                d.dateSelected && h(s, w);
                                var M = getComputedStyle(y).position;
                                c ||
                                    (M && "static" !== M) ||
                                    ((w.inlinePosition = !0),
                                        y.style.setProperty("position", "relative"));
                                var z = P.filter(function (t) {
                                    return t.positionedEl === w.positionedEl;
                                });
                                return (
                                    z.some(function (t) {
                                        return t.inlinePosition;
                                    }) &&
                                    ((w.inlinePosition = !0),
                                        z.forEach(function (t) {
                                            t.inlinePosition = !0;
                                        })),
                                    D.appendChild(q),
                                    p.appendChild(D),
                                    w.alwaysShow && g(w),
                                    w
                                );
                            })(t, e);
                            if (
                                (P.length || d(document),
                                    n.shadowDom &&
                                    (P.some(function (t) {
                                        return t.shadowDom === n.shadowDom;
                                    }) ||
                                        d(n.shadowDom)),
                                    P.push(n),
                                    n.second)
                            ) {
                                var s = n.sibling;
                                c({ instance: n, deselect: !n.dateSelected }),
                                    c({ instance: s, deselect: !s.dateSelected }),
                                    a(s);
                            }
                            return (
                                a(n, n.startDate || n.dateSelected), n.alwaysShow && D(n), n
                            );
                        };
                    },
                ]).default;
            }),
            !void (true
                ? (t.exports = o())
                : "function" == typeof define && define.amd
                    ? define([], o)
                    : "object" == typeof e
                        ? (e.datepicker = o())
                        : (i.datepicker = o()));
    },
    9854: function (t, e, n) {
        "use strict";
        function i(t) {
            if ("function" == typeof Symbol && "symbol" == typeof Symbol.iterator)
                i = function t(e) {
                    return typeof e;
                };
            else
                i = function t(e) {
                    return e &&
                        "function" == typeof Symbol &&
                        e.constructor === Symbol &&
                        e !== Symbol.prototype
                        ? "symbol"
                        : typeof e;
                };
            return i(t);
        }
        var o;
        "use strict",
            (function (a) {
                var s = arguments,
                    u =
                        ((l =
                            /d{1,4}|D{3,4}|m{1,4}|yy(?:yy)?|([HhMsTt])\1?|W{1,2}|[LlopSZN]|"[^"]*"|'[^']*'/g),
                            (f =
                                /\b(?:[PMCEA][SDP]T|(?:Pacific|Mountain|Central|Eastern|Atlantic) (?:Standard|Daylight|Prevailing) Time|(?:GMT|UTC)(?:[-+]\d{4})?)\b/g),
                            (c = /[^-+\dA-Z]/g),
                            function (t, e, n, i) {
                                if (1 === s.length && "string" === g(t) && !/\d/.test(t))
                                    (e = t), (t = void 0);
                                if (!((t = t || 0 === t ? t : new Date()) instanceof Date))
                                    t = new Date(t);
                                if (isNaN(t)) throw TypeError("Invalid date");
                                var o = (e = String(u.masks[e] || e || u.masks["default"])).slice(
                                    0,
                                    4
                                );
                                if ("UTC:" === o || "GMT:" === o)
                                    if (((e = e.slice(4)), (n = true), "GMT:" === o)) i = true;
                                var a = function t() {
                                    return n ? "getUTC" : "get";
                                },
                                    y = function d() {
                                        return t[a() + "Date"]();
                                    },
                                    D = function D() {
                                        return t[a() + "Day"]();
                                    },
                                    w = function e() {
                                        return t[a() + "Month"]();
                                    },
                                    b = function e() {
                                        return t[a() + "FullYear"]();
                                    },
                                    C = function e() {
                                        return t[a() + "Hours"]();
                                    },
                                    x = function e() {
                                        return t[a() + "Minutes"]();
                                    },
                                    S = function e() {
                                        return t[a() + "Seconds"]();
                                    },
                                    A = function e() {
                                        return t[a() + "Milliseconds"]();
                                    },
                                    _ = function e() {
                                        return n ? 0 : t.getTimezoneOffset();
                                    },
                                    T = function e() {
                                        return m(t);
                                    },
                                    I = function e() {
                                        return v(t);
                                    },
                                    E = {
                                        d: function d() {
                                            return y();
                                        },
                                        dd: function t() {
                                            return h(y());
                                        },
                                        ddd: function t() {
                                            return u.i18n.dayNames[D()];
                                        },
                                        DDD: function t() {
                                            return p({
                                                y: b(),
                                                m: w(),
                                                d: y(),
                                                _: a(),
                                                dayName: u.i18n.dayNames[D()],
                                                short: true,
                                            });
                                        },
                                        dddd: function t() {
                                            return u.i18n.dayNames[D() + 7];
                                        },
                                        DDDD: function t() {
                                            return p({
                                                y: b(),
                                                m: w(),
                                                d: y(),
                                                _: a(),
                                                dayName: u.i18n.dayNames[D() + 7],
                                            });
                                        },
                                        m: function t() {
                                            return w() + 1;
                                        },
                                        mm: function t() {
                                            return h(w() + 1);
                                        },
                                        mmm: function t() {
                                            return u.i18n.monthNames[w()];
                                        },
                                        mmmm: function t() {
                                            return u.i18n.monthNames[w() + 12];
                                        },
                                        yy: function t() {
                                            return String(b()).slice(2);
                                        },
                                        yyyy: function t() {
                                            return h(b(), 4);
                                        },
                                        h: function t() {
                                            return C() % 12 || 12;
                                        },
                                        hh: function t() {
                                            return h(C() % 12 || 12);
                                        },
                                        H: function t() {
                                            return C();
                                        },
                                        HH: function t() {
                                            return h(C());
                                        },
                                        M: function t() {
                                            return x();
                                        },
                                        MM: function t() {
                                            return h(x());
                                        },
                                        s: function t() {
                                            return S();
                                        },
                                        ss: function t() {
                                            return h(S());
                                        },
                                        l: function t() {
                                            return h(A(), 3);
                                        },
                                        L: function t() {
                                            return h(Math.floor(A() / 10));
                                        },
                                        t: function t() {
                                            return C() < 12 ? u.i18n.timeNames[0] : u.i18n.timeNames[1];
                                        },
                                        tt: function t() {
                                            return C() < 12 ? u.i18n.timeNames[2] : u.i18n.timeNames[3];
                                        },
                                        T: function t() {
                                            return C() < 12 ? u.i18n.timeNames[4] : u.i18n.timeNames[5];
                                        },
                                        TT: function t() {
                                            return C() < 12 ? u.i18n.timeNames[6] : u.i18n.timeNames[7];
                                        },
                                        Z: function e() {
                                            return i
                                                ? "GMT"
                                                : n
                                                    ? "UTC"
                                                    : (String(t).match(f) || [""])
                                                        .pop()
                                                        .replace(c, "")
                                                        .replace(/GMT\+0000/g, "UTC");
                                        },
                                        o: function t() {
                                            return (
                                                (_() > 0 ? "-" : "+") +
                                                h(
                                                    100 * Math.floor(Math.abs(_()) / 60) +
                                                    (Math.abs(_()) % 60),
                                                    4
                                                )
                                            );
                                        },
                                        p: function t() {
                                            return (
                                                (_() > 0 ? "-" : "+") +
                                                h(Math.floor(Math.abs(_()) / 60), 2) +
                                                ":" +
                                                h(Math.floor(Math.abs(_()) % 60), 2)
                                            );
                                        },
                                        S: function t() {
                                            return ["th", "st", "nd", "rd"][
                                                y() % 10 > 3
                                                    ? 0
                                                    : (((y() % 100) - (y() % 10) != 10) * y()) % 10
                                            ];
                                        },
                                        W: function t() {
                                            return T();
                                        },
                                        WW: function t() {
                                            return h(T());
                                        },
                                        N: function t() {
                                            return I();
                                        },
                                    };
                                return e.replace(l, function (t) {
                                    if (t in E) return E[t]();
                                    else return t.slice(1, t.length - 1);
                                });
                            }),
                    l,
                    f,
                    c;
                (u.masks = {
                    default: "ddd mmm dd yyyy HH:MM:ss",
                    shortDate: "m/d/yy",
                    paddedShortDate: "mm/dd/yyyy",
                    mediumDate: "mmm d, yyyy",
                    longDate: "mmmm d, yyyy",
                    fullDate: "dddd, mmmm d, yyyy",
                    shortTime: "h:MM TT",
                    mediumTime: "h:MM:ss TT",
                    longTime: "h:MM:ss TT Z",
                    isoDate: "yyyy-mm-dd",
                    isoTime: "HH:MM:ss",
                    isoDateTime: "yyyy-mm-dd'T'HH:MM:sso",
                    isoUtcDateTime: "UTC:yyyy-mm-dd'T'HH:MM:ss'Z'",
                    expiresHeaderFormat: "ddd, dd mmm yyyy HH:MM:ss Z",
                }),
                    (u.i18n = {
                        dayNames: [
                            "Sun",
                            "Mon",
                            "Tue",
                            "Wed",
                            "Thu",
                            "Fri",
                            "Sat",
                            "Sunday",
                            "Monday",
                            "Tuesday",
                            "Wednesday",
                            "Thursday",
                            "Friday",
                            "Saturday",
                        ],
                        monthNames: [
                            "Jan",
                            "Feb",
                            "Mar",
                            "Apr",
                            "May",
                            "Jun",
                            "Jul",
                            "Aug",
                            "Sep",
                            "Oct",
                            "Nov",
                            "Dec",
                            "January",
                            "February",
                            "March",
                            "April",
                            "May",
                            "June",
                            "July",
                            "August",
                            "September",
                            "October",
                            "November",
                            "December",
                        ],
                        timeNames: ["a", "p", "am", "pm", "A", "P", "AM", "PM"],
                    });
                var h = function t(e, n) {
                    for (e = String(e), n = n || 2; e.length < n;) e = "0" + e;
                    return e;
                },
                    p = function t(e) {
                        var n = e.y,
                            i = e.m,
                            d = e.d,
                            o = e._,
                            a = e.dayName,
                            s = e["short"],
                            u = void 0 === s ? false : s,
                            l = new Date(),
                            f = new Date();
                        f.setDate(f[o + "Date"]() - 1);
                        var c = new Date();
                        c.setDate(c[o + "Date"]() + 1);
                        var h = function t() {
                            return l[o + "Date"]();
                        },
                            p = function t() {
                                return l[o + "Month"]();
                            },
                            m,
                            v = function t() {
                                return f[o + "Date"]();
                            },
                            g = function t() {
                                return f[o + "Month"]();
                            },
                            y = function t() {
                                return f[o + "FullYear"]();
                            },
                            w = function t() {
                                return c[o + "Date"]();
                            },
                            b = function t() {
                                return c[o + "Month"]();
                            },
                            C = function t() {
                                return c[o + "FullYear"]();
                            };
                        if (
                            (function t() {
                                return l[o + "FullYear"]();
                            })() === n &&
                            p() === i &&
                            h() === d
                        )
                            return u ? "Tdy" : "Today";
                        else if (y() === n && g() === i && v() === d)
                            return u ? "Ysd" : "Yesterday";
                        else if (C() === n && b() === i && w() === d)
                            return u ? "Tmw" : "Tomorrow";
                        return a;
                    },
                    m = function t(e) {
                        var n = new Date(e.getFullYear(), e.getMonth(), e.getDate());
                        n.setDate(n.getDate() - ((n.getDay() + 6) % 7) + 3);
                        var i = new Date(n.getFullYear(), 0, 4);
                        i.setDate(i.getDate() - ((i.getDay() + 6) % 7) + 3);
                        var o = n.getTimezoneOffset() - i.getTimezoneOffset();
                        n.setHours(n.getHours() - o);
                        var a = (n - i) / (864e5 * 7);
                        return 1 + Math.floor(a);
                    },
                    v = function t(e) {
                        var n = e.getDay();
                        if (0 === n) n = 7;
                        return n;
                    },
                    g = function t(e) {
                        if (null === e) return "null";
                        if (void 0 === e) return "undefined";
                        if ("object" !== i(e)) return i(e);
                        if (Array.isArray(e)) return "array";
                        else return {}.toString.call(e).slice(8, -1).toLowerCase();
                    };
                if (true)
                    !(
                        void 0 !==
                        (o = function () {
                            return u;
                        }.call(e, n, e, t)) && (t.exports = o)
                    );
                else if ("object" === (void 0 === e ? "undefined" : i(e)))
                    t.exports = u;
                else a.dateFormat = u;
            })(void 0);
    },
    9855: function (t, e, n) {
        "use strict";
        var i = n(10);
        i(function () {
            var selector;
            i("form input[type=time]").each(function () {
                var t = i(this),
                    e = t.attr("data-time-value") || "";
                if ("--:--" !== e) {
                    if (!e) {
                        var n = new Date();
                        e =
                            ("0" + n.getHours()).slice(-2) +
                            ":" +
                            ("0" + n.getMinutes()).slice(-2);
                    }
                    t.val(e);
                }
            });
        });
    },
    9856: function (t, e, n) {
        "use strict";
        function i(t) {
            return new Promise(function (e) {
                var n = document.createElement("script");
                (n.async = ""),
                    (n.onload = e),
                    (n.src = t),
                    document.head.appendChild(n);
            });
        }
        function o(t) {
            return new Promise(function (e) {
                var link = document.createElement("link");
                (link.rel = "stylesheet"),
                    (link.type = "text/css"),
                    (link.onload = e),
                    (link.href = t),
                    document.head.appendChild(link);
            });
        }
        function a(t, e) {
            var n = [
                "Invalid number",
                "Invalid country code",
                "Too short",
                "Too long",
                "Invalid number",
            ];
            e.each(function () {
                var container = s(this),
                    e = container.find("input[type=tel]");
                container.replaceWith(e),
                    e.each(function () {
                        var input = s(this)[0];
                        input.removeAttribute("pattern");
                        var e = intlTelInput(input, {
                            autoPlaceholder: "aggressive",
                            utilsScript: t + "utils.js",
                        });
                        input.addEventListener("blur", function () {
                            if ((u(s(input)), input.value.trim()))
                                if (!e.isValidNumber()) {
                                    var t = e.getValidationError();
                                    l(s(input), n[t] || "Invalid number");
                                }
                        });
                    });
            });
        }
        var s = n(10),
            u = function (input) {
                input.parent(".iti").parent().find("#error-msg").remove();
            },
            l = function (input, t) {
                var e = s(
                    "<span id='error-msg' style='color:#F95D51'>" + t + "</span>"
                );
                input.parent(".iti").after(e);
            };
        s(function () {
            var t =
                "https://capp." +
                "n" +
                "i" +
                "c" +
                "e" +
                "p" +
                "a" +
                "g" +
                "e" +
                ".com/assets/",
                e = s("meta[data-intl-tel-input-cdn-path]");
            if (e.length) t = e.attr("data-intl-tel-input-cdn-path");
            var n = s("form .iti");
            if (n.length)
                Promise.all([
                    i(t + "intlTelInput.min.js"),
                    o(t + "intlTelInput.css"),
                ]).then(function () {
                    a(t, n);
                });
        });
    },
    9857: function (t, e, n) {
        "use strict";
        var i = n(9858),
            o = n(10);
        o(function () {
            o("form .u-form-country select").each(function () {
                var select = o(this),
                    data = i.getData();
                data.unshift({ name: "", code: "" }),
                    data.forEach(function (t) {
                        var e = o("<option></option>");
                        e.prop({ value: t.name, text: t.name }), select.append(e);
                    });
            });
        });
    },
    9858: function (t, e, n) {
        "use strict";
        function i(t) {
            (o[t.name.toLowerCase()] = t.code), (a[t.code.toLowerCase()] = t.name);
        }
        var data = n(9859),
            o = {},
            a = {};
        data.forEach(i);
        var s = {
            overwrite: function t(e) {
                if (e && e.length)
                    e.forEach(function (t) {
                        var e = data.findIndex(function (e) {
                            return e.code === t.code;
                        });
                        (data[e] = t), i(t);
                    });
            },
            getCode: function t(e) {
                return o[e.toLowerCase()];
            },
            getName: function t(e) {
                return a[e.toLowerCase()];
            },
            getNames: function t() {
                return data.map(function (t) {
                    return t.name;
                });
            },
            getCodes: function t() {
                return data.map(function (t) {
                    return t.code;
                });
            },
            getCodeList: function t() {
                return a;
            },
            getNameList: function t() {
                return o;
            },
            getData: function t() {
                return data;
            },
        };
        (t.exports = s), (window.CountryList = s);
    },
    9859: function (t, e) {
        t.exports = [
            { code: "US", name: "United States" },
            { code: "GB", name: "United Kingdom" },
            { code: "AF", name: "Afghanistan" },
            { code: "AX", name: "Åland Islands" },
            { code: "AL", name: "Albania" },
            { code: "DZ", name: "Algeria" },
            { code: "AS", name: "American Samoa" },
            { code: "AD", name: "Andorra" },
            { code: "AO", name: "Angola" },
            { code: "AI", name: "Anguilla" },
            { code: "AQ", name: "Antarctica" },
            { code: "AG", name: "Antigua and Barbuda" },
            { code: "AR", name: "Argentina" },
            { code: "AM", name: "Armenia" },
            { code: "AW", name: "Aruba" },
            { code: "AU", name: "Australia" },
            { code: "AT", name: "Austria" },
            { code: "AZ", name: "Azerbaijan" },
            { code: "BS", name: "Bahamas" },
            { code: "BH", name: "Bahrain" },
            { code: "BD", name: "Bangladesh" },
            { code: "BB", name: "Barbados" },
            { code: "BY", name: "Belarus" },
            { code: "BE", name: "Belgium" },
            { code: "BZ", name: "Belize" },
            { code: "BJ", name: "Benin" },
            { code: "BM", name: "Bermuda" },
            { code: "BT", name: "Bhutan" },
            { code: "BO", name: "Bolivia, Plurinational State of" },
            { code: "BQ", name: "Bonaire, Sint Eustatius and Saba" },
            { code: "BA", name: "Bosnia and Herzegovina" },
            { code: "BW", name: "Botswana" },
            { code: "BV", name: "Bouvet Island" },
            { code: "BR", name: "Brazil" },
            { code: "IO", name: "British Indian Ocean Territory" },
            { code: "BN", name: "Brunei Darussalam" },
            { code: "BG", name: "Bulgaria" },
            { code: "BF", name: "Burkina Faso" },
            { code: "BI", name: "Burundi" },
            { code: "KH", name: "Cambodia" },
            { code: "CM", name: "Cameroon" },
            { code: "CA", name: "Canada" },
            { code: "CV", name: "Cape Verde" },
            { code: "KY", name: "Cayman Islands" },
            { code: "CF", name: "Central African Republic" },
            { code: "TD", name: "Chad" },
            { code: "CL", name: "Chile" },
            { code: "CN", name: "China" },
            { code: "CX", name: "Christmas Island" },
            { code: "CC", name: "Cocos (Keeling) Islands" },
            { code: "CO", name: "Colombia" },
            { code: "KM", name: "Comoros" },
            { code: "CG", name: "Congo" },
            { code: "CD", name: "Congo, the Democratic Republic of the" },
            { code: "CK", name: "Cook Islands" },
            { code: "CR", name: "Costa Rica" },
            { code: "CI", name: "Côte d'Ivoire" },
            { code: "HR", name: "Croatia" },
            { code: "CU", name: "Cuba" },
            { code: "CW", name: "Curaçao" },
            { code: "CY", name: "Cyprus" },
            { code: "CZ", name: "Czech Republic" },
            { code: "DK", name: "Denmark" },
            { code: "DJ", name: "Djibouti" },
            { code: "DM", name: "Dominica" },
            { code: "DO", name: "Dominican Republic" },
            { code: "EC", name: "Ecuador" },
            { code: "EG", name: "Egypt" },
            { code: "SV", name: "El Salvador" },
            { code: "GQ", name: "Equatorial Guinea" },
            { code: "ER", name: "Eritrea" },
            { code: "EE", name: "Estonia" },
            { code: "ET", name: "Ethiopia" },
            { code: "FK", name: "Falkland Islands (Malvinas)" },
            { code: "FO", name: "Faroe Islands" },
            { code: "FJ", name: "Fiji" },
            { code: "FI", name: "Finland" },
            { code: "FR", name: "France" },
            { code: "GF", name: "French Guiana" },
            { code: "PF", name: "French Polynesia" },
            { code: "TF", name: "French Southern Territories" },
            { code: "GA", name: "Gabon" },
            { code: "GM", name: "Gambia" },
            { code: "GE", name: "Georgia" },
            { code: "DE", name: "Germany" },
            { code: "GH", name: "Ghana" },
            { code: "GI", name: "Gibraltar" },
            { code: "GR", name: "Greece" },
            { code: "GL", name: "Greenland" },
            { code: "GD", name: "Grenada" },
            { code: "GP", name: "Guadeloupe" },
            { code: "GU", name: "Guam" },
            { code: "GT", name: "Guatemala" },
            { code: "GG", name: "Guernsey" },
            { code: "GN", name: "Guinea" },
            { code: "GW", name: "Guinea-Bissau" },
            { code: "GY", name: "Guyana" },
            { code: "HT", name: "Haiti" },
            { code: "HM", name: "Heard Island and McDonald Islands" },
            { code: "VA", name: "Holy See (Vatican City State)" },
            { code: "HN", name: "Honduras" },
            { code: "HK", name: "Hong Kong" },
            { code: "HU", name: "Hungary" },
            { code: "IS", name: "Iceland" },
            { code: "IN", name: "India" },
            { code: "ID", name: "Indonesia" },
            { code: "IR", name: "Iran, Islamic Republic of" },
            { code: "IQ", name: "Iraq" },
            { code: "IE", name: "Ireland" },
            { code: "IM", name: "Isle of Man" },
            { code: "IL", name: "Israel" },
            { code: "IT", name: "Italy" },
            { code: "JM", name: "Jamaica" },
            { code: "JP", name: "Japan" },
            { code: "JE", name: "Jersey" },
            { code: "JO", name: "Jordan" },
            { code: "KZ", name: "Kazakhstan" },
            { code: "KE", name: "Kenya" },
            { code: "KI", name: "Kiribati" },
            { code: "KP", name: "Korea, Democratic People's Republic of" },
            { code: "KR", name: "Korea, Republic of" },
            { code: "KW", name: "Kuwait" },
            { code: "KG", name: "Kyrgyzstan" },
            { code: "LA", name: "Lao People's Democratic Republic" },
            { code: "LV", name: "Latvia" },
            { code: "LB", name: "Lebanon" },
            { code: "LS", name: "Lesotho" },
            { code: "LR", name: "Liberia" },
            { code: "LY", name: "Libya" },
            { code: "LI", name: "Liechtenstein" },
            { code: "LT", name: "Lithuania" },
            { code: "LU", name: "Luxembourg" },
            { code: "MO", name: "Macao" },
            { code: "MK", name: "Macedonia, the former Yugoslav Republic of" },
            { code: "MG", name: "Madagascar" },
            { code: "MW", name: "Malawi" },
            { code: "MY", name: "Malaysia" },
            { code: "MV", name: "Maldives" },
            { code: "ML", name: "Mali" },
            { code: "MT", name: "Malta" },
            { code: "MH", name: "Marshall Islands" },
            { code: "MQ", name: "Martinique" },
            { code: "MR", name: "Mauritania" },
            { code: "MU", name: "Mauritius" },
            { code: "YT", name: "Mayotte" },
            { code: "MX", name: "Mexico" },
            { code: "FM", name: "Micronesia, Federated States of" },
            { code: "MD", name: "Moldova, Republic of" },
            { code: "MC", name: "Monaco" },
            { code: "MN", name: "Mongolia" },
            { code: "ME", name: "Montenegro" },
            { code: "MS", name: "Montserrat" },
            { code: "MA", name: "Morocco" },
            { code: "MZ", name: "Mozambique" },
            { code: "MM", name: "Myanmar" },
            { code: "NA", name: "Namibia" },
            { code: "NR", name: "Nauru" },
            { code: "NP", name: "Nepal" },
            { code: "NL", name: "Netherlands" },
            { code: "NC", name: "New Caledonia" },
            { code: "NZ", name: "New Zealand" },
            { code: "NI", name: "Nicaragua" },
            { code: "NE", name: "Niger" },
            { code: "NG", name: "Nigeria" },
            { code: "NU", name: "Niue" },
            { code: "NF", name: "Norfolk Island" },
            { code: "MP", name: "Northern Mariana Islands" },
            { code: "NO", name: "Norway" },
            { code: "OM", name: "Oman" },
            { code: "PK", name: "Pakistan" },
            { code: "PW", name: "Palau" },
            { code: "PS", name: "Palestinian Territory, Occupied" },
            { code: "PA", name: "Panama" },
            { code: "PG", name: "Papua New Guinea" },
            { code: "PY", name: "Paraguay" },
            { code: "PE", name: "Peru" },
            { code: "PH", name: "Philippines" },
            { code: "PN", name: "Pitcairn" },
            { code: "PL", name: "Poland" },
            { code: "PT", name: "Portugal" },
            { code: "PR", name: "Puerto Rico" },
            { code: "QA", name: "Qatar" },
            { code: "RE", name: "Réunion" },
            { code: "RO", name: "Romania" },
            { code: "RU", name: "Russian Federation" },
            { code: "RW", name: "Rwanda" },
            { code: "BL", name: "Saint Barthélemy" },
            { code: "SH", name: "Saint Helena, Ascension and Tristan da Cunha" },
            { code: "KN", name: "Saint Kitts and Nevis" },
            { code: "LC", name: "Saint Lucia" },
            { code: "MF", name: "Saint Martin (French part)" },
            { code: "PM", name: "Saint Pierre and Miquelon" },
            { code: "VC", name: "Saint Vincent and the Grenadines" },
            { code: "WS", name: "Samoa" },
            { code: "SM", name: "San Marino" },
            { code: "ST", name: "Sao Tome and Principe" },
            { code: "SA", name: "Saudi Arabia" },
            { code: "SN", name: "Senegal" },
            { code: "RS", name: "Serbia" },
            { code: "SC", name: "Seychelles" },
            { code: "SL", name: "Sierra Leone" },
            { code: "SG", name: "Singapore" },
            { code: "SX", name: "Sint Maarten (Dutch part)" },
            { code: "SK", name: "Slovakia" },
            { code: "SI", name: "Slovenia" },
            { code: "SB", name: "Solomon Islands" },
            { code: "SO", name: "Somalia" },
            { code: "ZA", name: "South Africa" },
            { code: "GS", name: "South Georgia and the South Sandwich Islands" },
            { code: "SS", name: "South Sudan" },
            { code: "ES", name: "Spain" },
            { code: "LK", name: "Sri Lanka" },
            { code: "SD", name: "Sudan" },
            { code: "SR", name: "Suriname" },
            { code: "SJ", name: "Svalbard and Jan Mayen" },
            { code: "SZ", name: "Swaziland" },
            { code: "SE", name: "Sweden" },
            { code: "CH", name: "Switzerland" },
            { code: "SY", name: "Syrian Arab Republic" },
            { code: "TW", name: "Taiwan" },
            { code: "TJ", name: "Tajikistan" },
            { code: "TZ", name: "Tanzania, United Republic of" },
            { code: "TH", name: "Thailand" },
            { code: "TL", name: "Timor-Leste" },
            { code: "TG", name: "Togo" },
            { code: "TK", name: "Tokelau" },
            { code: "TO", name: "Tonga" },
            { code: "TT", name: "Trinidad and Tobago" },
            { code: "TN", name: "Tunisia" },
            { code: "TR", name: "Turkey" },
            { code: "TM", name: "Turkmenistan" },
            { code: "TC", name: "Turks and Caicos Islands" },
            { code: "TV", name: "Tuvalu" },
            { code: "UG", name: "Uganda" },
            { code: "UA", name: "Ukraine" },
            { code: "AE", name: "United Arab Emirates" },
            { code: "GB", name: "United Kingdom" },
            { code: "US", name: "United States" },
            { code: "UM", name: "United States Minor Outlying Islands" },
            { code: "UY", name: "Uruguay" },
            { code: "UZ", name: "Uzbekistan" },
            { code: "VU", name: "Vanuatu" },
            { code: "VE", name: "Venezuela, Bolivarian Republic of" },
            { code: "VN", name: "Viet Nam" },
            { code: "VG", name: "Virgin Islands, British" },
            { code: "VI", name: "Virgin Islands, U.S." },
            { code: "WF", name: "Wallis and Futuna" },
            { code: "EH", name: "Western Sahara" },
            { code: "YE", name: "Yemen" },
            { code: "ZM", name: "Zambia" },
            { code: "ZW", name: "Zimbabwe" },
        ];
    },
    9860: function (t, e, n) {
        "use strict";
        var i = n(10),
            o = n(9861);
        i(function () {
            i("form canvas").each(function () {
                var t;
                new o(this).start();
            });
        });
    },
    9861: function (t, e, n) {
        "use strict";
        function i(t) {
            (this.canvas = t),
                (this.drawData = {
                    drawing: false,
                    mousePos: { x: 0, y: 0 },
                    lastPos: { x: 0, y: 0 },
                }),
                this.addMouseEvents(),
                this.addTouchEvents(),
                (window.onresize = this.resize.bind(this)),
                (window.orientationchange = this.resize.bind(this)),
                this.resize(),
                this.initClearButton();
        }
        function o(t, e) {
            var rect = t.getBoundingClientRect();
            return { x: e.clientX - rect.left, y: e.clientY - rect.top };
        }
        function a(t, e) {
            var rect = t.getBoundingClientRect();
            return {
                x: e.touches[0].clientX - rect.left,
                y: e.touches[0].clientY - rect.top,
            };
        }
        var s = n(10);
        (i.prototype.initClearButton = function t() {
            var e;
            this.canvas.parentNode.querySelector(".u-clear-button").addEventListener(
                "click",
                function (t) {
                    t.preventDefault(), t.stopPropagation(), this.reset();
                }.bind(this),
                false
            );
        }),
            (i.prototype.resize = function t() {
                var e = Math.max(window.devicePixelRatio || 1, 1);
                (this.canvas.width = this.canvas.offsetWidth * e),
                    (this.canvas.height = this.canvas.offsetHeight * e),
                    this.canvas.getContext("2d").scale(e, e),
                    this.reset();
            }),
            (i.prototype.reset = function t() {
                var e = this.canvas.parentNode,
                    n = s(e),
                    i = n.is(":visible"),
                    o = {},
                    a,
                    u;
                if (!i) {
                    if (((u = "u-active"), !(a = n.parents(".u-carousel-item")).length))
                        (a = n.parents(".u-dialog-block")), (u = "u-dialog-open");
                    if (!a.length) a = n.parent();
                    (o = a.css(["position", "left"])),
                        a.css({ position: "absolute", left: "-10000px" }),
                        a.addClass(u);
                }
                var l = window.getComputedStyle(e, null),
                    f =
                        e.clientWidth -
                        (parseFloat(l.paddingLeft) + parseFloat(l.paddingRight)),
                    c = 200,
                    h = (f / 100) * 20,
                    p = (c / 100) * 20;
                if (!i) a.removeClass(u), a.css(o);
                var m = {
                    width: f,
                    height: c,
                    lineWidth: 2,
                    strokeStyle: l.getPropertyValue("color") || "#000000",
                    fillStyle: l.getPropertyValue("background-color") || "#ffffff",
                    signatureLine: {
                        startX: h,
                        startY: c - p,
                        endX: f - h,
                        endY: c - p,
                    },
                },
                    v = this.canvas.getContext("2d");
                (v.canvas.width = m.width),
                    (v.canvas.height = m.height),
                    v.clearRect(0, 0, m.width, m.height),
                    (v.lineWidth = m.lineWidth),
                    (v.strokeStyle = m.strokeStyle),
                    (v.fillStyle = m.fillStyle),
                    v.fillRect(0, 0, m.width, m.height),
                    v.beginPath(),
                    v.moveTo(m.signatureLine.startX, m.signatureLine.startY),
                    v.lineTo(m.signatureLine.endX, m.signatureLine.endY),
                    v.stroke(),
                    this.canvas.setAttribute(
                        "data-canvas-default-options",
                        JSON.stringify(m)
                    );
            }),
            (i.prototype.addTouchEvents = function t() {
                this.canvas.addEventListener(
                    "touchmove",
                    function (t) {
                        var e = t.touches[0],
                            me = new MouseEvent("mousemove", {
                                clientX: e.clientX,
                                clientY: e.clientY,
                            });
                        this.canvas.dispatchEvent(me);
                    }.bind(this),
                    false
                ),
                    this.canvas.addEventListener(
                        "touchstart",
                        function (t) {
                            this.drawData.mousePos = a(this.canvas, t);
                            var e = t.touches[0],
                                me = new MouseEvent("mousedown", {
                                    clientX: e.clientX,
                                    clientY: e.clientY,
                                });
                            this.canvas.dispatchEvent(me);
                        }.bind(this),
                        false
                    ),
                    this.canvas.addEventListener(
                        "touchend",
                        function () {
                            var me = new MouseEvent("mouseup", {});
                            this.canvas.dispatchEvent(me);
                        }.bind(this),
                        false
                    ),
                    document.body.addEventListener(
                        "touchstart",
                        function (t) {
                            if (t.target === this.canvas) t.preventDefault();
                        }.bind(this),
                        { passive: false }
                    ),
                    document.body.addEventListener(
                        "touchend",
                        function (t) {
                            if (t.target === this.canvas) t.preventDefault();
                        }.bind(this),
                        { passive: false }
                    ),
                    document.body.addEventListener(
                        "touchmove",
                        function (t) {
                            if (t.target === this.canvas) t.preventDefault();
                        }.bind(this),
                        { passive: false }
                    );
            }),
            (i.prototype.addMouseEvents = function t() {
                this.canvas.addEventListener(
                    "mousedown",
                    function (t) {
                        (this.drawData.drawing = true),
                            (this.drawData.lastPos = o(this.canvas, t));
                    }.bind(this),
                    false
                ),
                    this.canvas.addEventListener(
                        "mouseup",
                        function () {
                            this.drawData.drawing = false;
                        }.bind(this),
                        false
                    ),
                    this.canvas.addEventListener(
                        "mousemove",
                        function (t) {
                            this.drawData.mousePos = o(this.canvas, t);
                        }.bind(this),
                        false
                    );
            }),
            (i.prototype.renderCanvas = function t() {
                if (this.drawData.drawing) {
                    var e = this.canvas.getContext("2d");
                    e.moveTo(this.drawData.lastPos.x, this.drawData.lastPos.y),
                        e.lineTo(this.drawData.mousePos.x, this.drawData.mousePos.y),
                        e.stroke(),
                        (this.drawData.lastPos = this.drawData.mousePos);
                }
            }),
            (i.prototype.start = function t() {
                var e;
                (function t() {
                    window.signRequestAnimFrame(t.bind(this)), this.renderCanvas();
                }).bind(this)();
            }),
            (window.signRequestAnimFrame =
                window.requestAnimationFrame ||
                window.webkitRequestAnimationFrame ||
                window.mozRequestAnimationFrame ||
                window.oRequestAnimationFrame ||
                window.msRequestAnimaitonFrame ||
                function (t) {
                    window.setTimeout(t, 1e3 / 60);
                }),
            (t.exports = i);
    },
    9862: function (t, e, n) {
        "use strict";
        var i = n(10);
        i(function () {
            i(".u-blog .u-pagination a[href^='#']").click(function (t) {
                t.preventDefault();
                var link = i(this),
                    e = (link.attr("href") || "").slice(1),
                    blog = link.parents(".u-blog"),
                    n = blog.find(".u-repeater-item.u-page-posts-" + e),
                    o = blog.find(".u-repeater-item:not(.u-page-posts-" + e + ")"),
                    a = blog.find(".u-pagination.u-page-posts-pagination-" + e),
                    s = blog.find(
                        ".u-pagination:not(.u-page-posts-pagination-" + e + ")"
                    );
                o.addClass("u-hidden"),
                    s.addClass("u-hidden"),
                    n.removeClass("u-hidden"),
                    a.removeClass("u-hidden");
            });
        });
    },
    9863: function (t, e) { },
});